diff options
Diffstat (limited to 'spec/ruby/core')
904 files changed, 20637 insertions, 8994 deletions
diff --git a/spec/ruby/core/argf/bytes_spec.rb b/spec/ruby/core/argf/bytes_spec.rb deleted file mode 100644 index bf35ded1db..0000000000 --- a/spec/ruby/core/argf/bytes_spec.rb +++ /dev/null @@ -1,16 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'shared/each_byte' - -ruby_version_is ''...'3.0' do - describe "ARGF.bytes" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :argf_each_byte, :bytes - end -end diff --git a/spec/ruby/core/argf/chars_spec.rb b/spec/ruby/core/argf/chars_spec.rb deleted file mode 100644 index 6af73cdabb..0000000000 --- a/spec/ruby/core/argf/chars_spec.rb +++ /dev/null @@ -1,16 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'shared/each_char' - -ruby_version_is ''...'3.0' do - describe "ARGF.chars" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :argf_each_char, :chars - end -end diff --git a/spec/ruby/core/argf/codepoints_spec.rb b/spec/ruby/core/argf/codepoints_spec.rb deleted file mode 100644 index bb28c17fbb..0000000000 --- a/spec/ruby/core/argf/codepoints_spec.rb +++ /dev/null @@ -1,16 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'shared/each_codepoint' - -ruby_version_is ''...'3.0' do - describe "ARGF.codepoints" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :argf_each_codepoint, :codepoints - end -end diff --git a/spec/ruby/core/argf/lines_spec.rb b/spec/ruby/core/argf/lines_spec.rb deleted file mode 100644 index e964dbd0d3..0000000000 --- a/spec/ruby/core/argf/lines_spec.rb +++ /dev/null @@ -1,16 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'shared/each_line' - -ruby_version_is ''...'3.0' do - describe "ARGF.lines" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :argf_each_line, :lines - end -end diff --git a/spec/ruby/core/argf/readpartial_spec.rb b/spec/ruby/core/argf/readpartial_spec.rb index 5e284b3423..ea4301f25c 100644 --- a/spec/ruby/core/argf/readpartial_spec.rb +++ b/spec/ruby/core/argf/readpartial_spec.rb @@ -29,7 +29,7 @@ describe "ARGF.readpartial" do it "clears output buffer even if EOFError is raised because @argf is at end" do begin - output = "to be cleared" + output = +"to be cleared" argf [@file1_name] do @argf.read @@ -69,7 +69,7 @@ describe "ARGF.readpartial" do print ARGF.readpartial(#{@stdin.size}) ARGF.readpartial(1) rescue print $!.class STR - stdin = ruby_exe(ruby_str, args: "< #{@stdin_name}", escape: true) + stdin = ruby_exe(ruby_str, args: "< #{@stdin_name}") stdin.should == @stdin + "EOFError" end end diff --git a/spec/ruby/core/argf/shared/getc.rb b/spec/ruby/core/argf/shared/getc.rb index 8be39c60b6..d63372d9d7 100644 --- a/spec/ruby/core/argf/shared/getc.rb +++ b/spec/ruby/core/argf/shared/getc.rb @@ -9,7 +9,7 @@ describe :argf_getc, shared: true do it "reads each char of files" do argf [@file1, @file2] do - chars = "" + chars = +"" @chars.size.times { chars << @argf.send(@method) } chars.should == @chars end diff --git a/spec/ruby/core/argf/shared/read.rb b/spec/ruby/core/argf/shared/read.rb index fe903983c0..e76d022139 100644 --- a/spec/ruby/core/argf/shared/read.rb +++ b/spec/ruby/core/argf/shared/read.rb @@ -15,7 +15,7 @@ describe :argf_read, shared: true do it "treats second argument as an output buffer" do argf [@file1_name] do - buffer = "" + buffer = +"" @argf.send(@method, @file1.size, buffer) buffer.should == @file1 end @@ -23,7 +23,7 @@ describe :argf_read, shared: true do it "clears output buffer before appending to it" do argf [@file1_name] do - buffer = "to be cleared" + buffer = +"to be cleared" @argf.send(@method, @file1.size, buffer) buffer.should == @file1 end diff --git a/spec/ruby/core/array/all_spec.rb b/spec/ruby/core/array/all_spec.rb new file mode 100644 index 0000000000..680e8c26fa --- /dev/null +++ b/spec/ruby/core/array/all_spec.rb @@ -0,0 +1,13 @@ +require_relative '../../spec_helper' +require_relative 'shared/iterable_and_tolerating_size_increasing' + +describe "Array#all?" do + @value_to_return = -> _ { true } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :all? + + it "ignores the block if there is an argument" do + -> { + ['bar', 'foobar'].all?(/bar/) { false }.should == true + }.should complain(/given block not used/) + end +end diff --git a/spec/ruby/core/array/any_spec.rb b/spec/ruby/core/array/any_spec.rb index 09d949fe6e..b51ce62f0f 100644 --- a/spec/ruby/core/array/any_spec.rb +++ b/spec/ruby/core/array/any_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#any?" do describe 'with no block given (a default block of { |x| x } is implicit)' do @@ -19,6 +20,9 @@ describe "Array#any?" do end describe 'with a block given' do + @value_to_return = -> _ { false } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :any? + it 'is false if the array is empty' do empty_array = [] empty_array.any? {|v| 1 == 1 }.should == false @@ -34,4 +38,12 @@ describe "Array#any?" do array_with_members.any? {|v| v == 42 }.should == false end end + + describe 'when given a pattern argument' do + it "ignores the block if there is an argument" do + -> { + ['bar', 'foobar'].any?(/bar/) { false }.should == true + }.should complain(/given block not used/) + end + end end diff --git a/spec/ruby/core/array/assoc_spec.rb b/spec/ruby/core/array/assoc_spec.rb index f8479d763c..f0be3de795 100644 --- a/spec/ruby/core/array/assoc_spec.rb +++ b/spec/ruby/core/array/assoc_spec.rb @@ -6,7 +6,7 @@ describe "Array#assoc" do s1 = ["colors", "red", "blue", "green"] s2 = [:letters, "a", "b", "c"] s3 = [4] - s4 = ["colors", "cyan", "yellow", "magenda"] + s4 = ["colors", "cyan", "yellow", "magenta"] s5 = [:letters, "a", "i", "u"] s_nil = [nil, nil] a = [s1, s2, s3, s4, s5, s_nil] @@ -37,4 +37,16 @@ describe "Array#assoc" do a.assoc(s1.first).should equal(s1) a.assoc(s2.first).should equal(s2) end + + it "calls to_ary on non-array elements" do + s1 = [1, 2] + s2 = ArraySpecs::ArrayConvertible.new(2, 3) + a = [s1, s2] + + s1.should_not_receive(:to_ary) + a.assoc(s1.first).should equal(s1) + + a.assoc(2).should == [2, 3] + s2.called.should equal(:to_ary) + end end diff --git a/spec/ruby/core/array/bsearch_index_spec.rb b/spec/ruby/core/array/bsearch_index_spec.rb index df2c7c098e..94d85b37f3 100644 --- a/spec/ruby/core/array/bsearch_index_spec.rb +++ b/spec/ruby/core/array/bsearch_index_spec.rb @@ -63,10 +63,6 @@ describe "Array#bsearch_index" do @array.bsearch_index { |x| -1 }.should be_nil end - it "returns the middle element when block always returns zero" do - @array.bsearch_index { |x| 0 }.should == 2 - end - context "magnitude does not effect the result" do it "returns the index of any matched elements where element is between 4n <= xn < 8n" do [1, 2].should include(@array.bsearch_index { |x| (1 - x / 4) * (2**100) }) diff --git a/spec/ruby/core/array/clear_spec.rb b/spec/ruby/core/array/clear_spec.rb index bddc672d3b..81ba56e01e 100644 --- a/spec/ruby/core/array/clear_spec.rb +++ b/spec/ruby/core/array/clear_spec.rb @@ -20,30 +20,10 @@ describe "Array#clear" do a.size.should == 0 end - ruby_version_is ''...'2.7' do - it "keeps tainted status" do - a = [1] - a.taint - a.tainted?.should be_true - a.clear - a.tainted?.should be_true - end - end - it "does not accept any arguments" do -> { [1].clear(true) }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "keeps untrusted status" do - a = [1] - a.untrust - a.untrusted?.should be_true - a.clear - a.untrusted?.should be_true - end - end - it "raises a FrozenError on a frozen array" do a = [1] a.freeze diff --git a/spec/ruby/core/array/compact_spec.rb b/spec/ruby/core/array/compact_spec.rb index aa3c1c0446..83b3fa2a89 100644 --- a/spec/ruby/core/array/compact_spec.rb +++ b/spec/ruby/core/array/compact_spec.rb @@ -21,20 +21,6 @@ describe "Array#compact" do it "does not return subclass instance for Array subclasses" do ArraySpecs::MyArray[1, 2, 3, nil].compact.should be_an_instance_of(Array) end - - ruby_version_is ''...'2.7' do - it "does not keep tainted status even if all elements are removed" do - a = [nil, nil] - a.taint - a.compact.tainted?.should be_false - end - - it "does not keep untrusted status even if all elements are removed" do - a = [nil, nil] - a.untrust - a.compact.untrusted?.should be_false - end - end end describe "Array#compact!" do @@ -59,22 +45,6 @@ describe "Array#compact!" do [1, 2, false, 3].compact!.should == nil end - ruby_version_is ''...'2.7' do - it "keeps tainted status even if all elements are removed" do - a = [nil, nil] - a.taint - a.compact! - a.tainted?.should be_true - end - - it "keeps untrusted status even if all elements are removed" do - a = [nil, nil] - a.untrust - a.compact! - a.untrusted?.should be_true - end - end - it "raises a FrozenError on a frozen array" do -> { ArraySpecs.frozen_array.compact! }.should raise_error(FrozenError) end diff --git a/spec/ruby/core/array/concat_spec.rb b/spec/ruby/core/array/concat_spec.rb index da6763bfd6..f3cab9c17c 100644 --- a/spec/ruby/core/array/concat_spec.rb +++ b/spec/ruby/core/array/concat_spec.rb @@ -41,64 +41,6 @@ describe "Array#concat" do -> { ArraySpecs.frozen_array.concat([]) }.should raise_error(FrozenError) end - ruby_version_is ''...'2.7' do - it "keeps tainted status" do - ary = [1, 2] - ary.taint - ary.concat([3]) - ary.tainted?.should be_true - ary.concat([]) - ary.tainted?.should be_true - end - - it "is not infected by the other" do - ary = [1,2] - other = [3]; other.taint - ary.tainted?.should be_false - ary.concat(other) - ary.tainted?.should be_false - end - - it "keeps the tainted status of elements" do - ary = [ Object.new, Object.new, Object.new ] - ary.each {|x| x.taint } - - ary.concat([ Object.new ]) - ary[0].tainted?.should be_true - ary[1].tainted?.should be_true - ary[2].tainted?.should be_true - ary[3].tainted?.should be_false - end - - it "keeps untrusted status" do - ary = [1, 2] - ary.untrust - ary.concat([3]) - ary.untrusted?.should be_true - ary.concat([]) - ary.untrusted?.should be_true - end - - it "is not infected untrustedness by the other" do - ary = [1,2] - other = [3]; other.untrust - ary.untrusted?.should be_false - ary.concat(other) - ary.untrusted?.should be_false - end - - it "keeps the untrusted status of elements" do - ary = [ Object.new, Object.new, Object.new ] - ary.each {|x| x.untrust } - - ary.concat([ Object.new ]) - ary[0].untrusted?.should be_true - ary[1].untrusted?.should be_true - ary[2].untrusted?.should be_true - ary[3].untrusted?.should be_false - end - end - it "appends elements to an Array with enough capacity that has been shifted" do ary = [1, 2, 3, 4, 5] 2.times { ary.shift } diff --git a/spec/ruby/core/array/count_spec.rb b/spec/ruby/core/array/count_spec.rb index eaf275aeb7..e778233c16 100644 --- a/spec/ruby/core/array/count_spec.rb +++ b/spec/ruby/core/array/count_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#count" do it "returns the number of elements" do @@ -12,4 +13,14 @@ describe "Array#count" do it "returns the number of element for which the block evaluates to true" do [:a, :b, :c].count { |s| s != :b }.should == 2 end + + it "ignores the block if there is an argument" do + -> { + [:a, :b, :b, :c].count(:b) { |e| e.size > 10 }.should == 2 + }.should complain(/given block not used/) + end + + context "when a block argument given" do + it_behaves_like :array_iterable_and_tolerating_size_increasing, :count + end end diff --git a/spec/ruby/core/array/deconstruct_spec.rb b/spec/ruby/core/array/deconstruct_spec.rb index 2b07152dfc..ad67abe47b 100644 --- a/spec/ruby/core/array/deconstruct_spec.rb +++ b/spec/ruby/core/array/deconstruct_spec.rb @@ -1,11 +1,9 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Array#deconstruct" do - it "returns self" do - array = [1] +describe "Array#deconstruct" do + it "returns self" do + array = [1] - array.deconstruct.should equal array - end + array.deconstruct.should equal array end end diff --git a/spec/ruby/core/array/delete_at_spec.rb b/spec/ruby/core/array/delete_at_spec.rb index fc225a03f1..80ec643702 100644 --- a/spec/ruby/core/array/delete_at_spec.rb +++ b/spec/ruby/core/array/delete_at_spec.rb @@ -38,26 +38,4 @@ describe "Array#delete_at" do it "raises a FrozenError on a frozen array" do -> { [1,2,3].freeze.delete_at(0) }.should raise_error(FrozenError) end - - ruby_version_is ''...'2.7' do - it "keeps tainted status" do - ary = [1, 2] - ary.taint - ary.tainted?.should be_true - ary.delete_at(0) - ary.tainted?.should be_true - ary.delete_at(0) # now empty - ary.tainted?.should be_true - end - - it "keeps untrusted status" do - ary = [1, 2] - ary.untrust - ary.untrusted?.should be_true - ary.delete_at(0) - ary.untrusted?.should be_true - ary.delete_at(0) # now empty - ary.untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/array/delete_if_spec.rb b/spec/ruby/core/array/delete_if_spec.rb index e1931220f5..10972eee0e 100644 --- a/spec/ruby/core/array/delete_if_spec.rb +++ b/spec/ruby/core/array/delete_if_spec.rb @@ -2,6 +2,7 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative 'shared/enumeratorize' require_relative 'shared/delete_if' +require_relative 'shared/iterable_and_tolerating_size_increasing' require_relative '../enumerable/shared/enumeratorized' describe "Array#delete_if" do @@ -47,22 +48,35 @@ describe "Array#delete_if" do -> { ArraySpecs.empty_frozen_array.delete_if {} }.should raise_error(FrozenError) end - ruby_version_is ''...'2.7' do - it "keeps tainted status" do - @a.taint - @a.tainted?.should be_true - @a.delete_if{ true } - @a.tainted?.should be_true + it "does not truncate the array is the block raises an exception" do + a = [1, 2, 3] + begin + a.delete_if { raise StandardError, 'Oops' } + rescue end - it "keeps untrusted status" do - @a.untrust - @a.untrusted?.should be_true - @a.delete_if{ true } - @a.untrusted?.should be_true + a.should == [1, 2, 3] + end + + it "only removes elements for which the block returns true, keeping the element which raised an error." do + a = [1, 2, 3, 4] + begin + a.delete_if do |e| + case e + when 2 then true + when 3 then raise StandardError, 'Oops' + else false + end + end + rescue StandardError end + + a.should == [1, 3, 4] end it_behaves_like :enumeratorized_with_origin_size, :delete_if, [1,2,3] it_behaves_like :delete_if, :delete_if + + @value_to_return = -> _ { false } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :delete_if end diff --git a/spec/ruby/core/array/delete_spec.rb b/spec/ruby/core/array/delete_spec.rb index 5d53c74e47..dddbbe6bd3 100644 --- a/spec/ruby/core/array/delete_spec.rb +++ b/spec/ruby/core/array/delete_spec.rb @@ -43,26 +43,4 @@ describe "Array#delete" do it "raises a FrozenError on a frozen array" do -> { [1, 2, 3].freeze.delete(1) }.should raise_error(FrozenError) end - - ruby_version_is ''...'2.7' do - it "keeps tainted status" do - a = [1, 2] - a.taint - a.tainted?.should be_true - a.delete(2) - a.tainted?.should be_true - a.delete(1) # now empty - a.tainted?.should be_true - end - - it "keeps untrusted status" do - a = [1, 2] - a.untrust - a.untrusted?.should be_true - a.delete(2) - a.untrusted?.should be_true - a.delete(1) # now empty - a.untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/array/drop_spec.rb b/spec/ruby/core/array/drop_spec.rb index f911fd9018..0ea748e47d 100644 --- a/spec/ruby/core/array/drop_spec.rb +++ b/spec/ruby/core/array/drop_spec.rb @@ -50,15 +50,7 @@ describe "Array#drop" do -> { [1, 2].drop(obj) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it 'returns a subclass instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].drop(1).should be_an_instance_of(ArraySpecs::MyArray) - end - end - - ruby_version_is '3.0' do - it 'returns a Array instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].drop(1).should be_an_instance_of(Array) - end + it 'returns a Array instance for Array subclasses' do + ArraySpecs::MyArray[1, 2, 3, 4, 5].drop(1).should be_an_instance_of(Array) end end diff --git a/spec/ruby/core/array/drop_while_spec.rb b/spec/ruby/core/array/drop_while_spec.rb index bb783d22a5..bd46e8b882 100644 --- a/spec/ruby/core/array/drop_while_spec.rb +++ b/spec/ruby/core/array/drop_while_spec.rb @@ -1,7 +1,11 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#drop_while" do + @value_to_return = -> _ { true } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :drop_while + it "removes elements from the start of the array while the block evaluates to true" do [1, 2, 3, 4].drop_while { |n| n < 4 }.should == [4] end @@ -14,15 +18,7 @@ describe "Array#drop_while" do [1, 2, 3, false, 5].drop_while { |n| n }.should == [false, 5] end - ruby_version_is ''...'3.0' do - it 'returns a subclass instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].drop_while { |n| n < 4 }.should be_an_instance_of(ArraySpecs::MyArray) - end - end - - ruby_version_is '3.0' do - it 'returns a Array instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].drop_while { |n| n < 4 }.should be_an_instance_of(Array) - end + it 'returns a Array instance for Array subclasses' do + ArraySpecs::MyArray[1, 2, 3, 4, 5].drop_while { |n| n < 4 }.should be_an_instance_of(Array) end end diff --git a/spec/ruby/core/array/each_index_spec.rb b/spec/ruby/core/array/each_index_spec.rb index 51af5842c4..3a4bca9251 100644 --- a/spec/ruby/core/array/each_index_spec.rb +++ b/spec/ruby/core/array/each_index_spec.rb @@ -5,7 +5,7 @@ require_relative '../enumerable/shared/enumeratorized' # Modifying a collection while the contents are being iterated # gives undefined behavior. See -# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633 +# https://blade.ruby-lang.org/ruby-core/23633 describe "Array#each_index" do before :each do @@ -40,3 +40,19 @@ describe "Array#each_index" do it_behaves_like :enumeratorize, :each_index it_behaves_like :enumeratorized_with_origin_size, :each_index, [1,2,3] end + +describe "Array#each_index" do + it "tolerates increasing an array size during iteration" do + array = [:a, :b, :c] + ScratchPad.record [] + i = 0 + + array.each_index do |index| + ScratchPad << index + array << i if i < 100 + i += 1 + end + + ScratchPad.recorded.should == (0..102).to_a # element indices + end +end diff --git a/spec/ruby/core/array/each_spec.rb b/spec/ruby/core/array/each_spec.rb index 256647d61e..57d6082f01 100644 --- a/spec/ruby/core/array/each_spec.rb +++ b/spec/ruby/core/array/each_spec.rb @@ -1,11 +1,13 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative 'shared/enumeratorize' +require_relative 'shared/iterable_and_tolerating_size_increasing' require_relative '../enumerable/shared/enumeratorized' -# Modifying a collection while the contents are being iterated -# gives undefined behavior. See -# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633 +# Mutating the array while it is being iterated is discouraged as it can result in confusing behavior. +# Yet a Ruby implementation must not crash in such a case, and following the simple CRuby behavior makes sense. +# CRuby simply reads the array storage and checks the size for every iteration; +# like `i = 0; while i < size; yield self[i]; end` describe "Array#each" do it "yields each element to the block" do @@ -15,6 +17,34 @@ describe "Array#each" do a.should == [1, 2, 3] end + it "yields each element to the block even if the array is changed during iteration" do + a = [1, 2, 3, 4, 5] + iterated = [] + a.each { |x| iterated << x; a << x+5 if x.even? } + iterated.should == [1, 2, 3, 4, 5, 7, 9] + end + + it "yields only elements that are still in the array" do + a = [0, 1, 2, 3, 4] + iterated = [] + a.each { |x| iterated << x; a.pop if x.even? } + iterated.should == [0, 1, 2] + end + + it "yields elements based on an internal index" do + a = [0, 1, 2, 3, 4] + iterated = [] + a.each { |x| iterated << x; a.shift if x.even? } + iterated.should == [0, 2, 4] + end + + it "yields the same element multiple times if inserting while iterating" do + a = [1, 2] + iterated = [] + a.each { |x| iterated << x; a.unshift(0) if a.size == 2 } + iterated.should == [1, 1, 2] + end + it "yields each element to a block that takes multiple arguments" do a = [[1, 2], :a, [3, 4]] b = [] @@ -46,3 +76,7 @@ describe "Array#each" do it_behaves_like :enumeratorize, :each it_behaves_like :enumeratorized_with_origin_size, :each, [1,2,3] end + +describe "Array#each" do + it_behaves_like :array_iterable_and_tolerating_size_increasing, :each +end diff --git a/spec/ruby/core/array/element_set_spec.rb b/spec/ruby/core/array/element_set_spec.rb index 1e192c100f..df5ca9582e 100644 --- a/spec/ruby/core/array/element_set_spec.rb +++ b/spec/ruby/core/array/element_set_spec.rb @@ -481,50 +481,48 @@ describe "Array#[]= with [m..]" do end end -ruby_version_is "2.7" do - describe "Array#[]= with [..n] and [...n]" do - it "just sets the section defined by range to nil even if the rhs is nil" do - a = [1, 2, 3, 4, 5] - a[eval("(..2)")] = nil - a.should == [nil, 4, 5] - a[eval("(...2)")] = nil - a.should == [nil, 5] - end +describe "Array#[]= with [..n] and [...n]" do + it "just sets the section defined by range to nil even if the rhs is nil" do + a = [1, 2, 3, 4, 5] + a[(..2)] = nil + a.should == [nil, 4, 5] + a[(...2)] = nil + a.should == [nil, 5] + end - it "just sets the section defined by range to nil if n < 0 and the rhs is nil" do - a = [1, 2, 3, 4, 5] - a[eval("(..-3)")] = nil - a.should == [nil, 4, 5] - a[eval("(...-1)")] = [nil, 5] - end + it "just sets the section defined by range to nil if n < 0 and the rhs is nil" do + a = [1, 2, 3, 4, 5] + a[(..-3)] = nil + a.should == [nil, 4, 5] + a[(...-1)] = [nil, 5] + end - it "replaces the section defined by range" do - a = [6, 5, 4, 3, 2, 1] - a[eval("(...3)")] = 9 - a.should == [9, 3, 2, 1] - a[eval("(..2)")] = [7, 7, 7, 7, 7] - a.should == [7, 7, 7, 7, 7, 1] - end + it "replaces the section defined by range" do + a = [6, 5, 4, 3, 2, 1] + a[(...3)] = 9 + a.should == [9, 3, 2, 1] + a[(..2)] = [7, 7, 7, 7, 7] + a.should == [7, 7, 7, 7, 7, 1] + end - it "replaces the section if n < 0" do - a = [1, 2, 3, 4, 5] - a[eval("(..-2)")] = [7, 8, 9] - a.should == [7, 8, 9, 5] - end + it "replaces the section if n < 0" do + a = [1, 2, 3, 4, 5] + a[(..-2)] = [7, 8, 9] + a.should == [7, 8, 9, 5] + end - it "replaces everything if n > the array size" do - a = [1, 2, 3] - a[eval("(...7)")] = [4] - a.should == [4] - end + it "replaces everything if n > the array size" do + a = [1, 2, 3] + a[(...7)] = [4] + a.should == [4] + end - it "inserts at the beginning if n < negative the array size" do - a = [1, 2, 3] - a[eval("(..-7)")] = [4] - a.should == [4, 1, 2, 3] - a[eval("(...-10)")] = [6] - a.should == [6, 4, 1, 2, 3] - end + it "inserts at the beginning if n < negative the array size" do + a = [1, 2, 3] + a[(..-7)] = [4] + a.should == [4, 1, 2, 3] + a[(...-10)] = [6] + a.should == [6, 4, 1, 2, 3] end end diff --git a/spec/ruby/core/array/fill_spec.rb b/spec/ruby/core/array/fill_spec.rb index bfa8db551b..2c3b5d9e84 100644 --- a/spec/ruby/core/array/fill_spec.rb +++ b/spec/ruby/core/array/fill_spec.rb @@ -21,7 +21,7 @@ describe "Array#fill" do it "does not replicate the filler" do ary = [1, 2, 3, 4] - str = "x" + str = +"x" ary.fill(str).should == [str, str, str, str] str << "y" ary.should == [str, str, str, str] @@ -52,11 +52,9 @@ describe "Array#fill" do end it "raises an ArgumentError if 4 or more arguments are passed when no block given" do - -> { [].fill('a') }.should_not raise_error(ArgumentError) - - -> { [].fill('a', 1) }.should_not raise_error(ArgumentError) - - -> { [].fill('a', 1, 2) }.should_not raise_error(ArgumentError) + [].fill('a').should == [] + [].fill('a', 1).should == [] + [].fill('a', 1, 2).should == [nil, 'a', 'a'] -> { [].fill('a', 1, 2, true) }.should raise_error(ArgumentError) end @@ -65,12 +63,52 @@ describe "Array#fill" do end it "raises an ArgumentError if 3 or more arguments are passed when a block given" do - -> { [].fill() {|i|} }.should_not raise_error(ArgumentError) + [].fill() {|i|}.should == [] + [].fill(1) {|i|}.should == [] + [].fill(1, 2) {|i|}.should == [nil, nil, nil] + -> { [].fill(1, 2, true) {|i|} }.should raise_error(ArgumentError) + end - -> { [].fill(1) {|i|} }.should_not raise_error(ArgumentError) + it "does not truncate the array is the block raises an exception" do + a = [1, 2, 3] + begin + a.fill { raise StandardError, 'Oops' } + rescue + end - -> { [].fill(1, 2) {|i|} }.should_not raise_error(ArgumentError) - -> { [].fill(1, 2, true) {|i|} }.should raise_error(ArgumentError) + a.should == [1, 2, 3] + end + + it "only changes elements before error is raised, keeping the element which raised an error." do + a = [1, 2, 3, 4] + begin + a.fill do |i| + case i + when 0 then -1 + when 1 then -2 + when 2 then raise StandardError, 'Oops' + else 0 + end + end + rescue StandardError + end + + a.should == [-1, -2, 3, 4] + end + + it "tolerates increasing an array size during iteration" do + array = [:a, :b, :c] + ScratchPad.record [] + i = 0 + + array.fill do |index| + ScratchPad << index + array << i if i < 100 + i++ + index + end + + ScratchPad.recorded.should == [0, 1, 2] end end @@ -169,25 +207,25 @@ describe "Array#fill with (filler, index, length)" do [1, 2, 3, 4, 5].fill(-2, -2, &@never_passed).should == [1, 2, 3, 4, 5] end - # See: http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/17481 + # See: https://blade.ruby-lang.org/ruby-core/17481 it "does not raise an exception if the given length is negative and its absolute value does not exceed the index" do - -> { [1, 2, 3, 4].fill('a', 3, -1)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill('a', 3, -2)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill('a', 3, -3)}.should_not raise_error(ArgumentError) + [1, 2, 3, 4].fill('a', 3, -1).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill('a', 3, -2).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill('a', 3, -3).should == [1, 2, 3, 4] - -> { [1, 2, 3, 4].fill(3, -1, &@never_passed)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill(3, -2, &@never_passed)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill(3, -3, &@never_passed)}.should_not raise_error(ArgumentError) + [1, 2, 3, 4].fill(3, -1, &@never_passed).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill(3, -2, &@never_passed).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill(3, -3, &@never_passed).should == [1, 2, 3, 4] end it "does not raise an exception even if the given length is negative and its absolute value exceeds the index" do - -> { [1, 2, 3, 4].fill('a', 3, -4)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill('a', 3, -5)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill('a', 3, -10000)}.should_not raise_error(ArgumentError) + [1, 2, 3, 4].fill('a', 3, -4).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill('a', 3, -5).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill('a', 3, -10000).should == [1, 2, 3, 4] - -> { [1, 2, 3, 4].fill(3, -4, &@never_passed)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill(3, -5, &@never_passed)}.should_not raise_error(ArgumentError) - -> { [1, 2, 3, 4].fill(3, -10000, &@never_passed)}.should_not raise_error(ArgumentError) + [1, 2, 3, 4].fill(3, -4, &@never_passed).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill(3, -5, &@never_passed).should == [1, 2, 3, 4] + [1, 2, 3, 4].fill(3, -10000, &@never_passed).should == [1, 2, 3, 4] end it "tries to convert the second and third arguments to Integers using #to_int" do @@ -205,6 +243,12 @@ describe "Array#fill with (filler, index, length)" do -> { [].fill('a', obj) }.should raise_error(TypeError) end + it "raises a TypeError when the length is not numeric" do + -> { [1, 2, 3].fill("x", 1, "foo") }.should raise_error(TypeError, /no implicit conversion of String into Integer/) + -> { [1, 2, 3].fill("x", 1, :"foo") }.should raise_error(TypeError, /no implicit conversion of Symbol into Integer/) + -> { [1, 2, 3].fill("x", 1, Object.new) }.should raise_error(TypeError, /no implicit conversion of Object into Integer/) + end + not_supported_on :opal do it "raises an ArgumentError or RangeError for too-large sizes" do error_types = [RangeError, ArgumentError] @@ -323,10 +367,8 @@ describe "Array#fill with (filler, range)" do [1, 2, 3, 4].fill(eval("(3...)")) { |x| x + 2 }.should == [1, 2, 3, 5] end - ruby_version_is "2.7" do - it "works with beginless ranges" do - [1, 2, 3, 4].fill('x', eval("(..2)")).should == ["x", "x", "x", 4] - [1, 2, 3, 4].fill(eval("(...2)")) { |x| x + 2 }.should == [2, 3, 3, 4] - end + it "works with beginless ranges" do + [1, 2, 3, 4].fill('x', (..2)).should == ["x", "x", "x", 4] + [1, 2, 3, 4].fill((...2)) { |x| x + 2 }.should == [2, 3, 3, 4] end end diff --git a/spec/ruby/core/array/fixtures/classes.rb b/spec/ruby/core/array/fixtures/classes.rb index affb3b49e6..8596245fb8 100644 --- a/spec/ruby/core/array/fixtures/classes.rb +++ b/spec/ruby/core/array/fixtures/classes.rb @@ -40,6 +40,68 @@ module ArraySpecs a end + # Chi squared critical values for tests with n degrees of freedom at 99% confidence. + # Values obtained from NIST Engineering Statistic Handbook at + # https://www.itl.nist.gov/div898/handbook/eda/section3/eda3674.htm + + CHI_SQUARED_CRITICAL_VALUES = [ + 0, + 6.635, 9.210, 11.345, 13.277, 15.086, 16.812, 18.475, 20.090, 21.666, 23.209, + 24.725, 26.217, 27.688, 29.141, 30.578, 32.000, 33.409, 34.805, 36.191, 37.566, + 38.932, 40.289, 41.638, 42.980, 44.314, 45.642, 46.963, 48.278, 49.588, 50.892, + 52.191, 53.486, 54.776, 56.061, 57.342, 58.619, 59.893, 61.162, 62.428, 63.691, + 64.950, 66.206, 67.459, 68.710, 69.957, 71.201, 72.443, 73.683, 74.919, 76.154, + 77.386, 78.616, 79.843, 81.069, 82.292, 83.513, 84.733, 85.950, 87.166, 88.379, + 89.591, 90.802, 92.010, 93.217, 94.422, 95.626, 96.828, 98.028, 99.228, 100.425, + 101.621, 102.816, 104.010, 105.202, 106.393, 107.583, 108.771, 109.958, 111.144, 112.329, + 113.512, 114.695, 115.876, 117.057, 118.236, 119.414, 120.591, 121.767, 122.942, 124.116, + 125.289, 126.462, 127.633, 128.803, 129.973, 131.141, 132.309, 133.476, 134.642, 135.807, + ] + + def self.measure_sample_fairness(size, samples, iters) + ary = Array.new(size) { |x| x } + (samples).times do |i| + chi_results = [] + 3.times do + counts = Array.new(size) { 0 } + expected = iters / size + iters.times do + x = ary.sample(samples)[i] + counts[x] += 1 + end + chi_squared = 0.0 + counts.each do |count| + chi_squared += (((count - expected) ** 2) * 1.0 / expected) + end + chi_results << chi_squared + break if chi_squared <= CHI_SQUARED_CRITICAL_VALUES[size] + end + + chi_results.min.should <= CHI_SQUARED_CRITICAL_VALUES[size] + end + end + + def self.measure_sample_fairness_large_sample_size(size, samples, iters) + ary = Array.new(size) { |x| x } + counts = Array.new(size) { 0 } + expected = iters * samples / size + iters.times do + ary.sample(samples).each do |sample| + counts[sample] += 1 + end + end + chi_squared = 0.0 + counts.each do |count| + chi_squared += (((count - expected) ** 2) * 1.0 / expected) + end + + # Chi squared critical values for tests with 4 degrees of freedom + # Values obtained from NIST Engineering Statistic Handbook at + # https://www.itl.nist.gov/div898/handbook/eda/section3/eda3674.htm + + chi_squared.should <= CHI_SQUARED_CRITICAL_VALUES[size] + end + class MyArray < Array # The #initialize method has a different signature than Array to help # catch places in the specs that do not assert the #initialize is not @@ -98,6 +160,16 @@ module ArraySpecs end end + class ArrayMethodMissing + def initialize(*values, &block) + @values = values; + end + + def method_missing(name, *args) + @values + end + end + class SortSame def <=>(other); 0; end def ==(other); true; end diff --git a/spec/ruby/core/array/fixtures/encoded_strings.rb b/spec/ruby/core/array/fixtures/encoded_strings.rb index 5b85bd0e06..b5888d86ae 100644 --- a/spec/ruby/core/array/fixtures/encoded_strings.rb +++ b/spec/ruby/core/array/fixtures/encoded_strings.rb @@ -2,14 +2,14 @@ module ArraySpecs def self.array_with_usascii_and_7bit_utf8_strings [ - 'foo'.force_encoding('US-ASCII'), + 'foo'.dup.force_encoding('US-ASCII'), 'bar' ] end def self.array_with_usascii_and_utf8_strings [ - 'foo'.force_encoding('US-ASCII'), + 'foo'.dup.force_encoding('US-ASCII'), 'báz' ] end @@ -17,7 +17,7 @@ module ArraySpecs def self.array_with_7bit_utf8_and_usascii_strings [ 'bar', - 'foo'.force_encoding('US-ASCII') + 'foo'.dup.force_encoding('US-ASCII') ] end @@ -25,13 +25,13 @@ module ArraySpecs [ 'báz', 'bar', - 'foo'.force_encoding('US-ASCII') + 'foo'.dup.force_encoding('US-ASCII') ] end def self.array_with_usascii_and_utf8_strings [ - 'foo'.force_encoding('US-ASCII'), + 'foo'.dup.force_encoding('US-ASCII'), 'bar', 'báz' ] @@ -41,7 +41,7 @@ module ArraySpecs [ 'bar', 'báz', - 'foo'.force_encoding('BINARY') + 'foo'.dup.force_encoding('BINARY') ] end @@ -55,14 +55,14 @@ module ArraySpecs def self.array_with_usascii_and_7bit_binary_strings [ - 'bar'.force_encoding('US-ASCII'), - 'foo'.force_encoding('BINARY') + 'bar'.dup.force_encoding('US-ASCII'), + 'foo'.dup.force_encoding('BINARY') ] end def self.array_with_usascii_and_binary_strings [ - 'bar'.force_encoding('US-ASCII'), + 'bar'.dup.force_encoding('US-ASCII'), [255].pack('C').force_encoding('BINARY') ] end diff --git a/spec/ruby/core/array/flatten_spec.rb b/spec/ruby/core/array/flatten_spec.rb index 2f9fb8a3ec..8c97000c79 100644 --- a/spec/ruby/core/array/flatten_spec.rb +++ b/spec/ruby/core/array/flatten_spec.rb @@ -75,24 +75,12 @@ describe "Array#flatten" do [[obj]].flatten(1) end - ruby_version_is ''...'3.0' do - it "returns subclass instance for Array subclasses" do - ArraySpecs::MyArray[].flatten.should be_an_instance_of(ArraySpecs::MyArray) - ArraySpecs::MyArray[1, 2, 3].flatten.should be_an_instance_of(ArraySpecs::MyArray) - ArraySpecs::MyArray[1, [2], 3].flatten.should be_an_instance_of(ArraySpecs::MyArray) - ArraySpecs::MyArray[1, [2, 3], 4].flatten.should == ArraySpecs::MyArray[1, 2, 3, 4] - [ArraySpecs::MyArray[1, 2, 3]].flatten.should be_an_instance_of(Array) - end - end - - ruby_version_is '3.0' do - it "returns Array instance for Array subclasses" do - ArraySpecs::MyArray[].flatten.should be_an_instance_of(Array) - ArraySpecs::MyArray[1, 2, 3].flatten.should be_an_instance_of(Array) - ArraySpecs::MyArray[1, [2], 3].flatten.should be_an_instance_of(Array) - ArraySpecs::MyArray[1, [2, 3], 4].flatten.should == [1, 2, 3, 4] - [ArraySpecs::MyArray[1, 2, 3]].flatten.should be_an_instance_of(Array) - end + it "returns Array instance for Array subclasses" do + ArraySpecs::MyArray[].flatten.should be_an_instance_of(Array) + ArraySpecs::MyArray[1, 2, 3].flatten.should be_an_instance_of(Array) + ArraySpecs::MyArray[1, [2], 3].flatten.should be_an_instance_of(Array) + ArraySpecs::MyArray[1, [2, 3], 4].flatten.should == [1, 2, 3, 4] + [ArraySpecs::MyArray[1, 2, 3]].flatten.should be_an_instance_of(Array) end it "is not destructive" do @@ -147,16 +135,6 @@ describe "Array#flatten" do end end - ruby_version_is ''...'2.7' do - it "returns a tainted array if self is tainted" do - [].taint.flatten.tainted?.should be_true - end - - it "returns an untrusted array if self is untrusted" do - [].untrust.flatten.untrusted?.should be_true - end - end - it "performs respond_to? and method_missing-aware checks when coercing elements to array" do bo = BasicObject.new [bo].flatten.should == [bo] diff --git a/spec/ruby/core/array/initialize_spec.rb b/spec/ruby/core/array/initialize_spec.rb index a8deed2b84..b9fa77b16e 100644 --- a/spec/ruby/core/array/initialize_spec.rb +++ b/spec/ruby/core/array/initialize_spec.rb @@ -53,7 +53,9 @@ describe "Array#initialize with no arguments" do end it "does not use the given block" do - ->{ [1, 2, 3].send(:initialize) { raise } }.should_not raise_error + -> { + -> { [1, 2, 3].send(:initialize) { raise } }.should_not raise_error + }.should complain(/#{__FILE__}:#{__LINE__-1}: warning: given block not used/, verbose: true) end end diff --git a/spec/ruby/core/array/intersect_spec.rb b/spec/ruby/core/array/intersect_spec.rb new file mode 100644 index 0000000000..62ac157278 --- /dev/null +++ b/spec/ruby/core/array/intersect_spec.rb @@ -0,0 +1,66 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe 'Array#intersect?' do + ruby_version_is '3.1' do # https://bugs.ruby-lang.org/issues/15198 + describe 'when at least one element in two Arrays is the same' do + it 'returns true' do + [1, 2].intersect?([2, 3, 4]).should == true + [2, 3, 4].intersect?([1, 2]).should == true + end + end + + describe 'when there are no elements in common between two Arrays' do + it 'returns false' do + [0, 1, 2].intersect?([3, 4]).should == false + [3, 4].intersect?([0, 1, 2]).should == false + [3, 4].intersect?([]).should == false + [].intersect?([0, 1, 2]).should == false + end + end + + it "tries to convert the passed argument to an Array using #to_ary" do + obj = mock('[1,2,3]') + obj.should_receive(:to_ary).and_return([1, 2, 3]) + + [1, 2].intersect?(obj).should == true + end + + it "determines equivalence between elements in the sense of eql?" do + obj1 = mock('1') + obj2 = mock('2') + obj1.stub!(:hash).and_return(0) + obj2.stub!(:hash).and_return(0) + obj1.stub!(:eql?).and_return(true) + obj2.stub!(:eql?).and_return(true) + + [obj1].intersect?([obj2]).should == true + + obj1 = mock('3') + obj2 = mock('4') + obj1.stub!(:hash).and_return(0) + obj2.stub!(:hash).and_return(0) + obj1.stub!(:eql?).and_return(false) + obj2.stub!(:eql?).and_return(false) + + [obj1].intersect?([obj2]).should == false + end + + it "does not call to_ary on array subclasses" do + [5, 6].intersect?(ArraySpecs::ToAryArray[1, 2, 5, 6]).should == true + end + + it "properly handles an identical item even when its #eql? isn't reflexive" do + x = mock('x') + x.stub!(:hash).and_return(42) + x.stub!(:eql?).and_return(false) # Stubbed for clarity and latitude in implementation; not actually sent by MRI. + + [x].intersect?([x]).should == true + end + + it "has semantic of !(a & b).empty?" do + [].intersect?([]).should == false + [nil].intersect?([nil]).should == true + end + end +end diff --git a/spec/ruby/core/array/intersection_spec.rb b/spec/ruby/core/array/intersection_spec.rb index 27d90f1e44..e01a68d389 100644 --- a/spec/ruby/core/array/intersection_spec.rb +++ b/spec/ruby/core/array/intersection_spec.rb @@ -6,16 +6,14 @@ describe "Array#&" do it_behaves_like :array_intersection, :& end -ruby_version_is "2.7" do - describe "Array#intersection" do - it_behaves_like :array_intersection, :intersection +describe "Array#intersection" do + it_behaves_like :array_intersection, :intersection - it "accepts multiple arguments" do - [1, 2, 3, 4].intersection([1, 2, 3], [2, 3, 4]).should == [2, 3] - end + it "accepts multiple arguments" do + [1, 2, 3, 4].intersection([1, 2, 3], [2, 3, 4]).should == [2, 3] + end - it "preserves elements order from original array" do - [1, 2, 3, 4].intersection([3, 2, 1]).should == [1, 2, 3] - end + it "preserves elements order from original array" do + [1, 2, 3, 4].intersection([3, 2, 1]).should == [1, 2, 3] end end diff --git a/spec/ruby/core/array/keep_if_spec.rb b/spec/ruby/core/array/keep_if_spec.rb index bf2bdeaf91..40f7329b7c 100644 --- a/spec/ruby/core/array/keep_if_spec.rb +++ b/spec/ruby/core/array/keep_if_spec.rb @@ -1,3 +1,4 @@ +require_relative '../../spec_helper' require_relative 'shared/keep_if' describe "Array#keep_if" do diff --git a/spec/ruby/core/array/multiply_spec.rb b/spec/ruby/core/array/multiply_spec.rb index 16e407348b..eca51142fb 100644 --- a/spec/ruby/core/array/multiply_spec.rb +++ b/spec/ruby/core/array/multiply_spec.rb @@ -76,20 +76,10 @@ describe "Array#* with an integer" do @array = ArraySpecs::MyArray[1, 2, 3, 4, 5] end - ruby_version_is ''...'3.0' do - it "returns a subclass instance" do - (@array * 0).should be_an_instance_of(ArraySpecs::MyArray) - (@array * 1).should be_an_instance_of(ArraySpecs::MyArray) - (@array * 2).should be_an_instance_of(ArraySpecs::MyArray) - end - end - - ruby_version_is '3.0' do - it "returns an Array instance" do - (@array * 0).should be_an_instance_of(Array) - (@array * 1).should be_an_instance_of(Array) - (@array * 2).should be_an_instance_of(Array) - end + it "returns an Array instance" do + (@array * 0).should be_an_instance_of(Array) + (@array * 1).should be_an_instance_of(Array) + (@array * 2).should be_an_instance_of(Array) end it "does not call #initialize on the subclass instance" do @@ -97,46 +87,6 @@ describe "Array#* with an integer" do ScratchPad.recorded.should be_nil end end - - ruby_version_is ''...'2.7' do - it "copies the taint status of the original array even if the passed count is 0" do - ary = [1, 2, 3] - ary.taint - (ary * 0).should.tainted? - end - - it "copies the taint status of the original array even if the array is empty" do - ary = [] - ary.taint - (ary * 3).should.tainted? - end - - it "copies the taint status of the original array if the passed count is not 0" do - ary = [1, 2, 3] - ary.taint - (ary * 1).should.tainted? - (ary * 2).should.tainted? - end - - it "copies the untrusted status of the original array even if the passed count is 0" do - ary = [1, 2, 3] - ary.untrust - (ary * 0).should.untrusted? - end - - it "copies the untrusted status of the original array even if the array is empty" do - ary = [] - ary.untrust - (ary * 3).should.untrusted? - end - - it "copies the untrusted status of the original array if the passed count is not 0" do - ary = [1, 2, 3] - ary.untrust - (ary * 1).should.untrusted? - (ary * 2).should.untrusted? - end - end end describe "Array#* with a string" do diff --git a/spec/ruby/core/array/new_spec.rb b/spec/ruby/core/array/new_spec.rb index 96ec6b8198..b50a4857b0 100644 --- a/spec/ruby/core/array/new_spec.rb +++ b/spec/ruby/core/array/new_spec.rb @@ -26,7 +26,9 @@ describe "Array.new with no arguments" do end it "does not use the given block" do - ->{ Array.new { raise } }.should_not raise_error + -> { + -> { Array.new { raise } }.should_not raise_error + }.should complain(/warning: given block not used/, verbose: true) end end diff --git a/spec/ruby/core/array/none_spec.rb b/spec/ruby/core/array/none_spec.rb new file mode 100644 index 0000000000..31cd8c46d6 --- /dev/null +++ b/spec/ruby/core/array/none_spec.rb @@ -0,0 +1,13 @@ +require_relative '../../spec_helper' +require_relative 'shared/iterable_and_tolerating_size_increasing' + +describe "Array#none?" do + @value_to_return = -> _ { false } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :none? + + it "ignores the block if there is an argument" do + -> { + ['bar', 'foobar'].none?(/baz/) { true }.should == true + }.should complain(/given block not used/) + end +end diff --git a/spec/ruby/core/array/one_spec.rb b/spec/ruby/core/array/one_spec.rb new file mode 100644 index 0000000000..0c61907881 --- /dev/null +++ b/spec/ruby/core/array/one_spec.rb @@ -0,0 +1,13 @@ +require_relative '../../spec_helper' +require_relative 'shared/iterable_and_tolerating_size_increasing' + +describe "Array#one?" do + @value_to_return = -> _ { false } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :one? + + it "ignores the block if there is an argument" do + -> { + ['bar', 'foobar'].one?(/foo/) { false }.should == true + }.should complain(/given block not used/) + end +end diff --git a/spec/ruby/core/array/pack/a_spec.rb b/spec/ruby/core/array/pack/a_spec.rb index 7af7a16c68..f4a40502c2 100644 --- a/spec/ruby/core/array/pack/a_spec.rb +++ b/spec/ruby/core/array/pack/a_spec.rb @@ -12,6 +12,17 @@ describe "Array#pack with format 'A'" do it_behaves_like :array_pack_string, 'A' it_behaves_like :array_pack_taint, 'A' + it "calls #to_str to convert an Object to a String" do + obj = mock("pack A string") + obj.should_receive(:to_str).and_return("``abcdef") + [obj].pack("A*").should == "``abcdef" + end + + it "will not implicitly convert a number to a string" do + -> { [0].pack('A') }.should raise_error(TypeError) + -> { [0].pack('a') }.should raise_error(TypeError) + end + it "adds all the bytes to the output when passed the '*' modifier" do ["abc"].pack("A*").should == "abc" end diff --git a/spec/ruby/core/array/pack/b_spec.rb b/spec/ruby/core/array/pack/b_spec.rb index 872c1b88d5..ec82b7d1ab 100644 --- a/spec/ruby/core/array/pack/b_spec.rb +++ b/spec/ruby/core/array/pack/b_spec.rb @@ -13,11 +13,16 @@ describe "Array#pack with format 'B'" do it_behaves_like :array_pack_taint, 'B' it "calls #to_str to convert an Object to a String" do - obj = mock("pack H string") + obj = mock("pack B string") obj.should_receive(:to_str).and_return("``abcdef") [obj].pack("B*").should == "\x2a" end + it "will not implicitly convert a number to a string" do + -> { [0].pack('B') }.should raise_error(TypeError) + -> { [0].pack('b') }.should raise_error(TypeError) + end + it "encodes one bit for each character starting with the most significant bit" do [ [["0"], "\x00"], [["1"], "\x80"] diff --git a/spec/ruby/core/array/pack/buffer_spec.rb b/spec/ruby/core/array/pack/buffer_spec.rb index ecb40bfd06..f1206efb3e 100644 --- a/spec/ruby/core/array/pack/buffer_spec.rb +++ b/spec/ruby/core/array/pack/buffer_spec.rb @@ -13,13 +13,13 @@ describe "Array#pack with :buffer option" do it "adds result at the end of buffer content" do n = [ 65, 66, 67 ] # result without buffer is "ABC" - buffer = "" + buffer = +"" n.pack("ccc", buffer: buffer).should == "ABC" - buffer = "123" + buffer = +"123" n.pack("ccc", buffer: buffer).should == "123ABC" - buffer = "12345" + buffer = +"12345" n.pack("ccc", buffer: buffer).should == "12345ABC" end @@ -31,19 +31,19 @@ describe "Array#pack with :buffer option" do context "offset (@) is specified" do it 'keeps buffer content if it is longer than offset' do n = [ 65, 66, 67 ] - buffer = "123456" + buffer = +"123456" n.pack("@3ccc", buffer: buffer).should == "123ABC" end it "fills the gap with \\0 if buffer content is shorter than offset" do n = [ 65, 66, 67 ] - buffer = "123" + buffer = +"123" n.pack("@6ccc", buffer: buffer).should == "123\0\0\0ABC" end it 'does not keep buffer content if it is longer than offset + result' do n = [ 65, 66, 67 ] - buffer = "1234567890" + buffer = +"1234567890" n.pack("@3ccc", buffer: buffer).should == "123ABC" end end diff --git a/spec/ruby/core/array/pack/c_spec.rb b/spec/ruby/core/array/pack/c_spec.rb index 7200830331..ac133ff9b6 100644 --- a/spec/ruby/core/array/pack/c_spec.rb +++ b/spec/ruby/core/array/pack/c_spec.rb @@ -45,8 +45,20 @@ describe :array_pack_8bit, shared: true do [1, 2, 3, 4, 5].pack(pack_format('*')).should == "\x01\x02\x03\x04\x05" end - it "ignores NULL bytes between directives" do - [1, 2, 3].pack(pack_format("\000", 2)).should == "\x01\x02" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [1, 2, 3].pack(pack_format("\000", 2)).should == "\x01\x02" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [1, 2, 3].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/array/pack/h_spec.rb b/spec/ruby/core/array/pack/h_spec.rb index 85a875fc8b..2c1dac8d4a 100644 --- a/spec/ruby/core/array/pack/h_spec.rb +++ b/spec/ruby/core/array/pack/h_spec.rb @@ -18,6 +18,11 @@ describe "Array#pack with format 'H'" do [obj].pack("H").should == "\xa0" end + it "will not implicitly convert a number to a string" do + -> { [0].pack('H') }.should raise_error(TypeError) + -> { [0].pack('h') }.should raise_error(TypeError) + end + it "encodes the first character as the most significant nibble when passed no count modifier" do ["ab"].pack("H").should == "\xa0" end diff --git a/spec/ruby/core/array/pack/m_spec.rb b/spec/ruby/core/array/pack/m_spec.rb index 2b1a84abca..c6364af12d 100644 --- a/spec/ruby/core/array/pack/m_spec.rb +++ b/spec/ruby/core/array/pack/m_spec.rb @@ -80,8 +80,16 @@ describe "Array#pack with format 'M'" do ].should be_computed_by(:pack, "M") end - it "encodes a tab followed by a newline with an encoded newline" do + it "encodes a tab at the end of a line with an encoded newline" do + ["\t"].pack("M").should == "\t=\n" ["\t\n"].pack("M").should == "\t=\n\n" + ["abc\t\nxyz"].pack("M").should == "abc\t=\n\nxyz=\n" + end + + it "encodes a space at the end of a line with an encoded newline" do + [" "].pack("M").should == " =\n" + [" \n"].pack("M").should == " =\n\n" + ["abc \nxyz"].pack("M").should == "abc =\n\nxyz=\n" end it "encodes 127..255 in hex format" do diff --git a/spec/ruby/core/array/pack/p_spec.rb b/spec/ruby/core/array/pack/p_spec.rb index d7dff8a4da..b023bf9110 100644 --- a/spec/ruby/core/array/pack/p_spec.rb +++ b/spec/ruby/core/array/pack/p_spec.rb @@ -15,18 +15,6 @@ describe "Array#pack with format 'P'" do ["hello"].pack("P").unpack("P5").should == ["hello"] end - ruby_version_is ''...'2.7' do - it "taints the input string" do - input_string = "hello" - [input_string].pack("P") - input_string.tainted?.should be_true - end - - it "does not taint the output string in normal cases" do - ["hello"].pack("P").tainted?.should be_false - end - end - it "with nil gives a null pointer" do [nil].pack("P").unpack("J").should == [0] end @@ -44,18 +32,6 @@ describe "Array#pack with format 'p'" do ["hello"].pack("p").unpack("p").should == ["hello"] end - ruby_version_is ''...'2.7' do - it "taints the input string" do - input_string = "hello" - [input_string].pack("p") - input_string.tainted?.should be_true - end - - it "does not taint the output string in normal cases" do - ["hello"].pack("p").tainted?.should be_false - end - end - it "with nil gives a null pointer" do [nil].pack("p").unpack("J").should == [0] end diff --git a/spec/ruby/core/array/pack/shared/basic.rb b/spec/ruby/core/array/pack/shared/basic.rb index 9061273ad6..5e3eea55f9 100644 --- a/spec/ruby/core/array/pack/shared/basic.rb +++ b/spec/ruby/core/array/pack/shared/basic.rb @@ -27,17 +27,47 @@ describe :array_pack_basic_non_float, shared: true do [@obj, @obj].pack("a \t\n\v\f\r"+pack_format).should be_an_instance_of(String) end + it "ignores comments in the format string" do + # 2 additional directives ('a') are required for the X directive + [@obj, @obj, @obj, @obj].pack("aa #{pack_format} # some comment \n#{pack_format}").should be_an_instance_of(String) + end + + ruby_version_is ""..."3.2" do + it "warns in verbose mode that a directive is unknown" do + # additional directive ('a') is required for the X directive + -> { [@obj, @obj].pack("a R" + pack_format) }.should complain(/unknown pack directive 'R'/, verbose: true) + -> { [@obj, @obj].pack("a 0" + pack_format) }.should complain(/unknown pack directive '0'/, verbose: true) + -> { [@obj, @obj].pack("a :" + pack_format) }.should complain(/unknown pack directive ':'/, verbose: true) + end + end + + ruby_version_is "3.2"..."3.3" do + # https://bugs.ruby-lang.org/issues/19150 + # NOTE: it's just a plan of the Ruby core team + it "warns that a directive is unknown" do + # additional directive ('a') is required for the X directive + -> { [@obj, @obj].pack("a R" + pack_format) }.should complain(/unknown pack directive 'R'/) + -> { [@obj, @obj].pack("a 0" + pack_format) }.should complain(/unknown pack directive '0'/) + -> { [@obj, @obj].pack("a :" + pack_format) }.should complain(/unknown pack directive ':'/) + end + end + + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19150 + # NOTE: Added this case just to not forget about the decision in the ticket + it "raise ArgumentError when a directive is unknown" do + # additional directive ('a') is required for the X directive + -> { [@obj, @obj].pack("a R" + pack_format) }.should raise_error(ArgumentError) + -> { [@obj, @obj].pack("a 0" + pack_format) }.should raise_error(ArgumentError) + -> { [@obj, @obj].pack("a :" + pack_format) }.should raise_error(ArgumentError) + end + end + it "calls #to_str to coerce the directives string" do d = mock("pack directive") d.should_receive(:to_str).and_return("x"+pack_format) [@obj, @obj].pack(d).should be_an_instance_of(String) end - - ruby_version_is ''...'2.7' do - it "taints the output string if the format string is tainted" do - [@obj, @obj].pack("x"+pack_format.taint).tainted?.should be_true - end - end end describe :array_pack_basic_float, shared: true do @@ -45,17 +75,15 @@ describe :array_pack_basic_float, shared: true do [9.3, 4.7].pack(" \t\n\v\f\r"+pack_format).should be_an_instance_of(String) end + it "ignores comments in the format string" do + [9.3, 4.7].pack(pack_format + "# some comment \n" + pack_format).should be_an_instance_of(String) + end + it "calls #to_str to coerce the directives string" do d = mock("pack directive") d.should_receive(:to_str).and_return("x"+pack_format) [1.2, 4.7].pack(d).should be_an_instance_of(String) end - - ruby_version_is ''...'2.7' do - it "taints the output string if the format string is tainted" do - [3.2, 2.8].pack("x"+pack_format.taint).tainted?.should be_true - end - end end describe :array_pack_no_platform, shared: true do diff --git a/spec/ruby/core/array/pack/shared/float.rb b/spec/ruby/core/array/pack/shared/float.rb index c6b194007f..1780d7635e 100644 --- a/spec/ruby/core/array/pack/shared/float.rb +++ b/spec/ruby/core/array/pack/shared/float.rb @@ -25,8 +25,20 @@ describe :array_pack_float_le, shared: true do [2.9, 1.4, 8.2].pack(pack_format("*")).should == "\x9a\x999@33\xb3?33\x03A" end - it "ignores NULL bytes between directives" do - [5.3, 9.2].pack(pack_format("\000", 2)).should == "\x9a\x99\xa9@33\x13A" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [5.3, 9.2].pack(pack_format("\000", 2)).should == "\x9a\x99\xa9@33\x13A" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [5.3, 9.2].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -53,6 +65,14 @@ describe :array_pack_float_le, shared: true do it "encodes a negative Float outside the range of a single precision float" do [-1e150].pack(pack_format).should == "\x00\x00\x80\xff" end + + it "encodes a bignum as a float" do + [2 ** 65].pack(pack_format).should == [(2 ** 65).to_f].pack(pack_format) + end + + it "encodes a rational as a float" do + [Rational(3, 4)].pack(pack_format).should == [Rational(3, 4).to_f].pack(pack_format) + end end describe :array_pack_float_be, shared: true do @@ -66,6 +86,11 @@ describe :array_pack_float_be, shared: true do it "converts an Integer to a Float" do [8].pack(pack_format).should == "A\x00\x00\x00" + [bignum_value].pack(pack_format).should == "_\x80\x00\x00" + end + + it "converts a Rational to a Float" do + [Rational(8)].pack(pack_format).should == "A\x00\x00\x00" end it "raises a TypeError if passed a String representation of a floating point number" do @@ -80,8 +105,20 @@ describe :array_pack_float_be, shared: true do [2.9, 1.4, 8.2].pack(pack_format("*")).should == "@9\x99\x9a?\xb333A\x0333" end - it "ignores NULL bytes between directives" do - [5.3, 9.2].pack(pack_format("\000", 2)).should == "@\xa9\x99\x9aA\x1333" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [5.3, 9.2].pack(pack_format("\000", 2)).should == "@\xa9\x99\x9aA\x1333" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [5.3, 9.2].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -121,6 +158,11 @@ describe :array_pack_double_le, shared: true do it "converts an Integer to a Float" do [8].pack(pack_format).should == "\x00\x00\x00\x00\x00\x00\x20@" + [bignum_value].pack(pack_format).should == "\x00\x00\x00\x00\x00\x00\xF0C" + end + + it "converts a Rational to a Float" do + [Rational(8)].pack(pack_format).should == "\x00\x00\x00\x00\x00\x00 @" end it "raises a TypeError if passed a String representation of a floating point number" do @@ -135,8 +177,20 @@ describe :array_pack_double_le, shared: true do [2.9, 1.4, 8.2].pack(pack_format("*")).should == "333333\x07@ffffff\xf6?ffffff\x20@" end - it "ignores NULL bytes between directives" do - [5.3, 9.2].pack(pack_format("\000", 2)).should == "333333\x15@ffffff\x22@" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [5.3, 9.2].pack(pack_format("\000", 2)).should == "333333\x15@ffffff\x22@" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [5.3, 9.2].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -194,8 +248,20 @@ describe :array_pack_double_be, shared: true do [2.9, 1.4, 8.2].pack(pack_format("*")).should == "@\x07333333?\xf6ffffff@\x20ffffff" end - it "ignores NULL bytes between directives" do - [5.3, 9.2].pack(pack_format("\000", 2)).should == "@\x15333333@\x22ffffff" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [5.3, 9.2].pack(pack_format("\000", 2)).should == "@\x15333333@\x22ffffff" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [5.3, 9.2].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/array/pack/shared/integer.rb b/spec/ruby/core/array/pack/shared/integer.rb index 6592f85022..fd21b25b19 100644 --- a/spec/ruby/core/array/pack/shared/integer.rb +++ b/spec/ruby/core/array/pack/shared/integer.rb @@ -41,9 +41,21 @@ describe :array_pack_16bit_le, shared: true do str.should == "\x78\x65\xcd\xab\x21\x43" end - it "ignores NULL bytes between directives" do - str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) - str.should == "\x78\x65\xcd\xab" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + str.should == "\x78\x65\xcd\xab" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -93,9 +105,21 @@ describe :array_pack_16bit_be, shared: true do str.should == "\x65\x78\xab\xcd\x43\x21" end - it "ignores NULL bytes between directives" do - str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) - str.should == "\x65\x78\xab\xcd" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + str.should == "\x65\x78\xab\xcd" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -145,9 +169,21 @@ describe :array_pack_32bit_le, shared: true do str.should == "\x78\x65\x43\x12\xcd\xab\xf0\xde\x21\x43\x65\x78" end - it "ignores NULL bytes between directives" do - str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) - str.should == "\x78\x65\x43\x12\xcd\xab\xf0\xde" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + str.should == "\x78\x65\x43\x12\xcd\xab\xf0\xde" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -197,9 +233,21 @@ describe :array_pack_32bit_be, shared: true do str.should == "\x12\x43\x65\x78\xde\xf0\xab\xcd\x78\x65\x43\x21" end - it "ignores NULL bytes between directives" do - str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) - str.should == "\x12\x43\x65\x78\xde\xf0\xab\xcd" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + str = [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + str.should == "\x12\x43\x65\x78\xde\xf0\xab\xcd" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [0x1243_6578, 0xdef0_abcd].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -309,9 +357,21 @@ describe :array_pack_64bit_le, shared: true do str.should == "\x56\x78\x12\x34\xcd\xab\xf0\xde\xf0\xde\xba\xdc\x21\x43\x65\x78" end - it "ignores NULL bytes between directives" do - str = [0xdef0_abcd_3412_7856, 0x7865_4321_dcba_def0].pack(pack_format("\000", 2)) - str.should == "\x56\x78\x12\x34\xcd\xab\xf0\xde\xf0\xde\xba\xdc\x21\x43\x65\x78" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + str = [0xdef0_abcd_3412_7856, 0x7865_4321_dcba_def0].pack(pack_format("\000", 2)) + str.should == "\x56\x78\x12\x34\xcd\xab\xf0\xde\xf0\xde\xba\xdc\x21\x43\x65\x78" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [0xdef0_abcd_3412_7856, 0x7865_4321_dcba_def0].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do @@ -369,9 +429,21 @@ describe :array_pack_64bit_be, shared: true do str.should == "\xde\xf0\xab\xcd\x34\x12\x78\x56\x78\x65\x43\x21\xdc\xba\xde\xf0" end - it "ignores NULL bytes between directives" do - str = [0xdef0_abcd_3412_7856, 0x7865_4321_dcba_def0].pack(pack_format("\000", 2)) - str.should == "\xde\xf0\xab\xcd\x34\x12\x78\x56\x78\x65\x43\x21\xdc\xba\xde\xf0" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + str = [0xdef0_abcd_3412_7856, 0x7865_4321_dcba_def0].pack(pack_format("\000", 2)) + str.should == "\xde\xf0\xab\xcd\x34\x12\x78\x56\x78\x65\x43\x21\xdc\xba\xde\xf0" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [0xdef0_abcd_3412_7856, 0x7865_4321_dcba_def0].pack(pack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/array/pack/shared/numeric_basic.rb b/spec/ruby/core/array/pack/shared/numeric_basic.rb index 7c36ba4a32..545e215e64 100644 --- a/spec/ruby/core/array/pack/shared/numeric_basic.rb +++ b/spec/ruby/core/array/pack/shared/numeric_basic.rb @@ -37,8 +37,14 @@ describe :array_pack_float, shared: true do -> { ["a"].pack(pack_format) }.should raise_error(TypeError) end - it "raises a TypeError when the object does not respond to #to_f" do - obj = mock('not an float') + it "raises a TypeError when the object is not Numeric" do + obj = Object.new + -> { [obj].pack(pack_format) }.should raise_error(TypeError, /can't convert Object into Float/) + end + + it "raises a TypeError when the Numeric object does not respond to #to_f" do + klass = Class.new(Numeric) + obj = klass.new -> { [obj].pack(pack_format) }.should raise_error(TypeError) end end diff --git a/spec/ruby/core/array/pack/shared/string.rb b/spec/ruby/core/array/pack/shared/string.rb index 8c82e8c617..2f70dc3951 100644 --- a/spec/ruby/core/array/pack/shared/string.rb +++ b/spec/ruby/core/array/pack/shared/string.rb @@ -40,7 +40,7 @@ describe :array_pack_string, shared: true do f = pack_format("*") [ [["\u{3042 3044 3046 3048}", 0x2000B].pack(f+"U"), Encoding::BINARY], [["abcde\xd1", "\xFF\xFe\x81\x82"].pack(f+"u"), Encoding::BINARY], - [["a".force_encoding("ascii"), "\xFF\xFe\x81\x82"].pack(f+"u"), Encoding::BINARY], + [["a".dup.force_encoding("ascii"), "\xFF\xFe\x81\x82"].pack(f+"u"), Encoding::BINARY], # under discussion [ruby-dev:37294] [["\u{3042 3044 3046 3048}", 1].pack(f+"N"), Encoding::BINARY] ].should be_computed_by(:encoding) diff --git a/spec/ruby/core/array/pack/shared/taint.rb b/spec/ruby/core/array/pack/shared/taint.rb index 565f04b8b9..2c2b011c34 100644 --- a/spec/ruby/core/array/pack/shared/taint.rb +++ b/spec/ruby/core/array/pack/shared/taint.rb @@ -1,35 +1,2 @@ describe :array_pack_taint, shared: true do - ruby_version_is ''...'2.7' do - it "returns a tainted string when a pack argument is tainted" do - ["abcd".taint, 0x20].pack(pack_format("3C")).tainted?.should be_true - end - - it "does not return a tainted string when the array is tainted" do - ["abcd", 0x20].taint.pack(pack_format("3C")).tainted?.should be_false - end - - it "returns a tainted string when the format is tainted" do - ["abcd", 0x20].pack(pack_format("3C").taint).tainted?.should be_true - end - - it "returns a tainted string when an empty format is tainted" do - ["abcd", 0x20].pack("".taint).tainted?.should be_true - end - - it "returns a untrusted string when the format is untrusted" do - ["abcd", 0x20].pack(pack_format("3C").untrust).untrusted?.should be_true - end - - it "returns a untrusted string when the empty format is untrusted" do - ["abcd", 0x20].pack("".untrust).untrusted?.should be_true - end - - it "returns a untrusted string when a pack argument is untrusted" do - ["abcd".untrust, 0x20].pack(pack_format("3C")).untrusted?.should be_true - end - - it "returns a trusted string when the array is untrusted" do - ["abcd", 0x20].untrust.pack(pack_format("3C")).untrusted?.should be_false - end - end end diff --git a/spec/ruby/core/array/pack/shared/unicode.rb b/spec/ruby/core/array/pack/shared/unicode.rb index dd0f8b38aa..4d8eaef323 100644 --- a/spec/ruby/core/array/pack/shared/unicode.rb +++ b/spec/ruby/core/array/pack/shared/unicode.rb @@ -67,8 +67,20 @@ describe :array_pack_unicode, shared: true do -> { [obj].pack("U") }.should raise_error(TypeError) end - it "ignores NULL bytes between directives" do - [1, 2, 3].pack("U\x00U").should == "\x01\x02" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [1, 2, 3].pack("U\x00U").should == "\x01\x02" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [1, 2, 3].pack("U\x00U") + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/array/pack/u_spec.rb b/spec/ruby/core/array/pack/u_spec.rb index fe969cbb2d..b20093a647 100644 --- a/spec/ruby/core/array/pack/u_spec.rb +++ b/spec/ruby/core/array/pack/u_spec.rb @@ -18,6 +18,16 @@ describe "Array#pack with format 'u'" do it_behaves_like :array_pack_arguments, 'u' it_behaves_like :array_pack_taint, 'u' + it "calls #to_str to convert an Object to a String" do + obj = mock("pack u string") + obj.should_receive(:to_str).and_return("``abcdef") + [obj].pack("u*").should == "(8&!A8F-D968`\n" + end + + it "will not implicitly convert a number to a string" do + -> { [0].pack('u') }.should raise_error(TypeError) + end + it "encodes an empty string as an empty string" do [""].pack("u").should == "" end diff --git a/spec/ruby/core/array/pack/w_spec.rb b/spec/ruby/core/array/pack/w_spec.rb index 439fa02198..48ed4496a5 100644 --- a/spec/ruby/core/array/pack/w_spec.rb +++ b/spec/ruby/core/array/pack/w_spec.rb @@ -24,8 +24,20 @@ describe "Array#pack with format 'w'" do [obj].pack("w").should == "\x05" end - it "ignores NULL bytes between directives" do - [1, 2, 3].pack("w\x00w").should == "\x01\x02" + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + [1, 2, 3].pack("w\x00w").should == "\x01\x02" + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + [1, 2, 3].pack("w\x00w") + }.should raise_error(ArgumentError, /unknown pack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/array/pack/x_spec.rb b/spec/ruby/core/array/pack/x_spec.rb index a28dd0bf21..86c3ad1aa4 100644 --- a/spec/ruby/core/array/pack/x_spec.rb +++ b/spec/ruby/core/array/pack/x_spec.rb @@ -30,6 +30,7 @@ describe "Array#pack with format 'x'" do it "does not add a NULL byte when passed the '*' modifier" do [].pack("x*").should == "" + [1, 2].pack("Cx*C").should == "\x01\x02" end end diff --git a/spec/ruby/core/array/pack/z_spec.rb b/spec/ruby/core/array/pack/z_spec.rb index 82ce7b4a1c..5ad3afd69e 100644 --- a/spec/ruby/core/array/pack/z_spec.rb +++ b/spec/ruby/core/array/pack/z_spec.rb @@ -12,6 +12,16 @@ describe "Array#pack with format 'Z'" do it_behaves_like :array_pack_string, 'Z' it_behaves_like :array_pack_taint, 'Z' + it "calls #to_str to convert an Object to a String" do + obj = mock("pack Z string") + obj.should_receive(:to_str).and_return("``abcdef") + [obj].pack("Z*").should == "``abcdef\x00" + end + + it "will not implicitly convert a number to a string" do + -> { [0].pack('Z') }.should raise_error(TypeError) + end + it "adds all the bytes and appends a NULL byte when passed the '*' modifier" do ["abc"].pack("Z*").should == "abc\x00" end diff --git a/spec/ruby/core/array/plus_spec.rb b/spec/ruby/core/array/plus_spec.rb index 45f8438208..635bd131c9 100644 --- a/spec/ruby/core/array/plus_spec.rb +++ b/spec/ruby/core/array/plus_spec.rb @@ -14,10 +14,23 @@ describe "Array#+" do (ary + ary).should == [1, 2, 3, 1, 2, 3] end - it "tries to convert the passed argument to an Array using #to_ary" do - obj = mock('["x", "y"]') - obj.should_receive(:to_ary).and_return(["x", "y"]) - ([1, 2, 3] + obj).should == [1, 2, 3, "x", "y"] + describe "converts the passed argument to an Array using #to_ary" do + it "successfully concatenates the resulting array from the #to_ary call" do + obj = mock('["x", "y"]') + obj.should_receive(:to_ary).and_return(["x", "y"]) + ([1, 2, 3] + obj).should == [1, 2, 3, "x", "y"] + end + + it "raises a Typeerror if the given argument can't be converted to an array" do + -> { [1, 2, 3] + nil }.should raise_error(TypeError) + -> { [1, 2, 3] + "abc" }.should raise_error(TypeError) + end + + it "raises a NoMethodError if the given argument raises a NoMethodError during type coercion to an Array" do + obj = mock("hello") + obj.should_receive(:to_ary).and_raise(NoMethodError) + -> { [1, 2, 3] + obj }.should raise_error(NoMethodError) + end end it "properly handles recursive arrays" do @@ -40,20 +53,4 @@ describe "Array#+" do it "does not call to_ary on array subclasses" do ([5, 6] + ArraySpecs::ToAryArray[1, 2]).should == [5, 6, 1, 2] end - - ruby_version_is ''...'2.7' do - it "does not get infected even if an original array is tainted" do - ([1, 2] + [3, 4]).tainted?.should be_false - ([1, 2].taint + [3, 4]).tainted?.should be_false - ([1, 2] + [3, 4].taint).tainted?.should be_false - ([1, 2].taint + [3, 4].taint).tainted?.should be_false - end - - it "does not infected even if an original array is untrusted" do - ([1, 2] + [3, 4]).untrusted?.should be_false - ([1, 2].untrust + [3, 4]).untrusted?.should be_false - ([1, 2] + [3, 4].untrust).untrusted?.should be_false - ([1, 2].untrust + [3, 4].untrust).untrusted?.should be_false - end - end end diff --git a/spec/ruby/core/array/pop_spec.rb b/spec/ruby/core/array/pop_spec.rb index 96ef78da32..2a19408660 100644 --- a/spec/ruby/core/array/pop_spec.rb +++ b/spec/ruby/core/array/pop_spec.rb @@ -30,16 +30,6 @@ describe "Array#pop" do array.pop.should == [1, 'two', 3.0, array, array, array, array] end - ruby_version_is ''...'2.7' do - it "keeps taint status" do - a = [1, 2].taint - a.pop - a.tainted?.should be_true - a.pop - a.tainted?.should be_true - end - end - it "raises a FrozenError on a frozen array" do -> { ArraySpecs.frozen_array.pop }.should raise_error(FrozenError) end @@ -48,16 +38,6 @@ describe "Array#pop" do -> { ArraySpecs.empty_frozen_array.pop }.should raise_error(FrozenError) end - ruby_version_is ''...'2.7' do - it "keeps untrusted status" do - a = [1, 2].untrust - a.pop - a.untrusted?.should be_true - a.pop - a.untrusted?.should be_true - end - end - describe "passed a number n as an argument" do it "removes and returns an array with the last n elements of the array" do a = [1, 2, 3, 4, 5, 6] @@ -136,41 +116,9 @@ describe "Array#pop" do ArraySpecs::MyArray[1, 2, 3].pop(2).should be_an_instance_of(Array) end - ruby_version_is ''...'2.7' do - it "returns an untainted array even if the array is tainted" do - ary = [1, 2].taint - ary.pop(2).tainted?.should be_false - ary.pop(0).tainted?.should be_false - end - - it "keeps taint status" do - a = [1, 2].taint - a.pop(2) - a.tainted?.should be_true - a.pop(2) - a.tainted?.should be_true - end - - it "returns a trusted array even if the array is untrusted" do - ary = [1, 2].untrust - ary.pop(2).untrusted?.should be_false - ary.pop(0).untrusted?.should be_false - end - end - it "raises a FrozenError on a frozen array" do -> { ArraySpecs.frozen_array.pop(2) }.should raise_error(FrozenError) -> { ArraySpecs.frozen_array.pop(0) }.should raise_error(FrozenError) end - - ruby_version_is ''...'2.7' do - it "keeps untrusted status" do - a = [1, 2].untrust - a.pop(2) - a.untrusted?.should be_true - a.pop(2) - a.untrusted?.should be_true - end - end end end diff --git a/spec/ruby/core/array/product_spec.rb b/spec/ruby/core/array/product_spec.rb index 07d2880a96..6fb3818508 100644 --- a/spec/ruby/core/array/product_spec.rb +++ b/spec/ruby/core/array/product_spec.rb @@ -9,6 +9,11 @@ describe "Array#product" do ar.called.should == :to_ary end + it "returns converted arguments using :method_missing" do + ar = ArraySpecs::ArrayMethodMissing.new(2,3) + [1].product(ar).should == [[1,2],[1,3]] + end + it "returns the expected result" do [1,2].product([3,4,5],[6,8]).should == [[1, 3, 6], [1, 3, 8], [1, 4, 6], [1, 4, 8], [1, 5, 6], [1, 5, 8], [2, 3, 6], [2, 3, 8], [2, 4, 6], [2, 4, 8], [2, 5, 6], [2, 5, 8]] diff --git a/spec/ruby/core/array/rassoc_spec.rb b/spec/ruby/core/array/rassoc_spec.rb index 62fbd40611..632a05e8b3 100644 --- a/spec/ruby/core/array/rassoc_spec.rb +++ b/spec/ruby/core/array/rassoc_spec.rb @@ -35,4 +35,18 @@ describe "Array#rassoc" do [[1, :foobar, o], [2, o, 1], [3, mock('foo')]].rassoc(key).should == [2, o, 1] end + + ruby_version_is "3.3" do + it "calls to_ary on non-array elements" do + s1 = [1, 2] + s2 = ArraySpecs::ArrayConvertible.new(2, 3) + a = [s1, s2] + + s1.should_not_receive(:to_ary) + a.rassoc(2).should equal(s1) + + a.rassoc(3).should == [2, 3] + s2.called.should equal(:to_ary) + end + end end diff --git a/spec/ruby/core/array/reject_spec.rb b/spec/ruby/core/array/reject_spec.rb index fcf43fabde..81a467e364 100644 --- a/spec/ruby/core/array/reject_spec.rb +++ b/spec/ruby/core/array/reject_spec.rb @@ -2,6 +2,7 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative 'shared/enumeratorize' require_relative 'shared/delete_if' +require_relative 'shared/iterable_and_tolerating_size_increasing' require_relative '../enumerable/shared/enumeratorized' describe "Array#reject" do @@ -47,6 +48,10 @@ describe "Array#reject" do it_behaves_like :enumeratorized_with_origin_size, :reject, [1,2,3] end +describe "Array#reject" do + it_behaves_like :array_iterable_and_tolerating_size_increasing, :reject +end + describe "Array#reject!" do it "removes elements for which block is true" do a = [3, 4, 5, 6, 7, 8, 9, 10, 11] @@ -111,6 +116,11 @@ describe "Array#reject!" do -> { ArraySpecs.empty_frozen_array.reject! {} }.should raise_error(FrozenError) end + it "raises a FrozenError on a frozen array only during iteration if called without a block" do + enum = ArraySpecs.frozen_array.reject! + -> { enum.each {} }.should raise_error(FrozenError) + end + it "does not truncate the array is the block raises an exception" do a = [1, 2, 3] begin @@ -141,3 +151,8 @@ describe "Array#reject!" do it_behaves_like :enumeratorized_with_origin_size, :reject!, [1,2,3] it_behaves_like :delete_if, :reject! end + +describe "Array#reject!" do + @value_to_return = -> _ { false } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :reject! +end diff --git a/spec/ruby/core/array/reverse_each_spec.rb b/spec/ruby/core/array/reverse_each_spec.rb index 28b8bfcb34..59dabcd33d 100644 --- a/spec/ruby/core/array/reverse_each_spec.rb +++ b/spec/ruby/core/array/reverse_each_spec.rb @@ -5,7 +5,7 @@ require_relative '../enumerable/shared/enumeratorized' # Modifying a collection while the contents are being iterated # gives undefined behavior. See -# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633 +# https://blade.ruby-lang.org/ruby-core/23633 describe "Array#reverse_each" do before :each do @@ -38,6 +38,20 @@ describe "Array#reverse_each" do [1, 2, 3].reverse_each.size.should == 3 end + it "tolerates increasing an array size during iteration" do + array = [:a, :b, :c] + ScratchPad.record [] + i = 0 + + array.reverse_each do |e| + ScratchPad << e + array.prepend i if i < 100 + i += 1 + end + + ScratchPad.recorded.should == [:c, :a, 1] + end + it_behaves_like :enumeratorize, :reverse_each it_behaves_like :enumeratorized_with_origin_size, :reverse_each, [1,2,3] end diff --git a/spec/ruby/core/array/rindex_spec.rb b/spec/ruby/core/array/rindex_spec.rb index 175c7bcfe2..13de88818c 100644 --- a/spec/ruby/core/array/rindex_spec.rb +++ b/spec/ruby/core/array/rindex_spec.rb @@ -4,7 +4,7 @@ require_relative '../enumerable/shared/enumeratorized' # Modifying a collection while the contents are being iterated # gives undefined behavior. See -# http://blade.nagaokaut.ac.jp/cgi-bin/scat.rb/ruby/ruby-core/23633 +# https://blade.ruby-lang.org/ruby-core/23633 describe "Array#rindex" do it "returns the first index backwards from the end where element == to object" do @@ -68,6 +68,21 @@ describe "Array#rindex" do seen.should == [3] end + it "tolerates increasing an array size during iteration" do + array = [:a, :b, :c] + ScratchPad.record [] + i = 0 + + array.rindex do |e| + ScratchPad << e + array.prepend i if i < 100 + i += 1 + false + end + + ScratchPad.recorded.should == [:c, :a, 1] + end + describe "given no argument and no block" do it "produces an Enumerator" do enum = [4, 2, 1, 5, 1, 3].rindex diff --git a/spec/ruby/core/array/sample_spec.rb b/spec/ruby/core/array/sample_spec.rb index 565d7ff7f9..6ef78594f0 100644 --- a/spec/ruby/core/array/sample_spec.rb +++ b/spec/ruby/core/array/sample_spec.rb @@ -3,26 +3,36 @@ require_relative 'fixtures/classes' describe "Array#sample" do it "samples evenly" do - ary = [0, 1, 2, 3] - 3.times do |i| - counts = [0, 0, 0, 0] - 4000.times do - counts[ary.sample(3)[i]] += 1 - end - counts.each do |count| - (800..1200).should include(count) - end - end + ArraySpecs.measure_sample_fairness(4, 1, 400) + ArraySpecs.measure_sample_fairness(4, 2, 400) + ArraySpecs.measure_sample_fairness(4, 3, 400) + ArraySpecs.measure_sample_fairness(40, 3, 400) + ArraySpecs.measure_sample_fairness(40, 4, 400) + ArraySpecs.measure_sample_fairness(40, 8, 400) + ArraySpecs.measure_sample_fairness(40, 16, 400) + ArraySpecs.measure_sample_fairness_large_sample_size(100, 80, 4000) end it "returns nil for an empty Array" do [].sample.should be_nil end + it "returns nil for an empty array when called without n and a Random is given" do + [].sample(random: Random.new(42)).should be_nil + end + it "returns a single value when not passed a count" do [4].sample.should equal(4) end + it "returns a single value when not passed a count and a Random is given" do + [4].sample(random: Random.new(42)).should equal(4) + end + + it "returns a single value when not passed a count and a Random class is given" do + [4].sample(random: Random).should equal(4) + end + it "returns an empty Array when passed zero" do [4].sample(0).should == [] end diff --git a/spec/ruby/core/array/shared/clone.rb b/spec/ruby/core/array/shared/clone.rb index 3c17b1f10f..035b45ec99 100644 --- a/spec/ruby/core/array/shared/clone.rb +++ b/spec/ruby/core/array/shared/clone.rb @@ -17,28 +17,4 @@ describe :array_clone, shared: true do b.should == a b.__id__.should_not == a.__id__ end - - ruby_version_is ''...'2.7' do - it "copies taint status from the original" do - a = [1, 2, 3, 4] - b = [1, 2, 3, 4] - a.taint - aa = a.send @method - bb = b.send @method - - aa.should.tainted? - bb.should_not.tainted? - end - - it "copies untrusted status from the original" do - a = [1, 2, 3, 4] - b = [1, 2, 3, 4] - a.untrust - aa = a.send @method - bb = b.send @method - - aa.should.untrusted? - bb.should_not.untrusted? - end - end end diff --git a/spec/ruby/core/array/shared/collect.rb b/spec/ruby/core/array/shared/collect.rb index d84432734a..030302ced6 100644 --- a/spec/ruby/core/array/shared/collect.rb +++ b/spec/ruby/core/array/shared/collect.rb @@ -1,4 +1,5 @@ require_relative '../../enumerable/shared/enumeratorized' +require_relative '../shared/iterable_and_tolerating_size_increasing' describe :array_collect, shared: true do it "returns a copy of array with each element replaced by the value returned by block" do @@ -42,24 +43,12 @@ describe :array_collect, shared: true do }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "does not copy tainted status" do - a = [1, 2, 3] - a.taint - a.send(@method){|x| x}.tainted?.should be_false - end - - it "does not copy untrusted status" do - a = [1, 2, 3] - a.untrust - a.send(@method){|x| x}.untrusted?.should be_false - end - end - before :all do @object = [1, 2, 3, 4] end it_should_behave_like :enumeratorized_with_origin_size + + it_should_behave_like :array_iterable_and_tolerating_size_increasing end describe :array_collect_b, shared: true do @@ -96,23 +85,6 @@ describe :array_collect_b, shared: true do a.should == ["1!", "2!", "3!"] end - ruby_version_is ''...'2.7' do - it "keeps tainted status" do - a = [1, 2, 3] - a.taint - a.tainted?.should be_true - a.send(@method){|x| x} - a.tainted?.should be_true - end - - it "keeps untrusted status" do - a = [1, 2, 3] - a.untrust - a.send(@method){|x| x} - a.untrusted?.should be_true - end - end - describe "when frozen" do it "raises a FrozenError" do -> { ArraySpecs.frozen_array.send(@method) {} }.should raise_error(FrozenError) @@ -133,8 +105,37 @@ describe :array_collect_b, shared: true do end end + it "does not truncate the array is the block raises an exception" do + a = [1, 2, 3] + begin + a.send(@method) { raise StandardError, 'Oops' } + rescue + end + + a.should == [1, 2, 3] + end + + it "only changes elements before error is raised, keeping the element which raised an error." do + a = [1, 2, 3, 4] + begin + a.send(@method) do |e| + case e + when 1 then -1 + when 2 then -2 + when 3 then raise StandardError, 'Oops' + else 0 + end + end + rescue StandardError + end + + a.should == [-1, -2, 3, 4] + end + before :all do @object = [1, 2, 3, 4] end it_should_behave_like :enumeratorized_with_origin_size + + it_should_behave_like :array_iterable_and_tolerating_size_increasing end diff --git a/spec/ruby/core/array/shared/index.rb b/spec/ruby/core/array/shared/index.rb index a9896554f2..a4a0adbab6 100644 --- a/spec/ruby/core/array/shared/index.rb +++ b/spec/ruby/core/array/shared/index.rb @@ -1,3 +1,5 @@ +require_relative '../shared/iterable_and_tolerating_size_increasing' + describe :array_index, shared: true do it "returns the index of the first element == to object" do x = mock('3') @@ -34,4 +36,6 @@ describe :array_index, shared: true do [].send(@method).should be_an_instance_of(Enumerator) end end + + it_should_behave_like :array_iterable_and_tolerating_size_increasing end diff --git a/spec/ruby/core/array/shared/inspect.rb b/spec/ruby/core/array/shared/inspect.rb index 736f8d946b..af5128c645 100644 --- a/spec/ruby/core/array/shared/inspect.rb +++ b/spec/ruby/core/array/shared/inspect.rb @@ -19,7 +19,7 @@ describe :array_inspect, shared: true do end it "does not call #to_s on a String returned from #inspect" do - str = "abc" + str = +"abc" str.should_not_receive(:to_s) [str].send(@method).should == '["abc"]' @@ -64,32 +64,6 @@ describe :array_inspect, shared: true do ArraySpecs.empty_recursive_array.send(@method).should == "[[...]]" end - ruby_version_is ''...'2.7' do - it "taints the result if the Array is non-empty and tainted" do - [1, 2].taint.send(@method).tainted?.should be_true - end - - it "does not taint the result if the Array is tainted but empty" do - [].taint.send(@method).tainted?.should be_false - end - - it "taints the result if an element is tainted" do - ["str".taint].send(@method).tainted?.should be_true - end - - it "untrusts the result if the Array is untrusted" do - [1, 2].untrust.send(@method).untrusted?.should be_true - end - - it "does not untrust the result if the Array is untrusted but empty" do - [].untrust.send(@method).untrusted?.should be_false - end - - it "untrusts the result if an element is untrusted" do - ["str".untrust].send(@method).untrusted?.should be_true - end - end - describe "with encoding" do before :each do @default_external_encoding = Encoding.default_external @@ -124,8 +98,8 @@ describe :array_inspect, shared: true do end it "does not raise if inspected result is not default external encoding" do - utf_16be = mock("utf_16be") - utf_16be.should_receive(:inspect).and_return(%<"utf_16be \u3042">.encode!(Encoding::UTF_16BE)) + utf_16be = mock(+"utf_16be") + utf_16be.should_receive(:inspect).and_return(%<"utf_16be \u3042">.encode(Encoding::UTF_16BE)) [utf_16be].send(@method).should == '["utf_16be \u3042"]' end diff --git a/spec/ruby/core/array/shared/intersection.rb b/spec/ruby/core/array/shared/intersection.rb index 49849b08c2..0b4166ab63 100644 --- a/spec/ruby/core/array/shared/intersection.rb +++ b/spec/ruby/core/array/shared/intersection.rb @@ -11,7 +11,8 @@ describe :array_intersection, shared: true do end it "creates an array with elements in order they are first encountered" do - [ 1, 2, 3, 2, 5 ].send(@method, [ 5, 2, 3, 4 ]).should == [2, 3, 5] + [ 1, 2, 3, 2, 5, 6, 7, 8 ].send(@method, [ 5, 2, 3, 4 ]).should == [2, 3, 5] # array > other + [ 5, 2, 3, 4 ].send(@method, [ 1, 2, 3, 2, 5, 6, 7, 8 ]).should == [5, 2, 3] # array < other end it "does not modify the original Array" do diff --git a/spec/ruby/core/array/shared/iterable_and_tolerating_size_increasing.rb b/spec/ruby/core/array/shared/iterable_and_tolerating_size_increasing.rb new file mode 100644 index 0000000000..3e73bad44b --- /dev/null +++ b/spec/ruby/core/array/shared/iterable_and_tolerating_size_increasing.rb @@ -0,0 +1,25 @@ +describe :array_iterable_and_tolerating_size_increasing, shared: true do + before do + @value_to_return ||= -> _ { nil } + end + + it "tolerates increasing an array size during iteration" do + # The goal is to trigger potential reallocation of internal array storage, so we: + # - use elements of different types, starting with the less generic (Integer) + # - add reasonably big number of new elements (~ 100) + array = [1, 2, 3] # to test some methods we need several uniq elements + array_to_join = [:a, :b, :c] + (4..100).to_a + + ScratchPad.record [] + i = 0 + + array.send(@method) do |e| + ScratchPad << e + array << array_to_join[i] if i < array_to_join.size + i += 1 + @value_to_return.call(e) + end + + ScratchPad.recorded.should == [1, 2, 3] + array_to_join + end +end diff --git a/spec/ruby/core/array/shared/join.rb b/spec/ruby/core/array/shared/join.rb index c443d9a628..507b13e3c8 100644 --- a/spec/ruby/core/array/shared/join.rb +++ b/spec/ruby/core/array/shared/join.rb @@ -58,36 +58,6 @@ describe :array_join_with_default_separator, shared: true do -> { ArraySpecs.empty_recursive_array.send(@method) }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "taints the result if the Array is tainted and non-empty" do - [1, 2].taint.send(@method).tainted?.should be_true - end - - it "does not taint the result if the Array is tainted but empty" do - [].taint.send(@method).tainted?.should be_false - end - - it "taints the result if the result of coercing an element is tainted" do - s = mock("taint") - s.should_receive(:to_s).and_return("str".taint) - [s].send(@method).tainted?.should be_true - end - - it "untrusts the result if the Array is untrusted and non-empty" do - [1, 2].untrust.send(@method).untrusted?.should be_true - end - - it "does not untrust the result if the Array is untrusted but empty" do - [].untrust.send(@method).untrusted?.should be_false - end - - it "untrusts the result if the result of coercing an element is untrusted" do - s = mock("untrust") - s.should_receive(:to_s).and_return("str".untrust) - [s].send(@method).untrusted?.should be_true - end - end - it "uses the first encoding when other strings are compatible" do ary1 = ArraySpecs.array_with_7bit_utf8_and_usascii_strings ary2 = ArraySpecs.array_with_usascii_and_7bit_utf8_strings @@ -114,17 +84,16 @@ describe :array_join_with_default_separator, shared: true do -> { ary_utf8_bad_binary.send(@method) }.should raise_error(EncodingError) end - ruby_version_is "2.7" do - context "when $, is not nil" do - before do - suppress_warning do - $, = '*' - end + context "when $, is not nil" do + before do + suppress_warning do + $, = '*' end + end - it "warns" do - -> { [].join }.should complain(/warning: \$, is set to non-nil value/) - end + it "warns" do + -> { [].join }.should complain(/warning: \$, is set to non-nil value/) + -> { [].join(nil) }.should complain(/warning: \$, is set to non-nil value/) end end end @@ -140,42 +109,4 @@ describe :array_join_with_string_separator, shared: true do [1, [2, [3, 4], 5], 6].send(@method, ":").should == "1:2:3:4:5:6" [1, [2, ArraySpecs::MyArray[3, 4], 5], 6].send(@method, ":").should == "1:2:3:4:5:6" end - - ruby_version_is ''...'2.7' do - describe "with a tainted separator" do - before :each do - @sep = ":".taint - end - - it "does not taint the result if the array is empty" do - [].send(@method, @sep).tainted?.should be_false - end - - it "does not taint the result if the array has only one element" do - [1].send(@method, @sep).tainted?.should be_false - end - - it "taints the result if the array has two or more elements" do - [1, 2].send(@method, @sep).tainted?.should be_true - end - end - - describe "with an untrusted separator" do - before :each do - @sep = ":".untrust - end - - it "does not untrust the result if the array is empty" do - [].send(@method, @sep).untrusted?.should be_false - end - - it "does not untrust the result if the array has only one element" do - [1].send(@method, @sep).untrusted?.should be_false - end - - it "untrusts the result if the array has two or more elements" do - [1, 2].send(@method, @sep).untrusted?.should be_true - end - end - end end diff --git a/spec/ruby/core/array/shared/keep_if.rb b/spec/ruby/core/array/shared/keep_if.rb index f26aff028c..43a047c0a7 100644 --- a/spec/ruby/core/array/shared/keep_if.rb +++ b/spec/ruby/core/array/shared/keep_if.rb @@ -1,4 +1,5 @@ require_relative '../../enumerable/shared/enumeratorized' +require_relative '../shared/iterable_and_tolerating_size_increasing' describe :keep_if, shared: true do it "deletes elements for which the block returns a false value" do @@ -56,5 +57,39 @@ describe :keep_if, shared: true do -> { @frozen.send(@method) { false } }.should raise_error(FrozenError) end end + + it "raises a FrozenError on a frozen array only during iteration if called without a block" do + enum = @frozen.send(@method) + -> { enum.each {} }.should raise_error(FrozenError) + end + end + + it "does not truncate the array is the block raises an exception" do + a = [1, 2, 3] + begin + a.send(@method) { raise StandardError, 'Oops' } + rescue + end + + a.should == [1, 2, 3] end + + it "only changes elements before error is raised, keeping the element which raised an error." do + a = [1, 2, 3, 4] + begin + a.send(@method) do |e| + case e + when 2 then false + when 3 then raise StandardError, 'Oops' + else true + end + end + rescue StandardError + end + + a.should == [1, 3, 4] + end + + @value_to_return = -> _ { true } + it_should_behave_like :array_iterable_and_tolerating_size_increasing end diff --git a/spec/ruby/core/array/shared/select.rb b/spec/ruby/core/array/shared/select.rb index 09101e8ab5..9c2cbf76c4 100644 --- a/spec/ruby/core/array/shared/select.rb +++ b/spec/ruby/core/array/shared/select.rb @@ -2,11 +2,14 @@ require_relative '../../../spec_helper' require_relative '../fixtures/classes' require_relative '../shared/enumeratorize' require_relative '../shared/keep_if' +require_relative '../shared/iterable_and_tolerating_size_increasing' require_relative '../../enumerable/shared/enumeratorized' describe :array_select, shared: true do it_should_behave_like :enumeratorize + it_should_behave_like :array_iterable_and_tolerating_size_increasing + before :each do @object = [1,2,3] end diff --git a/spec/ruby/core/array/shared/slice.rb b/spec/ruby/core/array/shared/slice.rb index 19e1a3ee2b..d2866970a5 100644 --- a/spec/ruby/core/array/shared/slice.rb +++ b/spec/ruby/core/array/shared/slice.rb @@ -397,56 +397,28 @@ describe :array_slice, shared: true do @array = ArraySpecs::MyArray[1, 2, 3, 4, 5] end - ruby_version_is ''...'3.0' do - it "returns a subclass instance with [n, m]" do - @array.send(@method, 0, 2).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [-n, m]" do - @array.send(@method, -3, 2).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [n..m]" do - @array.send(@method, 1..3).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [n...m]" do - @array.send(@method, 1...3).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [-n..-m]" do - @array.send(@method, -3..-1).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [-n...-m]" do - @array.send(@method, -3...-1).should be_an_instance_of(ArraySpecs::MyArray) - end + it "returns a Array instance with [n, m]" do + @array.send(@method, 0, 2).should be_an_instance_of(Array) end - ruby_version_is '3.0' do - it "returns a Array instance with [n, m]" do - @array.send(@method, 0, 2).should be_an_instance_of(Array) - end - - it "returns a Array instance with [-n, m]" do - @array.send(@method, -3, 2).should be_an_instance_of(Array) - end + it "returns a Array instance with [-n, m]" do + @array.send(@method, -3, 2).should be_an_instance_of(Array) + end - it "returns a Array instance with [n..m]" do - @array.send(@method, 1..3).should be_an_instance_of(Array) - end + it "returns a Array instance with [n..m]" do + @array.send(@method, 1..3).should be_an_instance_of(Array) + end - it "returns a Array instance with [n...m]" do - @array.send(@method, 1...3).should be_an_instance_of(Array) - end + it "returns a Array instance with [n...m]" do + @array.send(@method, 1...3).should be_an_instance_of(Array) + end - it "returns a Array instance with [-n..-m]" do - @array.send(@method, -3..-1).should be_an_instance_of(Array) - end + it "returns a Array instance with [-n..-m]" do + @array.send(@method, -3..-1).should be_an_instance_of(Array) + end - it "returns a Array instance with [-n...-m]" do - @array.send(@method, -3...-1).should be_an_instance_of(Array) - end + it "returns a Array instance with [-n...-m]" do + @array.send(@method, -3...-1).should be_an_instance_of(Array) end it "returns an empty array when m == n with [m...n]" do @@ -517,8 +489,9 @@ describe :array_slice, shared: true do end it "raises a RangeError if passed a range with a bound that is too large" do - -> { "hello".send(@method, bignum_value..(bignum_value + 1)) }.should raise_error(RangeError) - -> { "hello".send(@method, 0..bignum_value) }.should raise_error(RangeError) + array = [1, 2, 3, 4, 5, 6] + -> { array.send(@method, bignum_value..(bignum_value + 1)) }.should raise_error(RangeError) + -> { array.send(@method, 0..bignum_value) }.should raise_error(RangeError) end it "can accept endless ranges" do @@ -533,26 +506,354 @@ describe :array_slice, shared: true do a.send(@method, eval("(-9...)")).should == nil end - ruby_version_is "2.7" do - it "can accept beginless ranges" do - a = [0, 1, 2, 3, 4, 5] - a.send(@method, eval("(..3)")).should == [0, 1, 2, 3] - a.send(@method, eval("(...3)")).should == [0, 1, 2] - a.send(@method, eval("(..-3)")).should == [0, 1, 2, 3] - a.send(@method, eval("(...-3)")).should == [0, 1, 2] - a.send(@method, eval("(..0)")).should == [0] - a.send(@method, eval("(...0)")).should == [] - a.send(@method, eval("(..9)")).should == [0, 1, 2, 3, 4, 5] - a.send(@method, eval("(...9)")).should == [0, 1, 2, 3, 4, 5] - a.send(@method, eval("(..-9)")).should == [] - a.send(@method, eval("(...-9)")).should == [] + describe "can be sliced with Enumerator::ArithmeticSequence" do + before :each do + @array = [0, 1, 2, 3, 4, 5] + end + + it "has endless range and positive steps" do + @array.send(@method, eval("(0..).step(1)")).should == [0, 1, 2, 3, 4, 5] + @array.send(@method, eval("(0..).step(2)")).should == [0, 2, 4] + @array.send(@method, eval("(0..).step(10)")).should == [0] + + @array.send(@method, eval("(2..).step(1)")).should == [2, 3, 4, 5] + @array.send(@method, eval("(2..).step(2)")).should == [2, 4] + @array.send(@method, eval("(2..).step(10)")).should == [2] + + @array.send(@method, eval("(-3..).step(1)")).should == [3, 4, 5] + @array.send(@method, eval("(-3..).step(2)")).should == [3, 5] + @array.send(@method, eval("(-3..).step(10)")).should == [3] + end + + it "has beginless range and positive steps" do + # end with zero index + @array.send(@method, (..0).step(1)).should == [0] + @array.send(@method, (...0).step(1)).should == [] + + @array.send(@method, (..0).step(2)).should == [0] + @array.send(@method, (...0).step(2)).should == [] + + @array.send(@method, (..0).step(10)).should == [0] + @array.send(@method, (...0).step(10)).should == [] + + # end with positive index + @array.send(@method, (..3).step(1)).should == [0, 1, 2, 3] + @array.send(@method, (...3).step(1)).should == [0, 1, 2] + + @array.send(@method, (..3).step(2)).should == [0, 2] + @array.send(@method, (...3).step(2)).should == [0, 2] + + @array.send(@method, (..3).step(10)).should == [0] + @array.send(@method, (...3).step(10)).should == [0] + + # end with negative index + @array.send(@method, (..-2).step(1)).should == [0, 1, 2, 3, 4,] + @array.send(@method, (...-2).step(1)).should == [0, 1, 2, 3] + + @array.send(@method, (..-2).step(2)).should == [0, 2, 4] + @array.send(@method, (...-2).step(2)).should == [0, 2] + + @array.send(@method, (..-2).step(10)).should == [0] + @array.send(@method, (...-2).step(10)).should == [0] + end + + it "has endless range and negative steps" do + @array.send(@method, eval("(0..).step(-1)")).should == [0] + @array.send(@method, eval("(0..).step(-2)")).should == [0] + @array.send(@method, eval("(0..).step(-10)")).should == [0] + + @array.send(@method, eval("(2..).step(-1)")).should == [2, 1, 0] + @array.send(@method, eval("(2..).step(-2)")).should == [2, 0] + + @array.send(@method, eval("(-3..).step(-1)")).should == [3, 2, 1, 0] + @array.send(@method, eval("(-3..).step(-2)")).should == [3, 1] + end + + it "has closed range and positive steps" do + # start and end with 0 + @array.send(@method, eval("(0..0).step(1)")).should == [0] + @array.send(@method, eval("(0...0).step(1)")).should == [] + + @array.send(@method, eval("(0..0).step(2)")).should == [0] + @array.send(@method, eval("(0...0).step(2)")).should == [] + + @array.send(@method, eval("(0..0).step(10)")).should == [0] + @array.send(@method, eval("(0...0).step(10)")).should == [] + + # start and end with positive index + @array.send(@method, eval("(1..3).step(1)")).should == [1, 2, 3] + @array.send(@method, eval("(1...3).step(1)")).should == [1, 2] + + @array.send(@method, eval("(1..3).step(2)")).should == [1, 3] + @array.send(@method, eval("(1...3).step(2)")).should == [1] + + @array.send(@method, eval("(1..3).step(10)")).should == [1] + @array.send(@method, eval("(1...3).step(10)")).should == [1] + + # start with positive index, end with negative index + @array.send(@method, eval("(1..-2).step(1)")).should == [1, 2, 3, 4] + @array.send(@method, eval("(1...-2).step(1)")).should == [1, 2, 3] + + @array.send(@method, eval("(1..-2).step(2)")).should == [1, 3] + @array.send(@method, eval("(1...-2).step(2)")).should == [1, 3] + + @array.send(@method, eval("(1..-2).step(10)")).should == [1] + @array.send(@method, eval("(1...-2).step(10)")).should == [1] + + # start with negative index, end with positive index + @array.send(@method, eval("(-4..4).step(1)")).should == [2, 3, 4] + @array.send(@method, eval("(-4...4).step(1)")).should == [2, 3] + + @array.send(@method, eval("(-4..4).step(2)")).should == [2, 4] + @array.send(@method, eval("(-4...4).step(2)")).should == [2] + + @array.send(@method, eval("(-4..4).step(10)")).should == [2] + @array.send(@method, eval("(-4...4).step(10)")).should == [2] + + # start with negative index, end with negative index + @array.send(@method, eval("(-4..-2).step(1)")).should == [2, 3, 4] + @array.send(@method, eval("(-4...-2).step(1)")).should == [2, 3] + + @array.send(@method, eval("(-4..-2).step(2)")).should == [2, 4] + @array.send(@method, eval("(-4...-2).step(2)")).should == [2] + + @array.send(@method, eval("(-4..-2).step(10)")).should == [2] + @array.send(@method, eval("(-4...-2).step(10)")).should == [2] + end + + it "has closed range and negative steps" do + # start and end with 0 + @array.send(@method, eval("(0..0).step(-1)")).should == [0] + @array.send(@method, eval("(0...0).step(-1)")).should == [] + + @array.send(@method, eval("(0..0).step(-2)")).should == [0] + @array.send(@method, eval("(0...0).step(-2)")).should == [] + + @array.send(@method, eval("(0..0).step(-10)")).should == [0] + @array.send(@method, eval("(0...0).step(-10)")).should == [] + + # start and end with positive index + @array.send(@method, eval("(1..3).step(-1)")).should == [] + @array.send(@method, eval("(1...3).step(-1)")).should == [] + + @array.send(@method, eval("(1..3).step(-2)")).should == [] + @array.send(@method, eval("(1...3).step(-2)")).should == [] + + @array.send(@method, eval("(1..3).step(-10)")).should == [] + @array.send(@method, eval("(1...3).step(-10)")).should == [] + + # start with positive index, end with negative index + @array.send(@method, eval("(1..-2).step(-1)")).should == [] + @array.send(@method, eval("(1...-2).step(-1)")).should == [] + + @array.send(@method, eval("(1..-2).step(-2)")).should == [] + @array.send(@method, eval("(1...-2).step(-2)")).should == [] + + @array.send(@method, eval("(1..-2).step(-10)")).should == [] + @array.send(@method, eval("(1...-2).step(-10)")).should == [] + + # start with negative index, end with positive index + @array.send(@method, eval("(-4..4).step(-1)")).should == [] + @array.send(@method, eval("(-4...4).step(-1)")).should == [] + + @array.send(@method, eval("(-4..4).step(-2)")).should == [] + @array.send(@method, eval("(-4...4).step(-2)")).should == [] + + @array.send(@method, eval("(-4..4).step(-10)")).should == [] + @array.send(@method, eval("(-4...4).step(-10)")).should == [] + + # start with negative index, end with negative index + @array.send(@method, eval("(-4..-2).step(-1)")).should == [] + @array.send(@method, eval("(-4...-2).step(-1)")).should == [] + + @array.send(@method, eval("(-4..-2).step(-2)")).should == [] + @array.send(@method, eval("(-4...-2).step(-2)")).should == [] + + @array.send(@method, eval("(-4..-2).step(-10)")).should == [] + @array.send(@method, eval("(-4...-2).step(-10)")).should == [] + end + + it "has inverted closed range and positive steps" do + # start and end with positive index + @array.send(@method, eval("(3..1).step(1)")).should == [] + @array.send(@method, eval("(3...1).step(1)")).should == [] + + @array.send(@method, eval("(3..1).step(2)")).should == [] + @array.send(@method, eval("(3...1).step(2)")).should == [] + + @array.send(@method, eval("(3..1).step(10)")).should == [] + @array.send(@method, eval("(3...1).step(10)")).should == [] + + # start with negative index, end with positive index + @array.send(@method, eval("(-2..1).step(1)")).should == [] + @array.send(@method, eval("(-2...1).step(1)")).should == [] + + @array.send(@method, eval("(-2..1).step(2)")).should == [] + @array.send(@method, eval("(-2...1).step(2)")).should == [] + + @array.send(@method, eval("(-2..1).step(10)")).should == [] + @array.send(@method, eval("(-2...1).step(10)")).should == [] + + # start with positive index, end with negative index + @array.send(@method, eval("(4..-4).step(1)")).should == [] + @array.send(@method, eval("(4...-4).step(1)")).should == [] + + @array.send(@method, eval("(4..-4).step(2)")).should == [] + @array.send(@method, eval("(4...-4).step(2)")).should == [] + + @array.send(@method, eval("(4..-4).step(10)")).should == [] + @array.send(@method, eval("(4...-4).step(10)")).should == [] + + # start with negative index, end with negative index + @array.send(@method, eval("(-2..-4).step(1)")).should == [] + @array.send(@method, eval("(-2...-4).step(1)")).should == [] + + @array.send(@method, eval("(-2..-4).step(2)")).should == [] + @array.send(@method, eval("(-2...-4).step(2)")).should == [] + + @array.send(@method, eval("(-2..-4).step(10)")).should == [] + @array.send(@method, eval("(-2...-4).step(10)")).should == [] end - it "can accept nil...nil ranges" do - a = [0, 1, 2, 3, 4, 5] - a.send(@method, eval("(nil...nil)")).should == a - a.send(@method, eval("(...nil)")).should == a - a.send(@method, eval("(nil..)")).should == a + it "has range with bounds outside of array" do + # end is equal to array's length + @array.send(@method, (0..6).step(1)).should == [0, 1, 2, 3, 4, 5] + -> { @array.send(@method, (0..6).step(2)) }.should raise_error(RangeError) + + # end is greater than length with positive steps + @array.send(@method, (1..6).step(2)).should == [1, 3, 5] + @array.send(@method, (2..7).step(2)).should == [2, 4] + -> { @array.send(@method, (2..8).step(2)) }.should raise_error(RangeError) + + # begin is greater than length with negative steps + @array.send(@method, (6..1).step(-2)).should == [5, 3, 1] + @array.send(@method, (7..2).step(-2)).should == [5, 3] + -> { @array.send(@method, (8..2).step(-2)) }.should raise_error(RangeError) + end + + it "has endless range with start outside of array's bounds" do + @array.send(@method, eval("(6..).step(1)")).should == [] + @array.send(@method, eval("(7..).step(1)")).should == nil + + @array.send(@method, eval("(6..).step(2)")).should == [] + -> { @array.send(@method, eval("(7..).step(2)")) }.should raise_error(RangeError) + end + end + + it "can accept beginless ranges" do + a = [0, 1, 2, 3, 4, 5] + a.send(@method, (..3)).should == [0, 1, 2, 3] + a.send(@method, (...3)).should == [0, 1, 2] + a.send(@method, (..-3)).should == [0, 1, 2, 3] + a.send(@method, (...-3)).should == [0, 1, 2] + a.send(@method, (..0)).should == [0] + a.send(@method, (...0)).should == [] + a.send(@method, (..9)).should == [0, 1, 2, 3, 4, 5] + a.send(@method, (...9)).should == [0, 1, 2, 3, 4, 5] + a.send(@method, (..-9)).should == [] + a.send(@method, (...-9)).should == [] + end + + ruby_version_is "3.2" do + describe "can be sliced with Enumerator::ArithmeticSequence" do + it "with infinite/inverted ranges and negative steps" do + @array = [0, 1, 2, 3, 4, 5] + @array.send(@method, (2..).step(-1)).should == [2, 1, 0] + @array.send(@method, (2..).step(-2)).should == [2, 0] + @array.send(@method, (2..).step(-3)).should == [2] + @array.send(@method, (2..).step(-4)).should == [2] + + @array.send(@method, (-3..).step(-1)).should == [3, 2, 1, 0] + @array.send(@method, (-3..).step(-2)).should == [3, 1] + @array.send(@method, (-3..).step(-3)).should == [3, 0] + @array.send(@method, (-3..).step(-4)).should == [3] + @array.send(@method, (-3..).step(-5)).should == [3] + + @array.send(@method, (..0).step(-1)).should == [5, 4, 3, 2, 1, 0] + @array.send(@method, (..0).step(-2)).should == [5, 3, 1] + @array.send(@method, (..0).step(-3)).should == [5, 2] + @array.send(@method, (..0).step(-4)).should == [5, 1] + @array.send(@method, (..0).step(-5)).should == [5, 0] + @array.send(@method, (..0).step(-6)).should == [5] + @array.send(@method, (..0).step(-7)).should == [5] + + @array.send(@method, (...0).step(-1)).should == [5, 4, 3, 2, 1] + @array.send(@method, (...0).step(-2)).should == [5, 3, 1] + @array.send(@method, (...0).step(-3)).should == [5, 2] + @array.send(@method, (...0).step(-4)).should == [5, 1] + @array.send(@method, (...0).step(-5)).should == [5] + @array.send(@method, (...0).step(-6)).should == [5] + + @array.send(@method, (...1).step(-1)).should == [5, 4, 3, 2] + @array.send(@method, (...1).step(-2)).should == [5, 3] + @array.send(@method, (...1).step(-3)).should == [5, 2] + @array.send(@method, (...1).step(-4)).should == [5] + @array.send(@method, (...1).step(-5)).should == [5] + + @array.send(@method, (..-5).step(-1)).should == [5, 4, 3, 2, 1] + @array.send(@method, (..-5).step(-2)).should == [5, 3, 1] + @array.send(@method, (..-5).step(-3)).should == [5, 2] + @array.send(@method, (..-5).step(-4)).should == [5, 1] + @array.send(@method, (..-5).step(-5)).should == [5] + @array.send(@method, (..-5).step(-6)).should == [5] + + @array.send(@method, (...-5).step(-1)).should == [5, 4, 3, 2] + @array.send(@method, (...-5).step(-2)).should == [5, 3] + @array.send(@method, (...-5).step(-3)).should == [5, 2] + @array.send(@method, (...-5).step(-4)).should == [5] + @array.send(@method, (...-5).step(-5)).should == [5] + + @array.send(@method, (4..1).step(-1)).should == [4, 3, 2, 1] + @array.send(@method, (4..1).step(-2)).should == [4, 2] + @array.send(@method, (4..1).step(-3)).should == [4, 1] + @array.send(@method, (4..1).step(-4)).should == [4] + @array.send(@method, (4..1).step(-5)).should == [4] + + @array.send(@method, (4...1).step(-1)).should == [4, 3, 2] + @array.send(@method, (4...1).step(-2)).should == [4, 2] + @array.send(@method, (4...1).step(-3)).should == [4] + @array.send(@method, (4...1).step(-4)).should == [4] + + @array.send(@method, (-2..1).step(-1)).should == [4, 3, 2, 1] + @array.send(@method, (-2..1).step(-2)).should == [4, 2] + @array.send(@method, (-2..1).step(-3)).should == [4, 1] + @array.send(@method, (-2..1).step(-4)).should == [4] + @array.send(@method, (-2..1).step(-5)).should == [4] + + @array.send(@method, (-2...1).step(-1)).should == [4, 3, 2] + @array.send(@method, (-2...1).step(-2)).should == [4, 2] + @array.send(@method, (-2...1).step(-3)).should == [4] + @array.send(@method, (-2...1).step(-4)).should == [4] + + @array.send(@method, (4..-5).step(-1)).should == [4, 3, 2, 1] + @array.send(@method, (4..-5).step(-2)).should == [4, 2] + @array.send(@method, (4..-5).step(-3)).should == [4, 1] + @array.send(@method, (4..-5).step(-4)).should == [4] + @array.send(@method, (4..-5).step(-5)).should == [4] + + @array.send(@method, (4...-5).step(-1)).should == [4, 3, 2] + @array.send(@method, (4...-5).step(-2)).should == [4, 2] + @array.send(@method, (4...-5).step(-3)).should == [4] + @array.send(@method, (4...-5).step(-4)).should == [4] + + @array.send(@method, (-2..-5).step(-1)).should == [4, 3, 2, 1] + @array.send(@method, (-2..-5).step(-2)).should == [4, 2] + @array.send(@method, (-2..-5).step(-3)).should == [4, 1] + @array.send(@method, (-2..-5).step(-4)).should == [4] + @array.send(@method, (-2..-5).step(-5)).should == [4] + + @array.send(@method, (-2...-5).step(-1)).should == [4, 3, 2] + @array.send(@method, (-2...-5).step(-2)).should == [4, 2] + @array.send(@method, (-2...-5).step(-3)).should == [4] + @array.send(@method, (-2...-5).step(-4)).should == [4] + end end end + + it "can accept nil...nil ranges" do + a = [0, 1, 2, 3, 4, 5] + a.send(@method, eval("(nil...nil)")).should == a + a.send(@method, (...nil)).should == a + a.send(@method, eval("(nil..)")).should == a + end end diff --git a/spec/ruby/core/array/shared/unshift.rb b/spec/ruby/core/array/shared/unshift.rb index fc82e19e2a..4941e098f6 100644 --- a/spec/ruby/core/array/shared/unshift.rb +++ b/spec/ruby/core/array/shared/unshift.rb @@ -22,6 +22,11 @@ describe :array_unshift, shared: true do a.should == [3, 4] end + it "returns self" do + a = [1, 2, 3] + a.send(@method, "a").should.equal?(a) + end + it "quietly ignores unshifting nothing" do [].send(@method).should == [] end @@ -43,4 +48,17 @@ describe :array_unshift, shared: true do it "raises a FrozenError on a frozen array when the array would not be modified" do -> { ArraySpecs.frozen_array.send(@method) }.should raise_error(FrozenError) end + + # https://github.com/oracle/truffleruby/issues/2772 + it "doesn't rely on Array#[]= so it can be overridden" do + subclass = Class.new(Array) do + def []=(*) + raise "[]= is called" + end + end + + array = subclass.new + array.send(@method, 1) + array.should == [1] + end end diff --git a/spec/ruby/core/array/shift_spec.rb b/spec/ruby/core/array/shift_spec.rb index b998e45d28..6b4ef39f77 100644 --- a/spec/ruby/core/array/shift_spec.rb +++ b/spec/ruby/core/array/shift_spec.rb @@ -116,21 +116,5 @@ describe "Array#shift" do it "does not return subclass instances with Array subclass" do ArraySpecs::MyArray[1, 2, 3].shift(2).should be_an_instance_of(Array) end - - ruby_version_is ''...'2.7' do - it "returns an untainted array even if the array is tainted" do - ary = [1, 2].taint - ary.shift(2).tainted?.should be_false - ary.shift(0).tainted?.should be_false - end - - it "keeps taint status" do - a = [1, 2].taint - a.shift(2) - a.tainted?.should be_true - a.shift(2) - a.tainted?.should be_true - end - end end end diff --git a/spec/ruby/core/array/shuffle_spec.rb b/spec/ruby/core/array/shuffle_spec.rb index b255147c75..1d528c124f 100644 --- a/spec/ruby/core/array/shuffle_spec.rb +++ b/spec/ruby/core/array/shuffle_spec.rb @@ -47,6 +47,10 @@ describe "Array#shuffle" do [1, 2].shuffle(random: random).should be_an_instance_of(Array) end + it "accepts a Random class for the value for random: argument" do + [1, 2].shuffle(random: Random).should be_an_instance_of(Array) + end + it "calls #to_int on the Object returned by #rand" do value = mock("array_shuffle_random_value") value.should_receive(:to_int).at_least(1).times.and_return(0) @@ -93,4 +97,14 @@ describe "Array#shuffle!" do -> { ArraySpecs.frozen_array.shuffle! }.should raise_error(FrozenError) -> { ArraySpecs.empty_frozen_array.shuffle! }.should raise_error(FrozenError) end + + it "matches CRuby with random:" do + %w[a b c].shuffle(random: Random.new(1)).should == %w[a c b] + (0..10).to_a.shuffle(random: Random.new(10)).should == [2, 6, 8, 5, 7, 10, 3, 1, 0, 4, 9] + end + + it "matches CRuby with srand" do + srand(123) + %w[a b c d e f g h i j k].shuffle.should == %w[a e f h i j d b g k c] + end end diff --git a/spec/ruby/core/array/slice_spec.rb b/spec/ruby/core/array/slice_spec.rb index 8c276f9084..731c129251 100644 --- a/spec/ruby/core/array/slice_spec.rb +++ b/spec/ruby/core/array/slice_spec.rb @@ -172,16 +172,14 @@ describe "Array#slice!" do a.should == [1, 2] end - ruby_version_is "2.7" do - it "works with beginless ranges" do - a = [0,1,2,3,4] - a.slice!(eval("(..3)")).should == [0, 1, 2, 3] - a.should == [4] - - a = [0,1,2,3,4] - a.slice!(eval("(...-2)")).should == [0, 1, 2] - a.should == [3, 4] - end + it "works with beginless ranges" do + a = [0,1,2,3,4] + a.slice!((..3)).should == [0, 1, 2, 3] + a.should == [4] + + a = [0,1,2,3,4] + a.slice!((...-2)).should == [0, 1, 2] + a.should == [3, 4] end describe "with a subclass of Array" do @@ -189,56 +187,28 @@ describe "Array#slice!" do @array = ArraySpecs::MyArray[1, 2, 3, 4, 5] end - ruby_version_is ''...'3.0' do - it "returns a subclass instance with [n, m]" do - @array.slice!(0, 2).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [-n, m]" do - @array.slice!(-3, 2).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [n..m]" do - @array.slice!(1..3).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [n...m]" do - @array.slice!(1...3).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [-n..-m]" do - @array.slice!(-3..-1).should be_an_instance_of(ArraySpecs::MyArray) - end - - it "returns a subclass instance with [-n...-m]" do - @array.slice!(-3...-1).should be_an_instance_of(ArraySpecs::MyArray) - end + it "returns a Array instance with [n, m]" do + @array.slice!(0, 2).should be_an_instance_of(Array) end - ruby_version_is '3.0' do - it "returns a Array instance with [n, m]" do - @array.slice!(0, 2).should be_an_instance_of(Array) - end - - it "returns a Array instance with [-n, m]" do - @array.slice!(-3, 2).should be_an_instance_of(Array) - end + it "returns a Array instance with [-n, m]" do + @array.slice!(-3, 2).should be_an_instance_of(Array) + end - it "returns a Array instance with [n..m]" do - @array.slice!(1..3).should be_an_instance_of(Array) - end + it "returns a Array instance with [n..m]" do + @array.slice!(1..3).should be_an_instance_of(Array) + end - it "returns a Array instance with [n...m]" do - @array.slice!(1...3).should be_an_instance_of(Array) - end + it "returns a Array instance with [n...m]" do + @array.slice!(1...3).should be_an_instance_of(Array) + end - it "returns a Array instance with [-n..-m]" do - @array.slice!(-3..-1).should be_an_instance_of(Array) - end + it "returns a Array instance with [-n..-m]" do + @array.slice!(-3..-1).should be_an_instance_of(Array) + end - it "returns a Array instance with [-n...-m]" do - @array.slice!(-3...-1).should be_an_instance_of(Array) - end + it "returns a Array instance with [-n...-m]" do + @array.slice!(-3...-1).should be_an_instance_of(Array) end end end diff --git a/spec/ruby/core/array/sort_by_spec.rb b/spec/ruby/core/array/sort_by_spec.rb index 7cea6ec6d3..0334f953f6 100644 --- a/spec/ruby/core/array/sort_by_spec.rb +++ b/spec/ruby/core/array/sort_by_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/iterable_and_tolerating_size_increasing' require_relative '../enumerable/shared/enumeratorized' describe "Array#sort_by!" do @@ -31,6 +32,11 @@ describe "Array#sort_by!" do -> { ArraySpecs.empty_frozen_array.sort_by! {}}.should raise_error(FrozenError) end + it "raises a FrozenError on a frozen array only during iteration if called without a block" do + enum = ArraySpecs.frozen_array.sort_by! + -> { enum.each {} }.should raise_error(FrozenError) + end + it "returns the specified value when it would break in the given block" do [1, 2, 3].sort_by!{ break :a }.should == :a end @@ -48,5 +54,32 @@ describe "Array#sort_by!" do [1].sort_by!(&:to_s).should == [1] end + it "does not truncate the array is the block raises an exception" do + a = [1, 2, 3] + begin + a.sort_by! { raise StandardError, 'Oops' } + rescue + end + + a.should == [1, 2, 3] + end + + it "doesn't change array if error is raised" do + a = [4, 3, 2, 1] + begin + a.sort_by! do |e| + raise StandardError, 'Oops' if e == 1 + e + end + rescue StandardError + end + + a.should == [4, 3, 2, 1] + end + it_behaves_like :enumeratorized_with_origin_size, :sort_by!, [1,2,3] end + +describe "Array#sort_by!" do + it_behaves_like :array_iterable_and_tolerating_size_increasing, :sort_by! +end diff --git a/spec/ruby/core/array/sum_spec.rb b/spec/ruby/core/array/sum_spec.rb index 39c769d328..06abe06135 100644 --- a/spec/ruby/core/array/sum_spec.rb +++ b/spec/ruby/core/array/sum_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#sum" do it "returns the sum of elements" do @@ -9,6 +10,39 @@ describe "Array#sum" do [1, 2, 3].sum { |i| i * 10 }.should == 60 end + it "doesn't apply the block init" do + [1, 2, 3].sum(1) { |i| i * 10 }.should == 61 + end + + # https://bugs.ruby-lang.org/issues/12217 + # https://github.com/ruby/ruby/blob/master/doc/ChangeLog/ChangeLog-2.4.0#L6208-L6214 + it "uses Kahan's compensated summation algorithm for precise sum of float numbers" do + floats = [2.7800000000000002, 5.0, 2.5, 4.44, 3.89, 3.89, 4.44, 7.78, 5.0, 2.7800000000000002, 5.0, 2.5] + naive_sum = floats.reduce { |sum, e| sum + e } + naive_sum.should == 50.00000000000001 + floats.sum.should == 50.0 + end + + it "handles infinite values and NaN" do + [1.0, Float::INFINITY].sum.should == Float::INFINITY + [1.0, -Float::INFINITY].sum.should == -Float::INFINITY + [1.0, Float::NAN].sum.should.nan? + + [Float::INFINITY, 1.0].sum.should == Float::INFINITY + [-Float::INFINITY, 1.0].sum.should == -Float::INFINITY + [Float::NAN, 1.0].sum.should.nan? + + [Float::NAN, Float::INFINITY].sum.should.nan? + [Float::INFINITY, Float::NAN].sum.should.nan? + + [Float::INFINITY, -Float::INFINITY].sum.should.nan? + [-Float::INFINITY, Float::INFINITY].sum.should.nan? + + [Float::INFINITY, Float::INFINITY].sum.should == Float::INFINITY + [-Float::INFINITY, -Float::INFINITY].sum.should == -Float::INFINITY + [Float::NAN, Float::NAN].sum.should.nan? + end + it "returns init value if array is empty" do [].sum(-1).should == -1 end @@ -39,4 +73,18 @@ describe "Array#sum" do a.should_receive(:+).with(b).and_return(42) [b].sum(a).should == 42 end + + ruby_bug '#19530', ''...'3.3' do + it "calls + on the init value" do + a = mock("a") + b = mock("b") + a.should_receive(:+).with(42).and_return(b) + [42].sum(a).should == b + end + end +end + +describe "Array#sum" do + @value_to_return = -> _ { 1 } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :sum end diff --git a/spec/ruby/core/array/take_spec.rb b/spec/ruby/core/array/take_spec.rb index 4fb6f0ce75..c4f0ac9aa4 100644 --- a/spec/ruby/core/array/take_spec.rb +++ b/spec/ruby/core/array/take_spec.rb @@ -26,15 +26,7 @@ describe "Array#take" do ->{ [1].take(-3) }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it 'returns a subclass instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].take(1).should be_an_instance_of(ArraySpecs::MyArray) - end - end - - ruby_version_is '3.0' do - it 'returns a Array instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].take(1).should be_an_instance_of(Array) - end + it 'returns a Array instance for Array subclasses' do + ArraySpecs::MyArray[1, 2, 3, 4, 5].take(1).should be_an_instance_of(Array) end end diff --git a/spec/ruby/core/array/take_while_spec.rb b/spec/ruby/core/array/take_while_spec.rb index 363419b265..8f50260b42 100644 --- a/spec/ruby/core/array/take_while_spec.rb +++ b/spec/ruby/core/array/take_while_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#take_while" do it "returns all elements until the block returns false" do @@ -14,15 +15,12 @@ describe "Array#take_while" do [1, 2, false, 4].take_while{ |element| element }.should == [1, 2] end - ruby_version_is ''...'3.0' do - it 'returns a subclass instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].take_while { |n| n < 4 }.should be_an_instance_of(ArraySpecs::MyArray) - end + it 'returns a Array instance for Array subclasses' do + ArraySpecs::MyArray[1, 2, 3, 4, 5].take_while { |n| n < 4 }.should be_an_instance_of(Array) end +end - ruby_version_is '3.0' do - it 'returns a Array instance for Array subclasses' do - ArraySpecs::MyArray[1, 2, 3, 4, 5].take_while { |n| n < 4 }.should be_an_instance_of(Array) - end - end +describe "Array#take_while" do + @value_to_return = -> _ { true } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :take_while end diff --git a/spec/ruby/core/array/to_h_spec.rb b/spec/ruby/core/array/to_h_spec.rb index f5a7e546e6..f4578211a1 100644 --- a/spec/ruby/core/array/to_h_spec.rb +++ b/spec/ruby/core/array/to_h_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#to_h" do it "converts empty array to empty hash" do @@ -77,3 +78,8 @@ describe "Array#to_h" do end end end + +describe "Array#to_h" do + @value_to_return = -> e { [e, e.to_s] } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :to_h +end diff --git a/spec/ruby/core/array/try_convert_spec.rb b/spec/ruby/core/array/try_convert_spec.rb index 47b4722d80..bea8815006 100644 --- a/spec/ruby/core/array/try_convert_spec.rb +++ b/spec/ruby/core/array/try_convert_spec.rb @@ -39,7 +39,7 @@ describe "Array.try_convert" do it "sends #to_ary to the argument and raises TypeError if it's not a kind of Array" do obj = mock("to_ary") obj.should_receive(:to_ary).and_return(Object.new) - -> { Array.try_convert obj }.should raise_error(TypeError) + -> { Array.try_convert obj }.should raise_error(TypeError, "can't convert MockObject to Array (MockObject#to_ary gives Object)") end it "does not rescue exceptions raised by #to_ary" do diff --git a/spec/ruby/core/array/uniq_spec.rb b/spec/ruby/core/array/uniq_spec.rb index 5911c23e6a..d5d826db15 100644 --- a/spec/ruby/core/array/uniq_spec.rb +++ b/spec/ruby/core/array/uniq_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/iterable_and_tolerating_size_increasing' describe "Array#uniq" do it "returns an array with no duplicates" do @@ -39,76 +40,32 @@ describe "Array#uniq" do [x, y].uniq.should == [x, y] end - ruby_version_is '2.7' do - it "compares elements with matching hash codes with #eql?" do - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) + it "compares elements with matching hash codes with #eql?" do + a = Array.new(2) do + obj = mock('0') + obj.should_receive(:hash).at_least(1).and_return(0) - def obj.eql?(o) - false - end - - obj + def obj.eql?(o) + false end - a.uniq.should == a - - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - true - end - - obj - end - - a.uniq.size.should == 1 + obj end - end - ruby_version_is ''...'2.7' do - it "compares elements with matching hash codes with #eql?" do - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - # It's undefined whether the impl does a[0].eql?(a[1]) or - # a[1].eql?(a[0]) so we taint both. - taint - o.taint - false - end - - obj - end + a.uniq.should == a - a.uniq.should == a - a[0].should.tainted? - a[1].should.tainted? + a = Array.new(2) do + obj = mock('0') + obj.should_receive(:hash).at_least(1).and_return(0) - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - # It's undefined whether the impl does a[0].eql?(a[1]) or - # a[1].eql?(a[0]) so we taint both. - taint - o.taint - true - end - - obj + def obj.eql?(o) + true end - a.uniq.size.should == 1 - a[0].should.tainted? - a[1].should.tainted? + obj end + + a.uniq.size.should == 1 end it "compares elements based on the value returned from the block" do @@ -128,16 +85,8 @@ describe "Array#uniq" do [false, nil, 42].uniq { :bar }.should == [false] end - ruby_version_is ''...'3.0' do - it "returns subclass instance on Array subclasses" do - ArraySpecs::MyArray[1, 2, 3].uniq.should be_an_instance_of(ArraySpecs::MyArray) - end - end - - ruby_version_is '3.0' do - it "returns Array instance on Array subclasses" do - ArraySpecs::MyArray[1, 2, 3].uniq.should be_an_instance_of(Array) - end + it "returns Array instance on Array subclasses" do + ArraySpecs::MyArray[1, 2, 3].uniq.should be_an_instance_of(Array) end it "properly handles an identical item even when its #eql? isn't reflexive" do @@ -175,6 +124,11 @@ describe "Array#uniq" do end end +describe "Array#uniq" do + @value_to_return = -> e { e } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :uniq +end + describe "Array#uniq!" do it "modifies the array in place" do a = [ "a", "a", "b", "b", "c" ] @@ -258,4 +212,32 @@ describe "Array#uniq!" do a.uniq! a.should == [x] end + + it "does not truncate the array is the block raises an exception" do + a = [1, 2, 3] + begin + a.send(@method) { raise StandardError, 'Oops' } + rescue + end + + a.should == [1, 2, 3] + end + + it "doesn't change array if error is raised" do + a = [1, 1, 2, 2, 3, 3, 4, 4] + begin + a.send(@method) do |e| + raise StandardError, 'Oops' if e == 3 + e + end + rescue StandardError + end + + a.should == [1, 1, 2, 2, 3, 3, 4, 4] + end +end + +describe "Array#uniq!" do + @value_to_return = -> e { e } + it_behaves_like :array_iterable_and_tolerating_size_increasing, :uniq! end diff --git a/spec/ruby/core/array/values_at_spec.rb b/spec/ruby/core/array/values_at_spec.rb index f1522e0bfe..e85bbee400 100644 --- a/spec/ruby/core/array/values_at_spec.rb +++ b/spec/ruby/core/array/values_at_spec.rb @@ -1,6 +1,7 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +# Should be synchronized with core/struct/values_at_spec.rb describe "Array#values_at" do it "returns an array of elements at the indexes when passed indexes" do [1, 2, 3, 4, 5].values_at().should == [] @@ -66,10 +67,8 @@ describe "Array#values_at" do [1, 2, 3, 4].values_at(eval("(3...)")).should == [4] end - ruby_version_is "2.7" do - it "works when given beginless ranges" do - [1, 2, 3, 4].values_at(eval("(..2)")).should == [1, 2, 3] - [1, 2, 3, 4].values_at(eval("(...2)")).should == [1, 2] - end + it "works when given beginless ranges" do + [1, 2, 3, 4].values_at((..2)).should == [1, 2, 3] + [1, 2, 3, 4].values_at((...2)).should == [1, 2] end end diff --git a/spec/ruby/core/array/zip_spec.rb b/spec/ruby/core/array/zip_spec.rb index af4013debe..2a0f64cb49 100644 --- a/spec/ruby/core/array/zip_spec.rb +++ b/spec/ruby/core/array/zip_spec.rb @@ -62,4 +62,10 @@ describe "Array#zip" do it "does not return subclass instance on Array subclasses" do ArraySpecs::MyArray[1, 2, 3].zip(["a", "b"]).should be_an_instance_of(Array) end + + it "raises TypeError when some argument isn't Array and doesn't respond to #to_ary and #to_enum" do + -> { [1, 2, 3].zip(Object.new) }.should raise_error(TypeError, "wrong argument type Object (must respond to :each)") + -> { [1, 2, 3].zip(1) }.should raise_error(TypeError, "wrong argument type Integer (must respond to :each)") + -> { [1, 2, 3].zip(true) }.should raise_error(TypeError, "wrong argument type TrueClass (must respond to :each)") + end end diff --git a/spec/ruby/core/basicobject/fixtures/classes.rb b/spec/ruby/core/basicobject/fixtures/classes.rb index d1785afe31..ed5a2dda17 100644 --- a/spec/ruby/core/basicobject/fixtures/classes.rb +++ b/spec/ruby/core/basicobject/fixtures/classes.rb @@ -15,8 +15,231 @@ module BasicObjectSpecs include InstExec end - module InstEvalCVar - instance_eval { @@count = 2 } + module InstEval + module CVar + module Get + class ReceiverScope + @@cvar = :value_defined_in_receiver_scope + end + + class BlockDefinitionScope + @@cvar = :value_defined_in_block_definition_scope + + def block + -> * { @@cvar } + end + end + + class CallerScope + @@cvar = :value_defined_in_caller_scope + + def get_class_variable_with_string(obj) + obj.instance_eval("@@cvar") + end + + def get_class_variable_with_block(obj, block) + obj.instance_eval(&block) + end + end + + class CallerWithoutCVarScope + def get_class_variable_with_string(obj) + obj.instance_eval("@@cvar") + end + end + + ReceiverWithCVarDefinedInSingletonClass = Class.new.new.tap do |obj| + obj.singleton_class.class_variable_set(:@@cvar, :value_defined_in_receiver_singleton_class) + end + end + + module Set + class ReceiverScope + end + + class BlockDefinitionScope + def self.get_class_variable + @@cvar + end + + def block_to_assign(value) + -> * { @@cvar = value } + end + end + + class CallerScope + def self.get_class_variable + @@cvar + end + + def set_class_variable_with_string(obj, value) + obj.instance_eval("@@cvar=#{value.inspect}") + end + + def set_class_variable_with_block(obj, block) + obj.instance_eval(&block) + end + end + end + end + end + + module InstEval + module Constants + module ConstantInReceiverSingletonClass + module ReceiverScope + FOO = :ReceiverScope + + class ReceiverParent + FOO = :ReceiverParent + end + + class Receiver < ReceiverParent + FOO = :Receiver + + def initialize + self.singleton_class.const_set(:FOO, :singleton_class) + end + end + end + + module CallerScope + FOO = :CallerScope + + class CallerParent + FOO = :CallerParent + end + + class Caller < CallerParent + FOO = :Caller + + def get_constant_with_string(receiver) + receiver.instance_eval("FOO") + end + end + end + end + + module ConstantInReceiverClass + module ReceiverScope + FOO = :ReceiverScope + + class ReceiverParent + FOO = :ReceiverParent + end + + class Receiver < ReceiverParent + FOO = :Receiver + end + end + + module CallerScope + FOO = :CallerScope + + class CallerParent + FOO = :CallerParent + end + + class Caller < CallerParent + FOO = :Caller + + def get_constant_with_string(receiver) + receiver.instance_eval("FOO") + end + end + end + end + + module ConstantInCallerClass + module ReceiverScope + FOO = :ReceiverScope + + class ReceiverParent + FOO = :ReceiverParent + end + + class Receiver < ReceiverParent + # FOO is not declared in a receiver class + end + end + + module CallerScope + FOO = :CallerScope + + class CallerParent + FOO = :CallerParent + end + + class Caller < CallerParent + FOO = :Caller + + def get_constant_with_string(receiver) + receiver.instance_eval("FOO") + end + end + end + end + + module ConstantInCallerOuterScopes + module ReceiverScope + FOO = :ReceiverScope + + class ReceiverParent + FOO = :ReceiverParent + end + + class Receiver < ReceiverParent + # FOO is not declared in a receiver class + end + end + + module CallerScope + FOO = :CallerScope + + class CallerParent + FOO = :CallerParent + end + + class Caller < CallerParent + # FOO is not declared in a caller class + + def get_constant_with_string(receiver) + receiver.instance_eval("FOO") + end + end + end + end + + module ConstantInReceiverParentClass + module ReceiverScope + FOO = :ReceiverScope + + class ReceiverParent + FOO = :ReceiverParent + end + + class Receiver < ReceiverParent + # FOO is not declared in a receiver class + end + end + + module CallerScope + # FOO is not declared in a caller outer scopes + + class CallerParent + FOO = :CallerParent + end + + class Caller < CallerParent + # FOO is not declared in a caller class + + def get_constant_with_string(receiver) + receiver.instance_eval("FOO") + end + end + end + end + end end class InstEvalConst @@ -26,7 +249,6 @@ module BasicObjectSpecs module InstEvalOuter module Inner obj = InstEvalConst.new - X_BY_STR = obj.instance_eval("INST_EVAL_CONST_X") rescue nil X_BY_BLOCK = obj.instance_eval { INST_EVAL_CONST_X } rescue nil end end diff --git a/spec/ruby/core/basicobject/instance_eval_spec.rb b/spec/ruby/core/basicobject/instance_eval_spec.rb index b6a146095d..1f3a43f341 100644 --- a/spec/ruby/core/basicobject/instance_eval_spec.rb +++ b/spec/ruby/core/basicobject/instance_eval_spec.rb @@ -20,12 +20,18 @@ describe "BasicObject#instance_eval" do a.instance_eval('self').equal?(a).should be_true end - it "expects a block with no arguments" do - -> { "hola".instance_eval }.should raise_error(ArgumentError) + it "raises an ArgumentError when no arguments and no block are given" do + -> { "hola".instance_eval }.should raise_error(ArgumentError, "wrong number of arguments (given 0, expected 1..3)") end - it "takes no arguments with a block" do - -> { "hola".instance_eval(4, 5) {|a,b| a + b } }.should raise_error(ArgumentError) + it "raises an ArgumentError when a block and normal arguments are given" do + -> { "hola".instance_eval(4, 5) {|a,b| a + b } }.should raise_error(ArgumentError, "wrong number of arguments (given 2, expected 0)") + end + + it "raises an ArgumentError when more than 3 arguments are given" do + -> { + "hola".instance_eval("1 + 1", "some file", 0, "bogus") + }.should raise_error(ArgumentError, "wrong number of arguments (given 4, expected 1..3)") end it "yields the object to the block" do @@ -78,11 +84,30 @@ describe "BasicObject#instance_eval" do end + ruby_version_is "3.3" do + it "uses the caller location as default location" do + f = Object.new + f.instance_eval("[__FILE__, __LINE__]").should == ["(eval at #{__FILE__}:#{__LINE__})", 1] + end + end + it "has access to receiver's instance variables" do BasicObjectSpecs::IVars.new.instance_eval { @secret }.should == 99 BasicObjectSpecs::IVars.new.instance_eval("@secret").should == 99 end + it "raises TypeError for frozen objects when tries to set receiver's instance variables" do + -> { nil.instance_eval { @foo = 42 } }.should raise_error(FrozenError, "can't modify frozen NilClass: nil") + -> { true.instance_eval { @foo = 42 } }.should raise_error(FrozenError, "can't modify frozen TrueClass: true") + -> { false.instance_eval { @foo = 42 } }.should raise_error(FrozenError, "can't modify frozen FalseClass: false") + -> { 1.instance_eval { @foo = 42 } }.should raise_error(FrozenError, "can't modify frozen Integer: 1") + -> { :symbol.instance_eval { @foo = 42 } }.should raise_error(FrozenError, "can't modify frozen Symbol: :symbol") + + obj = Object.new + obj.freeze + -> { obj.instance_eval { @foo = 42 } }.should raise_error(FrozenError) + end + it "treats block-local variables as local to the block" do prc = instance_eval <<-CODE proc do |x, prc| @@ -99,11 +124,6 @@ describe "BasicObject#instance_eval" do prc.call(false, prc).should == 1 end - it "sets class variables in the receiver" do - BasicObjectSpecs::InstEvalCVar.class_variables.should include(:@@count) - BasicObjectSpecs::InstEvalCVar.send(:class_variable_get, :@@count).should == 2 - end - it "makes the receiver metaclass the scoped class when used with a string" do obj = Object.new obj.instance_eval %{ @@ -113,8 +133,52 @@ describe "BasicObject#instance_eval" do obj.singleton_class.const_get(:B).should be_an_instance_of(Class) end - it "gets constants in the receiver if a string given" do - BasicObjectSpecs::InstEvalOuter::Inner::X_BY_STR.should == 2 + describe "constants lookup when a String given" do + it "looks in the receiver singleton class first" do + receiver = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverSingletonClass::ReceiverScope::Receiver.new + caller = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverSingletonClass::CallerScope::Caller.new + + caller.get_constant_with_string(receiver).should == :singleton_class + end + + ruby_version_is ""..."3.1" do + it "looks in the caller scope next" do + receiver = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverClass::ReceiverScope::Receiver.new + caller = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverClass::CallerScope::Caller.new + + caller.get_constant_with_string(receiver).should == :Caller + end + end + + ruby_version_is "3.1" do + it "looks in the receiver class next" do + receiver = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverClass::ReceiverScope::Receiver.new + caller = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverClass::CallerScope::Caller.new + + caller.get_constant_with_string(receiver).should == :Receiver + end + end + + it "looks in the caller class next" do + receiver = BasicObjectSpecs::InstEval::Constants::ConstantInCallerClass::ReceiverScope::Receiver.new + caller = BasicObjectSpecs::InstEval::Constants::ConstantInCallerClass::CallerScope::Caller.new + + caller.get_constant_with_string(receiver).should == :Caller + end + + it "looks in the caller outer scopes next" do + receiver = BasicObjectSpecs::InstEval::Constants::ConstantInCallerOuterScopes::ReceiverScope::Receiver.new + caller = BasicObjectSpecs::InstEval::Constants::ConstantInCallerOuterScopes::CallerScope::Caller.new + + caller.get_constant_with_string(receiver).should == :CallerScope + end + + it "looks in the receiver class hierarchy next" do + receiver = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverParentClass::ReceiverScope::Receiver.new + caller = BasicObjectSpecs::InstEval::Constants::ConstantInReceiverParentClass::CallerScope::Caller.new + + caller.get_constant_with_string(receiver).should == :ReceiverParent + end end it "doesn't get constants in the receiver if a block given" do @@ -130,17 +194,51 @@ describe "BasicObject#instance_eval" do end.should raise_error(TypeError) end -quarantine! do # Not clean, leaves cvars lying around to break other specs - it "scopes class var accesses in the caller when called on an Integer" do - # Integer can take instance vars - Integer.class_eval "@@__tmp_instance_eval_spec = 1" - (defined? @@__tmp_instance_eval_spec).should be_nil + describe "class variables lookup" do + it "gets class variables in the caller class when called with a String" do + receiver = BasicObjectSpecs::InstEval::CVar::Get::ReceiverScope.new + caller = BasicObjectSpecs::InstEval::CVar::Get::CallerScope.new - @@__tmp_instance_eval_spec = 2 - 1.instance_eval { @@__tmp_instance_eval_spec }.should == 2 - Integer.__send__(:remove_class_variable, :@@__tmp_instance_eval_spec) + caller.get_class_variable_with_string(receiver).should == :value_defined_in_caller_scope + end + + it "gets class variables in the block definition scope when called with a block" do + receiver = BasicObjectSpecs::InstEval::CVar::Get::ReceiverScope.new + caller = BasicObjectSpecs::InstEval::CVar::Get::CallerScope.new + block = BasicObjectSpecs::InstEval::CVar::Get::BlockDefinitionScope.new.block + + caller.get_class_variable_with_block(receiver, block).should == :value_defined_in_block_definition_scope + end + + it "sets class variables in the caller class when called with a String" do + receiver = BasicObjectSpecs::InstEval::CVar::Set::ReceiverScope.new + caller = BasicObjectSpecs::InstEval::CVar::Set::CallerScope.new + + caller.set_class_variable_with_string(receiver, 1) + BasicObjectSpecs::InstEval::CVar::Set::CallerScope.get_class_variable.should == 1 + end + + it "sets class variables in the block definition scope when called with a block" do + receiver = BasicObjectSpecs::InstEval::CVar::Set::ReceiverScope.new + caller = BasicObjectSpecs::InstEval::CVar::Set::CallerScope.new + block = BasicObjectSpecs::InstEval::CVar::Set::BlockDefinitionScope.new.block_to_assign(1) + + caller.set_class_variable_with_block(receiver, block) + BasicObjectSpecs::InstEval::CVar::Set::BlockDefinitionScope.get_class_variable.should == 1 + end + + it "does not have access to class variables in the receiver class when called with a String" do + receiver = BasicObjectSpecs::InstEval::CVar::Get::ReceiverScope.new + caller = BasicObjectSpecs::InstEval::CVar::Get::CallerWithoutCVarScope.new + -> { caller.get_class_variable_with_string(receiver) }.should raise_error(NameError, /uninitialized class variable @@cvar/) + end + + it "does not have access to class variables in the receiver's singleton class when called with a String" do + receiver = BasicObjectSpecs::InstEval::CVar::Get::ReceiverWithCVarDefinedInSingletonClass + caller = BasicObjectSpecs::InstEval::CVar::Get::CallerWithoutCVarScope.new + -> { caller.get_class_variable_with_string(receiver) }.should raise_error(NameError, /uninitialized class variable @@cvar/) + end end -end it "raises a TypeError when defining methods on numerics" do -> do @@ -185,4 +283,58 @@ end x.should == :value end + + it "converts string argument with #to_str method" do + source_code = Object.new + def source_code.to_str() "1" end + + a = BasicObject.new + a.instance_eval(source_code).should == 1 + end + + it "raises ArgumentError if returned value is not String" do + source_code = Object.new + def source_code.to_str() :symbol end + + a = BasicObject.new + -> { a.instance_eval(source_code) }.should raise_error(TypeError, /can't convert Object to String/) + end + + it "converts filename argument with #to_str method" do + filename = Object.new + def filename.to_str() "file.rb" end + + err = begin + Object.new.instance_eval("raise", filename) + rescue => e + e + end + err.backtrace.first.split(":")[0].should == "file.rb" + end + + it "raises ArgumentError if returned value is not String" do + filename = Object.new + def filename.to_str() :symbol end + + -> { Object.new.instance_eval("raise", filename) }.should raise_error(TypeError, /can't convert Object to String/) + end + + it "converts lineno argument with #to_int method" do + lineno = Object.new + def lineno.to_int() 15 end + + err = begin + Object.new.instance_eval("raise", "file.rb", lineno) + rescue => e + e + end + err.backtrace.first.split(":")[1].should == "15" + end + + it "raises ArgumentError if returned value is not Integer" do + lineno = Object.new + def lineno.to_int() :symbol end + + -> { Object.new.instance_eval("raise", "file.rb", lineno) }.should raise_error(TypeError, /can't convert Object to Integer/) + end end diff --git a/spec/ruby/core/basicobject/method_missing_spec.rb b/spec/ruby/core/basicobject/method_missing_spec.rb index b048780ee8..a29d4375bc 100644 --- a/spec/ruby/core/basicobject/method_missing_spec.rb +++ b/spec/ruby/core/basicobject/method_missing_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/basicobject/method_missing' describe "BasicObject#method_missing" do diff --git a/spec/ruby/core/basicobject/singleton_method_added_spec.rb b/spec/ruby/core/basicobject/singleton_method_added_spec.rb index ab6b2a2d10..fc65a091aa 100644 --- a/spec/ruby/core/basicobject/singleton_method_added_spec.rb +++ b/spec/ruby/core/basicobject/singleton_method_added_spec.rb @@ -94,7 +94,7 @@ describe "BasicObject#singleton_method_added" do -> { def self.foo end - }.should raise_error(NoMethodError, /undefined method `singleton_method_added' for/) + }.should raise_error(NoMethodError, /undefined method [`']singleton_method_added' for/) end end @@ -106,16 +106,16 @@ describe "BasicObject#singleton_method_added" do -> { def foo end - }.should raise_error(NoMethodError, /undefined method `singleton_method_added' for #<Object:/) + }.should raise_error(NoMethodError, /undefined method [`']singleton_method_added' for #<Object:/) -> { define_method(:bar) {} - }.should raise_error(NoMethodError, /undefined method `singleton_method_added' for #<Object:/) + }.should raise_error(NoMethodError, /undefined method [`']singleton_method_added' for #<Object:/) end -> { object.define_singleton_method(:baz) {} - }.should raise_error(NoMethodError, /undefined method `singleton_method_added' for #<Object:/) + }.should raise_error(NoMethodError, /undefined method [`']singleton_method_added' for #<Object:/) end it "calls #method_missing" do diff --git a/spec/ruby/core/binding/clone_spec.rb b/spec/ruby/core/binding/clone_spec.rb index ebd40f5377..f1769ac6de 100644 --- a/spec/ruby/core/binding/clone_spec.rb +++ b/spec/ruby/core/binding/clone_spec.rb @@ -4,4 +4,10 @@ require_relative 'shared/clone' describe "Binding#clone" do it_behaves_like :binding_clone, :clone + + it "preserves frozen status" do + bind = binding.freeze + bind.frozen?.should == true + bind.clone.frozen?.should == true + end end diff --git a/spec/ruby/core/binding/dup_spec.rb b/spec/ruby/core/binding/dup_spec.rb index 43968213c8..55fac6e333 100644 --- a/spec/ruby/core/binding/dup_spec.rb +++ b/spec/ruby/core/binding/dup_spec.rb @@ -4,4 +4,10 @@ require_relative 'shared/clone' describe "Binding#dup" do it_behaves_like :binding_clone, :dup + + it "resets frozen status" do + bind = binding.freeze + bind.frozen?.should == true + bind.dup.frozen?.should == false + end end diff --git a/spec/ruby/core/binding/eval_spec.rb b/spec/ruby/core/binding/eval_spec.rb index b36bec799e..bb2036f739 100644 --- a/spec/ruby/core/binding/eval_spec.rb +++ b/spec/ruby/core/binding/eval_spec.rb @@ -23,58 +23,29 @@ describe "Binding#eval" do bind2.local_variables.should == [] end - ruby_version_is ""..."3.0" do - it "inherits __LINE__ from the enclosing scope" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - suppress_warning {bind.eval("__LINE__")}.should == obj.get_line_of_binding - end - - it "preserves __LINE__ across multiple calls to eval" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - suppress_warning {bind.eval("__LINE__")}.should == obj.get_line_of_binding - suppress_warning {bind.eval("__LINE__")}.should == obj.get_line_of_binding - end - - it "increments __LINE__ on each line of a multiline eval" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - suppress_warning {bind.eval("#foo\n__LINE__")}.should == obj.get_line_of_binding + 1 - end - - it "inherits __LINE__ from the enclosing scope even if the Binding is created with #send" do - obj = BindingSpecs::Demo.new(1) - bind, line = obj.get_binding_with_send_and_line - suppress_warning {bind.eval("__LINE__")}.should == line - end + it "starts with line 1 if single argument is given" do + obj = BindingSpecs::Demo.new(1) + bind = obj.get_binding + bind.eval("__LINE__").should == 1 end - ruby_version_is "3.0" do - it "starts with line 1 if single argument is given" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - bind.eval("__LINE__").should == 1 - end - - it "preserves __LINE__ across multiple calls to eval" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - bind.eval("__LINE__").should == 1 - bind.eval("__LINE__").should == 1 - end + it "preserves __LINE__ across multiple calls to eval" do + obj = BindingSpecs::Demo.new(1) + bind = obj.get_binding + bind.eval("__LINE__").should == 1 + bind.eval("__LINE__").should == 1 + end - it "increments __LINE__ on each line of a multiline eval" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - bind.eval("#foo\n__LINE__").should == 2 - end + it "increments __LINE__ on each line of a multiline eval" do + obj = BindingSpecs::Demo.new(1) + bind = obj.get_binding + bind.eval("#foo\n__LINE__").should == 2 + end - it "starts with line 1 if the Binding is created with #send" do - obj = BindingSpecs::Demo.new(1) - bind, line = obj.get_binding_with_send_and_line - bind.eval("__LINE__").should == 1 - end + it "starts with line 1 if the Binding is created with #send" do + obj = BindingSpecs::Demo.new(1) + bind, line = obj.get_binding_with_send_and_line + bind.eval("__LINE__").should == 1 end it "starts with a __LINE__ of 1 if a filename is passed" do @@ -89,20 +60,18 @@ describe "Binding#eval" do bind.eval("#foo\n__LINE__", "(test)", 88).should == 89 end - ruby_version_is ""..."3.0" do - it "inherits __FILE__ from the enclosing scope" do + ruby_version_is ""..."3.3" do + it "uses (eval) as __FILE__ if single argument given" do obj = BindingSpecs::Demo.new(1) bind = obj.get_binding - suppress_warning {bind.eval("__FILE__")}.should == obj.get_file_of_binding + bind.eval("__FILE__").should == '(eval)' end end - ruby_version_is "3.0" do - it "Uses (eval) as __FILE__ if single argument given" do - obj = BindingSpecs::Demo.new(1) - bind = obj.get_binding - bind.eval("__FILE__").should == '(eval)' - end + it "uses 1 as __LINE__" do + obj = BindingSpecs::Demo.new(1) + bind = obj.get_binding + suppress_warning { bind.eval("__LINE__") }.should == 1 end it "uses the __FILE__ that is passed in" do @@ -137,4 +106,10 @@ describe "Binding#eval" do bind.eval("'bar'.foo").should == "foo" end + + ruby_version_is "3.3" do + it "uses the caller location as default filename" do + binding.eval("[__FILE__, __LINE__]").should == ["(eval at #{__FILE__}:#{__LINE__})", 1] + end + end end diff --git a/spec/ruby/core/binding/fixtures/irbrc b/spec/ruby/core/binding/fixtures/irbrc deleted file mode 100644 index 2bc12af2f7..0000000000 --- a/spec/ruby/core/binding/fixtures/irbrc +++ /dev/null @@ -1 +0,0 @@ -# empty configuration diff --git a/spec/ruby/core/binding/irb_spec.rb b/spec/ruby/core/binding/irb_spec.rb index b3bc274f78..25521f0dd7 100644 --- a/spec/ruby/core/binding/irb_spec.rb +++ b/spec/ruby/core/binding/irb_spec.rb @@ -1,16 +1,19 @@ require_relative '../../spec_helper' +require 'tmpdir' describe "Binding#irb" do it "creates an IRB session with the binding in scope" do irb_fixture = fixture __FILE__, "irb.rb" - irbrc_fixture = fixture __FILE__, "irbrc" + envs = %w[IRBRC HOME XDG_CONFIG_HOME].to_h {|e| [e, nil]} - out = IO.popen([{"IRBRC"=>irbrc_fixture}, *ruby_exe, irb_fixture], "r+") do |pipe| - pipe.puts "a ** 2" - pipe.puts "exit" - pipe.readlines.map(&:chomp) + out = Dir.mktmpdir do |dir| + IO.popen([envs, *ruby_exe, irb_fixture, chdir: dir], "r+") do |pipe| + pipe.puts "a ** 2" + pipe.puts "exit" + pipe.readlines.map(&:chomp) + end end - out[-3..-1].should == ["a ** 2", "100", "exit"] + out.last(3).should == ["a ** 2", "100", "exit"] end end diff --git a/spec/ruby/core/binding/shared/clone.rb b/spec/ruby/core/binding/shared/clone.rb index 0e934ac1b5..1224b8ec7d 100644 --- a/spec/ruby/core/binding/shared/clone.rb +++ b/spec/ruby/core/binding/shared/clone.rb @@ -31,4 +31,26 @@ describe :binding_clone, shared: true do b2.local_variable_defined?(:x).should == false end end + + ruby_version_is "3.4" do + it "copies instance variables" do + @b1.instance_variable_set(:@ivar, 1) + cl = @b1.send(@method) + cl.instance_variables.should == [:@ivar] + end + + it "copies the finalizer" do + code = <<-RUBY + obj = binding + + ObjectSpace.define_finalizer(obj, Proc.new { STDOUT.write "finalized\n" }) + + obj.clone + + exit 0 + RUBY + + ruby_exe(code).lines.sort.should == ["finalized\n", "finalized\n"] + end + end end diff --git a/spec/ruby/core/binding/source_location_spec.rb b/spec/ruby/core/binding/source_location_spec.rb index d439c3e399..d1c8191ea8 100644 --- a/spec/ruby/core/binding/source_location_spec.rb +++ b/spec/ruby/core/binding/source_location_spec.rb @@ -6,4 +6,9 @@ describe "Binding#source_location" do b = BindingSpecs::LocationMethod::TEST_BINDING b.source_location.should == [BindingSpecs::LocationMethod::FILE_PATH, 4] end + + it "works for eval with a given line" do + b = eval('binding', nil, "foo", 100) + b.source_location.should == ["foo", 100] + end end diff --git a/spec/ruby/core/builtin_constants/builtin_constants_spec.rb b/spec/ruby/core/builtin_constants/builtin_constants_spec.rb index 7c87a970d7..1960f5721f 100644 --- a/spec/ruby/core/builtin_constants/builtin_constants_spec.rb +++ b/spec/ruby/core/builtin_constants/builtin_constants_spec.rb @@ -34,12 +34,6 @@ describe "RUBY_PLATFORM" do it "is a String" do RUBY_PLATFORM.should be_kind_of(String) end - - platform_is :darwin do - it 'ends with the build time kernel major version on darwin' do - RUBY_PLATFORM.should =~ /-darwin\d+$/ - end - end end describe "RUBY_RELEASE_DATE" do @@ -49,15 +43,7 @@ describe "RUBY_RELEASE_DATE" do end describe "RUBY_REVISION" do - ruby_version_is ""..."2.7" do - it "is an Integer" do - RUBY_REVISION.should be_kind_of(Integer) - end - end - - ruby_version_is "2.7" do - it "is a String" do - RUBY_REVISION.should be_kind_of(String) - end + it "is a String" do + RUBY_REVISION.should be_kind_of(String) end end diff --git a/spec/ruby/core/class/attached_object_spec.rb b/spec/ruby/core/class/attached_object_spec.rb new file mode 100644 index 0000000000..f1c0f63a44 --- /dev/null +++ b/spec/ruby/core/class/attached_object_spec.rb @@ -0,0 +1,31 @@ +require_relative '../../spec_helper' + +ruby_version_is '3.2' do + describe "Class#attached_object" do + it "returns the object that is attached to a singleton class" do + a = Class.new + + a_obj = a.new + a_obj.singleton_class.attached_object.should == a_obj + end + + it "returns the class object that is attached to a class's singleton class" do + a = Class.new + singleton_class = (class << a; self; end) + + singleton_class.attached_object.should == a + end + + it "raises TypeError if the class is not a singleton class" do + a = Class.new + + -> { a.attached_object }.should raise_error(TypeError, /is not a singleton class/) + end + + it "raises TypeError for special singleton classes" do + -> { nil.singleton_class.attached_object }.should raise_error(TypeError, /[`']NilClass' is not a singleton class/) + -> { true.singleton_class.attached_object }.should raise_error(TypeError, /[`']TrueClass' is not a singleton class/) + -> { false.singleton_class.attached_object }.should raise_error(TypeError, /[`']FalseClass' is not a singleton class/) + end + end +end diff --git a/spec/ruby/core/class/dup_spec.rb b/spec/ruby/core/class/dup_spec.rb index 701fd72e19..c09ed71b31 100644 --- a/spec/ruby/core/class/dup_spec.rb +++ b/spec/ruby/core/class/dup_spec.rb @@ -61,4 +61,7 @@ describe "Class#dup" do CoreClassSpecs::RecordCopy.name.should == "CoreClassSpecs::RecordCopy" end + it "raises TypeError if called on BasicObject" do + -> { BasicObject.dup }.should raise_error(TypeError, "can't copy the root class") + end end diff --git a/spec/ruby/core/class/subclasses_spec.rb b/spec/ruby/core/class/subclasses_spec.rb new file mode 100644 index 0000000000..50eb5358d9 --- /dev/null +++ b/spec/ruby/core/class/subclasses_spec.rb @@ -0,0 +1,87 @@ +require_relative '../../spec_helper' +require_relative '../module/fixtures/classes' + +ruby_version_is '3.1' do + describe "Class#subclasses" do + it "returns a list of classes directly inheriting from self" do + assert_subclasses(ModuleSpecs::Parent, [ModuleSpecs::Child, ModuleSpecs::Child2]) + end + + it "does not return included modules from the parent" do + parent = Class.new + child = Class.new(parent) + mod = Module.new + parent.include(mod) + + assert_subclasses(parent, [child]) + end + + it "does not return included modules from the child" do + parent = Class.new + child = Class.new(parent) + mod = Module.new + parent.include(mod) + + assert_subclasses(parent, [child]) + end + + it "does not return prepended modules from the parent" do + parent = Class.new + child = Class.new(parent) + mod = Module.new + parent.prepend(mod) + + assert_subclasses(parent, [child]) + end + + it "does not return prepended modules from the child" do + parent = Class.new + child = Class.new(parent) + mod = Module.new + child.prepend(mod) + + assert_subclasses(parent, [child]) + end + + it "does not return singleton classes" do + a = Class.new + + a_obj = a.new + def a_obj.force_singleton_class + 42 + end + + a.subclasses.should_not include(a_obj.singleton_class) + end + + it "has 1 entry per module or class" do + ModuleSpecs::Parent.subclasses.should == ModuleSpecs::Parent.subclasses.uniq + end + + it "works when creating subclasses concurrently" do + t = 16 + n = 1000 + go = false + superclass = Class.new + + threads = t.times.map do + Thread.new do + Thread.pass until go + n.times.map do + Class.new(superclass) + end + end + end + + go = true + classes = threads.map(&:value) + + superclass.subclasses.size.should == t * n + superclass.subclasses.each { |c| c.should be_kind_of(Class) } + end + + def assert_subclasses(mod,subclasses) + mod.subclasses.sort_by(&:inspect).should == subclasses.sort_by(&:inspect) + end + end +end diff --git a/spec/ruby/core/comparable/clamp_spec.rb b/spec/ruby/core/comparable/clamp_spec.rb index 393496fc76..796d4a18c1 100644 --- a/spec/ruby/core/comparable/clamp_spec.rb +++ b/spec/ruby/core/comparable/clamp_spec.rb @@ -2,14 +2,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe 'Comparable#clamp' do - ruby_version_is ""..."2.7" do - it 'raises an Argument error unless given 2 parameters' do - c = ComparableSpecs::Weird.new(0) - -> { c.clamp(c) }.should raise_error(ArgumentError) - -> { c.clamp(c, c, c) }.should raise_error(ArgumentError) - end - end - it 'raises an Argument error unless the 2 parameters are correctly ordered' do one = ComparableSpecs::WithOnlyCompareDefined.new(1) two = ComparableSpecs::WithOnlyCompareDefined.new(2) @@ -48,41 +40,39 @@ describe 'Comparable#clamp' do c.clamp(one, two).should equal(two) end - ruby_version_is "2.7" do - it 'returns self if within the given range parameters' do - one = ComparableSpecs::WithOnlyCompareDefined.new(1) - two = ComparableSpecs::WithOnlyCompareDefined.new(2) - three = ComparableSpecs::WithOnlyCompareDefined.new(3) - c = ComparableSpecs::Weird.new(2) - - c.clamp(one..two).should equal(c) - c.clamp(two..two).should equal(c) - c.clamp(one..three).should equal(c) - c.clamp(two..three).should equal(c) - end - - it 'returns the minimum value of the range parameters if smaller than it' do - one = ComparableSpecs::WithOnlyCompareDefined.new(1) - two = ComparableSpecs::WithOnlyCompareDefined.new(2) - c = ComparableSpecs::Weird.new(0) - - c.clamp(one..two).should equal(one) - end - - it 'returns the maximum value of the range parameters if greater than it' do - one = ComparableSpecs::WithOnlyCompareDefined.new(1) - two = ComparableSpecs::WithOnlyCompareDefined.new(2) - c = ComparableSpecs::Weird.new(3) - - c.clamp(one..two).should equal(two) - end - - it 'raises an Argument error if the range parameter is exclusive' do - one = ComparableSpecs::WithOnlyCompareDefined.new(1) - two = ComparableSpecs::WithOnlyCompareDefined.new(2) - c = ComparableSpecs::Weird.new(3) - - -> { c.clamp(one...two) }.should raise_error(ArgumentError) - end + it 'returns self if within the given range parameters' do + one = ComparableSpecs::WithOnlyCompareDefined.new(1) + two = ComparableSpecs::WithOnlyCompareDefined.new(2) + three = ComparableSpecs::WithOnlyCompareDefined.new(3) + c = ComparableSpecs::Weird.new(2) + + c.clamp(one..two).should equal(c) + c.clamp(two..two).should equal(c) + c.clamp(one..three).should equal(c) + c.clamp(two..three).should equal(c) + end + + it 'returns the minimum value of the range parameters if smaller than it' do + one = ComparableSpecs::WithOnlyCompareDefined.new(1) + two = ComparableSpecs::WithOnlyCompareDefined.new(2) + c = ComparableSpecs::Weird.new(0) + + c.clamp(one..two).should equal(one) + end + + it 'returns the maximum value of the range parameters if greater than it' do + one = ComparableSpecs::WithOnlyCompareDefined.new(1) + two = ComparableSpecs::WithOnlyCompareDefined.new(2) + c = ComparableSpecs::Weird.new(3) + + c.clamp(one..two).should equal(two) + end + + it 'raises an Argument error if the range parameter is exclusive' do + one = ComparableSpecs::WithOnlyCompareDefined.new(1) + two = ComparableSpecs::WithOnlyCompareDefined.new(2) + c = ComparableSpecs::Weird.new(3) + + -> { c.clamp(one...two) }.should raise_error(ArgumentError) end end diff --git a/spec/ruby/core/complex/comparision_spec.rb b/spec/ruby/core/complex/comparision_spec.rb deleted file mode 100644 index 2a437afb71..0000000000 --- a/spec/ruby/core/complex/comparision_spec.rb +++ /dev/null @@ -1,27 +0,0 @@ -require_relative '../../spec_helper' - -describe "Complex#<=>" do - ruby_version_is "2.7" do - it "returns nil if either self or argument has imaginary part" do - (Complex(5, 1) <=> Complex(2)).should be_nil - (Complex(1) <=> Complex(2, 1)).should be_nil - (5 <=> Complex(2, 1)).should be_nil - end - - it "returns nil if argument is not numeric" do - (Complex(5, 1) <=> "cmp").should be_nil - (Complex(1) <=> "cmp").should be_nil - (Complex(1) <=> Object.new).should be_nil - end - - it "returns 0, 1, or -1 if self and argument do not have imaginary part" do - (Complex(5) <=> Complex(2)).should == 1 - (Complex(2) <=> Complex(3)).should == -1 - (Complex(2) <=> Complex(2)).should == 0 - - (Complex(5) <=> 2).should == 1 - (Complex(2) <=> 3).should == -1 - (Complex(2) <=> 2).should == 0 - end - end -end diff --git a/spec/ruby/core/complex/comparison_spec.rb b/spec/ruby/core/complex/comparison_spec.rb new file mode 100644 index 0000000000..3a3142f234 --- /dev/null +++ b/spec/ruby/core/complex/comparison_spec.rb @@ -0,0 +1,25 @@ +require_relative '../../spec_helper' + +describe "Complex#<=>" do + it "returns nil if either self or argument has imaginary part" do + (Complex(5, 1) <=> Complex(2)).should be_nil + (Complex(1) <=> Complex(2, 1)).should be_nil + (5 <=> Complex(2, 1)).should be_nil + end + + it "returns nil if argument is not numeric" do + (Complex(5, 1) <=> "cmp").should be_nil + (Complex(1) <=> "cmp").should be_nil + (Complex(1) <=> Object.new).should be_nil + end + + it "returns 0, 1, or -1 if self and argument do not have imaginary part" do + (Complex(5) <=> Complex(2)).should == 1 + (Complex(2) <=> Complex(3)).should == -1 + (Complex(2) <=> Complex(2)).should == 0 + + (Complex(5) <=> 2).should == 1 + (Complex(2) <=> 3).should == -1 + (Complex(2) <=> 2).should == 0 + end +end diff --git a/spec/ruby/core/complex/inspect_spec.rb b/spec/ruby/core/complex/inspect_spec.rb index 71aabde5be..045be94b22 100644 --- a/spec/ruby/core/complex/inspect_spec.rb +++ b/spec/ruby/core/complex/inspect_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative '../numeric/fixtures/classes' describe "Complex#inspect" do it "returns (${real}+${image}i) for positive imaginary parts" do @@ -13,4 +14,24 @@ describe "Complex#inspect" do Complex(-1, -4).inspect.should == "(-1-4i)" Complex(-7, -6.7).inspect.should == "(-7-6.7i)" end + + it "calls #inspect on real and imaginary" do + real = NumericSpecs::Subclass.new + # + because of https://bugs.ruby-lang.org/issues/20337 + real.should_receive(:inspect).and_return(+"1") + imaginary = NumericSpecs::Subclass.new + imaginary.should_receive(:inspect).and_return("2") + imaginary.should_receive(:<).any_number_of_times.and_return(false) + Complex(real, imaginary).inspect.should == "(1+2i)" + end + + it "adds an `*' before the `i' if the last character of the imaginary part is not numeric" do + real = NumericSpecs::Subclass.new + # + because of https://bugs.ruby-lang.org/issues/20337 + real.should_receive(:inspect).and_return(+"(1)") + imaginary = NumericSpecs::Subclass.new + imaginary.should_receive(:inspect).and_return("(2)") + imaginary.should_receive(:<).any_number_of_times.and_return(false) + Complex(real, imaginary).inspect.should == "((1)+(2)*i)" + end end diff --git a/spec/ruby/core/complex/polar_spec.rb b/spec/ruby/core/complex/polar_spec.rb index 2a5d8ebd69..3bb3751bc6 100644 --- a/spec/ruby/core/complex/polar_spec.rb +++ b/spec/ruby/core/complex/polar_spec.rb @@ -10,6 +10,22 @@ describe "Complex.polar" do ->{ Complex.polar(nil) }.should raise_error(TypeError) ->{ Complex.polar(nil, nil) }.should raise_error(TypeError) end + + ruby_bug "#19004", ""..."3.2" do + it "computes the real values of the real & imaginary parts from the polar form" do + a = Complex.polar(1.0+0.0i, Math::PI/2+0.0i) + a.real.should be_close(0.0, TOLERANCE) + a.imag.should be_close(1.0, TOLERANCE) + a.real.real?.should be_true + a.imag.real?.should be_true + + b = Complex.polar(1+0.0i) + b.real.should be_close(1.0, TOLERANCE) + b.imag.should be_close(0.0, TOLERANCE) + b.real.real?.should be_true + b.imag.real?.should be_true + end + end end describe "Complex#polar" do diff --git a/spec/ruby/core/complex/to_r_spec.rb b/spec/ruby/core/complex/to_r_spec.rb index 4559921492..788027a500 100644 --- a/spec/ruby/core/complex/to_r_spec.rb +++ b/spec/ruby/core/complex/to_r_spec.rb @@ -34,8 +34,16 @@ describe "Complex#to_r" do end describe "when the imaginary part is Float 0.0" do - it "raises RangeError" do - -> { Complex(0, 0.0).to_r }.should raise_error(RangeError) + ruby_version_is ''...'3.4' do + it "raises RangeError" do + -> { Complex(0, 0.0).to_r }.should raise_error(RangeError) + end + end + + ruby_version_is '3.4' do + it "returns a Rational" do + Complex(0, 0.0).to_r.should == 0r + end end end end diff --git a/spec/ruby/core/complex/to_s_spec.rb b/spec/ruby/core/complex/to_s_spec.rb index 989a7ae0b7..ceccffe470 100644 --- a/spec/ruby/core/complex/to_s_spec.rb +++ b/spec/ruby/core/complex/to_s_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative '../numeric/fixtures/classes' describe "Complex#to_s" do describe "when self's real component is 0" do @@ -41,4 +42,14 @@ describe "Complex#to_s" do it "returns 1+NaN*i for Complex(1, NaN)" do Complex(1, nan_value).to_s.should == "1+NaN*i" end + + it "treats real and imaginary parts as strings" do + real = NumericSpecs::Subclass.new + # + because of https://bugs.ruby-lang.org/issues/20337 + real.should_receive(:to_s).and_return(+"1") + imaginary = NumericSpecs::Subclass.new + imaginary.should_receive(:to_s).and_return("2") + imaginary.should_receive(:<).any_number_of_times.and_return(false) + Complex(real, imaginary).to_s.should == "1+2i" + end end diff --git a/spec/ruby/core/conditionvariable/broadcast_spec.rb b/spec/ruby/core/conditionvariable/broadcast_spec.rb new file mode 100644 index 0000000000..55a7b89c72 --- /dev/null +++ b/spec/ruby/core/conditionvariable/broadcast_spec.rb @@ -0,0 +1,39 @@ +require_relative '../../spec_helper' + +describe "ConditionVariable#broadcast" do + it "releases all threads waiting in line for this resource" do + m = Mutex.new + cv = ConditionVariable.new + threads = [] + r1 = [] + r2 = [] + + # large number to attempt to cause race conditions + 100.times do |i| + threads << Thread.new(i) do |tid| + m.synchronize do + r1 << tid + cv.wait(m) + r2 << tid + end + end + end + + # wait for all threads to acquire the mutex the first time + Thread.pass until m.synchronize { r1.size == threads.size } + # wait until all threads are sleeping (ie waiting) + Thread.pass until threads.all?(&:stop?) + + r2.should be_empty + m.synchronize do + cv.broadcast + end + + threads.each {|t| t.join } + + # ensure that all threads that enter cv.wait are released + r2.sort.should == r1.sort + # note that order is not specified as broadcast results in a race + # condition on regaining the lock m + end +end diff --git a/spec/ruby/core/conditionvariable/marshal_dump_spec.rb b/spec/ruby/core/conditionvariable/marshal_dump_spec.rb new file mode 100644 index 0000000000..88b1cc38c1 --- /dev/null +++ b/spec/ruby/core/conditionvariable/marshal_dump_spec.rb @@ -0,0 +1,8 @@ +require_relative '../../spec_helper' + +describe "ConditionVariable#marshal_dump" do + it "raises a TypeError" do + cv = ConditionVariable.new + -> { cv.marshal_dump }.should raise_error(TypeError, /can't dump/) + end +end diff --git a/spec/ruby/core/conditionvariable/signal_spec.rb b/spec/ruby/core/conditionvariable/signal_spec.rb new file mode 100644 index 0000000000..43a9cc611b --- /dev/null +++ b/spec/ruby/core/conditionvariable/signal_spec.rb @@ -0,0 +1,76 @@ +require_relative '../../spec_helper' + +describe "ConditionVariable#signal" do + it "releases the first thread waiting in line for this resource" do + m = Mutex.new + cv = ConditionVariable.new + threads = [] + r1 = [] + r2 = [] + + # large number to attempt to cause race conditions + 100.times do |i| + threads << Thread.new(i) do |tid| + m.synchronize do + r1 << tid + cv.wait(m) + r2 << tid + end + end + end + + # wait for all threads to acquire the mutex the first time + Thread.pass until m.synchronize { r1.size == threads.size } + # wait until all threads are sleeping (ie waiting) + Thread.pass until threads.all?(&:stop?) + + r2.should be_empty + 100.times do |i| + m.synchronize do + cv.signal + end + Thread.pass until r2.size == i+1 + end + + threads.each {|t| t.join } + + # ensure that all the threads that went into the cv.wait are + # released in the same order + r2.should == r1 + end + + it "allows control to be passed between a pair of threads" do + m = Mutex.new + cv = ConditionVariable.new + repeats = 100 + in_synchronize = false + + t1 = Thread.new do + m.synchronize do + in_synchronize = true + repeats.times do + cv.wait(m) + cv.signal + end + end + end + + # Make sure t1 is waiting for a signal before launching t2. + Thread.pass until in_synchronize + Thread.pass until t1.stop? + + t2 = Thread.new do + m.synchronize do + repeats.times do + cv.signal + cv.wait(m) + end + end + end + + # Check that both threads terminated without exception + t1.join + t2.join + m.should_not.locked? + end +end diff --git a/spec/ruby/core/conditionvariable/wait_spec.rb b/spec/ruby/core/conditionvariable/wait_spec.rb new file mode 100644 index 0000000000..fe73e513c0 --- /dev/null +++ b/spec/ruby/core/conditionvariable/wait_spec.rb @@ -0,0 +1,174 @@ +require_relative '../../spec_helper' + +describe "ConditionVariable#wait" do + it "calls #sleep on the given object" do + o = Object.new + o.should_receive(:sleep).with(1234) + + cv = ConditionVariable.new + + cv.wait(o, 1234) + end + + it "can be woken up by ConditionVariable#signal" do + m = Mutex.new + cv = ConditionVariable.new + in_synchronize = false + + th = Thread.new do + m.synchronize do + in_synchronize = true + cv.wait(m) + end + :success + end + + # wait for m to acquire the mutex + Thread.pass until in_synchronize + # wait until th is sleeping (ie waiting) + Thread.pass until th.stop? + + m.synchronize { cv.signal } + th.value.should == :success + end + + it "can be interrupted by Thread#run" do + m = Mutex.new + cv = ConditionVariable.new + in_synchronize = false + + th = Thread.new do + m.synchronize do + in_synchronize = true + cv.wait(m) + end + :success + end + + # wait for m to acquire the mutex + Thread.pass until in_synchronize + # wait until th is sleeping (ie waiting) + Thread.pass until th.stop? + + th.run + th.value.should == :success + end + + it "can be interrupted by Thread#wakeup" do + m = Mutex.new + cv = ConditionVariable.new + in_synchronize = false + + th = Thread.new do + m.synchronize do + in_synchronize = true + cv.wait(m) + end + :success + end + + # wait for m to acquire the mutex + Thread.pass until in_synchronize + # wait until th is sleeping (ie waiting) + Thread.pass until th.stop? + + th.wakeup + th.value.should == :success + end + + it "reacquires the lock even if the thread is killed" do + m = Mutex.new + cv = ConditionVariable.new + in_synchronize = false + owned = nil + + th = Thread.new do + m.synchronize do + in_synchronize = true + begin + cv.wait(m) + ensure + owned = m.owned? + $stderr.puts "\nThe Thread doesn't own the Mutex!" unless owned + end + end + end + + # wait for m to acquire the mutex + Thread.pass until in_synchronize + # wait until th is sleeping (ie waiting) + Thread.pass until th.stop? + + th.kill + th.join + + owned.should == true + end + + it "reacquires the lock even if the thread is killed after being signaled" do + m = Mutex.new + cv = ConditionVariable.new + in_synchronize = false + owned = nil + + th = Thread.new do + m.synchronize do + in_synchronize = true + begin + cv.wait(m) + ensure + owned = m.owned? + $stderr.puts "\nThe Thread doesn't own the Mutex!" unless owned + end + end + end + + # wait for m to acquire the mutex + Thread.pass until in_synchronize + # wait until th is sleeping (ie waiting) + Thread.pass until th.stop? + + m.synchronize { + cv.signal + # Wait that the thread is blocked on acquiring the Mutex + sleep 0.001 + # Kill the thread, yet the thread should first acquire the Mutex before going on + th.kill + } + + th.join + owned.should == true + end + + it "supports multiple Threads waiting on the same ConditionVariable and Mutex" do + m = Mutex.new + cv = ConditionVariable.new + n_threads = 4 + events = [] + + threads = n_threads.times.map { + Thread.new { + m.synchronize { + events << :t_in_synchronize + cv.wait(m) + } + } + } + + Thread.pass until m.synchronize { events.size } == n_threads + Thread.pass until threads.any?(&:stop?) + m.synchronize do + threads.each { |t| + # Cause interactions with the waiting threads. + # On TruffleRuby, this causes a safepoint which has interesting + # interactions with the ConditionVariable. + bt = t.backtrace + bt.should be_kind_of(Array) + bt.size.should >= 2 + } + end + + cv.broadcast + threads.each(&:join) + end +end diff --git a/spec/ruby/core/data/constants_spec.rb b/spec/ruby/core/data/constants_spec.rb index 1d469f9237..2eb43d501e 100644 --- a/spec/ruby/core/data/constants_spec.rb +++ b/spec/ruby/core/data/constants_spec.rb @@ -1,23 +1,21 @@ require_relative '../../spec_helper' -ruby_version_is ''...'3.0' do +ruby_version_is ''...'3.2' do describe "Data" do - it "is a subclass of Object" do - suppress_warning do - Data.superclass.should == Object - end - end - - it "is deprecated" do - -> { Data }.should complain(/constant ::Data is deprecated/) + it "does not exist anymore" do + Object.should_not have_constant(:Data) end end end -ruby_version_is '3.0' do +ruby_version_is '3.2' do describe "Data" do - it "does not exist anymore" do - Object.should_not have_constant(:Data) + it "is a new constant" do + Data.superclass.should == Object + end + + it "is not deprecated" do + -> { Data }.should_not complain end end end diff --git a/spec/ruby/core/data/define_spec.rb b/spec/ruby/core/data/define_spec.rb new file mode 100644 index 0000000000..2aa2c50d4c --- /dev/null +++ b/spec/ruby/core/data/define_spec.rb @@ -0,0 +1,36 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is "3.2" do + describe "Data.define" do + it "accepts no arguments" do + empty_data = Data.define + empty_data.members.should == [] + end + + it "accepts symbols" do + movie = Data.define(:title, :year) + movie.members.should == [:title, :year] + end + + it "accepts strings" do + movie = Data.define("title", "year") + movie.members.should == [:title, :year] + end + + it "accepts a mix of strings and symbols" do + movie = Data.define("title", :year, "genre") + movie.members.should == [:title, :year, :genre] + end + + it "accepts a block" do + movie = Data.define(:title, :year) do + def title_with_year + "#{title} (#{year})" + end + end + movie.members.should == [:title, :year] + movie.new("Matrix", 1999).title_with_year.should == "Matrix (1999)" + end + end +end diff --git a/spec/ruby/core/data/fixtures/classes.rb b/spec/ruby/core/data/fixtures/classes.rb new file mode 100644 index 0000000000..46a6b48bb2 --- /dev/null +++ b/spec/ruby/core/data/fixtures/classes.rb @@ -0,0 +1,5 @@ +module DataSpecs + guard -> { ruby_version_is "3.2" and Data.respond_to?(:define) } do + Measure = Data.define(:amount, :unit) + end +end diff --git a/spec/ruby/core/data/initialize_spec.rb b/spec/ruby/core/data/initialize_spec.rb new file mode 100644 index 0000000000..2c36bd3ac4 --- /dev/null +++ b/spec/ruby/core/data/initialize_spec.rb @@ -0,0 +1,65 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is "3.2" do + describe "Data#initialize" do + it "accepts positional arguments" do + data = DataSpecs::Measure.new(42, "km") + + data.amount.should == 42 + data.unit.should == "km" + end + + it "accepts alternative positional arguments" do + data = DataSpecs::Measure[42, "km"] + + data.amount.should == 42 + data.unit.should == "km" + end + + it "accepts keyword arguments" do + data = DataSpecs::Measure.new(amount: 42, unit: "km") + + data.amount.should == 42 + data.unit.should == "km" + end + + it "accepts alternative keyword arguments" do + data = DataSpecs::Measure[amount: 42, unit: "km"] + + data.amount.should == 42 + data.unit.should == "km" + end + + it "accepts String keyword arguments" do + data = DataSpecs::Measure.new("amount" => 42, "unit" => "km") + + data.amount.should == 42 + data.unit.should == "km" + end + + it "raises ArgumentError if no arguments are given" do + -> { + DataSpecs::Measure.new + }.should raise_error(ArgumentError) { |e| + e.message.should.include?("missing keywords: :amount, :unit") + } + end + + it "raises ArgumentError if at least one argument is missing" do + -> { + DataSpecs::Measure.new(unit: "km") + }.should raise_error(ArgumentError) { |e| + e.message.should.include?("missing keyword: :amount") + } + end + + it "raises ArgumentError if unknown keyword is given" do + -> { + DataSpecs::Measure.new(amount: 42, unit: "km", system: "metric") + }.should raise_error(ArgumentError) { |e| + e.message.should.include?("unknown keyword: :system") + } + end + end +end diff --git a/spec/ruby/core/data/with_spec.rb b/spec/ruby/core/data/with_spec.rb new file mode 100644 index 0000000000..97e34c951f --- /dev/null +++ b/spec/ruby/core/data/with_spec.rb @@ -0,0 +1,35 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is "3.2" do + describe "Data#with" do + it "returns self if given no arguments" do + data = DataSpecs::Measure.new(amount: 42, unit: "km") + data = data.with.should.equal?(data) + end + + it "accepts keyword arguments" do + data = DataSpecs::Measure.new(amount: 42, unit: "km") + data = data.with(amount: 4, unit: "m") + + data.amount.should == 4 + data.unit.should == "m" + end + + it "accepts String keyword arguments" do + data = DataSpecs::Measure.new(amount: 42, unit: "km") + data = data.with("amount" => 4, "unit" => "m") + + data.amount.should == 4 + data.unit.should == "m" + end + + it "raises ArgumentError if no keyword arguments are given" do + data = DataSpecs::Measure.new(amount: 42, unit: "km") + + -> { + data.with(4, "m") + }.should raise_error(ArgumentError, "wrong number of arguments (given 2, expected 0)") + end + end +end diff --git a/spec/ruby/core/dir/children_spec.rb b/spec/ruby/core/dir/children_spec.rb index 986c8f38c0..0ad3df4669 100644 --- a/spec/ruby/core/dir/children_spec.rb +++ b/spec/ruby/core/dir/children_spec.rb @@ -47,7 +47,7 @@ describe "Dir.children" do encoding = Encoding.find("filesystem") encoding = Encoding::BINARY if encoding == Encoding::US_ASCII platform_is_not :windows do - children.should include("ã“ã‚“ã«ã¡ã¯.txt".force_encoding(encoding)) + children.should include("ã“ã‚“ã«ã¡ã¯.txt".dup.force_encoding(encoding)) end children.first.encoding.should equal(Encoding.find("filesystem")) end @@ -105,14 +105,6 @@ describe "Dir#children" do dirs.each { |d| d.encoding.should == Encoding::UTF_8 } end - ruby_version_is ""..."2.7" do - it "accepts nil options" do - @dir = Dir.new("#{DirSpecs.mock_dir}/deeply/nested", nil) - dirs = @dir.to_a.sort - dirs.each { |d| d.encoding.should == Encoding.find("filesystem") } - end - end - it "returns children encoded with the filesystem encoding by default" do # This spec depends on the locale not being US-ASCII because if it is, the # children that are not ascii_only? will be BINARY encoded. @@ -121,7 +113,7 @@ describe "Dir#children" do encoding = Encoding.find("filesystem") encoding = Encoding::BINARY if encoding == Encoding::US_ASCII platform_is_not :windows do - children.should include("ã“ã‚“ã«ã¡ã¯.txt".force_encoding(encoding)) + children.should include("ã“ã‚“ã«ã¡ã¯.txt".dup.force_encoding(encoding)) end children.first.encoding.should equal(Encoding.find("filesystem")) end @@ -139,4 +131,17 @@ describe "Dir#children" do children = @dir.children.sort children.first.encoding.should equal(Encoding::EUC_KR) end + + it "returns the same result when called repeatedly" do + @dir = Dir.open DirSpecs.mock_dir + + a = [] + @dir.each {|dir| a << dir} + + b = [] + @dir.each {|dir| b << dir} + + a.sort.should == b.sort + a.sort.should == DirSpecs.expected_paths + end end diff --git a/spec/ruby/core/dir/each_child_spec.rb b/spec/ruby/core/dir/each_child_spec.rb index f7980991e5..7194273b95 100644 --- a/spec/ruby/core/dir/each_child_spec.rb +++ b/spec/ruby/core/dir/each_child_spec.rb @@ -15,13 +15,6 @@ describe "Dir.each_child" do dirs.each {|dir| dir.encoding.should == Encoding::UTF_8} end - ruby_version_is ""..."2.7" do - it "accepts nil options" do - dirs = Dir.each_child("#{DirSpecs.mock_dir}/deeply/nested", nil).to_a.sort - dirs.each {|dir| dir.encoding.should == Encoding.find("filesystem")} - end - end - it "yields all names in an existing directory to the provided block" do a, b = [], [] @@ -93,6 +86,19 @@ describe "Dir#each_child" do @dir.each_child { |f| f }.should == @dir end + it "returns the same result when called repeatedly" do + @dir = Dir.open DirSpecs.mock_dir + + a = [] + @dir.each {|dir| a << dir} + + b = [] + @dir.each {|dir| b << dir} + + a.sort.should == b.sort + a.sort.should == DirSpecs.expected_paths + end + describe "when no block is given" do it "returns an Enumerator" do @dir = Dir.new(DirSpecs.mock_dir) diff --git a/spec/ruby/core/dir/each_spec.rb b/spec/ruby/core/dir/each_spec.rb index 8c69a7212b..7674663d82 100644 --- a/spec/ruby/core/dir/each_spec.rb +++ b/spec/ruby/core/dir/each_spec.rb @@ -35,6 +35,17 @@ describe "Dir#each" do ls.should include(@dir.read) end + it "returns the same result when called repeatedly" do + a = [] + @dir.each {|dir| a << dir} + + b = [] + @dir.each {|dir| b << dir} + + a.sort.should == b.sort + a.sort.should == DirSpecs.expected_paths + end + describe "when no block is given" do it "returns an Enumerator" do @dir.each.should be_an_instance_of(Enumerator) diff --git a/spec/ruby/core/dir/entries_spec.rb b/spec/ruby/core/dir/entries_spec.rb index 9aa58657db..7462542acf 100644 --- a/spec/ruby/core/dir/entries_spec.rb +++ b/spec/ruby/core/dir/entries_spec.rb @@ -40,13 +40,6 @@ describe "Dir.entries" do dirs.each {|dir| dir.encoding.should == Encoding::UTF_8} end - ruby_version_is ""..."2.7" do - it "accepts nil options" do - dirs = Dir.entries("#{DirSpecs.mock_dir}/deeply/nested", nil).to_a.sort - dirs.each {|dir| dir.encoding.should == Encoding.find("filesystem")} - end - end - it "returns entries encoded with the filesystem encoding by default" do # This spec depends on the locale not being US-ASCII because if it is, the # entries that are not ascii_only? will be BINARY encoded. @@ -54,7 +47,7 @@ describe "Dir.entries" do encoding = Encoding.find("filesystem") encoding = Encoding::BINARY if encoding == Encoding::US_ASCII platform_is_not :windows do - entries.should include("ã“ã‚“ã«ã¡ã¯.txt".force_encoding(encoding)) + entries.should include("ã“ã‚“ã«ã¡ã¯.txt".dup.force_encoding(encoding)) end entries.first.encoding.should equal(Encoding.find("filesystem")) end diff --git a/spec/ruby/core/dir/exist_spec.rb b/spec/ruby/core/dir/exist_spec.rb index 43987b0f32..9023de533f 100644 --- a/spec/ruby/core/dir/exist_spec.rb +++ b/spec/ruby/core/dir/exist_spec.rb @@ -13,3 +13,11 @@ describe "Dir.exist?" do it_behaves_like :dir_exist, :exist? end + +ruby_version_is "3.2" do + describe "Dir.exists?" do + it "has been removed" do + Dir.should_not.respond_to?(:exists?) + end + end +end diff --git a/spec/ruby/core/dir/fchdir_spec.rb b/spec/ruby/core/dir/fchdir_spec.rb new file mode 100644 index 0000000000..429e569691 --- /dev/null +++ b/spec/ruby/core/dir/fchdir_spec.rb @@ -0,0 +1,68 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/common' + +ruby_version_is '3.3' do + guard -> { Dir.respond_to? :fchdir } do + describe "Dir.fchdir" do + before :all do + DirSpecs.create_mock_dirs + end + + after :all do + DirSpecs.delete_mock_dirs + end + + before :each do + @dirs = [Dir.new('.')] + @original = @dirs.first.fileno + end + + after :each do + Dir.fchdir(@original) + @dirs.each(&:close) + end + + it "changes to the specified directory" do + dir = Dir.new(DirSpecs.mock_dir) + @dirs << dir + Dir.fchdir dir.fileno + Dir.pwd.should == DirSpecs.mock_dir + end + + it "returns 0 when successfully changing directory" do + Dir.fchdir(@original).should == 0 + end + + it "returns the value of the block when a block is given" do + Dir.fchdir(@original) { :block_value }.should == :block_value + end + + it "changes to the specified directory for the duration of the block" do + pwd = Dir.pwd + dir = Dir.new(DirSpecs.mock_dir) + @dirs << dir + Dir.fchdir(dir.fileno) { Dir.pwd }.should == DirSpecs.mock_dir + Dir.pwd.should == pwd + end + + it "raises a SystemCallError if the file descriptor given is not valid" do + -> { Dir.fchdir(-1) }.should raise_error(SystemCallError) + -> { Dir.fchdir(-1) { } }.should raise_error(SystemCallError) + end + + it "raises a SystemCallError if the file descriptor given is not for a directory" do + -> { Dir.fchdir $stdout.fileno }.should raise_error(SystemCallError) + -> { Dir.fchdir($stdout.fileno) { } }.should raise_error(SystemCallError) + end + end + end + + guard_not -> { Dir.respond_to? :fchdir } do + describe "Dir.fchdir" do + it "raises NotImplementedError" do + -> { Dir.fchdir 1 }.should raise_error(NotImplementedError) + -> { Dir.fchdir(1) { } }.should raise_error(NotImplementedError) + end + end + end +end diff --git a/spec/ruby/core/dir/fixtures/common.rb b/spec/ruby/core/dir/fixtures/common.rb index a1ea3db215..087f46b331 100644 --- a/spec/ruby/core/dir/fixtures/common.rb +++ b/spec/ruby/core/dir/fixtures/common.rb @@ -81,6 +81,8 @@ module DirSpecs special/} special/test{1}/file[1] + special/{}/special + special/test\ +()[]{}/hello_world.erb ] platform_is_not :windows do @@ -91,19 +93,39 @@ module DirSpecs special/| special/ã“ã‚“ã«ã¡ã¯.txt + special/\a ] + @mock_dir_files << "special/_\u{1f60e}.erb" end end @mock_dir_files end + def self.mock_dir_links + unless @mock_dir_links + @mock_dir_links = [] + platform_is_not :windows do + @mock_dir_links += [ + ['special/ln', 'subdir_one'] + ] + end + end + @mock_dir_links + end + def self.create_mock_dirs mock_dir_files.each do |name| file = File.join mock_dir, name mkdir_p File.dirname(file) touch file end + mock_dir_links.each do |link, target| + full_link = File.join mock_dir, link + full_target = File.join mock_dir, target + + File.symlink full_target, full_link + end end def self.delete_mock_dirs diff --git a/spec/ruby/core/dir/foreach_spec.rb b/spec/ruby/core/dir/foreach_spec.rb index c3ddb27a84..9cf34b1d71 100644 --- a/spec/ruby/core/dir/foreach_spec.rb +++ b/spec/ruby/core/dir/foreach_spec.rb @@ -41,13 +41,13 @@ describe "Dir.foreach" do it "accepts an encoding keyword for the encoding of the entries" do dirs = Dir.foreach("#{DirSpecs.mock_dir}/deeply/nested", encoding: "utf-8").to_a.sort - dirs.each {|dir| dir.encoding.should == Encoding::UTF_8} - end + dirs.each { |dir| dir.encoding.should == Encoding::UTF_8 } + + dirs = Dir.foreach("#{DirSpecs.mock_dir}/deeply/nested", encoding: Encoding::ISO_8859_1).to_a.sort + dirs.each { |dir| dir.encoding.should == Encoding::ISO_8859_1 } - ruby_version_is ""..."2.7" do - it "accepts nil options" do - dirs = Dir.foreach("#{DirSpecs.mock_dir}/deeply/nested", nil).to_a.sort - dirs.each {|dir| dir.encoding.should == Encoding.find("filesystem")} + Dir.foreach("#{DirSpecs.mock_dir}/deeply/nested", encoding: Encoding::ISO_8859_1) do |f| + f.encoding.should == Encoding::ISO_8859_1 end end diff --git a/spec/ruby/core/dir/glob_spec.rb b/spec/ruby/core/dir/glob_spec.rb index 6533c9b65a..32f515c81d 100644 --- a/spec/ruby/core/dir/glob_spec.rb +++ b/spec/ruby/core/dir/glob_spec.rb @@ -79,7 +79,9 @@ describe "Dir.glob" do nested/ nested/.dotsubir/ special/ + special/test\ +()[]{}/ special/test{1}/ + special/{}/ subdir_one/ subdir_two/ ] @@ -104,11 +106,11 @@ describe "Dir.glob" do ruby_version_is '3.1' do it "recursively matches files and directories in nested dot subdirectory except . with 'nested/**/*' from the current directory and option File::FNM_DOTMATCH" do expected = %w[ - nested/. - nested/.dotsubir - nested/.dotsubir/.dotfile - nested/.dotsubir/nondotfile - ] + nested/. + nested/.dotsubir + nested/.dotsubir/.dotfile + nested/.dotsubir/nondotfile + ] Dir.glob('nested/**/*', File::FNM_DOTMATCH).sort.should == expected.sort end @@ -129,7 +131,9 @@ describe "Dir.glob" do ./nested/ ./nested/.dotsubir/ ./special/ + ./special/test\ +()[]{}/ ./special/test{1}/ + ./special/{}/ ./subdir_one/ ./subdir_two/ ] @@ -178,6 +182,134 @@ describe "Dir.glob" do Dir.glob('**/**/**').should_not.empty? end + it "handles **/** with base keyword argument" do + Dir.glob('**/**', base: "dir").should == ["filename_ordering"] + + expected = %w[ + nested + nested/directory + nested/directory/structure + nested/directory/structure/bar + nested/directory/structure/baz + nested/directory/structure/file_one + nested/directory/structure/file_one.ext + nested/directory/structure/foo + nondotfile + ].sort + + Dir.glob('**/**', base: "deeply").sort.should == expected + end + + it "handles **/ with base keyword argument" do + expected = %w[ + / + directory/ + directory/structure/ + ] + Dir.glob('**/', base: "deeply/nested").sort.should == expected + end + + it "handles **/nondotfile with base keyword argument" do + expected = %w[ + deeply/nondotfile + nondotfile + subdir_one/nondotfile + subdir_two/nondotfile + ] + Dir.glob('**/nondotfile', base: ".").sort.should == expected + end + + it "handles **/nondotfile with base keyword argument and FNM_DOTMATCH" do + expected = %w[ + .dotsubdir/nondotfile + deeply/nondotfile + nested/.dotsubir/nondotfile + nondotfile + subdir_one/nondotfile + subdir_two/nondotfile + ] + Dir.glob('**/nondotfile', File::FNM_DOTMATCH, base: ".").sort.should == expected + end + + it "handles **/.dotfile with base keyword argument" do + expected = %w[ + .dotfile + deeply/.dotfile + subdir_one/.dotfile + ] + Dir.glob('**/.dotfile', base: ".").sort.should == expected + end + + it "handles **/.dotfile with base keyword argument and FNM_DOTMATCH" do + expected = %w[ + .dotfile + .dotsubdir/.dotfile + deeply/.dotfile + nested/.dotsubir/.dotfile + subdir_one/.dotfile + ] + Dir.glob('**/.dotfile', File::FNM_DOTMATCH, base: ".").sort.should == expected + end + + it "handles **/.* with base keyword argument" do + expected = %w[ + .dotfile.ext + directory/structure/.ext + ].sort + + Dir.glob('**/.*', base: "deeply/nested").sort.should == expected + end + + # < 3.1 include a "." entry for every dir: ["directory/.", "directory/structure/.", ...] + ruby_version_is '3.1' do + it "handles **/.* with base keyword argument and FNM_DOTMATCH" do + expected = %w[ + . + .dotfile.ext + directory/structure/.ext + ].sort + + Dir.glob('**/.*', File::FNM_DOTMATCH, base: "deeply/nested").sort.should == expected + end + + it "handles **/** with base keyword argument and FNM_DOTMATCH" do + expected = %w[ + . + .dotfile.ext + directory + directory/structure + directory/structure/.ext + directory/structure/bar + directory/structure/baz + directory/structure/file_one + directory/structure/file_one.ext + directory/structure/foo + ].sort + + Dir.glob('**/**', File::FNM_DOTMATCH, base: "deeply/nested").sort.should == expected + end + end + + it "handles **/*pattern* with base keyword argument and FNM_DOTMATCH" do + expected = %w[ + .dotfile.ext + directory/structure/file_one + directory/structure/file_one.ext + ] + + Dir.glob('**/*file*', File::FNM_DOTMATCH, base: "deeply/nested").sort.should == expected + end + + it "handles **/glob with base keyword argument and FNM_EXTGLOB" do + expected = %w[ + directory/structure/bar + directory/structure/file_one + directory/structure/file_one.ext + ] + + Dir.glob('**/*{file,bar}*', File::FNM_EXTGLOB, base: "deeply/nested").sort.should == expected + end + it "handles simple filename patterns" do Dir.glob('.dotfile').should == ['.dotfile'] end @@ -220,5 +352,30 @@ describe "Dir.glob" do Dir.rmdir('no_permission') end end + + it "will follow symlinks when processing a `*/` pattern." do + expected = ['special/ln/nondotfile'] + Dir.glob('special/*/nondotfile').should == expected + end + + it "will not follow symlinks when recursively traversing directories" do + expected = %w[ + deeply/nondotfile + nondotfile + subdir_one/nondotfile + subdir_two/nondotfile + ] + Dir.glob('**/nondotfile').sort.should == expected + end + + it "will follow symlinks when testing directory after recursive directory in pattern" do + expected = %w[ + deeply/nondotfile + special/ln/nondotfile + subdir_one/nondotfile + subdir_two/nondotfile + ] + Dir.glob('**/*/nondotfile').sort.should == expected + end end end diff --git a/spec/ruby/core/dir/home_spec.rb b/spec/ruby/core/dir/home_spec.rb index 713ba9db9a..3cf745ab46 100644 --- a/spec/ruby/core/dir/home_spec.rb +++ b/spec/ruby/core/dir/home_spec.rb @@ -19,6 +19,44 @@ describe "Dir.home" do it "returns a non-frozen string" do Dir.home.should_not.frozen? end + + it "returns a string with the filesystem encoding" do + Dir.home.encoding.should == Encoding.find("filesystem") + end + + platform_is_not :windows do + it "works even if HOME is unset" do + ENV.delete('HOME') + Dir.home.should.start_with?('/') + Dir.home.encoding.should == Encoding.find("filesystem") + end + end + + platform_is :windows do + ruby_version_is "3.2" do + it "returns the home directory with forward slashs and as UTF-8" do + ENV['HOME'] = "C:\\rubyspäc\\home" + home = Dir.home + home.should == "C:/rubyspäc/home" + home.encoding.should == Encoding::UTF_8 + end + + it "retrieves the directory from HOME, USERPROFILE, HOMEDRIVE/HOMEPATH and the WinAPI in that order" do + old_dirs = [ENV.delete('HOME'), ENV.delete('USERPROFILE'), ENV.delete('HOMEDRIVE'), ENV.delete('HOMEPATH')] + + Dir.home.should == old_dirs[1].gsub("\\", "/") + ENV['HOMEDRIVE'] = "C:" + ENV['HOMEPATH'] = "\\rubyspec\\home1" + Dir.home.should == "C:/rubyspec/home1" + ENV['USERPROFILE'] = "C:\\rubyspec\\home2" + Dir.home.should == "C:/rubyspec/home2" + ENV['HOME'] = "C:\\rubyspec\\home3" + Dir.home.should == "C:/rubyspec/home3" + ensure + ENV['HOME'], ENV['USERPROFILE'], ENV['HOMEDRIVE'], ENV['HOMEPATH'] = *old_dirs + end + end + end end describe "when called with the current user name" do @@ -28,7 +66,7 @@ describe "Dir.home" do end end - platform_is_not :windows, :solaris, :android do + platform_is_not :windows, :solaris, :android, :wasi do it "returns the named user's home directory, from the user database" do Dir.home(ENV['USER']).should == `echo ~#{ENV['USER']}`.chomp end @@ -37,9 +75,19 @@ describe "Dir.home" do it "returns a non-frozen string" do Dir.home(ENV['USER']).should_not.frozen? end + + it "returns a string with the filesystem encoding" do + Dir.home(ENV['USER']).encoding.should == Encoding.find("filesystem") + end end it "raises an ArgumentError if the named user doesn't exist" do -> { Dir.home('geuw2n288dh2k') }.should raise_error(ArgumentError) end + + describe "when called with a nil user name" do + it "returns the current user's home directory, reading $HOME first" do + Dir.home(nil).should == "/rubyspec_home" + end + end end diff --git a/spec/ruby/core/dir/mkdir_spec.rb b/spec/ruby/core/dir/mkdir_spec.rb index 0ed28f5a99..076ec19dd9 100644 --- a/spec/ruby/core/dir/mkdir_spec.rb +++ b/spec/ruby/core/dir/mkdir_spec.rb @@ -46,7 +46,7 @@ describe "Dir.mkdir" do end end - it "calls #to_path on non-String arguments" do + it "calls #to_path on non-String path arguments" do DirSpecs.clear_dirs p = mock('path') p.should_receive(:to_path).and_return(DirSpecs.mock_dir('nonexisting')) @@ -54,6 +54,22 @@ describe "Dir.mkdir" do DirSpecs.clear_dirs end + it "calls #to_int on non-Integer permissions argument" do + DirSpecs.clear_dirs + path = DirSpecs.mock_dir('nonexisting') + permissions = mock('permissions') + permissions.should_receive(:to_int).and_return(0666) + Dir.mkdir(path, permissions) + DirSpecs.clear_dirs + end + + it "raises TypeError if non-Integer permissions argument does not have #to_int method" do + path = DirSpecs.mock_dir('nonexisting') + permissions = Object.new + + -> { Dir.mkdir(path, permissions) }.should raise_error(TypeError, 'no implicit conversion of Object into Integer') + end + it "raises a SystemCallError if any of the directories in the path before the last does not exist" do -> { Dir.mkdir "#{DirSpecs.nonexistent}/subdir" }.should raise_error(SystemCallError) end diff --git a/spec/ruby/core/dir/read_spec.rb b/spec/ruby/core/dir/read_spec.rb index 59de2e81cf..276930c6b7 100644 --- a/spec/ruby/core/dir/read_spec.rb +++ b/spec/ruby/core/dir/read_spec.rb @@ -39,5 +39,38 @@ describe "Dir#read" do entries.sort.should == DirSpecs.expected_paths end + platform_is_not :windows do + it "returns all directory entries even when encoding conversion will fail" do + dir = Dir.open(File.join(DirSpecs.mock_dir, 'special')) + utf8_entries = [] + begin + while entry = dir.read + utf8_entries << entry + end + ensure + dir.close + end + old_internal_encoding = Encoding::default_internal + old_external_encoding = Encoding::default_external + Encoding.default_internal = Encoding::UTF_8 + Encoding.default_external = Encoding::SHIFT_JIS + shift_jis_entries = [] + begin + Dir.open(File.join(DirSpecs.mock_dir, 'special')) do |d| + -> { + while entry = d.read + shift_jis_entries << entry + end + }.should_not raise_error + end + ensure + Encoding.default_internal = old_internal_encoding + Encoding.default_external = old_external_encoding + end + shift_jis_entries.size.should == utf8_entries.size + shift_jis_entries.filter { |f| f.encoding == Encoding::SHIFT_JIS }.size.should == 1 + end + end + it_behaves_like :dir_closed, :read end diff --git a/spec/ruby/core/dir/shared/chroot.rb b/spec/ruby/core/dir/shared/chroot.rb index b14a433670..a8f7c10a19 100644 --- a/spec/ruby/core/dir/shared/chroot.rb +++ b/spec/ruby/core/dir/shared/chroot.rb @@ -2,8 +2,8 @@ describe :dir_chroot_as_root, shared: true do before :all do DirSpecs.create_mock_dirs - @real_root = "../" * (File.dirname(__FILE__).count('/') - 1) - @ref_dir = File.join("/", Dir.new('/').entries.first) + @real_root = "../" * (__dir__.count('/') - 1) + @ref_dir = File.join("/", File.basename(Dir["/*"].first)) end after :all do @@ -14,10 +14,13 @@ describe :dir_chroot_as_root, shared: true do DirSpecs.delete_mock_dirs end + # Pending until https://github.com/ruby/ruby/runs/8075149420 is fixed + compilations_ci = ENV["GITHUB_WORKFLOW"] == "Compilations" + it "can be used to change the process' root directory" do - -> { Dir.send(@method, File.dirname(__FILE__)) }.should_not raise_error + -> { Dir.send(@method, __dir__) }.should_not raise_error File.should.exist?("/#{File.basename(__FILE__)}") - end + end unless compilations_ci it "returns 0 if successful" do Dir.send(@method, '/').should == 0 @@ -31,7 +34,7 @@ describe :dir_chroot_as_root, shared: true do Dir.send(@method, @real_root) File.should.exist?(@ref_dir) File.should_not.exist?("/#{File.basename(__FILE__)}") - end + end unless compilations_ci it "calls #to_path on non-String argument" do p = mock('path') diff --git a/spec/ruby/core/dir/shared/exist.rb b/spec/ruby/core/dir/shared/exist.rb index 765d1b656c..2ea4f88a80 100644 --- a/spec/ruby/core/dir/shared/exist.rb +++ b/spec/ruby/core/dir/shared/exist.rb @@ -1,6 +1,6 @@ describe :dir_exist, shared: true do it "returns true if the given directory exists" do - Dir.send(@method, File.dirname(__FILE__)).should be_true + Dir.send(@method, __dir__).should be_true end it "returns true for '.'" do @@ -20,7 +20,7 @@ describe :dir_exist, shared: true do end it "understands relative paths" do - Dir.send(@method, File.dirname(__FILE__) + '/../').should be_true + Dir.send(@method, __dir__ + '/../').should be_true end it "returns false if the given directory doesn't exist" do @@ -28,7 +28,7 @@ describe :dir_exist, shared: true do end it "doesn't require the name to have a trailing slash" do - dir = File.dirname(__FILE__) + dir = __dir__ dir.sub!(/\/$/,'') Dir.send(@method, dir).should be_true end @@ -50,7 +50,7 @@ describe :dir_exist, shared: true do it "calls #to_path on non String arguments" do p = mock('path') - p.should_receive(:to_path).and_return(File.dirname(__FILE__)) + p.should_receive(:to_path).and_return(__dir__) Dir.send(@method, p) end end diff --git a/spec/ruby/core/dir/shared/glob.rb b/spec/ruby/core/dir/shared/glob.rb index ae5c2a114b..745f02d46b 100644 --- a/spec/ruby/core/dir/shared/glob.rb +++ b/spec/ruby/core/dir/shared/glob.rb @@ -12,7 +12,7 @@ describe :dir_glob, shared: true do end it "raises an Encoding::CompatibilityError if the argument encoding is not compatible with US-ASCII" do - pattern = "file*".force_encoding Encoding::UTF_16BE + pattern = "file*".dup.force_encoding Encoding::UTF_16BE -> { Dir.send(@method, pattern) }.should raise_error(Encoding::CompatibilityError) end @@ -23,18 +23,43 @@ describe :dir_glob, shared: true do Dir.send(@method, obj).should == %w[file_one.ext] end - ruby_version_is ""..."2.7" do - it "splits the string on \\0 if there is only one string given and warns" do - -> { - Dir.send(@method, "file_o*\0file_t*").should == - %w!file_one.ext file_two.ext! - }.should complain(/warning: use glob patterns list instead of nul-separated patterns/) + it "raises an ArgumentError if the string contains \\0" do + -> {Dir.send(@method, "file_o*\0file_t*")}.should raise_error ArgumentError, /nul-separated/ + end + + it "result is sorted by default" do + result = Dir.send(@method, '*') + result.should == result.sort + end + + it "result is sorted with sort: true" do + result = Dir.send(@method, '*', sort: true) + result.should == result.sort + end + + it "sort: false returns same files" do + result = Dir.send(@method,'*', sort: false) + result.sort.should == Dir.send(@method, '*').sort + end + + ruby_version_is ""..."3.1" do + it "result is sorted with any non false value of sort:" do + result = Dir.send(@method, '*', sort: 0) + result.should == result.sort + + result = Dir.send(@method, '*', sort: nil) + result.should == result.sort + + result = Dir.send(@method, '*', sort: 'false') + result.should == result.sort end end - ruby_version_is "2.7" do - it "raises an ArgumentError if the string contains \\0" do - -> {Dir.send(@method, "file_o*\0file_t*")}.should raise_error ArgumentError, /nul-separated/ + ruby_version_is "3.1" do + it "raises an ArgumentError if sort: is not true or false" do + -> { Dir.send(@method, '*', sort: 0) }.should raise_error ArgumentError, /expected true or false/ + -> { Dir.send(@method, '*', sort: nil) }.should raise_error ArgumentError, /expected true or false/ + -> { Dir.send(@method, '*', sort: 'false') }.should raise_error ArgumentError, /expected true or false/ end end @@ -64,6 +89,10 @@ describe :dir_glob, shared: true do Dir.send(@method, 'special/+').should == ['special/+'] end + it "matches directories with special characters when escaped" do + Dir.send(@method, 'special/\{}/special').should == ["special/{}/special"] + end + platform_is_not :windows do it "matches regexp special *" do Dir.send(@method, 'special/\*').should == ['special/*'] @@ -76,6 +105,14 @@ describe :dir_glob, shared: true do it "matches regexp special |" do Dir.send(@method, 'special/|').should == ['special/|'] end + + it "matches files with backslashes in their name" do + Dir.glob('special/\\\\{a,b}').should == ['special/\a'] + end + + it "matches directory with special characters in their name in complex patterns" do + Dir.glob("special/test +()\\[\\]\\{\\}/hello_world{.{en},}{.{html},}{+{phone},}{.{erb},}").should == ['special/test +()[]{}/hello_world.erb'] + end end it "matches regexp special ^" do @@ -190,7 +227,9 @@ describe :dir_glob, shared: true do dir/ nested/ special/ + special/test\ +()[]{}/ special/test{1}/ + special/{}/ subdir_one/ subdir_two/ ] diff --git a/spec/ruby/core/encoding/compatible_spec.rb b/spec/ruby/core/encoding/compatible_spec.rb index dc47a6553a..f18d8680a9 100644 --- a/spec/ruby/core/encoding/compatible_spec.rb +++ b/spec/ruby/core/encoding/compatible_spec.rb @@ -7,7 +7,7 @@ require_relative '../../spec_helper' describe "Encoding.compatible? String, String" do describe "when the first's Encoding is valid US-ASCII" do before :each do - @str = "abc".force_encoding Encoding::US_ASCII + @str = "abc".dup.force_encoding Encoding::US_ASCII end it "returns US-ASCII when the second's is US-ASCII" do @@ -33,28 +33,28 @@ describe "Encoding.compatible? String, String" do describe "when the first's Encoding is ASCII compatible and ASCII only" do it "returns the first's Encoding if the second is ASCII compatible and ASCII only" do - [ [Encoding, "abc".force_encoding("UTF-8"), "123".force_encoding("Shift_JIS"), Encoding::UTF_8], - [Encoding, "123".force_encoding("Shift_JIS"), "abc".force_encoding("UTF-8"), Encoding::Shift_JIS] + [ [Encoding, "abc".dup.force_encoding("UTF-8"), "123".dup.force_encoding("Shift_JIS"), Encoding::UTF_8], + [Encoding, "123".dup.force_encoding("Shift_JIS"), "abc".dup.force_encoding("UTF-8"), Encoding::Shift_JIS] ].should be_computed_by(:compatible?) end it "returns the first's Encoding if the second is ASCII compatible and ASCII only" do - [ [Encoding, "abc".force_encoding("BINARY"), "123".force_encoding("US-ASCII"), Encoding::BINARY], - [Encoding, "123".force_encoding("US-ASCII"), "abc".force_encoding("BINARY"), Encoding::US_ASCII] + [ [Encoding, "abc".dup.force_encoding("BINARY"), "123".dup.force_encoding("US-ASCII"), Encoding::BINARY], + [Encoding, "123".dup.force_encoding("US-ASCII"), "abc".dup.force_encoding("BINARY"), Encoding::US_ASCII] ].should be_computed_by(:compatible?) end it "returns the second's Encoding if the second is ASCII compatible but not ASCII only" do - [ [Encoding, "abc".force_encoding("UTF-8"), "\xff".force_encoding("Shift_JIS"), Encoding::Shift_JIS], - [Encoding, "123".force_encoding("Shift_JIS"), "\xff".force_encoding("UTF-8"), Encoding::UTF_8], - [Encoding, "abc".force_encoding("BINARY"), "\xff".force_encoding("US-ASCII"), Encoding::US_ASCII], - [Encoding, "123".force_encoding("US-ASCII"), "\xff".force_encoding("BINARY"), Encoding::BINARY], + [ [Encoding, "abc".dup.force_encoding("UTF-8"), "\xff".dup.force_encoding("Shift_JIS"), Encoding::Shift_JIS], + [Encoding, "123".dup.force_encoding("Shift_JIS"), "\xff".dup.force_encoding("UTF-8"), Encoding::UTF_8], + [Encoding, "abc".dup.force_encoding("BINARY"), "\xff".dup.force_encoding("US-ASCII"), Encoding::US_ASCII], + [Encoding, "123".dup.force_encoding("US-ASCII"), "\xff".dup.force_encoding("BINARY"), Encoding::BINARY], ].should be_computed_by(:compatible?) end it "returns nil if the second's Encoding is not ASCII compatible" do - a = "abc".force_encoding("UTF-8") - b = "123".force_encoding("UTF-16LE") + a = "abc".dup.force_encoding("UTF-8") + b = "1234".dup.force_encoding("UTF-16LE") Encoding.compatible?(a, b).should be_nil end end @@ -75,7 +75,7 @@ describe "Encoding.compatible? String, String" do describe "when the first's Encoding is not ASCII compatible" do before :each do - @str = "abc".force_encoding Encoding::UTF_7 + @str = "abc".dup.force_encoding Encoding::UTF_7 end it "returns nil when the second String is US-ASCII" do @@ -91,14 +91,14 @@ describe "Encoding.compatible? String, String" do end it "returns the Encoding when the second's Encoding is not ASCII compatible but the same as the first's Encoding" do - encoding = Encoding.compatible?(@str, "def".force_encoding("utf-7")) + encoding = Encoding.compatible?(@str, "def".dup.force_encoding("utf-7")) encoding.should == Encoding::UTF_7 end end describe "when the first's Encoding is invalid" do before :each do - @str = "\xff".force_encoding Encoding::UTF_8 + @str = "\xff".dup.force_encoding Encoding::UTF_8 end it "returns the first's Encoding when the second's Encoding is US-ASCII" do @@ -114,11 +114,11 @@ describe "Encoding.compatible? String, String" do end it "returns nil when the second's Encoding is invalid and ASCII only" do - Encoding.compatible?(@str, "\x7f".force_encoding("utf-16be")).should be_nil + Encoding.compatible?(@str, "\x7f".dup.force_encoding("utf-16be")).should be_nil end it "returns nil when the second's Encoding is invalid and not ASCII only" do - Encoding.compatible?(@str, "\xff".force_encoding("utf-16be")).should be_nil + Encoding.compatible?(@str, "\xff".dup.force_encoding("utf-16be")).should be_nil end it "returns the Encoding when the second's Encoding is invalid but the same as the first" do @@ -129,7 +129,7 @@ describe "Encoding.compatible? String, String" do describe "when the first String is empty and the second is not" do describe "and the first's Encoding is ASCII compatible" do before :each do - @str = "".force_encoding("utf-8") + @str = "".dup.force_encoding("utf-8") end it "returns the first's encoding when the second String is ASCII only" do @@ -143,7 +143,7 @@ describe "Encoding.compatible? String, String" do describe "when the first's Encoding is not ASCII compatible" do before :each do - @str = "".force_encoding Encoding::UTF_7 + @str = "".dup.force_encoding Encoding::UTF_7 end it "returns the second string's encoding" do @@ -154,7 +154,7 @@ describe "Encoding.compatible? String, String" do describe "when the second String is empty" do before :each do - @str = "abc".force_encoding("utf-7") + @str = "abc".dup.force_encoding("utf-7") end it "returns the first Encoding" do @@ -165,7 +165,7 @@ end describe "Encoding.compatible? String, Regexp" do it "returns US-ASCII if both are US-ASCII" do - str = "abc".force_encoding("us-ascii") + str = "abc".dup.force_encoding("us-ascii") Encoding.compatible?(str, /abc/).should == Encoding::US_ASCII end @@ -180,15 +180,15 @@ describe "Encoding.compatible? String, Regexp" do it "returns the String's Encoding if the String is not ASCII only" do [ [Encoding, "\xff", Encoding::BINARY], [Encoding, "\u3042".encode("utf-8"), Encoding::UTF_8], - [Encoding, "\xa4\xa2".force_encoding("euc-jp"), Encoding::EUC_JP], - [Encoding, "\x82\xa0".force_encoding("shift_jis"), Encoding::Shift_JIS], + [Encoding, "\xa4\xa2".dup.force_encoding("euc-jp"), Encoding::EUC_JP], + [Encoding, "\x82\xa0".dup.force_encoding("shift_jis"), Encoding::Shift_JIS], ].should be_computed_by(:compatible?, /abc/) end end describe "Encoding.compatible? String, Symbol" do it "returns US-ASCII if both are ASCII only" do - str = "abc".force_encoding("us-ascii") + str = "abc".dup.force_encoding("us-ascii") Encoding.compatible?(str, :abc).should == Encoding::US_ASCII end @@ -203,8 +203,8 @@ describe "Encoding.compatible? String, Symbol" do it "returns the String's Encoding if the String is not ASCII only" do [ [Encoding, "\xff", Encoding::BINARY], [Encoding, "\u3042".encode("utf-8"), Encoding::UTF_8], - [Encoding, "\xa4\xa2".force_encoding("euc-jp"), Encoding::EUC_JP], - [Encoding, "\x82\xa0".force_encoding("shift_jis"), Encoding::Shift_JIS], + [Encoding, "\xa4\xa2".dup.force_encoding("euc-jp"), Encoding::EUC_JP], + [Encoding, "\x82\xa0".dup.force_encoding("shift_jis"), Encoding::Shift_JIS], ].should be_computed_by(:compatible?, :abc) end end @@ -221,8 +221,8 @@ describe "Encoding.compatible? String, Encoding" do it "returns the String's encoding if the Encoding is US-ASCII" do [ [Encoding, "\xff", Encoding::BINARY], [Encoding, "\u3042".encode("utf-8"), Encoding::UTF_8], - [Encoding, "\xa4\xa2".force_encoding("euc-jp"), Encoding::EUC_JP], - [Encoding, "\x82\xa0".force_encoding("shift_jis"), Encoding::Shift_JIS], + [Encoding, "\xa4\xa2".dup.force_encoding("euc-jp"), Encoding::EUC_JP], + [Encoding, "\x82\xa0".dup.force_encoding("shift_jis"), Encoding::Shift_JIS], ].should be_computed_by(:compatible?, Encoding::US_ASCII) end @@ -242,7 +242,7 @@ end describe "Encoding.compatible? Regexp, String" do it "returns US-ASCII if both are US-ASCII" do - str = "abc".force_encoding("us-ascii") + str = "abc".dup.force_encoding("us-ascii") Encoding.compatible?(/abc/, str).should == Encoding::US_ASCII end @@ -256,8 +256,8 @@ describe "Encoding.compatible? Regexp, Regexp" do it "returns the first's Encoding if it is not US-ASCII and not ASCII only" do [ [Encoding, Regexp.new("\xff"), Encoding::BINARY], [Encoding, Regexp.new("\u3042".encode("utf-8")), Encoding::UTF_8], - [Encoding, Regexp.new("\xa4\xa2".force_encoding("euc-jp")), Encoding::EUC_JP], - [Encoding, Regexp.new("\x82\xa0".force_encoding("shift_jis")), Encoding::Shift_JIS], + [Encoding, Regexp.new("\xa4\xa2".dup.force_encoding("euc-jp")), Encoding::EUC_JP], + [Encoding, Regexp.new("\x82\xa0".dup.force_encoding("shift_jis")), Encoding::Shift_JIS], ].should be_computed_by(:compatible?, /abc/) end end @@ -270,15 +270,15 @@ describe "Encoding.compatible? Regexp, Symbol" do it "returns the first's Encoding if it is not US-ASCII and not ASCII only" do [ [Encoding, Regexp.new("\xff"), Encoding::BINARY], [Encoding, Regexp.new("\u3042".encode("utf-8")), Encoding::UTF_8], - [Encoding, Regexp.new("\xa4\xa2".force_encoding("euc-jp")), Encoding::EUC_JP], - [Encoding, Regexp.new("\x82\xa0".force_encoding("shift_jis")), Encoding::Shift_JIS], + [Encoding, Regexp.new("\xa4\xa2".dup.force_encoding("euc-jp")), Encoding::EUC_JP], + [Encoding, Regexp.new("\x82\xa0".dup.force_encoding("shift_jis")), Encoding::Shift_JIS], ].should be_computed_by(:compatible?, /abc/) end end describe "Encoding.compatible? Symbol, String" do it "returns US-ASCII if both are ASCII only" do - str = "abc".force_encoding("us-ascii") + str = "abc".dup.force_encoding("us-ascii") Encoding.compatible?(str, :abc).should == Encoding::US_ASCII end end @@ -291,8 +291,8 @@ describe "Encoding.compatible? Symbol, Regexp" do it "returns the Regexp's Encoding if it is not US-ASCII and not ASCII only" do a = Regexp.new("\xff") b = Regexp.new("\u3042".encode("utf-8")) - c = Regexp.new("\xa4\xa2".force_encoding("euc-jp")) - d = Regexp.new("\x82\xa0".force_encoding("shift_jis")) + c = Regexp.new("\xa4\xa2".dup.force_encoding("euc-jp")) + d = Regexp.new("\x82\xa0".dup.force_encoding("shift_jis")) [ [Encoding, :abc, a, Encoding::BINARY], [Encoding, :abc, b, Encoding::UTF_8], @@ -310,8 +310,8 @@ describe "Encoding.compatible? Symbol, Symbol" do it "returns the first's Encoding if it is not ASCII only" do [ [Encoding, "\xff".to_sym, Encoding::BINARY], [Encoding, "\u3042".encode("utf-8").to_sym, Encoding::UTF_8], - [Encoding, "\xa4\xa2".force_encoding("euc-jp").to_sym, Encoding::EUC_JP], - [Encoding, "\x82\xa0".force_encoding("shift_jis").to_sym, Encoding::Shift_JIS], + [Encoding, "\xa4\xa2".dup.force_encoding("euc-jp").to_sym, Encoding::EUC_JP], + [Encoding, "\x82\xa0".dup.force_encoding("shift_jis").to_sym, Encoding::Shift_JIS], ].should be_computed_by(:compatible?, :abc) end end diff --git a/spec/ruby/core/encoding/converter/convert_spec.rb b/spec/ruby/core/encoding/converter/convert_spec.rb index 95a9e0b758..7f249d90a3 100644 --- a/spec/ruby/core/encoding/converter/convert_spec.rb +++ b/spec/ruby/core/encoding/converter/convert_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: binary -*- +# frozen_string_literal: true require_relative '../../../spec_helper' describe "Encoding::Converter#convert" do @@ -9,31 +10,31 @@ describe "Encoding::Converter#convert" do it "sets the encoding of the result to the target encoding" do ec = Encoding::Converter.new('ascii', 'utf-8') - str = 'glark'.force_encoding('ascii') + str = 'glark'.dup.force_encoding('ascii') ec.convert(str).encoding.should == Encoding::UTF_8 end it "transcodes the given String to the target encoding" do ec = Encoding::Converter.new("utf-8", "euc-jp") - ec.convert("\u3042".force_encoding('UTF-8')).should == \ - "\xA4\xA2".force_encoding('EUC-JP') + ec.convert("\u3042".dup.force_encoding('UTF-8')).should == \ + "\xA4\xA2".dup.force_encoding('EUC-JP') end it "allows Strings of different encodings to the source encoding" do ec = Encoding::Converter.new('ascii', 'utf-8') - str = 'glark'.force_encoding('SJIS') + str = 'glark'.dup.force_encoding('SJIS') ec.convert(str).encoding.should == Encoding::UTF_8 end it "reuses the given encoding pair if called multiple times" do ec = Encoding::Converter.new('ascii', 'SJIS') - ec.convert('a'.force_encoding('ASCII')).should == 'a'.force_encoding('SJIS') - ec.convert('b'.force_encoding('ASCII')).should == 'b'.force_encoding('SJIS') + ec.convert('a'.dup.force_encoding('ASCII')).should == 'a'.dup.force_encoding('SJIS') + ec.convert('b'.dup.force_encoding('ASCII')).should == 'b'.dup.force_encoding('SJIS') end it "raises UndefinedConversionError if the String contains characters invalid for the target encoding" do ec = Encoding::Converter.new('UTF-8', Encoding.find('macCyrillic')) - -> { ec.convert("\u{6543}".force_encoding('UTF-8')) }.should \ + -> { ec.convert("\u{6543}".dup.force_encoding('UTF-8')) }.should \ raise_error(Encoding::UndefinedConversionError) end diff --git a/spec/ruby/core/encoding/converter/finish_spec.rb b/spec/ruby/core/encoding/converter/finish_spec.rb index 11ca7e8510..239243430b 100644 --- a/spec/ruby/core/encoding/converter/finish_spec.rb +++ b/spec/ruby/core/encoding/converter/finish_spec.rb @@ -16,8 +16,8 @@ describe "Encoding::Converter#finish" do end it "returns the last part of the converted String if it hasn't already" do - @ec.convert("\u{9999}").should == "\e$B9a".force_encoding('iso-2022-jp') - @ec.finish.should == "\e(B".force_encoding('iso-2022-jp') + @ec.convert("\u{9999}").should == "\e$B9a".dup.force_encoding('iso-2022-jp') + @ec.finish.should == "\e(B".dup.force_encoding('iso-2022-jp') end it "returns a String in the destination encoding" do diff --git a/spec/ruby/core/encoding/converter/last_error_spec.rb b/spec/ruby/core/encoding/converter/last_error_spec.rb index 68567737b7..78779be70b 100644 --- a/spec/ruby/core/encoding/converter/last_error_spec.rb +++ b/spec/ruby/core/encoding/converter/last_error_spec.rb @@ -9,45 +9,45 @@ describe "Encoding::Converter#last_error" do it "returns nil when the last conversion did not produce an error" do ec = Encoding::Converter.new('ascii','utf-8') - ec.convert('a'.force_encoding('ascii')) + ec.convert('a'.dup.force_encoding('ascii')) ec.last_error.should be_nil end it "returns nil when #primitive_convert last returned :destination_buffer_full" do ec = Encoding::Converter.new("utf-8", "iso-2022-jp") - ec.primitive_convert("\u{9999}", "", 0, 0, partial_input: false) \ + ec.primitive_convert(+"\u{9999}", +"", 0, 0, partial_input: false) \ .should == :destination_buffer_full ec.last_error.should be_nil end it "returns nil when #primitive_convert last returned :finished" do ec = Encoding::Converter.new("utf-8", "iso-8859-1") - ec.primitive_convert("glark".force_encoding('utf-8'),"").should == :finished + ec.primitive_convert("glark".dup.force_encoding('utf-8'), +"").should == :finished ec.last_error.should be_nil end it "returns nil if the last conversion succeeded but the penultimate failed" do ec = Encoding::Converter.new("utf-8", "iso-8859-1") - ec.primitive_convert("\xf1abcd","").should == :invalid_byte_sequence - ec.primitive_convert("glark".force_encoding('utf-8'),"").should == :finished + ec.primitive_convert(+"\xf1abcd", +"").should == :invalid_byte_sequence + ec.primitive_convert("glark".dup.force_encoding('utf-8'), +"").should == :finished ec.last_error.should be_nil end it "returns an Encoding::InvalidByteSequenceError when #primitive_convert last returned :invalid_byte_sequence" do ec = Encoding::Converter.new("utf-8", "iso-8859-1") - ec.primitive_convert("\xf1abcd","").should == :invalid_byte_sequence + ec.primitive_convert(+"\xf1abcd", +"").should == :invalid_byte_sequence ec.last_error.should be_an_instance_of(Encoding::InvalidByteSequenceError) end it "returns an Encoding::UndefinedConversionError when #primitive_convert last returned :undefined_conversion" do ec = Encoding::Converter.new("utf-8", "iso-8859-1") - ec.primitive_convert("\u{9876}","").should == :undefined_conversion + ec.primitive_convert(+"\u{9876}", +"").should == :undefined_conversion ec.last_error.should be_an_instance_of(Encoding::UndefinedConversionError) end it "returns an Encoding::InvalidByteSequenceError when #primitive_convert last returned :incomplete_input" do ec = Encoding::Converter.new("EUC-JP", "ISO-8859-1") - ec.primitive_convert("\xa4", "", nil, 10).should == :incomplete_input + ec.primitive_convert(+"\xa4", +"", nil, 10).should == :incomplete_input ec.last_error.should be_an_instance_of(Encoding::InvalidByteSequenceError) end diff --git a/spec/ruby/core/encoding/converter/new_spec.rb b/spec/ruby/core/encoding/converter/new_spec.rb index 1f7affc72b..db9c3364d7 100644 --- a/spec/ruby/core/encoding/converter/new_spec.rb +++ b/spec/ruby/core/encoding/converter/new_spec.rb @@ -107,7 +107,7 @@ describe "Encoding::Converter.new" do it "sets the replacement String to '\\uFFFD'" do conv = Encoding::Converter.new("us-ascii", "utf-8", replace: nil) - conv.replacement.should == "\u{fffd}".force_encoding("utf-8") + conv.replacement.should == "\u{fffd}".dup.force_encoding("utf-8") end it "sets the replacement String encoding to UTF-8" do diff --git a/spec/ruby/core/encoding/converter/primitive_convert_spec.rb b/spec/ruby/core/encoding/converter/primitive_convert_spec.rb index 802d8e7cb1..63f25eddef 100644 --- a/spec/ruby/core/encoding/converter/primitive_convert_spec.rb +++ b/spec/ruby/core/encoding/converter/primitive_convert_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: binary -*- +# frozen_string_literal: false require_relative '../../../spec_helper' describe "Encoding::Converter#primitive_convert" do @@ -14,6 +15,10 @@ describe "Encoding::Converter#primitive_convert" do -> { @ec.primitive_convert("","") }.should_not raise_error end + it "raises FrozenError when the destination buffer is a frozen String" do + -> { @ec.primitive_convert("", "".freeze) }.should raise_error(FrozenError) + end + it "accepts nil for the destination byte offset" do -> { @ec.primitive_convert("","", nil) }.should_not raise_error end diff --git a/spec/ruby/core/encoding/converter/primitive_errinfo_spec.rb b/spec/ruby/core/encoding/converter/primitive_errinfo_spec.rb index 1f836b259f..668eb9a924 100644 --- a/spec/ruby/core/encoding/converter/primitive_errinfo_spec.rb +++ b/spec/ruby/core/encoding/converter/primitive_errinfo_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: binary -*- +# frozen_string_literal: false require_relative '../../../spec_helper' describe "Encoding::Converter#primitive_errinfo" do diff --git a/spec/ruby/core/encoding/converter/putback_spec.rb b/spec/ruby/core/encoding/converter/putback_spec.rb index 87495eaf3f..e19fe6c314 100644 --- a/spec/ruby/core/encoding/converter/putback_spec.rb +++ b/spec/ruby/core/encoding/converter/putback_spec.rb @@ -4,7 +4,7 @@ require_relative '../../../spec_helper' describe "Encoding::Converter#putback" do before :each do @ec = Encoding::Converter.new("EUC-JP", "ISO-8859-1") - @ret = @ec.primitive_convert(@src="abc\xa1def", @dst="", nil, 10) + @ret = @ec.primitive_convert(@src=+"abc\xa1def", @dst=+"", nil, 10) end it "returns a String" do @@ -34,14 +34,23 @@ describe "Encoding::Converter#putback" do @ec.putback.should == "" end + it "returns the problematic bytes for UTF-16LE" do + ec = Encoding::Converter.new("utf-16le", "iso-8859-1") + src = +"\x00\xd8\x61\x00" + dst = +"" + ec.primitive_convert(src, dst).should == :invalid_byte_sequence + ec.primitive_errinfo.should == [:invalid_byte_sequence, "UTF-16LE", "UTF-8", "\x00\xD8", "a\x00"] + ec.putback.should == "a\x00".dup.force_encoding("utf-16le") + ec.putback.should == "" + end + it "accepts an integer argument corresponding to the number of bytes to be put back" do ec = Encoding::Converter.new("utf-16le", "iso-8859-1") - src = "\x00\xd8\x61\x00" - dst = "" + src = +"\x00\xd8\x61\x00" + dst = +"" ec.primitive_convert(src, dst).should == :invalid_byte_sequence ec.primitive_errinfo.should == [:invalid_byte_sequence, "UTF-16LE", "UTF-8", "\x00\xD8", "a\x00"] - ec.putback(1).should == "\x00".force_encoding("utf-16le") - ec.putback.should == "a".force_encoding("utf-16le") + ec.putback(2).should == "a\x00".dup.force_encoding("utf-16le") ec.putback.should == "" end end diff --git a/spec/ruby/core/encoding/converter/replacement_spec.rb b/spec/ruby/core/encoding/converter/replacement_spec.rb index 5ca42e7e5a..ea514ca8dd 100644 --- a/spec/ruby/core/encoding/converter/replacement_spec.rb +++ b/spec/ruby/core/encoding/converter/replacement_spec.rb @@ -13,7 +13,7 @@ describe "Encoding::Converter#replacement" do it "returns \\uFFFD when the destination encoding is UTF-8" do ec = Encoding::Converter.new("us-ascii", "utf-8") - ec.replacement.should == "\u{fffd}".force_encoding('utf-8') + ec.replacement.should == "\u{fffd}".dup.force_encoding('utf-8') ec.replacement.encoding.should == Encoding::UTF_8 end end @@ -38,33 +38,33 @@ describe "Encoding::Converter#replacement=" do it "sets #replacement" do ec = Encoding::Converter.new("us-ascii", "utf-8") - ec.replacement.should == "\u{fffd}".force_encoding('utf-8') + ec.replacement.should == "\u{fffd}".dup.force_encoding('utf-8') ec.replacement = '?'.encode('utf-8') - ec.replacement.should == '?'.force_encoding('utf-8') + ec.replacement.should == '?'.dup.force_encoding('utf-8') end it "raises an UndefinedConversionError is the argument cannot be converted into the destination encoding" do ec = Encoding::Converter.new("sjis", "ascii") - utf8_q = "\u{986}".force_encoding('utf-8') - ec.primitive_convert(utf8_q.dup, "").should == :undefined_conversion + utf8_q = "\u{986}".dup.force_encoding('utf-8') + ec.primitive_convert(utf8_q.dup, +"").should == :undefined_conversion -> { ec.replacement = utf8_q }.should \ raise_error(Encoding::UndefinedConversionError) end it "does not change the replacement character if the argument cannot be converted into the destination encoding" do ec = Encoding::Converter.new("sjis", "ascii") - utf8_q = "\u{986}".force_encoding('utf-8') - ec.primitive_convert(utf8_q.dup, "").should == :undefined_conversion + utf8_q = "\u{986}".dup.force_encoding('utf-8') + ec.primitive_convert(utf8_q.dup, +"").should == :undefined_conversion -> { ec.replacement = utf8_q }.should \ raise_error(Encoding::UndefinedConversionError) - ec.replacement.should == "?".force_encoding('us-ascii') + ec.replacement.should == "?".dup.force_encoding('us-ascii') end it "uses the replacement character" do ec = Encoding::Converter.new("utf-8", "us-ascii", :invalid => :replace, :undef => :replace) ec.replacement = "!" - dest = "" - status = ec.primitive_convert "ä¸æ–‡123", dest + dest = +"" + status = ec.primitive_convert(+"ä¸æ–‡123", dest) status.should == :finished dest.should == "!!123" diff --git a/spec/ruby/core/encoding/default_external_spec.rb b/spec/ruby/core/encoding/default_external_spec.rb index e2cb9b02f4..9aae4976e0 100644 --- a/spec/ruby/core/encoding/default_external_spec.rb +++ b/spec/ruby/core/encoding/default_external_spec.rb @@ -17,6 +17,12 @@ describe "Encoding.default_external" do Encoding.default_external = Encoding::SHIFT_JIS Encoding.default_external.should == Encoding::SHIFT_JIS end + + platform_is :windows do + it 'is UTF-8 by default on Windows' do + Encoding.default_external.should == Encoding::UTF_8 + end + end end describe "Encoding.default_external=" do diff --git a/spec/ruby/core/encoding/inspect_spec.rb b/spec/ruby/core/encoding/inspect_spec.rb index 9a930b2a77..df96141db9 100644 --- a/spec/ruby/core/encoding/inspect_spec.rb +++ b/spec/ruby/core/encoding/inspect_spec.rb @@ -5,9 +5,23 @@ describe "Encoding#inspect" do Encoding::UTF_8.inspect.should be_an_instance_of(String) end - it "returns #<Encoding:name> for a non-dummy encoding named 'name'" do - Encoding.list.to_a.reject {|e| e.dummy? }.each do |enc| - enc.inspect.should =~ /#<Encoding:#{enc.name}>/ + ruby_version_is ""..."3.4" do + it "returns #<Encoding:name> for a non-dummy encoding named 'name'" do + Encoding.list.to_a.reject {|e| e.dummy? }.each do |enc| + enc.inspect.should =~ /#<Encoding:#{enc.name}>/ + end + end + end + + ruby_version_is "3.4" do + it "returns #<Encoding:name> for a non-dummy encoding named 'name'" do + Encoding.list.to_a.reject {|e| e.dummy? }.each do |enc| + if enc.name == "ASCII-8BIT" + enc.inspect.should == "#<Encoding:BINARY (ASCII-8BIT)>" + else + enc.inspect.should =~ /#<Encoding:#{enc.name}>/ + end + end end end diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_name_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_name_spec.rb index f5fa6f55e3..2b15fc1a0f 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_name_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_name_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::InvalidByteSequenceError#destination_encoding_name" do diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_spec.rb index 43be3ddd71..c2ed6de1d8 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/destination_encoding_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::InvalidByteSequenceError#destination_encoding" do diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/error_bytes_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/error_bytes_spec.rb index a8f7354b16..d2fc360dce 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/error_bytes_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/error_bytes_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: binary -*- +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::InvalidByteSequenceError#error_bytes" do diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/incomplete_input_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/incomplete_input_spec.rb index 94201a9b15..8a3f3de69a 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/incomplete_input_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/incomplete_input_spec.rb @@ -8,7 +8,7 @@ describe "Encoding::InvalidByteSequenceError#incomplete_input?" do it "returns true if #primitive_convert returned :incomplete_input for the same data" do ec = Encoding::Converter.new("EUC-JP", "ISO-8859-1") - ec.primitive_convert("\xA1",'').should == :incomplete_input + ec.primitive_convert(+"\xA1", +'').should == :incomplete_input begin ec.convert("\xA1") rescue Encoding::InvalidByteSequenceError => e @@ -18,7 +18,7 @@ describe "Encoding::InvalidByteSequenceError#incomplete_input?" do it "returns false if #primitive_convert returned :invalid_byte_sequence for the same data" do ec = Encoding::Converter.new("ascii", "utf-8") - ec.primitive_convert("\xfffffffff",'').should == :invalid_byte_sequence + ec.primitive_convert(+"\xfffffffff", +'').should == :invalid_byte_sequence begin ec.convert("\xfffffffff") rescue Encoding::InvalidByteSequenceError => e diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/readagain_bytes_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/readagain_bytes_spec.rb index 93823b5db4..a5e2824984 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/readagain_bytes_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/readagain_bytes_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: binary -*- +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::InvalidByteSequenceError#readagain_bytes" do @@ -14,11 +15,11 @@ describe "Encoding::InvalidByteSequenceError#readagain_bytes" do it "returns the bytes to be read again" do @exception.readagain_bytes.size.should == 1 - @exception.readagain_bytes.should == "a".force_encoding('binary') + @exception.readagain_bytes.should == "a".dup.force_encoding('binary') @exception.readagain_bytes.should == @errinfo[-1] @exception2.readagain_bytes.size.should == 1 - @exception2.readagain_bytes.should == "\xFF".force_encoding('binary') + @exception2.readagain_bytes.should == "\xFF".dup.force_encoding('binary') @exception2.readagain_bytes.should == @errinfo2[-1] end diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_name_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_name_spec.rb index bd3a51cbc5..a9464114a8 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_name_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_name_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::UndefinedConversionError#source_encoding_name" do diff --git a/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_spec.rb b/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_spec.rb index f43d6d5830..7fdc0a122b 100644 --- a/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_spec.rb +++ b/spec/ruby/core/encoding/invalid_byte_sequence_error/source_encoding_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::InvalidByteSequenceError#source_encoding" do diff --git a/spec/ruby/core/encoding/list_spec.rb b/spec/ruby/core/encoding/list_spec.rb index 8efd94ab9c..bd3d5b7bc0 100644 --- a/spec/ruby/core/encoding/list_spec.rb +++ b/spec/ruby/core/encoding/list_spec.rb @@ -40,10 +40,8 @@ describe "Encoding.list" do Encoding.list.should.include?(Encoding::UTF_8) end - ruby_version_is "2.7" do - it 'includes CESU-8 encoding' do - Encoding.list.should.include?(Encoding::CESU_8) - end + it 'includes CESU-8 encoding' do + Encoding.list.should.include?(Encoding::CESU_8) end # TODO: Find example that illustrates this diff --git a/spec/ruby/core/encoding/name_spec.rb b/spec/ruby/core/encoding/name_spec.rb index 5eadb1d2f5..dce9347978 100644 --- a/spec/ruby/core/encoding/name_spec.rb +++ b/spec/ruby/core/encoding/name_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/name' describe "Encoding#name" do diff --git a/spec/ruby/core/encoding/replicate_spec.rb b/spec/ruby/core/encoding/replicate_spec.rb index 45727a5c0d..e22673db7d 100644 --- a/spec/ruby/core/encoding/replicate_spec.rb +++ b/spec/ruby/core/encoding/replicate_spec.rb @@ -2,66 +2,87 @@ require_relative '../../spec_helper' describe "Encoding#replicate" do - before :all do - @i = 0 - end + ruby_version_is ""..."3.3" do + before :all do + @i = 0 + end - before :each do - @i += 1 - @prefix = "RS#{@i}" - end + before :each do + @i += 1 + @prefix = "RS#{@i}" + end - it "returns a replica of ASCII" do - name = @prefix + '-ASCII' - e = Encoding::ASCII.replicate(name) - e.name.should == name - Encoding.find(name).should == e + it "returns a replica of ASCII" do + name = @prefix + '-ASCII' + e = suppress_warning { Encoding::ASCII.replicate(name) } + e.name.should == name + Encoding.find(name).should == e - "a".force_encoding(e).valid_encoding?.should be_true - "\x80".force_encoding(e).valid_encoding?.should be_false - end + "a".dup.force_encoding(e).valid_encoding?.should be_true + "\x80".dup.force_encoding(e).valid_encoding?.should be_false + end - it "returns a replica of UTF-8" do - name = @prefix + 'UTF-8' - e = Encoding::UTF_8.replicate(name) - e.name.should == name - Encoding.find(name).should == e + it "returns a replica of UTF-8" do + name = @prefix + 'UTF-8' + e = suppress_warning { Encoding::UTF_8.replicate(name) } + e.name.should == name + Encoding.find(name).should == e - "a".force_encoding(e).valid_encoding?.should be_true - "\u3042".force_encoding(e).valid_encoding?.should be_true - "\x80".force_encoding(e).valid_encoding?.should be_false - end + "a".dup.force_encoding(e).valid_encoding?.should be_true + "\u3042".dup.force_encoding(e).valid_encoding?.should be_true + "\x80".dup.force_encoding(e).valid_encoding?.should be_false + end - it "returns a replica of UTF-16BE" do - name = @prefix + 'UTF-16-BE' - e = Encoding::UTF_16BE.replicate(name) - e.name.should == name - Encoding.find(name).should == e + it "returns a replica of UTF-16BE" do + name = @prefix + 'UTF-16-BE' + e = suppress_warning { Encoding::UTF_16BE.replicate(name) } + e.name.should == name + Encoding.find(name).should == e - "a".force_encoding(e).valid_encoding?.should be_false - "\x30\x42".force_encoding(e).valid_encoding?.should be_true - "\x80".force_encoding(e).valid_encoding?.should be_false - end + "a".dup.force_encoding(e).valid_encoding?.should be_false + "\x30\x42".dup.force_encoding(e).valid_encoding?.should be_true + "\x80".dup.force_encoding(e).valid_encoding?.should be_false + end - it "returns a replica of ISO-2022-JP" do - name = @prefix + 'ISO-2022-JP' - e = Encoding::ISO_2022_JP.replicate(name) - Encoding.find(name).should == e + it "returns a replica of ISO-2022-JP" do + name = @prefix + 'ISO-2022-JP' + e = suppress_warning { Encoding::ISO_2022_JP.replicate(name) } + Encoding.find(name).should == e - e.name.should == name - e.dummy?.should be_true + e.name.should == name + e.dummy?.should be_true + end + + # NOTE: it's unclear of the value of this (for the complexity cost of it), + # but it is the current CRuby behavior. + it "can be associated with a String" do + name = @prefix + '-US-ASCII' + e = suppress_warning { Encoding::US_ASCII.replicate(name) } + e.name.should == name + Encoding.find(name).should == e + + s = "abc".dup.force_encoding(e) + s.encoding.should == e + s.encoding.name.should == name + end end - # NOTE: it's unclear of the value of this (for the complexity cost of it), - # but it is the current CRuby behavior. - it "can be associated with a String" do - name = @prefix + '-US-ASCII' - e = Encoding::US_ASCII.replicate(name) - e.name.should == name - Encoding.find(name).should == e + ruby_version_is "3.2"..."3.3" do + it "warns about deprecation" do + -> { + Encoding::US_ASCII.replicate('MY-US-ASCII') + }.should complain(/warning: Encoding#replicate is deprecated and will be removed in Ruby 3.3; use the original encoding instead/) + end + + it "raises EncodingError if too many encodings" do + code = '1_000.times {|i| Encoding::US_ASCII.replicate("R_#{i}") }' + ruby_exe(code, args: "2>&1", exit_status: 1).should.include?('too many encoding (> 256) (EncodingError)') + end + end - s = "abc".force_encoding(e) - s.encoding.should == e - s.encoding.name.should == name + ruby_version_is "3.3" do + it "has been removed" do + Encoding::US_ASCII.should_not.respond_to?(:replicate, true) + end end end diff --git a/spec/ruby/core/encoding/to_s_spec.rb b/spec/ruby/core/encoding/to_s_spec.rb index 82d282386b..bab394a888 100644 --- a/spec/ruby/core/encoding/to_s_spec.rb +++ b/spec/ruby/core/encoding/to_s_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/name' describe "Encoding#to_s" do diff --git a/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_name_spec.rb b/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_name_spec.rb index 106fc7ecac..a51a9f46a0 100644 --- a/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_name_spec.rb +++ b/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_name_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::UndefinedConversionError#destination_encoding_name" do diff --git a/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_spec.rb b/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_spec.rb index c6e24732fd..905556407c 100644 --- a/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_spec.rb +++ b/spec/ruby/core/encoding/undefined_conversion_error/destination_encoding_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::UndefinedConversionError#destination_encoding" do diff --git a/spec/ruby/core/encoding/undefined_conversion_error/error_char_spec.rb b/spec/ruby/core/encoding/undefined_conversion_error/error_char_spec.rb index 780d81c1ee..9cb55e6d95 100644 --- a/spec/ruby/core/encoding/undefined_conversion_error/error_char_spec.rb +++ b/spec/ruby/core/encoding/undefined_conversion_error/error_char_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::UndefinedConversionError#error_char" do diff --git a/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_name_spec.rb b/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_name_spec.rb index 3b697cb82f..d5e60e78db 100644 --- a/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_name_spec.rb +++ b/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_name_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::UndefinedConversionError#source_encoding_name" do diff --git a/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_spec.rb b/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_spec.rb index 9101d51e11..de456a4b5a 100644 --- a/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_spec.rb +++ b/spec/ruby/core/encoding/undefined_conversion_error/source_encoding_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../../spec_helper" require_relative '../fixtures/classes' describe "Encoding::UndefinedConversionError#source_encoding" do diff --git a/spec/ruby/core/enumerable/all_spec.rb b/spec/ruby/core/enumerable/all_spec.rb index b782f94a3e..160cd52628 100644 --- a/spec/ruby/core/enumerable/all_spec.rb +++ b/spec/ruby/core/enumerable/all_spec.rb @@ -131,7 +131,6 @@ describe "Enumerable#all?" do pattern.yielded.should == [[0], [1], [2], [-1]] end - # may raise an exception in future versions it "always returns true on empty enumeration" do @empty.all?(Integer).should == true [].all?(Integer).should == true @@ -178,5 +177,11 @@ describe "Enumerable#all?" do multi.all?(pattern).should == true pattern.yielded.should == [[[1, 2]], [[3, 4, 5]], [[6, 7, 8, 9]]] end + + it "ignores the block if there is an argument" do + -> { + EnumerableSpecs::Numerous.new(1, 2, 3, 4, 5).all?(String) { true }.should == false + }.should complain(/given block not used/) + end end end diff --git a/spec/ruby/core/enumerable/any_spec.rb b/spec/ruby/core/enumerable/any_spec.rb index 636b1fa450..243f8735d5 100644 --- a/spec/ruby/core/enumerable/any_spec.rb +++ b/spec/ruby/core/enumerable/any_spec.rb @@ -145,7 +145,6 @@ describe "Enumerable#any?" do pattern.yielded.should == [[0], [1], [2]] end - # may raise an exception in future versions it "always returns false on empty enumeration" do @empty.any?(Integer).should == false [].any?(Integer).should == false @@ -191,5 +190,11 @@ describe "Enumerable#any?" do multi.any?(pattern).should == false pattern.yielded.should == [[[1, 2]], [[3, 4, 5]], [[6, 7, 8, 9]]] end + + it "ignores the block if there is an argument" do + -> { + EnumerableSpecs::Numerous.new(1, 2, 3, 4, 5).any?(String) { true }.should == false + }.should complain(/given block not used/) + end end end diff --git a/spec/ruby/core/enumerable/chunk_spec.rb b/spec/ruby/core/enumerable/chunk_spec.rb index c5579d67fa..ed6304307f 100644 --- a/spec/ruby/core/enumerable/chunk_spec.rb +++ b/spec/ruby/core/enumerable/chunk_spec.rb @@ -29,6 +29,11 @@ describe "Enumerable#chunk" do result.should == [[1, [1, 2]], [0, [3]], [1, [2]], [0, [3]], [1, [2, 1]]] end + it "returns a partitioned Array of values" do + e = EnumerableSpecs::Numerous.new(1,2,3) + e.chunk { |x| x > 2 }.map(&:last).should == [[1, 2], [3]] + end + it "returns elements for which the block returns :_alone in separate Arrays" do e = EnumerableSpecs::Numerous.new(1, 2, 3, 2, 1) result = e.chunk { |x| x < 2 && :_alone }.to_a diff --git a/spec/ruby/core/enumerable/compact_spec.rb b/spec/ruby/core/enumerable/compact_spec.rb new file mode 100644 index 0000000000..86e95dce08 --- /dev/null +++ b/spec/ruby/core/enumerable/compact_spec.rb @@ -0,0 +1,11 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is '3.1' do + describe "Enumerable#compact" do + it 'returns array without nil elements' do + arr = EnumerableSpecs::Numerous.new(nil, 1, 2, nil, true) + arr.compact.should == [1, 2, true] + end + end +end diff --git a/spec/ruby/core/enumerable/each_cons_spec.rb b/spec/ruby/core/enumerable/each_cons_spec.rb index 7d44f54f74..8fb31fb925 100644 --- a/spec/ruby/core/enumerable/each_cons_spec.rb +++ b/spec/ruby/core/enumerable/each_cons_spec.rb @@ -10,7 +10,7 @@ describe "Enumerable#each_cons" do it "passes element groups to the block" do acc = [] - @enum.each_cons(3){|g| acc << g}.should be_nil + @enum.each_cons(3){|g| acc << g} acc.should == @in_threes end @@ -27,7 +27,7 @@ describe "Enumerable#each_cons" do it "tries to convert n to an Integer using #to_int" do acc = [] - @enum.each_cons(3.3){|g| acc << g}.should == nil + @enum.each_cons(3.3){|g| acc << g} acc.should == @in_threes obj = mock('to_int') @@ -56,6 +56,12 @@ describe "Enumerable#each_cons" do multi.each_cons(2).to_a.should == [[[1, 2], [3, 4, 5]], [[3, 4, 5], [6, 7, 8, 9]]] end + ruby_version_is "3.1" do + it "returns self when a block is given" do + @enum.each_cons(3){}.should == @enum + end + end + describe "when no block is given" do it "returns an enumerator" do e = @enum.each_cons(3) diff --git a/spec/ruby/core/enumerable/each_slice_spec.rb b/spec/ruby/core/enumerable/each_slice_spec.rb index ab3b79c344..a57a1dba81 100644 --- a/spec/ruby/core/enumerable/each_slice_spec.rb +++ b/spec/ruby/core/enumerable/each_slice_spec.rb @@ -10,7 +10,7 @@ describe "Enumerable#each_slice" do it "passes element groups to the block" do acc = [] - @enum.each_slice(3){|g| acc << g}.should be_nil + @enum.each_slice(3){|g| acc << g} acc.should == @sliced end @@ -27,7 +27,7 @@ describe "Enumerable#each_slice" do it "tries to convert n to an Integer using #to_int" do acc = [] - @enum.each_slice(3.3){|g| acc << g}.should == nil + @enum.each_slice(3.3){|g| acc << g} acc.should == @sliced obj = mock('to_int') @@ -57,6 +57,12 @@ describe "Enumerable#each_slice" do e.to_a.should == @sliced end + ruby_version_is "3.1" do + it "returns self when a block is given" do + @enum.each_slice(3){}.should == @enum + end + end + it "gathers whole arrays as elements when each yields multiple" do multi = EnumerableSpecs::YieldsMulti.new multi.each_slice(2).to_a.should == [[[1, 2], [3, 4, 5]], [[6, 7, 8, 9]]] diff --git a/spec/ruby/core/enumerable/filter_map_spec.rb b/spec/ruby/core/enumerable/filter_map_spec.rb index 31acc277b4..aa4894230b 100644 --- a/spec/ruby/core/enumerable/filter_map_spec.rb +++ b/spec/ruby/core/enumerable/filter_map_spec.rb @@ -1,26 +1,24 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is '2.7' do - describe 'Enumerable#filter_map' do - before :each do - @numerous = EnumerableSpecs::Numerous.new(*(1..8).to_a) - end +describe 'Enumerable#filter_map' do + before :each do + @numerous = EnumerableSpecs::Numerous.new(*(1..8).to_a) + end - it 'returns an empty array if there are no elements' do - EnumerableSpecs::Empty.new.filter_map { true }.should == [] - end + it 'returns an empty array if there are no elements' do + EnumerableSpecs::Empty.new.filter_map { true }.should == [] + end - it 'returns an array with truthy results of passing each element to block' do - @numerous.filter_map { |i| i * 2 if i.even? }.should == [4, 8, 12, 16] - @numerous.filter_map { |i| i * 2 }.should == [2, 4, 6, 8, 10, 12, 14, 16] - @numerous.filter_map { 0 }.should == [0, 0, 0, 0, 0, 0, 0, 0] - @numerous.filter_map { false }.should == [] - @numerous.filter_map { nil }.should == [] - end + it 'returns an array with truthy results of passing each element to block' do + @numerous.filter_map { |i| i * 2 if i.even? }.should == [4, 8, 12, 16] + @numerous.filter_map { |i| i * 2 }.should == [2, 4, 6, 8, 10, 12, 14, 16] + @numerous.filter_map { 0 }.should == [0, 0, 0, 0, 0, 0, 0, 0] + @numerous.filter_map { false }.should == [] + @numerous.filter_map { nil }.should == [] + end - it 'returns an enumerator when no block given' do - @numerous.filter_map.should be_an_instance_of(Enumerator) - end + it 'returns an enumerator when no block given' do + @numerous.filter_map.should be_an_instance_of(Enumerator) end end diff --git a/spec/ruby/core/enumerable/fixtures/classes.rb b/spec/ruby/core/enumerable/fixtures/classes.rb index fb4951c6e6..2701c6999c 100644 --- a/spec/ruby/core/enumerable/fixtures/classes.rb +++ b/spec/ruby/core/enumerable/fixtures/classes.rb @@ -342,4 +342,10 @@ module EnumerableSpecs @block.call(*args) end end + + # Set is a core class since Ruby 3.2 + ruby_version_is '3.2' do + class SetSubclass < Set + end + end end # EnumerableSpecs utility classes diff --git a/spec/ruby/core/enumerable/grep_spec.rb b/spec/ruby/core/enumerable/grep_spec.rb index 4e66bb85ea..989358f01b 100644 --- a/spec/ruby/core/enumerable/grep_spec.rb +++ b/spec/ruby/core/enumerable/grep_spec.rb @@ -40,25 +40,28 @@ describe "Enumerable#grep" do $~.should == nil end - ruby_version_is ""..."3.0.0" do - it "sets $~ to the last match when given no block" do - "z" =~ /z/ # Reset $~ - ["abc", "def"].grep(/b/).should == ["abc"] - - # Set by the failed match of "def" - $~.should == nil + it "does not set $~ when given no block" do + "z" =~ /z/ # Reset $~ + ["abc", "def"].grep(/b/).should == ["abc"] + $&.should == "z" + end - ["abc", "def"].grep(/e/) - $&.should == "e" - end + it "does not modify Regexp.last_match without block" do + "z" =~ /z/ # Reset last match + ["abc", "def"].grep(/b/).should == ["abc"] + Regexp.last_match[0].should == "z" end - ruby_version_is "3.0.0" do - it "does not set $~ when given no block" do - "z" =~ /z/ # Reset $~ - ["abc", "def"].grep(/b/).should == ["abc"] - $&.should == "z" + it "correctly handles non-string elements" do + 'set last match' =~ /set last (.*)/ + [:a, 'b', 'z', :c, 42, nil].grep(/[a-d]/).should == [:a, 'b', :c] + $1.should == 'match' + + o = Object.new + def o.to_str + 'hello' end + [o].grep(/ll/).first.should.equal?(o) end describe "with a block" do diff --git a/spec/ruby/core/enumerable/grep_v_spec.rb b/spec/ruby/core/enumerable/grep_v_spec.rb index 8cae3ac618..ba19216968 100644 --- a/spec/ruby/core/enumerable/grep_v_spec.rb +++ b/spec/ruby/core/enumerable/grep_v_spec.rb @@ -20,25 +20,28 @@ describe "Enumerable#grep_v" do $&.should == "e" end - ruby_version_is ""..."3.0.0" do - it "sets $~ to the last match when given no block" do - "z" =~ /z/ # Reset $~ - ["abc", "def"].grep_v(/e/).should == ["abc"] - - # Set by the match of "def" - $&.should == "e" + it "does not set $~ when given no block" do + "z" =~ /z/ # Reset $~ + ["abc", "def"].grep_v(/e/).should == ["abc"] + $&.should == "z" + end - ["abc", "def"].grep_v(/b/) - $&.should == nil - end + it "does not modify Regexp.last_match without block" do + "z" =~ /z/ # Reset last match + ["abc", "def"].grep_v(/e/).should == ["abc"] + Regexp.last_match[0].should == "z" end - ruby_version_is "3.0.0" do - it "does not set $~ when given no block" do - "z" =~ /z/ # Reset $~ - ["abc", "def"].grep_v(/e/).should == ["abc"] - $&.should == "z" + it "correctly handles non-string elements" do + 'set last match' =~ /set last (.*)/ + [:a, 'b', 'z', :c, 42, nil].grep_v(/[a-d]/).should == ['z', 42, nil] + $1.should == 'match' + + o = Object.new + def o.to_str + 'hello' end + [o].grep_v(/mm/).first.should.equal?(o) end describe "without block" do diff --git a/spec/ruby/core/enumerable/group_by_spec.rb b/spec/ruby/core/enumerable/group_by_spec.rb index 52b5a68d64..4fd1603819 100644 --- a/spec/ruby/core/enumerable/group_by_spec.rb +++ b/spec/ruby/core/enumerable/group_by_spec.rb @@ -33,15 +33,5 @@ describe "Enumerable#group_by" do [3, 4, 5] => [[3, 4, 5]] } end - ruby_version_is ''...'2.7' do - it "returns a tainted hash if self is tainted" do - EnumerableSpecs::Empty.new.taint.group_by {}.tainted?.should be_true - end - - it "returns an untrusted hash if self is untrusted" do - EnumerableSpecs::Empty.new.untrust.group_by {}.untrusted?.should be_true - end - end - it_behaves_like :enumerable_enumeratorized_with_origin_size, :group_by end diff --git a/spec/ruby/core/enumerable/none_spec.rb b/spec/ruby/core/enumerable/none_spec.rb index b898d00063..fb42f13386 100644 --- a/spec/ruby/core/enumerable/none_spec.rb +++ b/spec/ruby/core/enumerable/none_spec.rb @@ -100,7 +100,6 @@ describe "Enumerable#none?" do pattern.yielded.should == [[0], [1], [2], [-1]] end - # may raise an exception in future versions it "always returns true on empty enumeration" do @empty.none?(Integer).should == true [].none?(Integer).should == true @@ -144,5 +143,11 @@ describe "Enumerable#none?" do multi.none?(pattern).should == true pattern.yielded.should == [[[1, 2]], [[3, 4, 5]], [[6, 7, 8, 9]]] end + + it "ignores the block if there is an argument" do + -> { + EnumerableSpecs::Numerous.new(1, 2, 3, 4, 5).none?(String) { true }.should == true + }.should complain(/given block not used/) + end end end diff --git a/spec/ruby/core/enumerable/one_spec.rb b/spec/ruby/core/enumerable/one_spec.rb index d54dd4a527..4bf8623d2e 100644 --- a/spec/ruby/core/enumerable/one_spec.rb +++ b/spec/ruby/core/enumerable/one_spec.rb @@ -83,7 +83,6 @@ describe "Enumerable#one?" do end end - describe 'when given a pattern argument' do it "calls `===` on the pattern the return value " do pattern = EnumerableSpecs::Pattern.new { |x| x == 1 } @@ -91,7 +90,6 @@ describe "Enumerable#one?" do pattern.yielded.should == [[0], [1], [2], [-1]] end - # may raise an exception in future versions it "always returns false on empty enumeration" do @empty.one?(Integer).should == false [].one?(Integer).should == false @@ -146,5 +144,11 @@ describe "Enumerable#one?" do multi.one?(pattern).should == false pattern.yielded.should == [[[1, 2]], [[3, 4, 5]], [[6, 7, 8, 9]]] end + + it "ignores the block if there is an argument" do + -> { + EnumerableSpecs::Numerous.new(1, 2, 3, 4, "5").one?(String) { false }.should == true + }.should complain(/given block not used/) + end end end diff --git a/spec/ruby/core/enumerable/shared/collect.rb b/spec/ruby/core/enumerable/shared/collect.rb index 32c1722c75..6df1a616eb 100644 --- a/spec/ruby/core/enumerable/shared/collect.rb +++ b/spec/ruby/core/enumerable/shared/collect.rb @@ -89,5 +89,19 @@ describe :enumerable_collect, shared: true do end.should raise_error(ArgumentError) end + it "calls the each method on sub-classes" do + c = Class.new(Hash) do + def each + ScratchPad << 'in each' + super + end + end + h = c.new + h[1] = 'a' + ScratchPad.record [] + h.send(@method) { |k,v| v } + ScratchPad.recorded.should == ['in each'] + end + it_should_behave_like :enumerable_enumeratorized_with_origin_size end diff --git a/spec/ruby/core/enumerable/shared/entries.rb b/spec/ruby/core/enumerable/shared/entries.rb index 590ce73bcf..e32eb23d2a 100644 --- a/spec/ruby/core/enumerable/shared/entries.rb +++ b/spec/ruby/core/enumerable/shared/entries.rb @@ -13,14 +13,4 @@ describe :enumerable_entries, shared: true do count.send(@method, :hello, "world").should == [1, 2, 3] count.arguments_passed.should == [:hello, "world"] end - - ruby_version_is ''...'2.7' do - it "returns a tainted array if self is tainted" do - EnumerableSpecs::Empty.new.taint.send(@method).tainted?.should be_true - end - - it "returns an untrusted array if self is untrusted" do - EnumerableSpecs::Empty.new.untrust.send(@method).untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/enumerable/shared/inject.rb b/spec/ruby/core/enumerable/shared/inject.rb index 12e0665dda..693d34d675 100644 --- a/spec/ruby/core/enumerable/shared/inject.rb +++ b/spec/ruby/core/enumerable/shared/inject.rb @@ -1,3 +1,5 @@ +require_relative '../../array/shared/iterable_and_tolerating_size_increasing' + describe :enumerable_inject, shared: true do it "with argument takes a block with an accumulator (with argument as initial value) and the current element. Value of block becomes new accumulator" do a = [] @@ -17,7 +19,22 @@ describe :enumerable_inject, shared: true do end it "ignores the block if two arguments" do - EnumerableSpecs::Numerous.new(1, 2, 3).send(@method, 10, :-){ raise "we never get here"}.should == 4 + -> { + EnumerableSpecs::Numerous.new(1, 2, 3).send(@method, 10, :-) { raise "we never get here"}.should == 4 + }.should complain(/#{__FILE__}:#{__LINE__-1}: warning: given block not used/, verbose: true) + + -> { + [1, 2, 3].send(@method, 10, :-) { raise "we never get here"}.should == 4 + }.should complain(/#{__FILE__}:#{__LINE__-1}: warning: given block not used/, verbose: true) + end + + it "does not warn when given a Symbol with $VERBOSE true" do + -> { + [1, 2].send(@method, 0, :+) + [1, 2].send(@method, :+) + EnumerableSpecs::Numerous.new(1, 2).send(@method, 0, :+) + EnumerableSpecs::Numerous.new(1, 2).send(@method, :+) + }.should_not complain(verbose: true) end it "can take a symbol argument" do @@ -30,10 +47,10 @@ describe :enumerable_inject, shared: true do a.should == [[2, 5], [5, 3], [3, 6], [6, 1], [1, 4]] end - it "gathers whole arrays as elements when each yields multiple" do - multi = EnumerableSpecs::YieldsMulti.new - multi.send(@method, []) {|acc, e| acc << e }.should == [[1, 2], [3, 4, 5], [6, 7, 8, 9]] - end + it "gathers whole arrays as elements when each yields multiple" do + multi = EnumerableSpecs::YieldsMulti.new + multi.send(@method, []) {|acc, e| acc << e }.should == [[1, 2], [3, 4, 5], [6, 7, 8, 9]] + end it "with inject arguments(legacy rubycon)" do # with inject argument @@ -66,4 +83,27 @@ describe :enumerable_inject, shared: true do it "returns nil when fails(legacy rubycon)" do EnumerableSpecs::EachDefiner.new().send(@method) {|acc,x| 999 }.should == nil end + + it "tolerates increasing a collection size during iterating Array" do + array = [:a, :b, :c] + ScratchPad.record [] + i = 0 + + array.send(@method, nil) do |_, e| + ScratchPad << e + array << i if i < 100 + i += 1 + end + + actual = ScratchPad.recorded + expected = [:a, :b, :c] + (0..99).to_a + actual.sort_by(&:to_s).should == expected.sort_by(&:to_s) + end + + ruby_bug '#18635', ''...'3.2' do + it "raises an ArgumentError when no parameters or block is given" do + -> { [1,2].send(@method) }.should raise_error(ArgumentError) + -> { {one: 1, two: 2}.send(@method) }.should raise_error(ArgumentError) + end + end end diff --git a/spec/ruby/core/enumerable/sum_spec.rb b/spec/ruby/core/enumerable/sum_spec.rb index c9d7017b45..2eb74db6ac 100644 --- a/spec/ruby/core/enumerable/sum_spec.rb +++ b/spec/ruby/core/enumerable/sum_spec.rb @@ -22,7 +22,29 @@ describe 'Enumerable#sum' do @enum.sum.should == 5/3r end - it 'takes a block to transform the elements' do - @enum.sum { |element| element * 2 }.should == 10/3r + context 'with a block' do + it 'transforms the elements' do + @enum.sum { |element| element * 2 }.should == 10/3r + end + + it 'does not destructure array elements' do + class << @enum + def each + yield [1,2] + yield [3] + end + end + + @enum.sum(&:last).should == 5 + end + end + + # https://bugs.ruby-lang.org/issues/12217 + # https://github.com/ruby/ruby/blob/master/doc/ChangeLog/ChangeLog-2.4.0#L6208-L6214 + it "uses Kahan's compensated summation algorithm for precise sum of float numbers" do + floats = [2.7800000000000002, 5.0, 2.5, 4.44, 3.89, 3.89, 4.44, 7.78, 5.0, 2.7800000000000002, 5.0, 2.5].to_enum + naive_sum = floats.reduce { |sum, e| sum + e } + naive_sum.should == 50.00000000000001 + floats.sum.should == 50.0 end end diff --git a/spec/ruby/core/enumerable/tally_spec.rb b/spec/ruby/core/enumerable/tally_spec.rb index c23ea11697..e0edc8dc75 100644 --- a/spec/ruby/core/enumerable/tally_spec.rb +++ b/spec/ruby/core/enumerable/tally_spec.rb @@ -1,36 +1,34 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is "2.7" do - describe "Enumerable#tally" do - before :each do - ScratchPad.record [] - end +describe "Enumerable#tally" do + before :each do + ScratchPad.record [] + end - it "returns a hash with counts according to the value" do - enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') - enum.tally.should == { 'foo' => 2, 'bar' => 1, 'baz' => 1} - end + it "returns a hash with counts according to the value" do + enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') + enum.tally.should == { 'foo' => 2, 'bar' => 1, 'baz' => 1} + end - it "returns a hash without default" do - hash = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz').tally - hash.default_proc.should be_nil - hash.default.should be_nil - end + it "returns a hash without default" do + hash = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz').tally + hash.default_proc.should be_nil + hash.default.should be_nil + end - it "returns an empty hash for empty enumerables" do - EnumerableSpecs::Empty.new.tally.should == {} - end + it "returns an empty hash for empty enumerables" do + EnumerableSpecs::Empty.new.tally.should == {} + end - it "counts values as gathered array when yielded with multiple arguments" do - EnumerableSpecs::YieldsMixed2.new.tally.should == EnumerableSpecs::YieldsMixed2.gathered_yields.group_by(&:itself).transform_values(&:size) - end + it "counts values as gathered array when yielded with multiple arguments" do + EnumerableSpecs::YieldsMixed2.new.tally.should == EnumerableSpecs::YieldsMixed2.gathered_yields.group_by(&:itself).transform_values(&:size) + end - it "does not call given block" do - enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') - enum.tally { |v| ScratchPad << v } - ScratchPad.recorded.should == [] - end + it "does not call given block" do + enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') + enum.tally { |v| ScratchPad << v } + ScratchPad.recorded.should == [] end end @@ -51,13 +49,26 @@ ruby_version_is "3.1" do enum.tally(hash).should equal(hash) end - it "raises a FrozenError and does not udpate the given hash when the hash is frozen" do + it "calls #to_hash to convert argument to Hash implicitly if passed not a Hash" do + enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') + object = Object.new + def object.to_hash; { 'foo' => 1 }; end + enum.tally(object).should == { 'foo' => 3, 'bar' => 1, 'baz' => 1} + end + + it "raises a FrozenError and does not update the given hash when the hash is frozen" do enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') hash = { 'foo' => 1 }.freeze -> { enum.tally(hash) }.should raise_error(FrozenError) hash.should == { 'foo' => 1 } end + it "raises a FrozenError even if enumerable is empty" do + enum = EnumerableSpecs::Numerous.new() + hash = { 'foo' => 1 }.freeze + -> { enum.tally(hash) }.should raise_error(FrozenError) + end + it "does not call given block" do enum = EnumerableSpecs::Numerous.new('foo', 'bar', 'foo', 'baz') enum.tally({ 'foo' => 1 }) { |v| ScratchPad << v } diff --git a/spec/ruby/core/enumerable/to_set_spec.rb b/spec/ruby/core/enumerable/to_set_spec.rb new file mode 100644 index 0000000000..c21a2772c4 --- /dev/null +++ b/spec/ruby/core/enumerable/to_set_spec.rb @@ -0,0 +1,29 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is "3.2" do + describe "Enumerable#to_set" do + it "returns a new Set created from self" do + [1, 2, 3].to_set.should == Set[1, 2, 3] + {a: 1, b: 2}.to_set.should == Set[[:b, 2], [:a, 1]] + end + + it "passes down passed blocks" do + [1, 2, 3].to_set { |x| x * x }.should == Set[1, 4, 9] + end + + it "instantiates an object of provided as the first argument set class" do + set = [1, 2, 3].to_set(EnumerableSpecs::SetSubclass) + set.should be_kind_of(EnumerableSpecs::SetSubclass) + set.to_a.sort.should == [1, 2, 3] + end + + it "does not need explicit `require 'set'`" do + output = ruby_exe(<<~RUBY, options: '--disable-gems', args: '2>&1') + puts [1, 2, 3].to_set + RUBY + + output.chomp.should == "#<Set: {1, 2, 3}>" + end + end +end diff --git a/spec/ruby/core/enumerable/uniq_spec.rb b/spec/ruby/core/enumerable/uniq_spec.rb index e58dd36366..a1ed44796f 100644 --- a/spec/ruby/core/enumerable/uniq_spec.rb +++ b/spec/ruby/core/enumerable/uniq_spec.rb @@ -31,76 +31,32 @@ describe 'Enumerable#uniq' do [x, y].to_enum.uniq.should == [x, y] end - ruby_version_is '2.7' do - it "compares elements with matching hash codes with #eql?" do - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - false - end - - obj - end - - a.uniq.should == a + it "compares elements with matching hash codes with #eql?" do + a = Array.new(2) do + obj = mock('0') + obj.should_receive(:hash).at_least(1).and_return(0) - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - true - end - - obj + def obj.eql?(o) + false end - a.to_enum.uniq.size.should == 1 + obj end - end - ruby_version_is ''...'2.7' do - it "compares elements with matching hash codes with #eql?" do - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - # It's undefined whether the impl does a[0].eql?(a[1]) or - # a[1].eql?(a[0]) so we taint both. - taint - o.taint - false - end - - obj - end - - a.uniq.should == a - a[0].should.tainted? - a[1].should.tainted? + a.uniq.should == a - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) + a = Array.new(2) do + obj = mock('0') + obj.should_receive(:hash).at_least(1).and_return(0) - def obj.eql?(o) - # It's undefined whether the impl does a[0].eql?(a[1]) or - # a[1].eql?(a[0]) so we taint both. - taint - o.taint - true - end - - obj + def obj.eql?(o) + true end - a.to_enum.uniq.size.should == 1 - a[0].should.tainted? - a[1].should.tainted? + obj end + + a.to_enum.uniq.size.should == 1 end context 'when yielded with multiple arguments' do diff --git a/spec/ruby/core/enumerable/zip_spec.rb b/spec/ruby/core/enumerable/zip_spec.rb index 9ec15aa030..ab148f2a6e 100644 --- a/spec/ruby/core/enumerable/zip_spec.rb +++ b/spec/ruby/core/enumerable/zip_spec.rb @@ -38,4 +38,9 @@ describe "Enumerable#zip" do multi.zip(multi).should == [[[1, 2], [1, 2]], [[3, 4, 5], [3, 4, 5]], [[6, 7, 8, 9], [6, 7, 8, 9]]] end + it "raises TypeError when some argument isn't Array and doesn't respond to #to_ary and #to_enum" do + -> { EnumerableSpecs::Numerous.new(1,2,3).zip(Object.new) }.should raise_error(TypeError, "wrong argument type Object (must respond to :each)") + -> { EnumerableSpecs::Numerous.new(1,2,3).zip(1) }.should raise_error(TypeError, "wrong argument type Integer (must respond to :each)") + -> { EnumerableSpecs::Numerous.new(1,2,3).zip(true) }.should raise_error(TypeError, "wrong argument type TrueClass (must respond to :each)") + end end diff --git a/spec/ruby/core/enumerator/arithmetic_sequence/begin_spec.rb b/spec/ruby/core/enumerator/arithmetic_sequence/begin_spec.rb index bed30c546d..bd243fa0b5 100644 --- a/spec/ruby/core/enumerator/arithmetic_sequence/begin_spec.rb +++ b/spec/ruby/core/enumerator/arithmetic_sequence/begin_spec.rb @@ -6,4 +6,11 @@ describe "Enumerator::ArithmeticSequence#begin" do (1..10).step.begin.should == 1 (1...10).step.begin.should == 1 end + + context "with beginless" do + it "returns nil as begin of the sequence" do + (..10).step(1).begin.should == nil + (...10).step(1).begin.should == nil + end + end end diff --git a/spec/ruby/core/enumerator/arithmetic_sequence/end_spec.rb b/spec/ruby/core/enumerator/arithmetic_sequence/end_spec.rb index 29e6e105cf..05429cac3e 100644 --- a/spec/ruby/core/enumerator/arithmetic_sequence/end_spec.rb +++ b/spec/ruby/core/enumerator/arithmetic_sequence/end_spec.rb @@ -6,4 +6,11 @@ describe "Enumerator::ArithmeticSequence#end" do (1..10).step.end.should == 10 (1...10).step(17).end.should == 10 end + + context "with endless" do + it "returns nil as end of the sequence" do + (1..).step(1).end.should == nil + (1...).step(1).end.should == nil + end + end end diff --git a/spec/ruby/core/enumerator/chain/initialize_spec.rb b/spec/ruby/core/enumerator/chain/initialize_spec.rb index 69484dfcb4..daa30351d7 100644 --- a/spec/ruby/core/enumerator/chain/initialize_spec.rb +++ b/spec/ruby/core/enumerator/chain/initialize_spec.rb @@ -22,10 +22,10 @@ describe "Enumerator::Chain#initialize" do end describe "on frozen instance" do - it "raises a RuntimeError" do + it "raises a FrozenError" do -> { @uninitialized.freeze.send(:initialize) - }.should raise_error(RuntimeError) + }.should raise_error(FrozenError) end end end diff --git a/spec/ruby/core/enumerator/chain/inspect_spec.rb b/spec/ruby/core/enumerator/chain/inspect_spec.rb index a0450c808a..9b5a442b75 100644 --- a/spec/ruby/core/enumerator/chain/inspect_spec.rb +++ b/spec/ruby/core/enumerator/chain/inspect_spec.rb @@ -11,4 +11,8 @@ describe "Enumerator::Chain#inspect" do obj.should_receive(:inspect).and_return('some desc') Enumerator::Chain.new(obj).inspect.should == "#<Enumerator::Chain: [some desc]>" end + + it "returns a not initialized representation if #initialized is not called yet" do + Enumerator::Chain.allocate.inspect.should == "#<Enumerator::Chain: uninitialized>" + end end diff --git a/spec/ruby/core/enumerator/each_spec.rb b/spec/ruby/core/enumerator/each_spec.rb index 99ac3120af..3af16e5587 100644 --- a/spec/ruby/core/enumerator/each_spec.rb +++ b/spec/ruby/core/enumerator/each_spec.rb @@ -10,41 +10,41 @@ describe "Enumerator#each" do @enum_with_arguments = object_each_with_arguments.to_enum(:each_with_arguments, :arg0, :arg1, :arg2) - @enum_with_yielder = Enumerator.new {|y| y.yield :ok} + @enum_with_yielder = Enumerator.new { |y| y.yield :ok } end it "yields each element of self to the given block" do acc = [] - [1,2,3].to_enum.each {|e| acc << e } - acc.should == [1,2,3] + [1, 2, 3].to_enum.each { |e| acc << e } + acc.should == [1, 2, 3] end it "calls #each on the object given in the constructor by default" do each = mock('each') each.should_receive(:each) - each.to_enum.each {|e| e } + each.to_enum.each { |e| e } end it "calls #each on the underlying object until it's exhausted" do each = mock('each') each.should_receive(:each).and_yield(1).and_yield(2).and_yield(3) acc = [] - each.to_enum.each {|e| acc << e } - acc.should == [1,2,3] + each.to_enum.each { |e| acc << e } + acc.should == [1, 2, 3] end it "calls the method given in the constructor instead of #each" do each = mock('peach') each.should_receive(:peach) - each.to_enum(:peach).each {|e| e } + each.to_enum(:peach).each { |e| e } end it "calls the method given in the constructor until it's exhausted" do each = mock('peach') each.should_receive(:peach).and_yield(1).and_yield(2).and_yield(3) acc = [] - each.to_enum(:peach).each {|e| acc << e } - acc.should == [1,2,3] + each.to_enum(:peach).each { |e| acc << e } + acc.should == [1, 2, 3] end it "raises a NoMethodError if the object doesn't respond to #each" do diff --git a/spec/ruby/core/enumerator/generator/initialize_spec.rb b/spec/ruby/core/enumerator/generator/initialize_spec.rb index f75c7d6f26..acc1174253 100644 --- a/spec/ruby/core/enumerator/generator/initialize_spec.rb +++ b/spec/ruby/core/enumerator/generator/initialize_spec.rb @@ -17,10 +17,10 @@ describe "Enumerator::Generator#initialize" do end describe "on frozen instance" do - it "raises a RuntimeError" do + it "raises a FrozenError" do -> { @uninitialized.freeze.send(:initialize) {} - }.should raise_error(RuntimeError) + }.should raise_error(FrozenError) end end end diff --git a/spec/ruby/core/enumerator/initialize_spec.rb b/spec/ruby/core/enumerator/initialize_spec.rb index 217af1d3bc..5e0256ca46 100644 --- a/spec/ruby/core/enumerator/initialize_spec.rb +++ b/spec/ruby/core/enumerator/initialize_spec.rb @@ -11,14 +11,6 @@ describe "Enumerator#initialize" do Enumerator.should have_private_instance_method(:initialize, false) end - ruby_version_is ''...'3.0' do - it "returns self when given an object" do - suppress_warning do - @uninitialized.send(:initialize, Object.new).should equal(@uninitialized) - end - end - end - it "returns self when given a block" do @uninitialized.send(:initialize) {}.should equal(@uninitialized) end @@ -56,10 +48,10 @@ describe "Enumerator#initialize" do end describe "on frozen instance" do - it "raises a RuntimeError" do + it "raises a FrozenError" do -> { @uninitialized.freeze.send(:initialize) {} - }.should raise_error(RuntimeError) + }.should raise_error(FrozenError) end end end diff --git a/spec/ruby/core/enumerator/inspect_spec.rb b/spec/ruby/core/enumerator/inspect_spec.rb index 3bcf07e754..7e97864246 100644 --- a/spec/ruby/core/enumerator/inspect_spec.rb +++ b/spec/ruby/core/enumerator/inspect_spec.rb @@ -14,4 +14,9 @@ describe "Enumerator#inspect" do (1..3).each.each_slice(2).inspect.should == "#<Enumerator: #<Enumerator: 1..3:each>:each_slice(2)>" end end + + it "returns a not initialized representation if #initialized is not called yet" do + Enumerator.allocate.inspect.should == "#<Enumerator: uninitialized>" + Enumerator::Lazy.allocate.inspect.should == "#<Enumerator::Lazy: uninitialized>" + end end diff --git a/spec/ruby/core/enumerator/lazy/compact_spec.rb b/spec/ruby/core/enumerator/lazy/compact_spec.rb new file mode 100644 index 0000000000..e678bc71eb --- /dev/null +++ b/spec/ruby/core/enumerator/lazy/compact_spec.rb @@ -0,0 +1,16 @@ +require_relative '../../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is '3.1' do + describe "Enumerator::Lazy#compact" do + it 'returns array without nil elements' do + arr = [1, nil, 3, false, 5].to_enum.lazy.compact + arr.should be_an_instance_of(Enumerator::Lazy) + arr.force.should == [1, 3, false, 5] + end + + it "sets #size to nil" do + Enumerator::Lazy.new(Object.new, 100) {}.compact.size.should == nil + end + end +end diff --git a/spec/ruby/core/enumerator/lazy/eager_spec.rb b/spec/ruby/core/enumerator/lazy/eager_spec.rb index 30ba2dfe0e..592da4fd8c 100644 --- a/spec/ruby/core/enumerator/lazy/eager_spec.rb +++ b/spec/ruby/core/enumerator/lazy/eager_spec.rb @@ -1,29 +1,27 @@ require_relative '../../../spec_helper' -ruby_version_is "2.7" do - describe "Enumerator::Lazy#eager" do - it "returns a non-lazy Enumerator converted from the lazy enumerator" do - enum = [1, 2, 3].lazy +describe "Enumerator::Lazy#eager" do + it "returns a non-lazy Enumerator converted from the lazy enumerator" do + enum = [1, 2, 3].lazy - enum.class.should == Enumerator::Lazy - enum.eager.class.should == Enumerator - end + enum.class.should == Enumerator::Lazy + enum.eager.class.should == Enumerator + end - it "does not enumerate an enumerator" do - ScratchPad.record [] + it "does not enumerate an enumerator" do + ScratchPad.record [] - sequence = [1, 2, 3] - enum_lazy = Enumerator::Lazy.new(sequence) do |yielder, value| - yielder << value - ScratchPad << value - end + sequence = [1, 2, 3] + enum_lazy = Enumerator::Lazy.new(sequence) do |yielder, value| + yielder << value + ScratchPad << value + end - ScratchPad.recorded.should == [] - enum = enum_lazy.eager - ScratchPad.recorded.should == [] + ScratchPad.recorded.should == [] + enum = enum_lazy.eager + ScratchPad.recorded.should == [] - enum.map { |i| i }.should == [1, 2, 3] - ScratchPad.recorded.should == [1, 2, 3] - end + enum.map { |i| i }.should == [1, 2, 3] + ScratchPad.recorded.should == [1, 2, 3] end end diff --git a/spec/ruby/core/enumerator/lazy/filter_map_spec.rb b/spec/ruby/core/enumerator/lazy/filter_map_spec.rb index 3480af0865..99dd59cebe 100644 --- a/spec/ruby/core/enumerator/lazy/filter_map_spec.rb +++ b/spec/ruby/core/enumerator/lazy/filter_map_spec.rb @@ -3,14 +3,12 @@ require_relative '../../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is "2.7" do - describe "Enumerator::Lazy#filter_map" do - it "maps only truthy results" do - (1..Float::INFINITY).lazy.filter_map { |i| i if i.odd? }.first(4).should == [1, 3, 5, 7] - end +describe "Enumerator::Lazy#filter_map" do + it "maps only truthy results" do + (1..Float::INFINITY).lazy.filter_map { |i| i if i.odd? }.first(4).should == [1, 3, 5, 7] + end - it "does not map false results" do - (1..Float::INFINITY).lazy.filter_map { |i| i.odd? ? i : false }.first(4).should == [1, 3, 5, 7] - end + it "does not map false results" do + (1..Float::INFINITY).lazy.filter_map { |i| i.odd? ? i : false }.first(4).should == [1, 3, 5, 7] end end diff --git a/spec/ruby/core/enumerator/lazy/initialize_spec.rb b/spec/ruby/core/enumerator/lazy/initialize_spec.rb index f23018d010..e1e0b1d608 100644 --- a/spec/ruby/core/enumerator/lazy/initialize_spec.rb +++ b/spec/ruby/core/enumerator/lazy/initialize_spec.rb @@ -56,8 +56,8 @@ describe "Enumerator::Lazy#initialize" do end describe "on frozen instance" do - it "raises a RuntimeError" do - -> { @uninitialized.freeze.send(:initialize, @receiver) {} }.should raise_error(RuntimeError) + it "raises a FrozenError" do + -> { @uninitialized.freeze.send(:initialize, @receiver) {} }.should raise_error(FrozenError) end end end diff --git a/spec/ruby/core/enumerator/lazy/lazy_spec.rb b/spec/ruby/core/enumerator/lazy/lazy_spec.rb index cde9b31066..0fb104e25a 100644 --- a/spec/ruby/core/enumerator/lazy/lazy_spec.rb +++ b/spec/ruby/core/enumerator/lazy/lazy_spec.rb @@ -16,6 +16,10 @@ describe "Enumerator::Lazy" do ] lazy_methods += [:chunk_while, :uniq] + ruby_version_is '3.1' do + lazy_methods += [:compact] + end + Enumerator::Lazy.instance_methods(false).should include(*lazy_methods) end end diff --git a/spec/ruby/core/enumerator/lazy/with_index_spec.rb b/spec/ruby/core/enumerator/lazy/with_index_spec.rb index 3a59ba4116..a6b5c38777 100644 --- a/spec/ruby/core/enumerator/lazy/with_index_spec.rb +++ b/spec/ruby/core/enumerator/lazy/with_index_spec.rb @@ -3,28 +3,34 @@ require_relative '../../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is "2.7" do - describe "Enumerator::Lazy#with_index" do - it "enumerates with an index" do - (0..Float::INFINITY).lazy.with_index.map { |i, idx| [i, idx] }.first(3).should == [[0, 0], [1, 1], [2, 2]] - end +describe "Enumerator::Lazy#with_index" do + it "enumerates with an index" do + (0..Float::INFINITY).lazy.with_index.map { |i, idx| [i, idx] }.first(3).should == [[0, 0], [1, 1], [2, 2]] + end + + it "enumerates with an index starting at a given offset" do + (0..Float::INFINITY).lazy.with_index(3).map { |i, idx| [i, idx] }.first(3).should == [[0, 3], [1, 4], [2, 5]] + end - it "enumerates with an index starting at a given offset" do - (0..Float::INFINITY).lazy.with_index(3).map { |i, idx| [i, idx] }.first(3).should == [[0, 3], [1, 4], [2, 5]] - end + it "enumerates with an index starting at 0 when offset is nil" do + (0..Float::INFINITY).lazy.with_index(nil).map { |i, idx| [i, idx] }.first(3).should == [[0, 0], [1, 1], [2, 2]] + end - it "enumerates with an index starting at 0 when offset is nil" do - (0..Float::INFINITY).lazy.with_index(nil).map { |i, idx| [i, idx] }.first(3).should == [[0, 0], [1, 1], [2, 2]] - end + it "raises TypeError when offset does not convert to Integer" do + -> { (0..Float::INFINITY).lazy.with_index(false).map { |i, idx| i }.first(3) }.should raise_error(TypeError) + end - it "raises TypeError when offset does not convert to Integer" do - -> { (0..Float::INFINITY).lazy.with_index(false).map { |i, idx| i }.first(3) }.should raise_error(TypeError) - end + it "enumerates with a given block" do + result = [] + (0..Float::INFINITY).lazy.with_index { |i, idx| result << [i * 2, idx] }.first(3) + result.should == [[0,0],[2,1],[4,2]] + end - it "enumerates with a given block" do - result = [] - (0..Float::INFINITY).lazy.with_index { |i, idx| result << [i * 2, idx] }.first(3) - result.should == [[0,0],[2,1],[4,2]] - end + it "resets after a new call to each" do + enum = (0..2).lazy.with_index.map { |i, idx| [i, idx] } + result = [] + enum.each { |i, idx| result << [i, idx] } + enum.each { |i, idx| result << [i, idx] } + result.should == [[0,0], [1,1], [2,2], [0,0], [1,1], [2,2]] end end diff --git a/spec/ruby/core/enumerator/new_spec.rb b/spec/ruby/core/enumerator/new_spec.rb index 5cc0b3ff2e..671912224f 100644 --- a/spec/ruby/core/enumerator/new_spec.rb +++ b/spec/ruby/core/enumerator/new_spec.rb @@ -2,51 +2,8 @@ require_relative '../../spec_helper' describe "Enumerator.new" do context "no block given" do - ruby_version_is '3.0' do - it "raises" do - -> { Enumerator.new(1, :upto, 3) }.should raise_error(ArgumentError) - end - end - - ruby_version_is ''...'3.0' do - it "creates a new custom enumerator with the given object, iterator and arguments" do - enum = suppress_warning { Enumerator.new(1, :upto, 3) } - enum.should be_an_instance_of(Enumerator) - end - - it "creates a new custom enumerator that responds to #each" do - enum = suppress_warning { Enumerator.new(1, :upto, 3) } - enum.respond_to?(:each).should == true - end - - it "creates a new custom enumerator that runs correctly" do - suppress_warning { Enumerator.new(1, :upto, 3) }.map{ |x| x }.should == [1,2,3] - end - - it "aliases the second argument to :each" do - suppress_warning { Enumerator.new(1..2) }.to_a.should == - suppress_warning { Enumerator.new(1..2, :each) }.to_a - end - - it "doesn't check for the presence of the iterator method" do - suppress_warning { Enumerator.new(nil) }.should be_an_instance_of(Enumerator) - end - - it "uses the latest define iterator method" do - class StrangeEach - def each - yield :foo - end - end - enum = suppress_warning { Enumerator.new(StrangeEach.new) } - enum.to_a.should == [:foo] - class StrangeEach - def each - yield :bar - end - end - enum.to_a.should == [:bar] - end + it "raises" do + -> { Enumerator.new(1, :upto, 3) }.should raise_error(ArgumentError) end end @@ -77,14 +34,12 @@ describe "Enumerator.new" do enum.take(3).should == [1, 2, 3] end - ruby_version_is "2.7" do - it "defines iteration with block, yielder argument and treating it as a proc" do - enum = Enumerator.new do |yielder| - "a\nb\nc".each_line(&yielder) - end - - enum.to_a.should == ["a\n", "b\n", "c"] + it "defines iteration with block, yielder argument and treating it as a proc" do + enum = Enumerator.new do |yielder| + "a\nb\nc".each_line(&yielder) end + + enum.to_a.should == ["a\n", "b\n", "c"] end describe 'yielded values' do diff --git a/spec/ruby/core/enumerator/produce_spec.rb b/spec/ruby/core/enumerator/produce_spec.rb index f6f1dcd429..c69fb49303 100644 --- a/spec/ruby/core/enumerator/produce_spec.rb +++ b/spec/ruby/core/enumerator/produce_spec.rb @@ -1,36 +1,34 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Enumerator.produce" do - it "creates an infinite enumerator" do - enum = Enumerator.produce(0) { |prev| prev + 1 } - enum.take(5).should == [0, 1, 2, 3, 4] - end - - it "terminates iteration when block raises StopIteration exception" do - enum = Enumerator.produce(0) do | prev| - raise StopIteration if prev >= 2 - prev + 1 - end +describe "Enumerator.produce" do + it "creates an infinite enumerator" do + enum = Enumerator.produce(0) { |prev| prev + 1 } + enum.take(5).should == [0, 1, 2, 3, 4] + end - enum.to_a.should == [0, 1, 2] + it "terminates iteration when block raises StopIteration exception" do + enum = Enumerator.produce(0) do | prev| + raise StopIteration if prev >= 2 + prev + 1 end - context "when initial value skipped" do - it "uses nil instead" do - ScratchPad.record [] - enum = Enumerator.produce { |prev| ScratchPad << prev; (prev || 0) + 1 } + enum.to_a.should == [0, 1, 2] + end + + context "when initial value skipped" do + it "uses nil instead" do + ScratchPad.record [] + enum = Enumerator.produce { |prev| ScratchPad << prev; (prev || 0) + 1 } - enum.take(3).should == [1, 2, 3] - ScratchPad.recorded.should == [nil, 1, 2] - end + enum.take(3).should == [1, 2, 3] + ScratchPad.recorded.should == [nil, 1, 2] + end - it "starts enumerable from result of first block call" do - array = "a\nb\nc\nd".lines - lines = Enumerator.produce { array.shift }.take_while { |s| s } + it "starts enumerable from result of first block call" do + array = "a\nb\nc\nd".lines + lines = Enumerator.produce { array.shift }.take_while { |s| s } - lines.should == ["a\n", "b\n", "c\n", "d"] - end + lines.should == ["a\n", "b\n", "c\n", "d"] end end end diff --git a/spec/ruby/core/enumerator/product/each_spec.rb b/spec/ruby/core/enumerator/product/each_spec.rb new file mode 100644 index 0000000000..cabeb9d93a --- /dev/null +++ b/spec/ruby/core/enumerator/product/each_spec.rb @@ -0,0 +1,73 @@ +require_relative '../../../spec_helper' +require_relative '../../enumerable/shared/enumeratorized' + +ruby_version_is "3.2" do + describe "Enumerator::Product#each" do + it_behaves_like :enumeratorized_with_origin_size, :each, Enumerator::Product.new([1, 2], [:a, :b]) + + it "yields each element of Cartesian product of enumerators" do + enum = Enumerator::Product.new([1, 2], [:a, :b]) + acc = [] + enum.each { |e| acc << e } + acc.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "calls #each_entry method on enumerators" do + object1 = Object.new + def object1.each_entry + yield 1 + yield 2 + end + + object2 = Object.new + def object2.each_entry + yield :a + yield :b + end + + enum = Enumerator::Product.new(object1, object2) + acc = [] + enum.each { |e| acc << e } + acc.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "raises a NoMethodError if the object doesn't respond to #each_entry" do + -> { + Enumerator::Product.new(Object.new).each {} + }.should raise_error(NoMethodError, /undefined method [`']each_entry' for/) + end + + it "returns enumerator if not given a block" do + enum = Enumerator::Product.new([1, 2], [:a, :b]) + enum.each.should.kind_of?(Enumerator) + + enum = Enumerator::Product.new([1, 2], [:a, :b]) + enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "returns self if given a block" do + enum = Enumerator::Product.new([1, 2], [:a, :b]) + enum.each {}.should.equal?(enum) + end + + it "doesn't accept arguments" do + Enumerator::Product.instance_method(:each).arity.should == 0 + end + + it "yields each element to a block that takes multiple arguments" do + enum = Enumerator::Product.new([1, 2], [:a, :b]) + + acc = [] + enum.each { |x, y| acc << x } + acc.should == [1, 1, 2, 2] + + acc = [] + enum.each { |x, y| acc << y } + acc.should == [:a, :b, :a, :b] + + acc = [] + enum.each { |x, y, z| acc << z } + acc.should == [nil, nil, nil, nil] + end + end +end diff --git a/spec/ruby/core/enumerator/product/initialize_copy_spec.rb b/spec/ruby/core/enumerator/product/initialize_copy_spec.rb new file mode 100644 index 0000000000..46e8421322 --- /dev/null +++ b/spec/ruby/core/enumerator/product/initialize_copy_spec.rb @@ -0,0 +1,54 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.2" do + describe "Enumerator::Product#initialize_copy" do + it "replaces content of the receiver with content of the other object" do + enum = Enumerator::Product.new([true, false]) + enum2 = Enumerator::Product.new([1, 2], [:a, :b]) + + enum.send(:initialize_copy, enum2) + enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "returns self" do + enum = Enumerator::Product.new([true, false]) + enum2 = Enumerator::Product.new([1, 2], [:a, :b]) + + enum.send(:initialize_copy, enum2).should.equal?(enum) + end + + it "is a private method" do + Enumerator::Product.should have_private_instance_method(:initialize_copy, false) + end + + it "does nothing if the argument is the same as the receiver" do + enum = Enumerator::Product.new(1..2) + enum.send(:initialize_copy, enum).should.equal?(enum) + + enum.freeze + enum.send(:initialize_copy, enum).should.equal?(enum) + end + + it "raises FrozenError if the receiver is frozen" do + enum = Enumerator::Product.new(1..2) + enum2 = Enumerator::Product.new(3..4) + + -> { enum.freeze.send(:initialize_copy, enum2) }.should raise_error(FrozenError) + end + + it "raises TypeError if the objects are of different class" do + enum = Enumerator::Product.new(1..2) + enum2 = Class.new(Enumerator::Product).new(3..4) + + -> { enum.send(:initialize_copy, enum2) }.should raise_error(TypeError, 'initialize_copy should take same class object') + -> { enum2.send(:initialize_copy, enum) }.should raise_error(TypeError, 'initialize_copy should take same class object') + end + + it "raises ArgumentError if the argument is not initialized yet" do + enum = Enumerator::Product.new(1..2) + enum2 = Enumerator::Product.allocate + + -> { enum.send(:initialize_copy, enum2) }.should raise_error(ArgumentError, 'uninitialized product') + end + end +end diff --git a/spec/ruby/core/enumerator/product/initialize_spec.rb b/spec/ruby/core/enumerator/product/initialize_spec.rb new file mode 100644 index 0000000000..4b60564240 --- /dev/null +++ b/spec/ruby/core/enumerator/product/initialize_spec.rb @@ -0,0 +1,33 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.2" do + describe "Enumerator::Product#initialize" do + before :each do + @uninitialized = Enumerator::Product.allocate + end + + it "is a private method" do + Enumerator::Product.should have_private_instance_method(:initialize, false) + end + + it "returns self" do + @uninitialized.send(:initialize).should equal(@uninitialized) + end + + it "accepts many arguments" do + @uninitialized.send(:initialize, 0..1, 2..3, 4..5).should equal(@uninitialized) + end + + it "accepts arguments that are not Enumerable nor responding to :each_entry" do + @uninitialized.send(:initialize, Object.new).should equal(@uninitialized) + end + + describe "on frozen instance" do + it "raises a FrozenError" do + -> { + @uninitialized.freeze.send(:initialize, 0..1) + }.should raise_error(FrozenError) + end + end + end +end diff --git a/spec/ruby/core/enumerator/product/inspect_spec.rb b/spec/ruby/core/enumerator/product/inspect_spec.rb new file mode 100644 index 0000000000..1ea8e9c49b --- /dev/null +++ b/spec/ruby/core/enumerator/product/inspect_spec.rb @@ -0,0 +1,22 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.2" do + describe "Enumerator::Product#inspect" do + it "returns a String including enumerators" do + enum = Enumerator::Product.new([1, 2], [:a, :b]) + enum.inspect.should == "#<Enumerator::Product: [[1, 2], [:a, :b]]>" + end + + it "represents a recursive element with '[...]'" do + enum = [1, 2] + enum_recursive = Enumerator::Product.new(enum) + + enum << enum_recursive + enum_recursive.inspect.should == "#<Enumerator::Product: [[1, 2, #<Enumerator::Product: ...>]]>" + end + + it "returns a not initialized representation if #initialized is not called yet" do + Enumerator::Product.allocate.inspect.should == "#<Enumerator::Product: uninitialized>" + end + end +end diff --git a/spec/ruby/core/enumerator/product/rewind_spec.rb b/spec/ruby/core/enumerator/product/rewind_spec.rb new file mode 100644 index 0000000000..e8ee730239 --- /dev/null +++ b/spec/ruby/core/enumerator/product/rewind_spec.rb @@ -0,0 +1,64 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.2" do + describe "Enumerator::Product#rewind" do + before :each do + @enum = Enumerator::Product.new([1, 2].each.to_enum, [:a, :b].each.to_enum) + end + + it "resets the enumerator to its initial state" do + @enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + @enum.rewind + @enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "returns self" do + @enum.rewind.should.equal? @enum + end + + it "has no effect on a new enumerator" do + @enum.rewind + @enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "has no effect if called multiple, consecutive times" do + @enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + @enum.rewind + @enum.rewind + @enum.each.to_a.should == [[1, :a], [1, :b], [2, :a], [2, :b]] + end + + it "calls the enclosed object's rewind method if one exists" do + obj = mock('rewinder') + enum = Enumerator::Product.new(obj.to_enum) + + obj.should_receive(:rewind) + enum.rewind + end + + it "does nothing if the object doesn't have a #rewind method" do + obj = mock('rewinder') + enum = Enumerator::Product.new(obj.to_enum) + + enum.rewind.should == enum + end + + it "calls a rewind method on each enumerable in direct order" do + ScratchPad.record [] + + object1 = Object.new + def object1.rewind; ScratchPad << :object1; end + + object2 = Object.new + def object2.rewind; ScratchPad << :object2; end + + object3 = Object.new + def object3.rewind; ScratchPad << :object3; end + + enum = Enumerator::Product.new(object1, object2, object3) + enum.rewind + + ScratchPad.recorded.should == [:object1, :object2, :object3] + end + end +end diff --git a/spec/ruby/core/enumerator/product/size_spec.rb b/spec/ruby/core/enumerator/product/size_spec.rb new file mode 100644 index 0000000000..46958b1a22 --- /dev/null +++ b/spec/ruby/core/enumerator/product/size_spec.rb @@ -0,0 +1,56 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.2" do + describe "Enumerator::Product#size" do + it "returns the total size of the enumerator product calculated by multiplying the sizes of enumerables in the product" do + product = Enumerator::Product.new(1..2, 1..3, 1..4) + product.size.should == 24 # 2 * 3 * 4 + end + + it "returns nil if any enumerable reports its size as nil" do + enum = Object.new + def enum.size; nil; end + + product = Enumerator::Product.new(1..2, enum) + product.size.should == nil + end + + it "returns Float::INFINITY if any enumerable reports its size as Float::INFINITY" do + enum = Object.new + def enum.size; Float::INFINITY; end + + product = Enumerator::Product.new(1..2, enum) + product.size.should == Float::INFINITY + end + + it "returns nil if any enumerable reports its size as Float::NAN" do + enum = Object.new + def enum.size; Float::NAN; end + + product = Enumerator::Product.new(1..2, enum) + product.size.should == nil + end + + it "returns nil if any enumerable doesn't respond to #size" do + enum = Object.new + product = Enumerator::Product.new(1..2, enum) + product.size.should == nil + end + + it "returns nil if any enumerable reports a not-convertible to Integer" do + enum = Object.new + def enum.size; :symbol; end + + product = Enumerator::Product.new(1..2, enum) + product.size.should == nil + end + + it "returns nil if any enumerable reports a non-Integer but convertible to Integer size" do + enum = Object.new + def enum.size; 1.0; end + + product = Enumerator::Product.new(1..2, enum) + product.size.should == nil + end + end +end diff --git a/spec/ruby/core/enumerator/product_spec.rb b/spec/ruby/core/enumerator/product_spec.rb new file mode 100644 index 0000000000..0acca6690e --- /dev/null +++ b/spec/ruby/core/enumerator/product_spec.rb @@ -0,0 +1,93 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "Enumerator.product" do + it "returns a Cartesian product of enumerators" do + enum = Enumerator.product(1..2, ["A", "B"]) + enum.to_a.should == [[1, "A"], [1, "B"], [2, "A"], [2, "B"]] + end + + it "accepts a list of enumerators of any length" do + enum = Enumerator.product(1..2) + enum.to_a.should == [[1], [2]] + + enum = Enumerator.product(1..2, ["A"]) + enum.to_a.should == [[1, "A"], [2, "A"]] + + enum = Enumerator.product(1..2, ["A"], ["B"]) + enum.to_a.should == [[1, "A", "B"], [2, "A", "B"]] + + enum = Enumerator.product(2..3, ["A"], ["B"], ["C"]) + enum.to_a.should == [[2, "A", "B", "C"], [3, "A", "B", "C"]] + end + + it "returns an enumerator with an empty array when no arguments passed" do + enum = Enumerator.product + enum.to_a.should == [[]] + end + + it "returns an instance of Enumerator::Product" do + enum = Enumerator.product + enum.class.should == Enumerator::Product + end + + it "accepts infinite enumerators and returns infinite enumerator" do + enum = Enumerator.product(1.., ["A", "B"]) + enum.take(5).should == [[1, "A"], [1, "B"], [2, "A"], [2, "B"], [3, "A"]] + enum.size.should == Float::INFINITY + end + + it "accepts a block" do + elems = [] + enum = Enumerator.product(1..2, ["X", "Y"]) { elems << _1 } + + elems.should == [[1, "X"], [1, "Y"], [2, "X"], [2, "Y"]] + end + + it "returns nil when a block passed" do + Enumerator.product(1..2) {}.should == nil + end + + # https://bugs.ruby-lang.org/issues/19829 + it "reject keyword arguments" do + -> { + Enumerator.product(1..3, foo: 1, bar: 2) + }.should raise_error(ArgumentError, "unknown keywords: :foo, :bar") + end + + it "calls only #each_entry method on arguments" do + object = Object.new + def object.each_entry + yield 1 + yield 2 + end + + enum = Enumerator.product(object, ["A", "B"]) + enum.to_a.should == [[1, "A"], [1, "B"], [2, "A"], [2, "B"]] + end + + it "raises NoMethodError when argument doesn't respond to #each_entry" do + -> { + Enumerator.product(Object.new).to_a + }.should raise_error(NoMethodError, /undefined method [`']each_entry' for/) + end + + it "calls #each_entry lazily" do + Enumerator.product(Object.new).should be_kind_of(Enumerator) + end + + it "iterates through consuming enumerator elements only once" do + a = [1, 2, 3] + i = 0 + + enum = Enumerator.new do |y| + while i < a.size + y << a[i] + i += 1 + end + end + + Enumerator.product(['a', 'b'], enum).to_a.should == [["a", 1], ["a", 2], ["a", 3]] + end + end +end diff --git a/spec/ruby/core/enumerator/rewind_spec.rb b/spec/ruby/core/enumerator/rewind_spec.rb index a105f2c619..6ba0edf174 100644 --- a/spec/ruby/core/enumerator/rewind_spec.rb +++ b/spec/ruby/core/enumerator/rewind_spec.rb @@ -14,7 +14,7 @@ describe "Enumerator#rewind" do end it "returns self" do - @enum.rewind.should == @enum + @enum.rewind.should.equal? @enum end it "has no effect on a new enumerator" do @@ -49,7 +49,7 @@ describe "Enumerator#rewind" do obj = mock('rewinder') enum = obj.to_enum obj.should_receive(:each).at_most(1) - -> { enum.rewind.should == enum }.should_not raise_error + enum.rewind.should == enum end end diff --git a/spec/ruby/core/enumerator/yielder/to_proc_spec.rb b/spec/ruby/core/enumerator/yielder/to_proc_spec.rb index 0ed1645853..1d3681ab50 100644 --- a/spec/ruby/core/enumerator/yielder/to_proc_spec.rb +++ b/spec/ruby/core/enumerator/yielder/to_proc_spec.rb @@ -1,18 +1,16 @@ require_relative '../../../spec_helper' -ruby_version_is "2.7" do - describe "Enumerator::Yielder#to_proc" do - it "returns a Proc object that takes an argument and yields it to the block" do - ScratchPad.record [] - y = Enumerator::Yielder.new { |*args| ScratchPad << args; "foobar" } +describe "Enumerator::Yielder#to_proc" do + it "returns a Proc object that takes an argument and yields it to the block" do + ScratchPad.record [] + y = Enumerator::Yielder.new { |*args| ScratchPad << args; "foobar" } - callable = y.to_proc - callable.class.should == Proc + callable = y.to_proc + callable.class.should == Proc - result = callable.call(1, 2) - ScratchPad.recorded.should == [[1, 2]] + result = callable.call(1, 2) + ScratchPad.recorded.should == [[1, 2]] - result.should == "foobar" - end + result.should == "foobar" end end diff --git a/spec/ruby/core/env/clone_spec.rb b/spec/ruby/core/env/clone_spec.rb new file mode 100644 index 0000000000..991e4e6774 --- /dev/null +++ b/spec/ruby/core/env/clone_spec.rb @@ -0,0 +1,23 @@ +require_relative '../../spec_helper' + +describe "ENV#clone" do + it "raises ArgumentError when keyword argument 'freeze' is neither nil nor boolean" do + -> { + ENV.clone(freeze: 1) + }.should raise_error(ArgumentError) + end + + it "raises ArgumentError when keyword argument is not 'freeze'" do + -> { + ENV.clone(foo: nil) + }.should raise_error(ArgumentError) + end + + ruby_version_is "3.2" do + it "raises TypeError" do + -> { + ENV.clone + }.should raise_error(TypeError, /Cannot clone ENV, use ENV.to_h to get a copy of ENV as a hash/) + end + end +end diff --git a/spec/ruby/core/env/delete_spec.rb b/spec/ruby/core/env/delete_spec.rb index 5e7891f74d..f28ac97911 100644 --- a/spec/ruby/core/env/delete_spec.rb +++ b/spec/ruby/core/env/delete_spec.rb @@ -30,11 +30,9 @@ describe "ENV.delete" do ScratchPad.recorded.should == "foo" end - ruby_version_is "3.0" do - it "returns the result of given block if the named environment variable does not exist" do - ENV.delete("foo") - ENV.delete("foo") { |name| "bar" }.should == "bar" - end + it "returns the result of given block if the named environment variable does not exist" do + ENV.delete("foo") + ENV.delete("foo") { |name| "bar" }.should == "bar" end it "does not evaluate the block if the environment variable exists" do @@ -43,6 +41,14 @@ describe "ENV.delete" do ENV["foo"].should == nil end + it "removes the variable coerced with #to_str" do + ENV["foo"] = "bar" + k = mock('key') + k.should_receive(:to_str).and_return("foo") + ENV.delete(k) + ENV["foo"].should == nil + end + it "raises TypeError if the argument is not a String and does not respond to #to_str" do -> { ENV.delete(Object.new) }.should raise_error(TypeError, "no implicit conversion of Object into String") end diff --git a/spec/ruby/core/env/dup_spec.rb b/spec/ruby/core/env/dup_spec.rb new file mode 100644 index 0000000000..46d125aca8 --- /dev/null +++ b/spec/ruby/core/env/dup_spec.rb @@ -0,0 +1,11 @@ +require_relative '../../spec_helper' + +describe "ENV#dup" do + ruby_version_is "3.1" do + it "raises TypeError" do + -> { + ENV.dup + }.should raise_error(TypeError, /Cannot dup ENV, use ENV.to_h to get a copy of ENV as a hash/) + end + end +end diff --git a/spec/ruby/core/env/except_spec.rb b/spec/ruby/core/env/except_spec.rb index cfe5865abe..fb8f3b7536 100644 --- a/spec/ruby/core/env/except_spec.rb +++ b/spec/ruby/core/env/except_spec.rb @@ -1,36 +1,34 @@ require_relative 'spec_helper' require_relative 'shared/to_hash' -ruby_version_is "3.0" do - describe "ENV.except" do - before do - @orig_hash = ENV.to_hash - end +describe "ENV.except" do + before do + @orig_hash = ENV.to_hash + end - after do - ENV.replace @orig_hash - end + after do + ENV.replace @orig_hash + end - # Testing the method without arguments is covered via - it_behaves_like :env_to_hash, :except + # Testing the method without arguments is covered via + it_behaves_like :env_to_hash, :except - it "returns a hash without the requested subset" do - ENV.clear + it "returns a hash without the requested subset" do + ENV.clear - ENV['one'] = '1' - ENV['two'] = '2' - ENV['three'] = '3' + ENV['one'] = '1' + ENV['two'] = '2' + ENV['three'] = '3' - ENV.except('one', 'three').should == { 'two' => '2' } - end + ENV.except('one', 'three').should == { 'two' => '2' } + end - it "ignores keys not present in the original hash" do - ENV.clear + it "ignores keys not present in the original hash" do + ENV.clear - ENV['one'] = '1' - ENV['two'] = '2' + ENV['one'] = '1' + ENV['two'] = '2' - ENV.except('one', 'three').should == { 'two' => '2' } - end + ENV.except('one', 'three').should == { 'two' => '2' } end end diff --git a/spec/ruby/core/env/index_spec.rb b/spec/ruby/core/env/index_spec.rb deleted file mode 100644 index 301a66ab4e..0000000000 --- a/spec/ruby/core/env/index_spec.rb +++ /dev/null @@ -1,14 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'shared/key' - -ruby_version_is ''...'3.0' do - describe "ENV.index" do - it_behaves_like :env_key, :index - - it "warns about deprecation" do - -> do - ENV.index("foo") - end.should complain(/warning: ENV.index is deprecated; use ENV.key/) - end - end -end diff --git a/spec/ruby/core/env/indexes_spec.rb b/spec/ruby/core/env/indexes_spec.rb deleted file mode 100644 index e724feaa39..0000000000 --- a/spec/ruby/core/env/indexes_spec.rb +++ /dev/null @@ -1 +0,0 @@ -require_relative '../../spec_helper' diff --git a/spec/ruby/core/env/indices_spec.rb b/spec/ruby/core/env/indices_spec.rb deleted file mode 100644 index e724feaa39..0000000000 --- a/spec/ruby/core/env/indices_spec.rb +++ /dev/null @@ -1 +0,0 @@ -require_relative '../../spec_helper' diff --git a/spec/ruby/core/env/key_spec.rb b/spec/ruby/core/env/key_spec.rb index 82cfbefa39..cf70286409 100644 --- a/spec/ruby/core/env/key_spec.rb +++ b/spec/ruby/core/env/key_spec.rb @@ -1,11 +1,39 @@ require_relative '../../spec_helper' require_relative 'shared/include' -require_relative 'shared/key' describe "ENV.key?" do it_behaves_like :env_include, :key? end describe "ENV.key" do - it_behaves_like :env_key, :key + before :each do + @saved_foo = ENV["foo"] + end + + after :each do + ENV["foo"] = @saved_foo + end + + it "returns the index associated with the passed value" do + ENV["foo"] = "bar" + ENV.key("bar").should == "foo" + end + + it "returns nil if the passed value is not found" do + ENV.delete("foo") + ENV.key("foo").should be_nil + end + + it "coerces the key element with #to_str" do + ENV["foo"] = "bar" + k = mock('key') + k.should_receive(:to_str).and_return("bar") + ENV.key(k).should == "foo" + end + + it "raises TypeError if the argument is not a String and does not respond to #to_str" do + -> { + ENV.key(Object.new) + }.should raise_error(TypeError, "no implicit conversion of Object into String") + end end diff --git a/spec/ruby/core/env/merge_spec.rb b/spec/ruby/core/env/merge_spec.rb index b418cd11f4..f10662cf79 100644 --- a/spec/ruby/core/env/merge_spec.rb +++ b/spec/ruby/core/env/merge_spec.rb @@ -1,8 +1,6 @@ require_relative '../../spec_helper' require_relative 'shared/update' -ruby_version_is "2.7" do - describe "ENV.merge!" do - it_behaves_like :env_update, :merge! - end +describe "ENV.merge!" do + it_behaves_like :env_update, :merge! end diff --git a/spec/ruby/core/env/shared/include.rb b/spec/ruby/core/env/shared/include.rb index 3efcd523d6..70aa555301 100644 --- a/spec/ruby/core/env/shared/include.rb +++ b/spec/ruby/core/env/shared/include.rb @@ -17,6 +17,13 @@ describe :env_include, shared: true do ENV.send(@method, "foo").should == false end + it "coerces the key with #to_str" do + ENV["foo"] = "bar" + k = mock('key') + k.should_receive(:to_str).and_return("foo") + ENV.send(@method, k).should == true + end + it "raises TypeError if the argument is not a String and does not respond to #to_str" do -> { ENV.send(@method, Object.new) }.should raise_error(TypeError, "no implicit conversion of Object into String") end diff --git a/spec/ruby/core/env/shared/key.rb b/spec/ruby/core/env/shared/key.rb deleted file mode 100644 index 93396d2aca..0000000000 --- a/spec/ruby/core/env/shared/key.rb +++ /dev/null @@ -1,31 +0,0 @@ -describe :env_key, shared: true do - before :each do - @saved_foo = ENV["foo"] - end - - after :each do - ENV["foo"] = @saved_foo - end - - it "returns the index associated with the passed value" do - ENV["foo"] = "bar" - suppress_warning { - ENV.send(@method, "bar").should == "foo" - } - end - - it "returns nil if the passed value is not found" do - ENV.delete("foo") - suppress_warning { - ENV.send(@method, "foo").should be_nil - } - end - - it "raises TypeError if the argument is not a String and does not respond to #to_str" do - -> { - suppress_warning { - ENV.send(@method, Object.new) - } - }.should raise_error(TypeError, "no implicit conversion of Object into String") - end -end diff --git a/spec/ruby/core/env/shared/update.rb b/spec/ruby/core/env/shared/update.rb index 129a56544c..7d4799955b 100644 --- a/spec/ruby/core/env/shared/update.rb +++ b/spec/ruby/core/env/shared/update.rb @@ -15,6 +15,14 @@ describe :env_update, shared: true do ENV["bar"].should == "1" end + ruby_version_is "3.2" do + it "adds the multiple parameter hashes to ENV, returning ENV" do + ENV.send(@method, {"foo" => "multi1"}, {"bar" => "multi2"}).should equal(ENV) + ENV["foo"].should == "multi1" + ENV["bar"].should == "multi2" + end + end + it "returns ENV when no block given" do ENV.send(@method, {"foo" => "0", "bar" => "1"}).should equal(ENV) end @@ -39,23 +47,21 @@ describe :env_update, shared: true do ENV["bar"].should == "5" end - ruby_version_is "2.7" do - # BUG: https://bugs.ruby-lang.org/issues/16192 - it "does not evaluate the block when the name is new" do - ENV.delete("bar") - ENV.send @method, {"foo" => "0"} - ENV.send(@method, "bar" => "1") { |key, old, new| fail "Should not get here" } - ENV["bar"].should == "1" - end + # BUG: https://bugs.ruby-lang.org/issues/16192 + it "does not evaluate the block when the name is new" do + ENV.delete("bar") + ENV.send @method, {"foo" => "0"} + ENV.send(@method, "bar" => "1") { |key, old, new| fail "Should not get here" } + ENV["bar"].should == "1" + end - # BUG: https://bugs.ruby-lang.org/issues/16192 - it "does not use the block's return value as the value when the name is new" do - ENV.delete("bar") - ENV.send @method, {"foo" => "0"} - ENV.send(@method, "bar" => "1") { |key, old, new| "Should not use this value" } - ENV["foo"].should == "0" - ENV["bar"].should == "1" - end + # BUG: https://bugs.ruby-lang.org/issues/16192 + it "does not use the block's return value as the value when the name is new" do + ENV.delete("bar") + ENV.send @method, {"foo" => "0"} + ENV.send(@method, "bar" => "1") { |key, old, new| "Should not use this value" } + ENV["foo"].should == "0" + ENV["bar"].should == "1" end it "returns ENV when block given" do diff --git a/spec/ruby/core/env/shared/value.rb b/spec/ruby/core/env/shared/value.rb index bef96b5fef..c2b5025465 100644 --- a/spec/ruby/core/env/shared/value.rb +++ b/spec/ruby/core/env/shared/value.rb @@ -16,6 +16,13 @@ describe :env_value, shared: true do ENV.send(@method, "foo").should == false end + it "coerces the value element with #to_str" do + ENV["foo"] = "bar" + v = mock('value') + v.should_receive(:to_str).and_return("bar") + ENV.send(@method, v).should == true + end + it "returns nil if the argument is not a String and does not respond to #to_str" do ENV.send(@method, Object.new).should == nil end diff --git a/spec/ruby/core/env/shift_spec.rb b/spec/ruby/core/env/shift_spec.rb index b6c139dc29..1b92e5d1e4 100644 --- a/spec/ruby/core/env/shift_spec.rb +++ b/spec/ruby/core/env/shift_spec.rb @@ -2,36 +2,13 @@ require_relative '../../spec_helper' require_relative 'fixtures/common' describe "ENV.shift" do - it "returns a pair and deletes it" do - ENV.should_not.empty? - orig = ENV.to_hash - begin - pair = ENV.shift - ENV.has_key?(pair.first).should == false - ensure - ENV.replace orig - end - ENV.has_key?(pair.first).should == true - end - - it "returns nil if ENV.empty?" do - orig = ENV.to_hash - begin - ENV.clear - ENV.shift.should == nil - ensure - ENV.replace orig - end - end -end - -describe "ENV.shift" do before :each do @orig = ENV.to_hash @external = Encoding.default_external @internal = Encoding.default_internal Encoding.default_external = Encoding::BINARY + ENV.replace({"FOO"=>"BAR"}) end after :each do @@ -40,6 +17,18 @@ describe "ENV.shift" do ENV.replace @orig end + it "returns a pair and deletes it" do + ENV.should.has_key?("FOO") + pair = ENV.shift + pair.should == ["FOO", "BAR"] + ENV.should_not.has_key?("FOO") + end + + it "returns nil if ENV.empty?" do + ENV.clear + ENV.shift.should == nil + end + it "uses the locale encoding if Encoding.default_internal is nil" do Encoding.default_internal = nil diff --git a/spec/ruby/core/env/slice_spec.rb b/spec/ruby/core/env/slice_spec.rb index e3b6020391..959239d2b2 100644 --- a/spec/ruby/core/env/slice_spec.rb +++ b/spec/ruby/core/env/slice_spec.rb @@ -21,6 +21,16 @@ describe "ENV.slice" do ENV.slice("foo", "boo", "bar").should == {"foo" => "0", "bar" => "1"} end + it "returns the values for the keys coerced with #to_str, but keeps the original objects as result keys" do + foo = mock('key 1') + foo.should_receive(:to_str).and_return("foo") + boo = mock('key 2') + boo.should_receive(:to_str).and_return("boo") + bar = mock('key 3') + bar.should_receive(:to_str).and_return("bar") + ENV.slice(foo, boo, bar).should == {foo => "0", bar => "1"} + end + it "raises TypeError if any argument is not a String and does not respond to #to_str" do -> { ENV.slice(Object.new) }.should raise_error(TypeError, "no implicit conversion of Object into String") end diff --git a/spec/ruby/core/env/to_a_spec.rb b/spec/ruby/core/env/to_a_spec.rb index 39e3877b48..2b1649281f 100644 --- a/spec/ruby/core/env/to_a_spec.rb +++ b/spec/ruby/core/env/to_a_spec.rb @@ -6,7 +6,10 @@ describe "ENV.to_a" do a = ENV.to_a a.is_a?(Array).should == true a.size.should == ENV.size - ENV.each_pair { |k, v| a.should include([k, v])} + a.each { |k,v| ENV[k].should == v } + + a.first.should.is_a?(Array) + a.first.size.should == 2 end it "returns the entries in the locale encoding" do diff --git a/spec/ruby/core/exception/backtrace_spec.rb b/spec/ruby/core/exception/backtrace_spec.rb index 3f74c4cefe..9a65ea3820 100644 --- a/spec/ruby/core/exception/backtrace_spec.rb +++ b/spec/ruby/core/exception/backtrace_spec.rb @@ -27,7 +27,7 @@ describe "Exception#backtrace" do end it "includes the name of the method from where self raised in the first element" do - @backtrace.first.should =~ /in `backtrace'/ + @backtrace.first.should =~ /in [`'](?:ExceptionSpecs::Backtrace\.)?backtrace'/ end it "includes the filename of the location immediately prior to where self raised in the second element" do @@ -38,12 +38,25 @@ describe "Exception#backtrace" do @backtrace[1].should =~ /:6(:in )?/ end - it "contains lines of the same format for each prior position in the stack" do - @backtrace[2..-1].each do |line| - # This regexp is deliberately imprecise to account for the need to abstract out - # the paths of the included mspec files and the desire to avoid specifying in any - # detail what the in `...' portion looks like. - line.should =~ /^.+:\d+:in `[^`]+'$/ + ruby_version_is ""..."3.4" do + it "contains lines of the same format for each prior position in the stack" do + @backtrace[2..-1].each do |line| + # This regexp is deliberately imprecise to account for the need to abstract out + # the paths of the included mspec files and the desire to avoid specifying in any + # detail what the in `...' portion looks like. + line.should =~ /^.+:\d+:in `[^`]+'$/ + end + end + end + + ruby_version_is "3.4" do + it "contains lines of the same format for each prior position in the stack" do + @backtrace[2..-1].each do |line| + # This regexp is deliberately imprecise to account for the need to abstract out + # the paths of the included mspec files and the desire to avoid specifying in any + # detail what the in '...' portion looks like. + line.should =~ /^.+:\d+:in '[^`]+'$/ + end end end diff --git a/spec/ruby/core/exception/case_compare_spec.rb b/spec/ruby/core/exception/case_compare_spec.rb index 87b9dee3ca..5fd11ae741 100644 --- a/spec/ruby/core/exception/case_compare_spec.rb +++ b/spec/ruby/core/exception/case_compare_spec.rb @@ -26,13 +26,11 @@ describe "SystemCallError.===" do end it "returns true if receiver is generic and arg is kind of SystemCallError" do - unknown_error_number = Errno.constants.size e = SystemCallError.new('foo', @example_errno) SystemCallError.===(e).should == true end it "returns false if receiver is generic and arg is not kind of SystemCallError" do - unknown_error_number = Errno.constants.size e = Object.new SystemCallError.===(e).should == false end diff --git a/spec/ruby/core/exception/detailed_message_spec.rb b/spec/ruby/core/exception/detailed_message_spec.rb new file mode 100644 index 0000000000..fbe4443daa --- /dev/null +++ b/spec/ruby/core/exception/detailed_message_spec.rb @@ -0,0 +1,43 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/common' + +describe "Exception#detailed_message" do + ruby_version_is "3.2" do + it "returns decorated message" do + RuntimeError.new("new error").detailed_message.should == "new error (RuntimeError)" + end + + it "is called by #full_message to allow message customization" do + exception = Exception.new("new error") + def exception.detailed_message(**) + "<prefix>#{message}<suffix>" + end + exception.full_message(highlight: false).should.include? "<prefix>new error<suffix>" + end + + it "accepts highlight keyword argument and adds escape control sequences" do + RuntimeError.new("new error").detailed_message(highlight: true).should == "\e[1mnew error (\e[1;4mRuntimeError\e[m\e[1m)\e[m" + end + + it "allows and ignores other keyword arguments" do + RuntimeError.new("new error").detailed_message(foo: true).should == "new error (RuntimeError)" + end + + it "returns just a message if exception class is anonymous" do + Class.new(RuntimeError).new("message").detailed_message.should == "message" + end + + it "returns 'unhandled exception' for an instance of RuntimeError with empty message" do + RuntimeError.new("").detailed_message.should == "unhandled exception" + end + + it "returns just class name for an instance of RuntimeError subclass with empty message" do + DetailedMessageSpec::C.new("").detailed_message.should == "DetailedMessageSpec::C" + end + + it "returns a generated class name for an instance of RuntimeError anonymous subclass with empty message" do + klass = Class.new(RuntimeError) + klass.new("").detailed_message.should =~ /\A#<Class:0x\h+>\z/ + end + end +end diff --git a/spec/ruby/core/exception/equal_value_spec.rb b/spec/ruby/core/exception/equal_value_spec.rb index 7f2065511a..e8f3ce0f8d 100644 --- a/spec/ruby/core/exception/equal_value_spec.rb +++ b/spec/ruby/core/exception/equal_value_spec.rb @@ -22,18 +22,18 @@ describe "Exception#==" do it "returns true if both exceptions have the same class, the same message, and the same backtrace" do one = TypeError.new("message") - one.set_backtrace [File.dirname(__FILE__)] + one.set_backtrace [__dir__] two = TypeError.new("message") - two.set_backtrace [File.dirname(__FILE__)] + two.set_backtrace [__dir__] one.should == two end it "returns false if the two exceptions inherit from Exception but have different classes" do one = RuntimeError.new("message") - one.set_backtrace [File.dirname(__FILE__)] + one.set_backtrace [__dir__] one.should be_kind_of(Exception) two = TypeError.new("message") - two.set_backtrace [File.dirname(__FILE__)] + two.set_backtrace [__dir__] two.should be_kind_of(Exception) one.should_not == two end @@ -52,7 +52,7 @@ describe "Exception#==" do it "returns false if the two exceptions differ only in their backtrace" do one = RuntimeError.new("message") - one.set_backtrace [File.dirname(__FILE__)] + one.set_backtrace [__dir__] two = RuntimeError.new("message") two.set_backtrace nil one.should_not == two @@ -60,9 +60,9 @@ describe "Exception#==" do it "returns false if the two exceptions differ only in their message" do one = RuntimeError.new("message") - one.set_backtrace [File.dirname(__FILE__)] + one.set_backtrace [__dir__] two = RuntimeError.new("message2") - two.set_backtrace [File.dirname(__FILE__)] + two.set_backtrace [__dir__] one.should_not == two end end diff --git a/spec/ruby/core/exception/errno_spec.rb b/spec/ruby/core/exception/errno_spec.rb index 095a926e09..a063e522ea 100644 --- a/spec/ruby/core/exception/errno_spec.rb +++ b/spec/ruby/core/exception/errno_spec.rb @@ -56,3 +56,12 @@ describe "Errno::ENOTSUP" do end end end + +describe "Errno::ENOENT" do + it "lets subclasses inherit the default error message" do + c = Class.new(Errno::ENOENT) + raise c, "custom message" + rescue => e + e.message.should == "No such file or directory - custom message" + end +end diff --git a/spec/ruby/core/exception/fixtures/common.rb b/spec/ruby/core/exception/fixtures/common.rb index 0ffb3ed855..1e243098bd 100644 --- a/spec/ruby/core/exception/fixtures/common.rb +++ b/spec/ruby/core/exception/fixtures/common.rb @@ -93,3 +93,7 @@ class NameErrorSpecs end end end + +module DetailedMessageSpec + C = Class.new(RuntimeError) +end diff --git a/spec/ruby/core/exception/fixtures/syntax_error.rb b/spec/ruby/core/exception/fixtures/syntax_error.rb new file mode 100644 index 0000000000..ccec62f7a1 --- /dev/null +++ b/spec/ruby/core/exception/fixtures/syntax_error.rb @@ -0,0 +1,3 @@ +# rubocop:disable Lint/Syntax +1+1=2 +# rubocop:enable Lint/Syntax diff --git a/spec/ruby/core/exception/fixtures/thread_fiber_ensure.rb b/spec/ruby/core/exception/fixtures/thread_fiber_ensure.rb new file mode 100644 index 0000000000..c109ec6247 --- /dev/null +++ b/spec/ruby/core/exception/fixtures/thread_fiber_ensure.rb @@ -0,0 +1,22 @@ +ready = false +t = Thread.new do + f = Fiber.new do + begin + Fiber.yield + ensure + STDERR.puts "suspended fiber ensure" + end + end + f.resume + + begin + ready = true + sleep + ensure + STDERR.puts "current fiber ensure" + end +end + +Thread.pass until ready && t.stop? + +# let the program end, it's the same as #exit or an exception for this behavior diff --git a/spec/ruby/core/exception/fixtures/thread_fiber_ensure_non_root_fiber.rb b/spec/ruby/core/exception/fixtures/thread_fiber_ensure_non_root_fiber.rb new file mode 100644 index 0000000000..3364ed06d0 --- /dev/null +++ b/spec/ruby/core/exception/fixtures/thread_fiber_ensure_non_root_fiber.rb @@ -0,0 +1,25 @@ +ready = false +t = Thread.new do + f = Fiber.new do + begin + Fiber.yield + ensure + STDERR.puts "suspended fiber ensure" + end + end + f.resume + + f2 = Fiber.new do + begin + ready = true + sleep + ensure + STDERR.puts "current fiber ensure" + end + end + f2.resume +end + +Thread.pass until ready && t.stop? + +# let the program end, it's the same as #exit or an exception for this behavior diff --git a/spec/ruby/core/exception/frozen_error_spec.rb b/spec/ruby/core/exception/frozen_error_spec.rb index f27b33295c..979ec2ff98 100644 --- a/spec/ruby/core/exception/frozen_error_spec.rb +++ b/spec/ruby/core/exception/frozen_error_spec.rb @@ -1,26 +1,38 @@ require_relative '../../spec_helper' describe "FrozenError.new" do - ruby_version_is "2.7" do - it "should take optional receiver argument" do - o = Object.new - FrozenError.new("msg", receiver: o).receiver.should equal(o) - end + it "should take optional receiver argument" do + o = Object.new + FrozenError.new("msg", receiver: o).receiver.should equal(o) end end describe "FrozenError#receiver" do - ruby_version_is "2.7" do - it "should return frozen object that modification was attempted on" do - o = Object.new.freeze - begin - def o.x; end - rescue => e - e.should be_kind_of(FrozenError) - e.receiver.should equal(o) - else - raise - end + it "should return frozen object that modification was attempted on" do + o = Object.new.freeze + begin + def o.x; end + rescue => e + e.should be_kind_of(FrozenError) + e.receiver.should equal(o) + else + raise + end + end +end + +describe "Modifying a frozen object" do + context "#inspect is redefined and modifies the object" do + it "returns ... instead of String representation of object" do + object = Object.new + def object.inspect; @a = 1 end + def object.modify; @a = 2 end + + object.freeze + + # CRuby's message contains multiple whitespaces before '...'. + # So handle both multiple and single whitespace. + -> { object.modify }.should raise_error(FrozenError, /can't modify frozen .*?: \s*.../) end end end diff --git a/spec/ruby/core/exception/full_message_spec.rb b/spec/ruby/core/exception/full_message_spec.rb index 4cece9ebf9..5154354555 100644 --- a/spec/ruby/core/exception/full_message_spec.rb +++ b/spec/ruby/core/exception/full_message_spec.rb @@ -15,13 +15,19 @@ describe "Exception#full_message" do it "supports :highlight option and adds escape sequences to highlight some strings" do e = RuntimeError.new("Some runtime error") - full_message = e.full_message(highlight: true, order: :bottom) - full_message.should include "\e[1mTraceback\e[m (most recent call last)" - full_message.should include "\e[1mSome runtime error (\e[1;4mRuntimeError\e[m\e[1m)" + full_message = e.full_message(highlight: true, order: :top).lines + full_message[0].should.end_with? "\e[1mSome runtime error (\e[1;4mRuntimeError\e[m\e[1m)\e[m\n" - full_message = e.full_message(highlight: false, order: :bottom) - full_message.should include "Traceback (most recent call last)" - full_message.should include "Some runtime error (RuntimeError)" + full_message = e.full_message(highlight: true, order: :bottom).lines + full_message[0].should == "\e[1mTraceback\e[m (most recent call last):\n" + full_message[-1].should.end_with? "\e[1mSome runtime error (\e[1;4mRuntimeError\e[m\e[1m)\e[m\n" + + full_message = e.full_message(highlight: false, order: :top).lines + full_message[0].should.end_with? "Some runtime error (RuntimeError)\n" + + full_message = e.full_message(highlight: false, order: :bottom).lines + full_message[0].should == "Traceback (most recent call last):\n" + full_message[-1].should.end_with? "Some runtime error (RuntimeError)\n" end it "supports :order option and places the error message and the backtrace at the top or the bottom" do @@ -35,9 +41,52 @@ describe "Exception#full_message" do it "shows the caller if the exception has no backtrace" do e = RuntimeError.new("Some runtime error") e.backtrace.should == nil - full_message = e.full_message(highlight: false, order: :top) - full_message.should include("#{__FILE__}:#{__LINE__-1}:in `") - full_message.should include("': Some runtime error (RuntimeError)\n") + full_message = e.full_message(highlight: false, order: :top).lines + full_message[0].should.start_with?("#{__FILE__}:#{__LINE__-1}:in ") + full_message[0].should.end_with?("': Some runtime error (RuntimeError)\n") + end + + describe "includes details about whether an exception was handled" do + describe "RuntimeError" do + it "should report as unhandled if message is empty" do + err = RuntimeError.new("") + + err.full_message.should =~ /unhandled exception/ + err.full_message(highlight: true).should =~ /unhandled exception/ + err.full_message(highlight: false).should =~ /unhandled exception/ + end + + it "should not report as unhandled if the message is not empty" do + err = RuntimeError.new("non-empty") + + err.full_message.should !~ /unhandled exception/ + err.full_message(highlight: true).should !~ /unhandled exception/ + err.full_message(highlight: false).should !~ /unhandled exception/ + end + + it "should not report as unhandled if the message is nil" do + err = RuntimeError.new(nil) + + err.full_message.should !~ /unhandled exception/ + err.full_message(highlight: true).should !~ /unhandled exception/ + err.full_message(highlight: false).should !~ /unhandled exception/ + end + + it "should not report as unhandled if the message is not specified" do + err = RuntimeError.new() + + err.full_message.should !~ /unhandled exception/ + err.full_message(highlight: true).should !~ /unhandled exception/ + err.full_message(highlight: false).should !~ /unhandled exception/ + end + end + + describe "generic Error" do + it "should not report as unhandled in any event" do + StandardError.new("").full_message.should !~ /unhandled exception/ + StandardError.new("non-empty").full_message.should !~ /unhandled exception/ + end + end end it "shows the exception class at the end of the first line of the message when the message contains multiple lines" do @@ -45,12 +94,24 @@ describe "Exception#full_message" do line = __LINE__; raise "first line\nsecond line" rescue => e full_message = e.full_message(highlight: false, order: :top).lines - full_message[0].should include("#{__FILE__}:#{line}:in `") - full_message[0].should include(": first line (RuntimeError)\n") + full_message[0].should.start_with?("#{__FILE__}:#{line}:in ") + full_message[0].should.end_with?(": first line (RuntimeError)\n") full_message[1].should == "second line\n" end end + it "highlights the entire message when the message contains multiple lines" do + begin + line = __LINE__; raise "first line\nsecond line\nthird line" + rescue => e + full_message = e.full_message(highlight: true, order: :top).lines + full_message[0].should.start_with?("#{__FILE__}:#{line}:in ") + full_message[0].should.end_with?(": \e[1mfirst line (\e[1;4mRuntimeError\e[m\e[1m)\e[m\n") + full_message[1].should == "\e[1msecond line\e[m\n" + full_message[2].should == "\e[1mthird line\e[m\n" + end + end + it "contains cause of exception" do begin begin @@ -85,4 +146,53 @@ describe "Exception#full_message" do exception.full_message.should include "intermediate exception" exception.full_message.should include "origin exception" end + + ruby_version_is "3.2" do + it "relies on #detailed_message" do + e = RuntimeError.new("new error") + e.define_singleton_method(:detailed_message) { |**| "DETAILED MESSAGE" } + + e.full_message.lines.first.should =~ /DETAILED MESSAGE/ + end + + it "passes all its own keyword arguments (with :highlight default value and without :order default value) to #detailed_message" do + e = RuntimeError.new("new error") + options_passed = nil + e.define_singleton_method(:detailed_message) do |**options| + options_passed = options + "DETAILED MESSAGE" + end + + e.full_message(foo: "bar") + options_passed.should == { foo: "bar", highlight: Exception.to_tty? } + end + + it "converts #detailed_message returned value to String if it isn't a String" do + message = Object.new + def message.to_str; "DETAILED MESSAGE"; end + + e = RuntimeError.new("new error") + e.define_singleton_method(:detailed_message) { |**| message } + + e.full_message.lines.first.should =~ /DETAILED MESSAGE/ + end + + it "uses class name if #detailed_message returns nil" do + e = RuntimeError.new("new error") + e.define_singleton_method(:detailed_message) { |**| nil } + + e.full_message(highlight: false).lines.first.should =~ /RuntimeError/ + e.full_message(highlight: true).lines.first.should =~ /#{Regexp.escape("\e[1;4mRuntimeError\e[m")}/ + end + + it "uses class name if exception object doesn't respond to #detailed_message" do + e = RuntimeError.new("new error") + class << e + undef :detailed_message + end + + e.full_message(highlight: false).lines.first.should =~ /RuntimeError/ + e.full_message(highlight: true).lines.first.should =~ /#{Regexp.escape("\e[1;4mRuntimeError\e[m")}/ + end + end end diff --git a/spec/ruby/core/exception/interrupt_spec.rb b/spec/ruby/core/exception/interrupt_spec.rb index a7501efadc..90d261e470 100644 --- a/spec/ruby/core/exception/interrupt_spec.rb +++ b/spec/ruby/core/exception/interrupt_spec.rb @@ -48,4 +48,13 @@ describe "Interrupt" do RUBY out.should == "Interrupt: #{Signal.list["INT"]}\n" end + + platform_is_not :windows do + it "shows the backtrace and has a signaled exit status" do + err = IO.popen([*ruby_exe, '-e', 'Process.kill :INT, Process.pid; sleep'], err: [:child, :out], &:read) + $?.termsig.should == Signal.list.fetch('INT') + err.should.include? ': Interrupt' + err.should =~ /from -e:1:in [`']<main>'/ + end + end end diff --git a/spec/ruby/core/exception/no_method_error_spec.rb b/spec/ruby/core/exception/no_method_error_spec.rb index 8428ba0382..26df3338e9 100644 --- a/spec/ruby/core/exception/no_method_error_spec.rb +++ b/spec/ruby/core/exception/no_method_error_spec.rb @@ -62,26 +62,49 @@ describe "NoMethodError#message" do NoMethodErrorSpecs::NoMethodErrorC.new.a_private_method rescue Exception => e e.should be_kind_of(NoMethodError) - e.message.lines[0].should =~ /private method `a_private_method' called for #<NoMethodErrorSpecs::NoMethodErrorC:0x[\h]+>/ + e.message.lines[0].should =~ /private method [`']a_private_method' called for / end end - it "calls receiver.inspect only when calling Exception#message" do - ScratchPad.record [] - test_class = Class.new do - def inspect - ScratchPad << :inspect_called - "<inspect>" + ruby_version_is ""..."3.3" do + it "calls receiver.inspect only when calling Exception#message" do + ScratchPad.record [] + test_class = Class.new do + def inspect + ScratchPad << :inspect_called + "<inspect>" + end + end + instance = test_class.new + begin + instance.bar + rescue Exception => e + e.name.should == :bar + ScratchPad.recorded.should == [] + e.message.should =~ /undefined method.+\bbar\b/ + ScratchPad.recorded.should == [:inspect_called] end end - instance = test_class.new - begin - instance.bar - rescue Exception => e - e.name.should == :bar - ScratchPad.recorded.should == [] - e.message.should =~ /undefined method.+\bbar\b/ - ScratchPad.recorded.should == [:inspect_called] + end + + ruby_version_is "3.3" do + it "does not call receiver.inspect even when calling Exception#message" do + ScratchPad.record [] + test_class = Class.new do + def inspect + ScratchPad << :inspect_called + "<inspect>" + end + end + instance = test_class.new + begin + instance.bar + rescue Exception => e + e.name.should == :bar + ScratchPad.recorded.should == [] + e.message.should =~ /undefined method.+\bbar\b/ + ScratchPad.recorded.should == [] + end end end @@ -102,21 +125,19 @@ describe "NoMethodError#message" do end end - ruby_version_is "3.0" do - it "uses #name to display the receiver if it is a class or a module" do - klass = Class.new { def self.name; "MyClass"; end } - begin - klass.foo - rescue NoMethodError => error - error.message.lines.first.chomp.should == "undefined method `foo' for MyClass:Class" - end + it "uses #name to display the receiver if it is a class or a module" do + klass = Class.new { def self.name; "MyClass"; end } + begin + klass.foo + rescue NoMethodError => error + error.message.lines.first.chomp.should =~ /^undefined method [`']foo' for / + end - mod = Module.new { def self.name; "MyModule"; end } - begin - mod.foo - rescue NoMethodError => error - error.message.lines.first.chomp.should == "undefined method `foo' for MyModule:Module" - end + mod = Module.new { def self.name; "MyModule"; end } + begin + mod.foo + rescue NoMethodError => error + error.message.lines.first.chomp.should =~ /^undefined method [`']foo' for / end end end diff --git a/spec/ruby/core/exception/set_backtrace_spec.rb b/spec/ruby/core/exception/set_backtrace_spec.rb index ba2e1bf7aa..12c1da919c 100644 --- a/spec/ruby/core/exception/set_backtrace_spec.rb +++ b/spec/ruby/core/exception/set_backtrace_spec.rb @@ -11,9 +11,37 @@ describe "Exception#set_backtrace" do it "allows the user to set the backtrace from a rescued exception" do bt = ExceptionSpecs::Backtrace.backtrace err = RuntimeError.new + err.backtrace.should == nil + err.backtrace_locations.should == nil err.set_backtrace bt + err.backtrace.should == bt + err.backtrace_locations.should == nil + end + + ruby_version_is "3.4" do + it "allows the user to set backtrace locations from a rescued exception" do + bt_locations = ExceptionSpecs::Backtrace.backtrace_locations + err = RuntimeError.new + err.backtrace.should == nil + err.backtrace_locations.should == nil + + err.set_backtrace bt_locations + + err.backtrace_locations.size.should == bt_locations.size + err.backtrace_locations.each_with_index do |loc, index| + other_loc = bt_locations[index] + + loc.path.should == other_loc.path + loc.label.should == other_loc.label + loc.base_label.should == other_loc.base_label + loc.lineno.should == other_loc.lineno + loc.absolute_path.should == other_loc.absolute_path + loc.to_s.should == other_loc.to_s + end + err.backtrace.size.should == err.backtrace_locations.size + end end it "accepts an empty Array" do diff --git a/spec/ruby/core/exception/signal_exception_spec.rb b/spec/ruby/core/exception/signal_exception_spec.rb index 566bcb4672..1a0940743f 100644 --- a/spec/ruby/core/exception/signal_exception_spec.rb +++ b/spec/ruby/core/exception/signal_exception_spec.rb @@ -93,7 +93,7 @@ describe "SignalException" do platform_is_not :windows do it "runs after at_exit" do - output = ruby_exe(<<-RUBY, exit_status: nil) + output = ruby_exe(<<-RUBY, exit_status: :SIGKILL) at_exit do puts "hello" $stdout.flush @@ -107,7 +107,7 @@ describe "SignalException" do end it "cannot be trapped with Signal.trap" do - ruby_exe(<<-RUBY, exit_status: nil) + ruby_exe(<<-RUBY, exit_status: :SIGPROF) Signal.trap("PROF") {} raise(SignalException, "PROF") RUBY @@ -116,7 +116,7 @@ describe "SignalException" do end it "self-signals for USR1" do - ruby_exe("raise(SignalException, 'USR1')", exit_status: nil) + ruby_exe("raise(SignalException, 'USR1')", exit_status: :SIGUSR1) $?.termsig.should == Signal.list.fetch('USR1') end end diff --git a/spec/ruby/core/exception/syntax_error_spec.rb b/spec/ruby/core/exception/syntax_error_spec.rb new file mode 100644 index 0000000000..6cc8522de3 --- /dev/null +++ b/spec/ruby/core/exception/syntax_error_spec.rb @@ -0,0 +1,27 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "SyntaxError#path" do + it "returns the file path provided to eval" do + filename = "speccing.rb" + + -> { + eval("if true", TOPLEVEL_BINDING, filename) + }.should raise_error(SyntaxError) { |e| + e.path.should == filename + } + end + + it "returns the file path that raised an exception" do + expected_path = fixture(__FILE__, "syntax_error.rb") + + -> { + require_relative "fixtures/syntax_error" + }.should raise_error(SyntaxError) { |e| e.path.should == expected_path } + end + + it "returns nil when constructed directly" do + SyntaxError.new.path.should == nil + end + end +end diff --git a/spec/ruby/core/exception/system_exit_spec.rb b/spec/ruby/core/exception/system_exit_spec.rb index eef9faf271..d899844c4e 100644 --- a/spec/ruby/core/exception/system_exit_spec.rb +++ b/spec/ruby/core/exception/system_exit_spec.rb @@ -1,6 +1,48 @@ require_relative '../../spec_helper' describe "SystemExit" do + describe "#initialize" do + it "accepts a status and message" do + exc = SystemExit.new(42, "message") + exc.status.should == 42 + exc.message.should == "message" + + exc = SystemExit.new(true, "message") + exc.status.should == 0 + exc.message.should == "message" + + exc = SystemExit.new(false, "message") + exc.status.should == 1 + exc.message.should == "message" + end + + it "accepts a status only" do + exc = SystemExit.new(42) + exc.status.should == 42 + exc.message.should == "SystemExit" + + exc = SystemExit.new(true) + exc.status.should == 0 + exc.message.should == "SystemExit" + + exc = SystemExit.new(false) + exc.status.should == 1 + exc.message.should == "SystemExit" + end + + it "accepts a message only" do + exc = SystemExit.new("message") + exc.status.should == 0 + exc.message.should == "message" + end + + it "accepts no arguments" do + exc = SystemExit.new + exc.status.should == 0 + exc.message.should == "SystemExit" + end + end + it "sets the exit status and exits silently when raised" do code = 'raise SystemExit.new(7)' result = ruby_exe(code, args: "2>&1", exit_status: 7) diff --git a/spec/ruby/core/exception/to_s_spec.rb b/spec/ruby/core/exception/to_s_spec.rb index 4c4c7ab432..65c0d73a98 100644 --- a/spec/ruby/core/exception/to_s_spec.rb +++ b/spec/ruby/core/exception/to_s_spec.rb @@ -23,7 +23,7 @@ describe "NameError#to_s" do begin puts not_defined rescue => exception - exception.message.should =~ /undefined local variable or method `not_defined'/ + exception.message.should =~ /undefined local variable or method [`']not_defined'/ end end diff --git a/spec/ruby/core/exception/top_level_spec.rb b/spec/ruby/core/exception/top_level_spec.rb index b47648425e..cc961d06d5 100644 --- a/spec/ruby/core/exception/top_level_spec.rb +++ b/spec/ruby/core/exception/top_level_spec.rb @@ -2,30 +2,38 @@ require_relative '../../spec_helper' describe "An Exception reaching the top level" do it "is printed on STDERR" do - ruby_exe('raise "foo"', args: "2>&1", exit_status: 1).should.include?("in `<main>': foo (RuntimeError)") + ruby_exe('raise "foo"', args: "2>&1", exit_status: 1).should =~ /in [`']<main>': foo \(RuntimeError\)/ end it "the Exception#cause is printed to STDERR with backtraces" do code = <<-RUBY def raise_cause - raise "the cause" + raise "the cause" # 2 end def raise_wrapped - raise "wrapped" + raise "wrapped" # 5 end begin - raise_cause + raise_cause # 8 rescue - raise_wrapped + raise_wrapped # 10 end RUBY lines = ruby_exe(code, args: "2>&1", exit_status: 1).lines - lines.reject! { |l| l.include?('rescue in') } - lines.map! { |l| l.chomp[/:(in.+)/, 1] } - lines.should == ["in `raise_wrapped': wrapped (RuntimeError)", - "in `<main>'", - "in `raise_cause': the cause (RuntimeError)", - "in `<main>'"] + + lines.map! { |l| l.chomp[/:(\d+:in.+)/, 1] } + lines[0].should =~ /\A5:in [`'](?:Object#)?raise_wrapped': wrapped \(RuntimeError\)\z/ + if lines[1].include? 'rescue in' + # CRuby < 3.4 has an extra 'rescue in' backtrace entry + lines[1].should =~ /\A10:in [`']rescue in <main>'\z/ + lines.delete_at 1 + lines[1].should =~ /\A7:in [`']<main>'\z/ + else + lines[1].should =~ /\A10:in [`']<main>'\z/ + end + lines[2].should =~ /\A2:in [`'](?:Object#)?raise_cause': the cause \(RuntimeError\)\z/ + lines[3].should =~ /\A8:in [`']<main>'\z/ + lines.size.should == 4 end describe "with a custom backtrace" do @@ -42,4 +50,16 @@ describe "An Exception reaching the top level" do EOS end end + + describe "kills all threads and fibers, ensure clauses are only run for threads current fibers, not for suspended fibers" do + it "with ensure on the root fiber" do + file = fixture(__FILE__, "thread_fiber_ensure.rb") + ruby_exe(file, args: "2>&1", exit_status: 0).should == "current fiber ensure\n" + end + + it "with ensure on non-root fiber" do + file = fixture(__FILE__, "thread_fiber_ensure_non_root_fiber.rb") + ruby_exe(file, args: "2>&1", exit_status: 0).should == "current fiber ensure\n" + end + end end diff --git a/spec/ruby/core/false/case_compare_spec.rb b/spec/ruby/core/false/case_compare_spec.rb new file mode 100644 index 0000000000..0bd0ab44ae --- /dev/null +++ b/spec/ruby/core/false/case_compare_spec.rb @@ -0,0 +1,14 @@ +require_relative '../../spec_helper' + +describe "FalseClass#===" do + it "returns true for false" do + (false === false).should == true + end + + it "returns false for non-false object" do + (false === 0).should == false + (false === "").should == false + (false === Object).should == false + (false === nil).should == false + end +end diff --git a/spec/ruby/core/false/singleton_method_spec.rb b/spec/ruby/core/false/singleton_method_spec.rb new file mode 100644 index 0000000000..738794b46c --- /dev/null +++ b/spec/ruby/core/false/singleton_method_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' + +describe "FalseClass#singleton_method" do + ruby_version_is '3.3' do + it "raises regardless of whether FalseClass defines the method" do + -> { false.singleton_method(:foo) }.should raise_error(NameError) + begin + def (false).foo; end + -> { false.singleton_method(:foo) }.should raise_error(NameError) + ensure + FalseClass.send(:remove_method, :foo) + end + end + end +end diff --git a/spec/ruby/core/false/to_s_spec.rb b/spec/ruby/core/false/to_s_spec.rb index 4cae278891..62f67f6f55 100644 --- a/spec/ruby/core/false/to_s_spec.rb +++ b/spec/ruby/core/false/to_s_spec.rb @@ -5,13 +5,11 @@ describe "FalseClass#to_s" do false.to_s.should == "false" end - ruby_version_is "2.7" do - it "returns a frozen string" do - false.to_s.should.frozen? - end + it "returns a frozen string" do + false.to_s.should.frozen? + end - it "always returns the same string" do - false.to_s.should equal(false.to_s) - end + it "always returns the same string" do + false.to_s.should equal(false.to_s) end end diff --git a/spec/ruby/core/fiber/blocking_spec.rb b/spec/ruby/core/fiber/blocking_spec.rb new file mode 100644 index 0000000000..ebefa116af --- /dev/null +++ b/spec/ruby/core/fiber/blocking_spec.rb @@ -0,0 +1,77 @@ +require_relative '../../spec_helper' +require_relative 'shared/blocking' + +require "fiber" + +describe "Fiber.blocking?" do + it_behaves_like :non_blocking_fiber, -> { Fiber.blocking? } + + context "when fiber is blocking" do + context "root Fiber of the main thread" do + it "returns 1 for blocking: true" do + fiber = Fiber.new(blocking: true) { Fiber.blocking? } + blocking = fiber.resume + + blocking.should == 1 + end + end + + context "root Fiber of a new thread" do + it "returns 1 for blocking: true" do + thread = Thread.new do + fiber = Fiber.new(blocking: true) { Fiber.blocking? } + blocking = fiber.resume + + blocking.should == 1 + end + + thread.join + end + end + end +end + +describe "Fiber#blocking?" do + it_behaves_like :non_blocking_fiber, -> { Fiber.current.blocking? } + + context "when fiber is blocking" do + context "root Fiber of the main thread" do + it "returns true for blocking: true" do + fiber = Fiber.new(blocking: true) { Fiber.current.blocking? } + blocking = fiber.resume + + blocking.should == true + end + end + + context "root Fiber of a new thread" do + it "returns true for blocking: true" do + thread = Thread.new do + fiber = Fiber.new(blocking: true) { Fiber.current.blocking? } + blocking = fiber.resume + + blocking.should == true + end + + thread.join + end + end + end +end + +ruby_version_is "3.2" do + describe "Fiber.blocking" do + context "when fiber is non-blocking" do + it "can become blocking" do + fiber = Fiber.new(blocking: false) do + Fiber.blocking do |f| + f.blocking? ? :blocking : :non_blocking + end + end + + blocking = fiber.resume + blocking.should == :blocking + end + end + end +end diff --git a/spec/ruby/core/fiber/inspect_spec.rb b/spec/ruby/core/fiber/inspect_spec.rb new file mode 100644 index 0000000000..f20a153fc2 --- /dev/null +++ b/spec/ruby/core/fiber/inspect_spec.rb @@ -0,0 +1,36 @@ +require_relative '../../spec_helper' +require 'fiber' + +describe "Fiber#inspect" do + describe "status" do + it "is resumed for the root Fiber of a Thread" do + inspected = Thread.new { Fiber.current.inspect }.value + inspected.should =~ /\A#<Fiber:0x\h+ .*\(resumed\)>\z/ + end + + it "is created for a Fiber which did not run yet" do + inspected = Fiber.new {}.inspect + inspected.should =~ /\A#<Fiber:0x\h+ .+ \(created\)>\z/ + end + + it "is resumed for a Fiber which was resumed" do + inspected = Fiber.new { Fiber.current.inspect }.resume + inspected.should =~ /\A#<Fiber:0x\h+ .+ \(resumed\)>\z/ + end + + it "is resumed for a Fiber which was transferred" do + inspected = Fiber.new { Fiber.current.inspect }.transfer + inspected.should =~ /\A#<Fiber:0x\h+ .+ \(resumed\)>\z/ + end + + it "is suspended for a Fiber which was resumed and yielded" do + inspected = Fiber.new { Fiber.yield }.tap(&:resume).inspect + inspected.should =~ /\A#<Fiber:0x\h+ .+ \(suspended\)>\z/ + end + + it "is terminated for a Fiber which has terminated" do + inspected = Fiber.new {}.tap(&:resume).inspect + inspected.should =~ /\A#<Fiber:0x\h+ .+ \(terminated\)>\z/ + end + end +end diff --git a/spec/ruby/core/fiber/kill_spec.rb b/spec/ruby/core/fiber/kill_spec.rb new file mode 100644 index 0000000000..2f4c499280 --- /dev/null +++ b/spec/ruby/core/fiber/kill_spec.rb @@ -0,0 +1,90 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' +require_relative '../../shared/kernel/raise' + +ruby_version_is "3.3" do + describe "Fiber#kill" do + it "kills a non-resumed fiber" do + fiber = Fiber.new{} + + fiber.alive?.should == true + + fiber.kill + fiber.alive?.should == false + end + + it "kills a resumed fiber" do + fiber = Fiber.new{while true; Fiber.yield; end} + fiber.resume + + fiber.alive?.should == true + + fiber.kill + fiber.alive?.should == false + end + + it "can kill itself" do + fiber = Fiber.new do + Fiber.current.kill + end + + fiber.alive?.should == true + + fiber.resume + fiber.alive?.should == false + end + + it "kills a resumed fiber from a child" do + parent = Fiber.new do + child = Fiber.new do + parent.kill + parent.alive?.should == true + end + + child.resume + end + + parent.resume + parent.alive?.should == false + end + + it "executes the ensure block" do + ensure_executed = false + + fiber = Fiber.new do + while true; Fiber.yield; end + ensure + ensure_executed = true + end + + fiber.resume + fiber.kill + ensure_executed.should == true + end + + it "does not execute rescue block" do + rescue_executed = false + + fiber = Fiber.new do + while true; Fiber.yield; end + rescue Exception + rescue_executed = true + end + + fiber.resume + fiber.kill + rescue_executed.should == false + end + + it "repeatedly kills a fiber" do + fiber = Fiber.new do + while true; Fiber.yield; end + ensure + while true; Fiber.yield; end + end + + fiber.kill + fiber.alive?.should == false + end + end +end diff --git a/spec/ruby/core/fiber/raise_spec.rb b/spec/ruby/core/fiber/raise_spec.rb index 2a465c8bfa..b3e021e636 100644 --- a/spec/ruby/core/fiber/raise_spec.rb +++ b/spec/ruby/core/fiber/raise_spec.rb @@ -2,120 +2,138 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative '../../shared/kernel/raise' -ruby_version_is "2.7" do - describe "Fiber#raise" do - it_behaves_like :kernel_raise, :raise, FiberSpecs::NewFiberToRaise +describe "Fiber#raise" do + it_behaves_like :kernel_raise, :raise, FiberSpecs::NewFiberToRaise +end + +describe "Fiber#raise" do + it 'raises RuntimeError by default' do + -> { FiberSpecs::NewFiberToRaise.raise }.should raise_error(RuntimeError) end - describe "Fiber#raise" do - it 'raises RuntimeError by default' do - -> { FiberSpecs::NewFiberToRaise.raise }.should raise_error(RuntimeError) - end + it "raises FiberError if Fiber is not born" do + fiber = Fiber.new { true } + -> { fiber.raise }.should raise_error(FiberError, "cannot raise exception on unborn fiber") + end - it "raises FiberError if Fiber is not born" do - fiber = Fiber.new { true } - -> { fiber.raise }.should raise_error(FiberError, "cannot raise exception on unborn fiber") - end + it "raises FiberError if Fiber is dead" do + fiber = Fiber.new { true } + fiber.resume + -> { fiber.raise }.should raise_error(FiberError, /dead fiber called|attempt to resume a terminated fiber/) + end - it "raises FiberError if Fiber is dead" do - fiber = Fiber.new { true } - fiber.resume - -> { fiber.raise }.should raise_error(FiberError, /dead fiber called|attempt to resume a terminated fiber/) - end + it 'accepts error class' do + -> { FiberSpecs::NewFiberToRaise.raise FiberSpecs::CustomError }.should raise_error(FiberSpecs::CustomError) + end - it 'accepts error class' do - -> { FiberSpecs::NewFiberToRaise.raise FiberSpecs::CustomError }.should raise_error(FiberSpecs::CustomError) - end + it 'accepts error message' do + -> { FiberSpecs::NewFiberToRaise.raise "error message" }.should raise_error(RuntimeError, "error message") + end - it 'accepts error message' do - -> { FiberSpecs::NewFiberToRaise.raise "error message" }.should raise_error(RuntimeError, "error message") - end + it 'does not accept array of backtrace information only' do + -> { FiberSpecs::NewFiberToRaise.raise ['foo'] }.should raise_error(TypeError) + end - it 'does not accept array of backtrace information only' do - -> { FiberSpecs::NewFiberToRaise.raise ['foo'] }.should raise_error(TypeError) - end + it 'does not accept integer' do + -> { FiberSpecs::NewFiberToRaise.raise 100 }.should raise_error(TypeError) + end - it 'does not accept integer' do - -> { FiberSpecs::NewFiberToRaise.raise 100 }.should raise_error(TypeError) - end + it 'accepts error class with error message' do + -> { FiberSpecs::NewFiberToRaise.raise FiberSpecs::CustomError, 'test error' }.should raise_error(FiberSpecs::CustomError, 'test error') + end - it 'accepts error class with error message' do - -> { FiberSpecs::NewFiberToRaise.raise FiberSpecs::CustomError, 'test error' }.should raise_error(FiberSpecs::CustomError, 'test error') - end + it 'accepts error class with with error message and backtrace information' do + -> { + FiberSpecs::NewFiberToRaise.raise FiberSpecs::CustomError, 'test error', ['foo', 'boo'] + }.should raise_error(FiberSpecs::CustomError) { |e| + e.message.should == 'test error' + e.backtrace.should == ['foo', 'boo'] + } + end + + it 'does not accept only error message and backtrace information' do + -> { FiberSpecs::NewFiberToRaise.raise 'test error', ['foo', 'boo'] }.should raise_error(TypeError) + end - it 'accepts error class with with error message and backtrace information' do + it "raises a FiberError if invoked from a different Thread" do + fiber = Fiber.new { Fiber.yield } + fiber.resume + Thread.new do -> { - FiberSpecs::NewFiberToRaise.raise FiberSpecs::CustomError, 'test error', ['foo', 'boo'] - }.should raise_error(FiberSpecs::CustomError) { |e| - e.message.should == 'test error' - e.backtrace.should == ['foo', 'boo'] - } + fiber.raise + }.should raise_error(FiberError, "fiber called across threads") + end.join + end + + it "kills Fiber" do + fiber = Fiber.new { Fiber.yield :first; :second } + fiber.resume + -> { fiber.raise }.should raise_error + -> { fiber.resume }.should raise_error(FiberError, /dead fiber called|attempt to resume a terminated fiber/) + end + + it "returns to calling fiber after raise" do + fiber_one = Fiber.new do + Fiber.yield :yield_one + :unreachable end - it 'does not accept only error message and backtrace information' do - -> { FiberSpecs::NewFiberToRaise.raise 'test error', ['foo', 'boo'] }.should raise_error(TypeError) + fiber_two = Fiber.new do + results = [] + results << fiber_one.resume + begin + fiber_one.raise + rescue + results << :rescued + end + results end - it "raises a FiberError if invoked from a different Thread" do - fiber = Fiber.new { Fiber.yield } - fiber.resume - Thread.new do - -> { - fiber.raise - }.should raise_error(FiberError, "fiber called across threads") - end.join + fiber_two.resume.should == [:yield_one, :rescued] + end + + ruby_version_is "3.4" do + it "raises on the resumed fiber" do + root_fiber = Fiber.current + f1 = Fiber.new { root_fiber.transfer } + f2 = Fiber.new { f1.resume } + f2.transfer + + -> do + f2.raise(RuntimeError, "Expected error") + end.should raise_error(RuntimeError, "Expected error") end - it "kills Fiber" do - fiber = Fiber.new { Fiber.yield :first; :second } - fiber.resume - -> { fiber.raise }.should raise_error - -> { fiber.resume }.should raise_error(FiberError, /dead fiber called|attempt to resume a terminated fiber/) + it "raises on itself" do + -> do + Fiber.current.raise(RuntimeError, "Expected error") + end.should raise_error(RuntimeError, "Expected error") end - it "returns to calling fiber after raise" do - fiber_one = Fiber.new do - Fiber.yield :yield_one - :unreachable + it "should raise on parent fiber" do + f2 = nil + f1 = Fiber.new do + # This is equivalent to Kernel#raise: + f2.raise(RuntimeError, "Expected error") end - - fiber_two = Fiber.new do - results = [] - results << fiber_one.resume - begin - fiber_one.raise - rescue - results << :rescued - end - results + f2 = Fiber.new do + f1.resume end - fiber_two.resume.should == [:yield_one, :rescued] + -> do + f2.resume + end.should raise_error(RuntimeError, "Expected error") end end - end -ruby_version_is "2.7"..."3.0" do - describe "Fiber#raise" do - it "raises a FiberError if invoked on a transferring Fiber" do - require "fiber" - root = Fiber.current - fiber = Fiber.new { root.transfer } - fiber.transfer - -> { fiber.raise }.should raise_error(FiberError, "cannot resume transferred Fiber") - end - end -end -ruby_version_is "3.0" do - describe "Fiber#raise" do - it "transfers and raises on a transferring fiber" do - require "fiber" - root = Fiber.current - fiber = Fiber.new { root.transfer } - fiber.transfer - -> { fiber.raise "msg" }.should raise_error(RuntimeError, "msg") - end +describe "Fiber#raise" do + it "transfers and raises on a transferring fiber" do + require "fiber" + root = Fiber.current + fiber = Fiber.new { root.transfer } + fiber.transfer + -> { fiber.raise "msg" }.should raise_error(RuntimeError, "msg") end end diff --git a/spec/ruby/core/fiber/resume_spec.rb b/spec/ruby/core/fiber/resume_spec.rb index 273bc866af..ab9a6799ab 100644 --- a/spec/ruby/core/fiber/resume_spec.rb +++ b/spec/ruby/core/fiber/resume_spec.rb @@ -28,18 +28,9 @@ describe "Fiber#resume" do fiber.resume :second end - ruby_version_is '3.0' do - it "raises a FiberError if the Fiber tries to resume itself" do - fiber = Fiber.new { fiber.resume } - -> { fiber.resume }.should raise_error(FiberError, /current fiber/) - end - end - - ruby_version_is '' ... '3.0' do - it "raises a FiberError if the Fiber tries to resume itself" do - fiber = Fiber.new { fiber.resume } - -> { fiber.resume }.should raise_error(FiberError, /double resume/) - end + it "raises a FiberError if the Fiber tries to resume itself" do + fiber = Fiber.new { fiber.resume } + -> { fiber.resume }.should raise_error(FiberError, /current fiber/) end it "returns control to the calling Fiber if called from one" do diff --git a/spec/ruby/core/fiber/shared/blocking.rb b/spec/ruby/core/fiber/shared/blocking.rb new file mode 100644 index 0000000000..21707e1ea7 --- /dev/null +++ b/spec/ruby/core/fiber/shared/blocking.rb @@ -0,0 +1,41 @@ +describe :non_blocking_fiber, shared: true do + context "root Fiber of the main thread" do + it "returns false" do + fiber = Fiber.new { @method.call } + blocking = fiber.resume + + blocking.should == false + end + + it "returns false for blocking: false" do + fiber = Fiber.new(blocking: false) { @method.call } + blocking = fiber.resume + + blocking.should == false + end + end + + context "root Fiber of a new thread" do + it "returns false" do + thread = Thread.new do + fiber = Fiber.new { @method.call } + blocking = fiber.resume + + blocking.should == false + end + + thread.join + end + + it "returns false for blocking: false" do + thread = Thread.new do + fiber = Fiber.new(blocking: false) { @method.call } + blocking = fiber.resume + + blocking.should == false + end + + thread.join + end + end +end diff --git a/spec/ruby/core/fiber/storage_spec.rb b/spec/ruby/core/fiber/storage_spec.rb new file mode 100644 index 0000000000..5c87ed5d41 --- /dev/null +++ b/spec/ruby/core/fiber/storage_spec.rb @@ -0,0 +1,158 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "Fiber.new(storage:)" do + it "creates a Fiber with the given storage" do + storage = {life: 42} + fiber = Fiber.new(storage: storage) { Fiber.current.storage } + fiber.resume.should == storage + end + + it "creates a fiber with lazily initialized storage" do + Fiber.new(storage: nil) { Fiber[:x] = 10; Fiber.current.storage }.resume.should == {x: 10} + end + + it "creates a fiber by inheriting the storage of the parent fiber" do + fiber = Fiber.new(storage: {life: 42}) do + Fiber.new { Fiber.current.storage }.resume + end + fiber.resume.should == {life: 42} + end + + it "cannot create a fiber with non-hash storage" do + -> { Fiber.new(storage: 42) {} }.should raise_error(TypeError) + end + + it "cannot create a fiber with a frozen hash as storage" do + -> { Fiber.new(storage: {life: 43}.freeze) {} }.should raise_error(FrozenError) + end + + it "cannot create a fiber with a storage hash with non-symbol keys" do + -> { Fiber.new(storage: {life: 43, Object.new => 44}) {} }.should raise_error(TypeError) + end + end + + describe "Fiber#storage" do + it "cannot be accessed from a different fiber" do + f = Fiber.new(storage: {life: 42}) { nil } + -> { + f.storage + }.should raise_error(ArgumentError, /Fiber storage can only be accessed from the Fiber it belongs to/) + end + end + + describe "Fiber#storage=" do + it "can clear the storage of the fiber" do + fiber = Fiber.new(storage: {life: 42}) do + Fiber.current.storage = nil + Fiber[:x] = 10 + Fiber.current.storage + end + fiber.resume.should == {x: 10} + end + + it "can set the storage of the fiber" do + fiber = Fiber.new(storage: {life: 42}) do + Fiber.current.storage = {life: 43} + Fiber.current.storage + end + fiber.resume.should == {life: 43} + end + + it "can't set the storage of the fiber to non-hash" do + -> { Fiber.current.storage = 42 }.should raise_error(TypeError) + end + + it "can't set the storage of the fiber to a frozen hash" do + -> { Fiber.current.storage = {life: 43}.freeze }.should raise_error(FrozenError) + end + + it "can't set the storage of the fiber to a hash with non-symbol keys" do + -> { Fiber.current.storage = {life: 43, Object.new => 44} }.should raise_error(TypeError) + end + end + + describe "Fiber.[]" do + it "returns the value of the given key in the storage of the current fiber" do + Fiber.new(storage: {life: 42}) { Fiber[:life] }.resume.should == 42 + end + + it "returns nil if the key is not present in the storage of the current fiber" do + Fiber.new(storage: {life: 42}) { Fiber[:death] }.resume.should be_nil + end + + it "returns nil if the current fiber has no storage" do + Fiber.new { Fiber[:life] }.resume.should be_nil + end + + ruby_version_is "3.2.3" do + it "can use dynamically defined keys" do + key = :"#{self.class.name}#.#{self.object_id}" + Fiber.new { Fiber[key] = 42; Fiber[key] }.resume.should == 42 + end + + it "can't use invalid keys" do + invalid_keys = [Object.new, "Foo", 12] + invalid_keys.each do |key| + -> { Fiber[key] }.should raise_error(TypeError) + end + end + end + + it "can access the storage of the parent fiber" do + f = Fiber.new(storage: {life: 42}) do + Fiber.new { Fiber[:life] }.resume + end + f.resume.should == 42 + end + + it "can't access the storage of the fiber with non-symbol keys" do + -> { Fiber[Object.new] }.should raise_error(TypeError) + end + end + + describe "Fiber.[]=" do + it "sets the value of the given key in the storage of the current fiber" do + Fiber.new(storage: {life: 42}) { Fiber[:life] = 43; Fiber[:life] }.resume.should == 43 + end + + it "sets the value of the given key in the storage of the current fiber" do + Fiber.new(storage: {life: 42}) { Fiber[:death] = 43; Fiber[:death] }.resume.should == 43 + end + + it "sets the value of the given key in the storage of the current fiber" do + Fiber.new { Fiber[:life] = 43; Fiber[:life] }.resume.should == 43 + end + + it "does not overwrite the storage of the parent fiber" do + f = Fiber.new(storage: {life: 42}) do + Fiber.yield Fiber.new { Fiber[:life] = 43; Fiber[:life] }.resume + Fiber[:life] + end + f.resume.should == 43 # Value of the inner fiber + f.resume.should == 42 # Value of the outer fiber + end + + it "can't access the storage of the fiber with non-symbol keys" do + -> { Fiber[Object.new] = 44 }.should raise_error(TypeError) + end + + ruby_version_is "3.3" do + it "deletes the fiber storage key when assigning nil" do + Fiber.new(storage: {life: 42}) { + Fiber[:life] = nil + Fiber.current.storage + }.resume.should == {} + end + end + end + + describe "Thread.new" do + it "creates a thread with the storage of the current fiber" do + fiber = Fiber.new(storage: {life: 42}) do + Thread.new { Fiber.current.storage }.value + end + fiber.resume.should == {life: 42} + end + end +end diff --git a/spec/ruby/core/file/absolute_path_spec.rb b/spec/ruby/core/file/absolute_path_spec.rb index 9f39923472..315eead34f 100644 --- a/spec/ruby/core/file/absolute_path_spec.rb +++ b/spec/ruby/core/file/absolute_path_spec.rb @@ -1,54 +1,52 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "File.absolute_path?" do - before :each do - @abs = File.expand_path(__FILE__) - end +describe "File.absolute_path?" do + before :each do + @abs = File.expand_path(__FILE__) + end - it "returns true if it's an absolute pathname" do - File.absolute_path?(@abs).should be_true - end + it "returns true if it's an absolute pathname" do + File.absolute_path?(@abs).should be_true + end - it "returns false if it's a relative path" do - File.absolute_path?(File.basename(__FILE__)).should be_false - end + it "returns false if it's a relative path" do + File.absolute_path?(File.basename(__FILE__)).should be_false + end - it "returns false if it's a tricky relative path" do - File.absolute_path?("C:foo\\bar").should be_false - end + it "returns false if it's a tricky relative path" do + File.absolute_path?("C:foo\\bar").should be_false + end - it "does not expand '~' to a home directory." do - File.absolute_path?('~').should be_false - end + it "does not expand '~' to a home directory." do + File.absolute_path?('~').should be_false + end - it "does not expand '~user' to a home directory." do - path = File.dirname(@abs) - Dir.chdir(path) do - File.absolute_path?('~user').should be_false - end + it "does not expand '~user' to a home directory." do + path = File.dirname(@abs) + Dir.chdir(path) do + File.absolute_path?('~user').should be_false end + end - it "calls #to_path on its argument" do - mock = mock_to_path(File.expand_path(__FILE__)) + it "calls #to_path on its argument" do + mock = mock_to_path(File.expand_path(__FILE__)) - File.absolute_path?(mock).should be_true - end + File.absolute_path?(mock).should be_true + end - platform_is_not :windows do - it "takes into consideration the platform's root" do - File.absolute_path?("C:\\foo\\bar").should be_false - File.absolute_path?("C:/foo/bar").should be_false - File.absolute_path?("/foo/bar\\baz").should be_true - end + platform_is_not :windows do + it "takes into consideration the platform's root" do + File.absolute_path?("C:\\foo\\bar").should be_false + File.absolute_path?("C:/foo/bar").should be_false + File.absolute_path?("/foo/bar\\baz").should be_true end + end - platform_is :windows do - it "takes into consideration the platform path separator(s)" do - File.absolute_path?("C:\\foo\\bar").should be_true - File.absolute_path?("C:/foo/bar").should be_true - File.absolute_path?("/foo/bar\\baz").should be_false - end + platform_is :windows do + it "takes into consideration the platform path separator(s)" do + File.absolute_path?("C:\\foo\\bar").should be_true + File.absolute_path?("C:/foo/bar").should be_true + File.absolute_path?("/foo/bar\\baz").should be_false end end end @@ -87,7 +85,7 @@ describe "File.absolute_path" do end it "accepts a second argument of a directory from which to resolve the path" do - File.absolute_path(__FILE__, File.dirname(__FILE__)).should == @abs + File.absolute_path(__FILE__, __dir__).should == @abs end it "calls #to_path on its argument" do diff --git a/spec/ruby/core/file/atime_spec.rb b/spec/ruby/core/file/atime_spec.rb index cef07ba010..e47e70e5ac 100644 --- a/spec/ruby/core/file/atime_spec.rb +++ b/spec/ruby/core/file/atime_spec.rb @@ -16,10 +16,10 @@ describe "File.atime" do end platform_is :linux, :windows do - platform_is_not :"powerpc64le-linux" do # https://bugs.ruby-lang.org/issues/17926 + unless ENV.key?('TRAVIS') # https://bugs.ruby-lang.org/issues/17926 ## NOTE also that some Linux systems disable atime (e.g. via mount params) for better filesystem speed. it "returns the last access time for the named file with microseconds" do - supports_subseconds = Integer(`stat -c%x '#{__FILE__}'`[/\.(\d+)/, 1], 10) + supports_subseconds = Integer(`stat -c%x '#{__FILE__}'`[/\.(\d{1,6})/, 1], 10) if supports_subseconds != 0 expected_time = Time.at(Time.now.to_i + 0.123456) File.utime expected_time, 0, @file @@ -27,6 +27,9 @@ describe "File.atime" do else File.atime(__FILE__).usec.should == 0 end + rescue Errno::ENOENT => e + # Native Windows don't have stat command. + skip e.message end end end diff --git a/spec/ruby/core/file/ctime_spec.rb b/spec/ruby/core/file/ctime_spec.rb index b16eb13c1e..718f26d5cc 100644 --- a/spec/ruby/core/file/ctime_spec.rb +++ b/spec/ruby/core/file/ctime_spec.rb @@ -16,12 +16,15 @@ describe "File.ctime" do platform_is :linux, :windows do it "returns the change time for the named file (the time at which directory information about the file was changed, not the file itself) with microseconds." do - supports_subseconds = Integer(`stat -c%z '#{__FILE__}'`[/\.(\d+)/, 1], 10) + supports_subseconds = Integer(`stat -c%z '#{__FILE__}'`[/\.(\d{1,6})/, 1], 10) if supports_subseconds != 0 File.ctime(__FILE__).usec.should > 0 else File.ctime(__FILE__).usec.should == 0 end + rescue Errno::ENOENT => e + # Windows don't have stat command. + skip e.message end end diff --git a/spec/ruby/core/file/dirname_spec.rb b/spec/ruby/core/file/dirname_spec.rb index cf0f909f59..8dd6c4ca88 100644 --- a/spec/ruby/core/file/dirname_spec.rb +++ b/spec/ruby/core/file/dirname_spec.rb @@ -12,18 +12,33 @@ describe "File.dirname" do end ruby_version_is '3.1' do - it "returns all the components of filename except the last parts by the level" do - File.dirname('/home/jason', 2).should == '/' - File.dirname('/home/jason/poot.txt', 2).should == '/home' - end - - it "returns the same string if the level is 0" do - File.dirname('poot.txt', 0).should == 'poot.txt' - File.dirname('/', 0).should == '/' - end - - it "raises ArgumentError if the level is negative" do - -> {File.dirname('/home/jason', -1)}.should raise_error(ArgumentError) + context "when level is passed" do + it "returns all the components of filename except the last parts by the level" do + File.dirname('/home/jason', 2).should == '/' + File.dirname('/home/jason/poot.txt', 2).should == '/home' + end + + it "returns the same String if the level is 0" do + File.dirname('poot.txt', 0).should == 'poot.txt' + File.dirname('/', 0).should == '/' + end + + it "raises ArgumentError if the level is negative" do + -> { + File.dirname('/home/jason', -1) + }.should raise_error(ArgumentError, "negative level: -1") + end + + it "returns '/' when level exceeds the number of segments in the path" do + File.dirname("/home/jason", 100).should == '/' + end + + it "calls #to_int if passed not numeric value" do + object = Object.new + def object.to_int; 2; end + + File.dirname("/a/b/c/d", object).should == '/a/b' + end end end diff --git a/spec/ruby/core/file/exist_spec.rb b/spec/ruby/core/file/exist_spec.rb index ddb5febcba..2633376880 100644 --- a/spec/ruby/core/file/exist_spec.rb +++ b/spec/ruby/core/file/exist_spec.rb @@ -4,3 +4,11 @@ require_relative '../../shared/file/exist' describe "File.exist?" do it_behaves_like :file_exist, :exist?, File end + +ruby_version_is "3.2" do + describe "File.exists?" do + it "has been removed" do + File.should_not.respond_to?(:exists?) + end + end +end diff --git a/spec/ruby/core/file/expand_path_spec.rb b/spec/ruby/core/file/expand_path_spec.rb index c31f885b92..1abcf93900 100644 --- a/spec/ruby/core/file/expand_path_spec.rb +++ b/spec/ruby/core/file/expand_path_spec.rb @@ -137,7 +137,7 @@ describe "File.expand_path" do it "returns a String in the same encoding as the argument" do Encoding.default_external = Encoding::SHIFT_JIS - path = "./a".force_encoding Encoding::CP1251 + path = "./a".dup.force_encoding Encoding::CP1251 File.expand_path(path).encoding.should equal(Encoding::CP1251) weird_path = [222, 173, 190, 175].pack('C*') diff --git a/spec/ruby/core/file/extname_spec.rb b/spec/ruby/core/file/extname_spec.rb index e182ed44f2..d20cf813d9 100644 --- a/spec/ruby/core/file/extname_spec.rb +++ b/spec/ruby/core/file/extname_spec.rb @@ -33,14 +33,14 @@ describe "File.extname" do end describe "for a filename ending with a dot" do - guard -> { platform_is :windows or ruby_version_is ""..."2.7" } do + platform_is :windows do it "returns ''" do File.extname(".foo.").should == "" File.extname("foo.").should == "" end end - guard -> { platform_is_not :windows and ruby_version_is "2.7" } do + platform_is_not :windows do it "returns '.'" do File.extname(".foo.").should == "." File.extname("foo.").should == "." diff --git a/spec/ruby/core/file/flock_spec.rb b/spec/ruby/core/file/flock_spec.rb index 751e99d994..070d830bc4 100644 --- a/spec/ruby/core/file/flock_spec.rb +++ b/spec/ruby/core/file/flock_spec.rb @@ -30,7 +30,7 @@ describe "File#flock" do it "returns false if trying to lock an exclusively locked file" do @file.flock File::LOCK_EX - ruby_exe(<<-END_OF_CODE, escape: true).should == "false" + ruby_exe(<<-END_OF_CODE).should == "false" File.open('#{@name}', "w") do |f2| print f2.flock(File::LOCK_EX | File::LOCK_NB).to_s end @@ -40,7 +40,7 @@ describe "File#flock" do it "blocks if trying to lock an exclusively locked file" do @file.flock File::LOCK_EX - out = ruby_exe(<<-END_OF_CODE, escape: true) + out = ruby_exe(<<-END_OF_CODE) running = false t = Thread.new do diff --git a/spec/ruby/core/file/lutime_spec.rb b/spec/ruby/core/file/lutime_spec.rb index 1f0625f61e..0f6df42ea3 100644 --- a/spec/ruby/core/file/lutime_spec.rb +++ b/spec/ruby/core/file/lutime_spec.rb @@ -1,7 +1,12 @@ require_relative '../../spec_helper' +require_relative 'shared/update_time' -describe "File.lutime" do - platform_is_not :windows do +platform_is_not :windows do + describe "File.lutime" do + it_behaves_like :update_time, :lutime + end + + describe "File.lutime" do before :each do @atime = Time.utc(2000) @mtime = Time.utc(2001) diff --git a/spec/ruby/core/file/mtime_spec.rb b/spec/ruby/core/file/mtime_spec.rb index 8d47d3021a..0e9c95caee 100644 --- a/spec/ruby/core/file/mtime_spec.rb +++ b/spec/ruby/core/file/mtime_spec.rb @@ -16,14 +16,19 @@ describe "File.mtime" do end platform_is :linux, :windows do - it "returns the modification Time of the file with microseconds" do - supports_subseconds = Integer(`stat -c%y '#{__FILE__}'`[/\.(\d+)/, 1], 10) - if supports_subseconds != 0 - expected_time = Time.at(Time.now.to_i + 0.123456) - File.utime 0, expected_time, @filename - File.mtime(@filename).usec.should == expected_time.usec - else - File.mtime(__FILE__).usec.should == 0 + unless ENV.key?('TRAVIS') # https://bugs.ruby-lang.org/issues/17926 + it "returns the modification Time of the file with microseconds" do + supports_subseconds = Integer(`stat -c%y '#{__FILE__}'`[/\.(\d{1,6})/, 1], 10) + if supports_subseconds != 0 + expected_time = Time.at(Time.now.to_i + 0.123456) + File.utime 0, expected_time, @filename + File.mtime(@filename).usec.should == expected_time.usec + else + File.mtime(__FILE__).usec.should == 0 + end + rescue Errno::ENOENT => e + # Windows don't have stat command. + skip e.message end end end diff --git a/spec/ruby/core/file/new_spec.rb b/spec/ruby/core/file/new_spec.rb index 004f78503a..1e82a070b1 100644 --- a/spec/ruby/core/file/new_spec.rb +++ b/spec/ruby/core/file/new_spec.rb @@ -78,13 +78,29 @@ describe "File.new" do File.should.exist?(@file) end + it "returns a new read-only File when mode is not specified" do + @fh = File.new(@file) + + -> { @fh.puts("test") }.should raise_error(IOError) + @fh.read.should == "" + File.should.exist?(@file) + end + + it "returns a new read-only File when mode is not specified but flags option is present" do + @fh = File.new(@file, flags: File::CREAT) + + -> { @fh.puts("test") }.should raise_error(IOError) + @fh.read.should == "" + File.should.exist?(@file) + end + it "creates a new file when use File::EXCL mode" do @fh = File.new(@file, File::EXCL) @fh.should be_kind_of(File) File.should.exist?(@file) end - it "raises an Errorno::EEXIST if the file exists when create a new file with File::CREAT|File::EXCL" do + it "raises an Errno::EEXIST if the file exists when create a new file with File::CREAT|File::EXCL" do -> { @fh = File.new(@file, File::CREAT|File::EXCL) }.should raise_error(Errno::EEXIST) end @@ -112,13 +128,32 @@ describe "File.new" do File.should.exist?(@file) end - it "creates a new file when use File::WRONLY|File::TRUNC mode" do @fh = File.new(@file, File::WRONLY|File::TRUNC) @fh.should be_kind_of(File) File.should.exist?(@file) end + it "returns a new read-only File when use File::RDONLY|File::CREAT mode" do + @fh = File.new(@file, File::RDONLY|File::CREAT) + @fh.should be_kind_of(File) + File.should.exist?(@file) + + # it's read-only + -> { @fh.puts("test") }.should raise_error(IOError) + @fh.read.should == "" + end + + it "returns a new read-only File when use File::CREAT mode" do + @fh = File.new(@file, File::CREAT) + @fh.should be_kind_of(File) + File.should.exist?(@file) + + # it's read-only + -> { @fh.puts("test") }.should raise_error(IOError) + @fh.read.should == "" + end + it "coerces filename using to_str" do name = mock("file") name.should_receive(:to_str).and_return(@file) @@ -133,6 +168,32 @@ describe "File.new" do File.should.exist?(@file) end + it "accepts options as a keyword argument" do + @fh = File.new(@file, 'w', 0755, flags: @flags) + @fh.should be_kind_of(File) + @fh.close + + -> { + @fh = File.new(@file, 'w', 0755, {flags: @flags}) + }.should raise_error(ArgumentError, "wrong number of arguments (given 4, expected 1..3)") + end + + it "bitwise-ORs mode and flags option" do + -> { + @fh = File.new(@file, 'w', flags: File::EXCL) + }.should raise_error(Errno::EEXIST, /File exists/) + + -> { + @fh = File.new(@file, mode: 'w', flags: File::EXCL) + }.should raise_error(Errno::EEXIST, /File exists/) + end + + it "does not use the given block and warns to use File::open" do + -> { + @fh = File.new(@file) { raise } + }.should complain(/warning: File::new\(\) does not take block; use File::open\(\) instead/) + end + it "raises a TypeError if the first parameter can't be coerced to a string" do -> { File.new(true) }.should raise_error(TypeError) -> { File.new(false) }.should raise_error(TypeError) diff --git a/spec/ruby/core/file/open_spec.rb b/spec/ruby/core/file/open_spec.rb index c7dd34d5c6..6bfc16bbf9 100644 --- a/spec/ruby/core/file/open_spec.rb +++ b/spec/ruby/core/file/open_spec.rb @@ -314,7 +314,7 @@ describe "File.open" do end end - it "raises an IOError when read in a block opened with File::RDONLY|File::APPEND mode" do + it "raises an IOError when write in a block opened with File::RDONLY|File::APPEND mode" do -> { File.open(@file, File::RDONLY|File::APPEND ) do |f| f.puts("writing") @@ -354,7 +354,7 @@ describe "File.open" do end end - it "raises an Errorno::EEXIST if the file exists when open with File::CREAT|File::EXCL" do + it "raises an Errno::EEXIST if the file exists when open with File::CREAT|File::EXCL" do -> { File.open(@file, File::CREAT|File::EXCL) do |f| f.puts("writing") @@ -423,7 +423,7 @@ describe "File.open" do }.should raise_error(IOError) end - it "raises an Errorno::EEXIST if the file exists when open with File::RDONLY|File::TRUNC" do + it "raises an Errno::EEXIST if the file exists when open with File::RDONLY|File::TRUNC" do -> { File.open(@file, File::RDONLY|File::TRUNC) do |f| f.puts("writing").should == nil @@ -441,7 +441,7 @@ describe "File.open" do }.should raise_error(Errno::EINVAL) end - it "raises an Errorno::EEXIST if the file exists when open with File::RDONLY|File::TRUNC" do + it "raises an Errno::EEXIST if the file exists when open with File::RDONLY|File::TRUNC" do -> { File.open(@file, File::RDONLY|File::TRUNC) do |f| f.puts("writing").should == nil @@ -494,6 +494,14 @@ describe "File.open" do File.open(@file, "w") { |f| f.puts "testing" } File.size(@file).should > 0 File.open(@file, "rb+") do |f| + f.binmode?.should == true + f.external_encoding.should == Encoding::ASCII_8BIT + f.pos.should == 0 + f.should_not.eof? + end + File.open(@file, "r+b") do |f| + f.binmode?.should == true + f.external_encoding.should == Encoding::ASCII_8BIT f.pos.should == 0 f.should_not.eof? end @@ -557,6 +565,15 @@ describe "File.open" do File.open(@file, 'wb+') {|f| f.external_encoding.should == Encoding::BINARY} end + it "accepts options as a keyword argument" do + @fh = File.open(@file, 'w', 0755, flags: File::CREAT) + @fh.should be_an_instance_of(File) + + -> { + File.open(@file, 'w', 0755, {flags: File::CREAT}) + }.should raise_error(ArgumentError, "wrong number of arguments (given 4, expected 1..3)") + end + it "uses the second argument as an options Hash" do @fh = File.open(@file, mode: "r") @fh.should be_an_instance_of(File) diff --git a/spec/ruby/core/file/realpath_spec.rb b/spec/ruby/core/file/realpath_spec.rb index bd27e09da6..bd25bfdecf 100644 --- a/spec/ruby/core/file/realpath_spec.rb +++ b/spec/ruby/core/file/realpath_spec.rb @@ -54,6 +54,10 @@ platform_is_not :windows do File.realpath(@relative_symlink).should == @file end + it "removes the file element when going one level up" do + File.realpath('../', @file).should == @real_dir + end + it "raises an Errno::ELOOP if the symlink points to itself" do File.unlink @link File.symlink(@link, @link) diff --git a/spec/ruby/core/file/shared/fnmatch.rb b/spec/ruby/core/file/shared/fnmatch.rb index a8488fd30a..db4b5c5d8c 100644 --- a/spec/ruby/core/file/shared/fnmatch.rb +++ b/spec/ruby/core/file/shared/fnmatch.rb @@ -75,6 +75,14 @@ describe :file_fnmatch, shared: true do File.send(@method, 'c*t', 'c/a/b/t').should == true end + it "does not match unterminated range of characters" do + File.send(@method, 'abc[de', 'abcd').should == false + end + + it "does not match unterminated range of characters as a literal" do + File.send(@method, 'abc[de', 'abc[de').should == false + end + it "matches ranges of characters using bracket expression (e.g. [a-z])" do File.send(@method, 'ca[a-z]', 'cat').should == true end @@ -94,6 +102,7 @@ describe :file_fnmatch, shared: true do it "matches ranges of characters using exclusive bracket expression (e.g. [^t] or [!t])" do File.send(@method, 'ca[^t]', 'cat').should == false + File.send(@method, 'ca[^t]', 'cas').should == true File.send(@method, 'ca[!t]', 'cat').should == false end @@ -117,6 +126,13 @@ describe :file_fnmatch, shared: true do end end + it "matches wildcard with characters when flags includes FNM_PATHNAME" do + File.send(@method, '*a', 'aa', File::FNM_PATHNAME).should == true + File.send(@method, 'a*', 'aa', File::FNM_PATHNAME).should == true + File.send(@method, 'a*', 'aaa', File::FNM_PATHNAME).should == true + File.send(@method, '*a', 'aaa', File::FNM_PATHNAME).should == true + end + it "does not match '/' characters with ? or * when flags includes FNM_PATHNAME" do File.send(@method, '?', '/', File::FNM_PATHNAME).should == false File.send(@method, '*', '/', File::FNM_PATHNAME).should == false @@ -151,15 +167,25 @@ describe :file_fnmatch, shared: true do end it "does not match leading periods in filenames with wildcards by default" do - File.send(@method, '*', '.profile').should == false - File.send(@method, '*', 'home/.profile').should == true - File.send(@method, '*/*', 'home/.profile').should == true - File.send(@method, '*/*', 'dave/.profile', File::FNM_PATHNAME).should == false + File.should_not.send(@method, '*', '.profile') + File.should.send(@method, '*', 'home/.profile') + File.should.send(@method, '*/*', 'home/.profile') + File.should_not.send(@method, '*/*', 'dave/.profile', File::FNM_PATHNAME) end - it "matches patterns with leading periods to dotfiles by default" do + it "matches patterns with leading periods to dotfiles" do File.send(@method, '.*', '.profile').should == true + File.send(@method, '.*', '.profile', File::FNM_PATHNAME).should == true File.send(@method, ".*file", "nondotfile").should == false + File.send(@method, ".*file", "nondotfile", File::FNM_PATHNAME).should == false + end + + it "does not match directories with leading periods by default with FNM_PATHNAME" do + File.send(@method, '.*', '.directory/nondotfile', File::FNM_PATHNAME).should == false + File.send(@method, '.*', '.directory/.profile', File::FNM_PATHNAME).should == false + File.send(@method, '.*', 'foo/.directory/nondotfile', File::FNM_PATHNAME).should == false + File.send(@method, '.*', 'foo/.directory/.profile', File::FNM_PATHNAME).should == false + File.send(@method, '**/.dotfile', '.dotsubdir/.dotfile', File::FNM_PATHNAME).should == false end it "matches leading periods in filenames when flags includes FNM_DOTMATCH" do @@ -213,6 +239,33 @@ describe :file_fnmatch, shared: true do File.send(@method, pattern, 'a/.b/c/foo', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true end + it "has special handling for ./ when using * and FNM_PATHNAME" do + File.send(@method, './*', '.', File::FNM_PATHNAME).should be_false + File.send(@method, './*', './', File::FNM_PATHNAME).should be_true + File.send(@method, './*/', './', File::FNM_PATHNAME).should be_false + File.send(@method, './**', './', File::FNM_PATHNAME).should be_true + File.send(@method, './**/', './', File::FNM_PATHNAME).should be_true + File.send(@method, './*', '.', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_false + File.send(@method, './*', './', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true + File.send(@method, './*/', './', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_false + File.send(@method, './**', './', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true + File.send(@method, './**/', './', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true + end + + it "matches **/* with FNM_PATHNAME to recurse directories" do + File.send(@method, 'nested/**/*', 'nested/subdir', File::FNM_PATHNAME).should be_true + File.send(@method, 'nested/**/*', 'nested/subdir/file', File::FNM_PATHNAME).should be_true + File.send(@method, 'nested/**/*', 'nested/.dotsubdir', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true + File.send(@method, 'nested/**/*', 'nested/.dotsubir/.dotfile', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true + end + + it "matches ** with FNM_PATHNAME only in current directory" do + File.send(@method, 'nested/**', 'nested/subdir', File::FNM_PATHNAME).should be_true + File.send(@method, 'nested/**', 'nested/subdir/file', File::FNM_PATHNAME).should be_false + File.send(@method, 'nested/**', 'nested/.dotsubdir', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_true + File.send(@method, 'nested/**', 'nested/.dotsubir/.dotfile', File::FNM_PATHNAME | File::FNM_DOTMATCH).should be_false + end + it "accepts an object that has a #to_path method" do File.send(@method, '\*', mock_to_path('a')).should == false end diff --git a/spec/ruby/core/file/shared/path.rb b/spec/ruby/core/file/shared/path.rb index 0a5abe33f0..aa2a64cf25 100644 --- a/spec/ruby/core/file/shared/path.rb +++ b/spec/ruby/core/file/shared/path.rb @@ -1,7 +1,7 @@ describe :file_path, shared: true do before :each do - @name = "file_to_path" - @path = tmp(@name) + @path = tmp("file_to_path") + @name = File.basename(@path) touch @path end @@ -78,13 +78,15 @@ describe :file_path, shared: true do rm_r @dir end - it "raises IOError if file was opened with File::TMPFILE" do - begin - File.open(@dir, File::RDWR | File::TMPFILE) do |f| - -> { f.send(@method) }.should raise_error(IOError) + ruby_version_is ""..."3.1" do + it "raises IOError if file was opened with File::TMPFILE" do + begin + File.open(@dir, File::RDWR | File::TMPFILE) do |f| + -> { f.send(@method) }.should raise_error(IOError) + end + rescue Errno::EOPNOTSUPP, Errno::EINVAL, Errno::EISDIR + skip "no support from the filesystem" end - rescue Errno::EOPNOTSUPP, Errno::EINVAL, Errno::EISDIR - skip "no support from the filesystem" end end end diff --git a/spec/ruby/core/file/shared/update_time.rb b/spec/ruby/core/file/shared/update_time.rb new file mode 100644 index 0000000000..9c063a8e93 --- /dev/null +++ b/spec/ruby/core/file/shared/update_time.rb @@ -0,0 +1,105 @@ +describe :update_time, shared: true do + before :all do + @time_is_float = platform_is :windows + end + + before :each do + @atime = Time.now + @mtime = Time.now + @file1 = tmp("specs_file_utime1") + @file2 = tmp("specs_file_utime2") + touch @file1 + touch @file2 + end + + after :each do + rm_r @file1, @file2 + end + + it "sets the access and modification time of each file" do + File.send(@method, @atime, @mtime, @file1, @file2) + + if @time_is_float + File.atime(@file1).should be_close(@atime, 0.0001) + File.mtime(@file1).should be_close(@mtime, 0.0001) + File.atime(@file2).should be_close(@atime, 0.0001) + File.mtime(@file2).should be_close(@mtime, 0.0001) + else + File.atime(@file1).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) + File.mtime(@file1).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) + File.atime(@file2).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) + File.mtime(@file2).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) + end + end + + it "uses the current times if two nil values are passed" do + tn = Time.now + File.send(@method, nil, nil, @file1, @file2) + + if @time_is_float + File.atime(@file1).should be_close(tn, 0.050) + File.mtime(@file1).should be_close(tn, 0.050) + File.atime(@file2).should be_close(tn, 0.050) + File.mtime(@file2).should be_close(tn, 0.050) + else + File.atime(@file1).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) + File.mtime(@file1).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) + File.atime(@file2).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) + File.mtime(@file2).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) + end + end + + it "accepts an object that has a #to_path method" do + File.send(@method, @atime, @mtime, mock_to_path(@file1), mock_to_path(@file2)) + end + + it "accepts numeric atime and mtime arguments" do + if @time_is_float + File.send(@method, @atime.to_f, @mtime.to_f, @file1, @file2) + + File.atime(@file1).should be_close(@atime, 0.0001) + File.mtime(@file1).should be_close(@mtime, 0.0001) + File.atime(@file2).should be_close(@atime, 0.0001) + File.mtime(@file2).should be_close(@mtime, 0.0001) + else + File.send(@method, @atime.to_i, @mtime.to_i, @file1, @file2) + + File.atime(@file1).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) + File.mtime(@file1).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) + File.atime(@file2).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) + File.mtime(@file2).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) + end + end + + it "may set nanosecond precision" do + t = Time.utc(2007, 11, 1, 15, 25, 0, 123456.789r) + File.send(@method, t, t, @file1) + + File.atime(@file1).nsec.should.between?(0, 123500000) + File.mtime(@file1).nsec.should.between?(0, 123500000) + end + + it "returns the number of filenames in the arguments" do + File.send(@method, @atime.to_f, @mtime.to_f, @file1, @file2).should == 2 + end + + platform_is :linux do + platform_is wordsize: 64 do + it "allows Time instances in the far future to set mtime and atime (but some filesystems limit it up to 2446-05-10 or 2038-01-19 or 2486-07-02)" do + # https://ext4.wiki.kernel.org/index.php/Ext4_Disk_Layout#Inode_Timestamps + # "Therefore, timestamps should not overflow until May 2446." + # https://lwn.net/Articles/804382/ + # "On-disk timestamps hitting the y2038 limit..." + # The problem seems to be being improved, but currently it actually fails on XFS on RHEL8 + # https://rubyci.org/logs/rubyci.s3.amazonaws.com/rhel8/ruby-master/log/20201112T123004Z.fail.html.gz + # Amazon Linux 2023 returns 2486-07-02 in this example + # http://rubyci.s3.amazonaws.com/amazon2023/ruby-master/log/20230322T063004Z.fail.html.gz + time = Time.at(1<<44) + File.send(@method, time, time, @file1) + + [559444, 2486, 2446, 2038].should.include? File.atime(@file1).year + [559444, 2486, 2446, 2038].should.include? File.mtime(@file1).year + end + end + end +end diff --git a/spec/ruby/core/file/utime_spec.rb b/spec/ruby/core/file/utime_spec.rb index 19cb80d5f8..d87626be50 100644 --- a/spec/ruby/core/file/utime_spec.rb +++ b/spec/ruby/core/file/utime_spec.rb @@ -1,89 +1,6 @@ require_relative '../../spec_helper' +require_relative 'shared/update_time' describe "File.utime" do - - before :all do - @time_is_float = platform_is :windows - end - - before :each do - @atime = Time.now - @mtime = Time.now - @file1 = tmp("specs_file_utime1") - @file2 = tmp("specs_file_utime2") - touch @file1 - touch @file2 - end - - after :each do - rm_r @file1, @file2 - end - - it "sets the access and modification time of each file" do - File.utime(@atime, @mtime, @file1, @file2) - if @time_is_float - File.atime(@file1).should be_close(@atime, 0.0001) - File.mtime(@file1).should be_close(@mtime, 0.0001) - File.atime(@file2).should be_close(@atime, 0.0001) - File.mtime(@file2).should be_close(@mtime, 0.0001) - else - File.atime(@file1).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) - File.mtime(@file1).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) - File.atime(@file2).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) - File.mtime(@file2).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) - end - end - - it "uses the current times if two nil values are passed" do - tn = Time.now - File.utime(nil, nil, @file1, @file2) - if @time_is_float - File.atime(@file1).should be_close(tn, 0.050) - File.mtime(@file1).should be_close(tn, 0.050) - File.atime(@file2).should be_close(tn, 0.050) - File.mtime(@file2).should be_close(tn, 0.050) - else - File.atime(@file1).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) - File.mtime(@file1).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) - File.atime(@file2).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) - File.mtime(@file2).to_i.should be_close(Time.now.to_i, TIME_TOLERANCE) - end - end - - it "accepts an object that has a #to_path method" do - File.utime(@atime, @mtime, mock_to_path(@file1), mock_to_path(@file2)) - end - - it "accepts numeric atime and mtime arguments" do - if @time_is_float - File.utime(@atime.to_f, @mtime.to_f, @file1, @file2) - File.atime(@file1).should be_close(@atime, 0.0001) - File.mtime(@file1).should be_close(@mtime, 0.0001) - File.atime(@file2).should be_close(@atime, 0.0001) - File.mtime(@file2).should be_close(@mtime, 0.0001) - else - File.utime(@atime.to_i, @mtime.to_i, @file1, @file2) - File.atime(@file1).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) - File.mtime(@file1).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) - File.atime(@file2).to_i.should be_close(@atime.to_i, TIME_TOLERANCE) - File.mtime(@file2).to_i.should be_close(@mtime.to_i, TIME_TOLERANCE) - end - end - - platform_is :linux do - platform_is wordsize: 64 do - it "allows Time instances in the far future to set mtime and atime (but some filesystems limit it up to 2446-05-10 or 2038-01-19)" do - # https://ext4.wiki.kernel.org/index.php/Ext4_Disk_Layout#Inode_Timestamps - # "Therefore, timestamps should not overflow until May 2446." - # https://lwn.net/Articles/804382/ - # "On-disk timestamps hitting the y2038 limit..." - # The problem seems to be being improved, but currently it actually fails on XFS on RHEL8 - # https://rubyci.org/logs/rubyci.s3.amazonaws.com/rhel8/ruby-master/log/20201112T123004Z.fail.html.gz - time = Time.at(1<<44) - File.utime(time, time, @file1) - [559444, 2446, 2038].should.include? File.atime(@file1).year - [559444, 2446, 2038].should.include? File.mtime(@file1).year - end - end - end + it_behaves_like :update_time, :utime end diff --git a/spec/ruby/core/filetest/exist_spec.rb b/spec/ruby/core/filetest/exist_spec.rb index 4d14bea231..a95d3f91a1 100644 --- a/spec/ruby/core/filetest/exist_spec.rb +++ b/spec/ruby/core/filetest/exist_spec.rb @@ -4,3 +4,11 @@ require_relative '../../shared/file/exist' describe "FileTest.exist?" do it_behaves_like :file_exist, :exist?, FileTest end + +ruby_version_is "3.2" do + describe "FileTest.exists?" do + it "has been removed" do + FileTest.should_not.respond_to?(:exists?) + end + end +end diff --git a/spec/ruby/core/float/coerce_spec.rb b/spec/ruby/core/float/coerce_spec.rb index ea108f3303..baa831dcf6 100644 --- a/spec/ruby/core/float/coerce_spec.rb +++ b/spec/ruby/core/float/coerce_spec.rb @@ -9,10 +9,10 @@ describe "Float#coerce" do 1.0.coerce(3.14).should == [3.14, 1.0] a, b = -0.0.coerce(bignum_value) - a.should be_close(9223372036854775808.0, TOLERANCE) + a.should be_close(18446744073709551616.0, TOLERANCE) b.should be_close(-0.0, TOLERANCE) a, b = 1.0.coerce(bignum_value) - a.should be_close(9223372036854775808.0, TOLERANCE) + a.should be_close(18446744073709551616.0, TOLERANCE) b.should be_close(1.0, TOLERANCE) end end diff --git a/spec/ruby/core/float/comparison_spec.rb b/spec/ruby/core/float/comparison_spec.rb index e367198903..1373b3a1fb 100644 --- a/spec/ruby/core/float/comparison_spec.rb +++ b/spec/ruby/core/float/comparison_spec.rb @@ -7,13 +7,32 @@ describe "Float#<=>" do ((bignum_value*1.1) <=> bignum_value).should == 1 end - it "returns nil when either argument is NaN" do - (nan_value <=> 71.2).should be_nil - (1771.176 <=> nan_value).should be_nil + it "returns nil if one side is NaN" do + [1.0, 42, bignum_value].each { |n| + (nan_value <=> n).should == nil + (n <=> nan_value).should == nil + } + end + + it "handles positive infinity" do + [1.0, 42, bignum_value].each { |n| + (infinity_value <=> n).should == 1 + (n <=> infinity_value).should == -1 + } + end + + it "handles negative infinity" do + [1.0, 42, bignum_value].each { |n| + (-infinity_value <=> n).should == -1 + (n <=> -infinity_value).should == 1 + } end it "returns nil when the given argument is not a Float" do (1.0 <=> "1").should be_nil + (1.0 <=> "1".freeze).should be_nil + (1.0 <=> :one).should be_nil + (1.0 <=> true).should be_nil end it "compares using #coerce when argument is not a Float" do @@ -46,21 +65,10 @@ describe "Float#<=>" do }.should raise_error(TypeError, "coerce must return [x, y]") end - # The 4 tests below are taken from matz's revision 23730 for Ruby trunk - # - it "returns 1 when self is Infinity and other is an Integer" do + it "returns the correct result when one side is infinite" do (infinity_value <=> Float::MAX.to_i*2).should == 1 - end - - it "returns -1 when self is negative and other is Infinity" do (-Float::MAX.to_i*2 <=> infinity_value).should == -1 - end - - it "returns -1 when self is -Infinity and other is negative" do (-infinity_value <=> -Float::MAX.to_i*2).should == -1 - end - - it "returns 1 when self is negative and other is -Infinity" do (-Float::MAX.to_i*2 <=> -infinity_value).should == 1 end @@ -87,4 +95,19 @@ describe "Float#<=>" do end (infinity_value <=> obj).should == 1 end + + it "returns 0 for -0.0 and 0.0" do + (-0.0 <=> 0.0).should == 0 + (0.0 <=> -0.0).should == 0 + end + + it "returns 0 for -0.0 and 0" do + (-0.0 <=> 0).should == 0 + (0 <=> -0.0).should == 0 + end + + it "returns 0 for 0.0 and 0" do + (0.0 <=> 0).should == 0 + (0 <=> 0.0).should == 0 + end end diff --git a/spec/ruby/core/float/divide_spec.rb b/spec/ruby/core/float/divide_spec.rb index d8f71a6b98..72ab7527bd 100644 --- a/spec/ruby/core/float/divide_spec.rb +++ b/spec/ruby/core/float/divide_spec.rb @@ -36,4 +36,8 @@ describe "Float#/" do -> { 13.0 / "10" }.should raise_error(TypeError) -> { 13.0 / :symbol }.should raise_error(TypeError) end + + it "divides correctly by Rational numbers" do + (1.2345678901234567 / Rational(1, 10000000000000000000)).should == 1.2345678901234567e+19 + end end diff --git a/spec/ruby/core/float/divmod_spec.rb b/spec/ruby/core/float/divmod_spec.rb index ec55dd3681..dad45a9b89 100644 --- a/spec/ruby/core/float/divmod_spec.rb +++ b/spec/ruby/core/float/divmod_spec.rb @@ -10,7 +10,7 @@ describe "Float#divmod" do values[1].should be_close(2.8284, TOLERANCE) values = -1.0.divmod(bignum_value) values[0].should eql(-1) - values[1].should be_close(9223372036854775808.000, TOLERANCE) + values[1].should be_close(18446744073709551616.0, TOLERANCE) values = -1.0.divmod(1) values[0].should eql(-1) values[1].should eql(0.0) @@ -23,7 +23,7 @@ describe "Float#divmod" do # Behaviour established as correct in r23953 it "raises a FloatDomainError if other is NaN" do - -> { 1.divmod(nan_value) }.should raise_error(FloatDomainError) + -> { 1.0.divmod(nan_value) }.should raise_error(FloatDomainError) end # Behaviour established as correct in r23953 diff --git a/spec/ruby/core/float/gt_spec.rb b/spec/ruby/core/float/gt_spec.rb index 0d73f1c3df..33078e07ce 100644 --- a/spec/ruby/core/float/gt_spec.rb +++ b/spec/ruby/core/float/gt_spec.rb @@ -14,4 +14,25 @@ describe "Float#>" do -> { 5.0 > "4" }.should raise_error(ArgumentError) -> { 5.0 > mock('x') }.should raise_error(ArgumentError) end + + it "returns false if one side is NaN" do + [1.0, 42, bignum_value].each { |n| + (nan_value > n).should == false + (n > nan_value).should == false + } + end + + it "handles positive infinity" do + [1.0, 42, bignum_value].each { |n| + (infinity_value > n).should == true + (n > infinity_value).should == false + } + end + + it "handles negative infinity" do + [1.0, 42, bignum_value].each { |n| + (-infinity_value > n).should == false + (n > -infinity_value).should == true + } + end end diff --git a/spec/ruby/core/float/gte_spec.rb b/spec/ruby/core/float/gte_spec.rb index 98ec60b70b..44c0a81b43 100644 --- a/spec/ruby/core/float/gte_spec.rb +++ b/spec/ruby/core/float/gte_spec.rb @@ -14,4 +14,25 @@ describe "Float#>=" do -> { 5.0 >= "4" }.should raise_error(ArgumentError) -> { 5.0 >= mock('x') }.should raise_error(ArgumentError) end + + it "returns false if one side is NaN" do + [1.0, 42, bignum_value].each { |n| + (nan_value >= n).should == false + (n >= nan_value).should == false + } + end + + it "handles positive infinity" do + [1.0, 42, bignum_value].each { |n| + (infinity_value >= n).should == true + (n >= infinity_value).should == false + } + end + + it "handles negative infinity" do + [1.0, 42, bignum_value].each { |n| + (-infinity_value >= n).should == false + (n >= -infinity_value).should == true + } + end end diff --git a/spec/ruby/core/float/lt_spec.rb b/spec/ruby/core/float/lt_spec.rb index c01b6e0e02..94dcfc42f8 100644 --- a/spec/ruby/core/float/lt_spec.rb +++ b/spec/ruby/core/float/lt_spec.rb @@ -14,4 +14,25 @@ describe "Float#<" do -> { 5.0 < "4" }.should raise_error(ArgumentError) -> { 5.0 < mock('x') }.should raise_error(ArgumentError) end + + it "returns false if one side is NaN" do + [1.0, 42, bignum_value].each { |n| + (nan_value < n).should == false + (n < nan_value).should == false + } + end + + it "handles positive infinity" do + [1.0, 42, bignum_value].each { |n| + (infinity_value < n).should == false + (n < infinity_value).should == true + } + end + + it "handles negative infinity" do + [1.0, 42, bignum_value].each { |n| + (-infinity_value < n).should == true + (n < -infinity_value).should == false + } + end end diff --git a/spec/ruby/core/float/lte_spec.rb b/spec/ruby/core/float/lte_spec.rb index 66f2ddc2c7..7b5a86ee76 100644 --- a/spec/ruby/core/float/lte_spec.rb +++ b/spec/ruby/core/float/lte_spec.rb @@ -15,4 +15,25 @@ describe "Float#<=" do -> { 5.0 <= "4" }.should raise_error(ArgumentError) -> { 5.0 <= mock('x') }.should raise_error(ArgumentError) end + + it "returns false if one side is NaN" do + [1.0, 42, bignum_value].each { |n| + (nan_value <= n).should == false + (n <= nan_value).should == false + } + end + + it "handles positive infinity" do + [1.0, 42, bignum_value].each { |n| + (infinity_value <= n).should == false + (n <= infinity_value).should == true + } + end + + it "handles negative infinity" do + [1.0, 42, bignum_value].each { |n| + (-infinity_value <= n).should == true + (n <= -infinity_value).should == false + } + end end diff --git a/spec/ruby/core/float/magnitude_spec.rb b/spec/ruby/core/float/magnitude_spec.rb index db577c15c5..7cdd8ef28a 100644 --- a/spec/ruby/core/float/magnitude_spec.rb +++ b/spec/ruby/core/float/magnitude_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/abs' describe "Float#magnitude" do diff --git a/spec/ruby/core/float/minus_spec.rb b/spec/ruby/core/float/minus_spec.rb index 5626cbdac2..a4281a397b 100644 --- a/spec/ruby/core/float/minus_spec.rb +++ b/spec/ruby/core/float/minus_spec.rb @@ -6,7 +6,7 @@ describe "Float#-" do it "returns self minus other" do (9_237_212.5280 - 5_280).should be_close(9231932.528, TOLERANCE) - (2_560_496.1691 - bignum_value).should be_close(-9223372036852215808.000, TOLERANCE) + (2_560_496.1691 - bignum_value).should be_close(-18446744073706991616.0, TOLERANCE) (5.5 - 5.5).should be_close(0.0,TOLERANCE) end end diff --git a/spec/ruby/core/float/multiply_spec.rb b/spec/ruby/core/float/multiply_spec.rb index eca0b52c4f..2adb8796cd 100644 --- a/spec/ruby/core/float/multiply_spec.rb +++ b/spec/ruby/core/float/multiply_spec.rb @@ -7,7 +7,7 @@ describe "Float#*" do it "returns self multiplied by other" do (4923.98221 * 2).should be_close(9847.96442, TOLERANCE) (6712.5 * 0.25).should be_close(1678.125, TOLERANCE) - (256.4096 * bignum_value).should be_close(2364961134621118431232.000, TOLERANCE) + (256.4096 * bignum_value).should be_close(4729922269242236862464.0, TOLERANCE) end it "raises a TypeError when given a non-Numeric" do diff --git a/spec/ruby/core/float/plus_spec.rb b/spec/ruby/core/float/plus_spec.rb index 06b136a06b..e3e19d7f39 100644 --- a/spec/ruby/core/float/plus_spec.rb +++ b/spec/ruby/core/float/plus_spec.rb @@ -6,7 +6,7 @@ describe "Float#+" do it "returns self plus other" do (491.213 + 2).should be_close(493.213, TOLERANCE) - (9.99 + bignum_value).should be_close(9223372036854775808.000, TOLERANCE) + (9.99 + bignum_value).should be_close(18446744073709551616.0, TOLERANCE) (1001.99 + 5.219).should be_close(1007.209, TOLERANCE) end end diff --git a/spec/ruby/core/float/round_spec.rb b/spec/ruby/core/float/round_spec.rb index 4bd2dc460c..9b4c307f9d 100644 --- a/spec/ruby/core/float/round_spec.rb +++ b/spec/ruby/core/float/round_spec.rb @@ -103,6 +103,70 @@ describe "Float#round" do 5.55.round(1, half: :up).should eql(5.6) 5.55.round(1, half: :down).should eql(5.5) 5.55.round(1, half: :even).should eql(5.6) + -5.55.round(1, half: nil).should eql(-5.6) + -5.55.round(1, half: :up).should eql(-5.6) + -5.55.round(1, half: :down).should eql(-5.5) + -5.55.round(1, half: :even).should eql(-5.6) + end + + it "preserves cases where neighbouring floating pointer number increase the decimal places" do + 4.8100000000000005.round(5, half: nil).should eql(4.81) + 4.8100000000000005.round(5, half: :up).should eql(4.81) + 4.8100000000000005.round(5, half: :down).should eql(4.81) + 4.8100000000000005.round(5, half: :even).should eql(4.81) + -4.8100000000000005.round(5, half: nil).should eql(-4.81) + -4.8100000000000005.round(5, half: :up).should eql(-4.81) + -4.8100000000000005.round(5, half: :down).should eql(-4.81) + -4.8100000000000005.round(5, half: :even).should eql(-4.81) + 4.81.round(5, half: nil).should eql(4.81) + 4.81.round(5, half: :up).should eql(4.81) + 4.81.round(5, half: :down).should eql(4.81) + 4.81.round(5, half: :even).should eql(4.81) + -4.81.round(5, half: nil).should eql(-4.81) + -4.81.round(5, half: :up).should eql(-4.81) + -4.81.round(5, half: :down).should eql(-4.81) + -4.81.round(5, half: :even).should eql(-4.81) + 4.809999999999999.round(5, half: nil).should eql(4.81) + 4.809999999999999.round(5, half: :up).should eql(4.81) + 4.809999999999999.round(5, half: :down).should eql(4.81) + 4.809999999999999.round(5, half: :even).should eql(4.81) + -4.809999999999999.round(5, half: nil).should eql(-4.81) + -4.809999999999999.round(5, half: :up).should eql(-4.81) + -4.809999999999999.round(5, half: :down).should eql(-4.81) + -4.809999999999999.round(5, half: :even).should eql(-4.81) + end + + ruby_bug "#19318", ""..."3.3" do + # These numbers are neighbouring floating point numbers round a + # precise value. They test that the rounding modes work correctly + # round that value and precision is not lost which might cause + # incorrect results. + it "does not lose precision during the rounding process" do + 767573.1875850001.round(5, half: nil).should eql(767573.18759) + 767573.1875850001.round(5, half: :up).should eql(767573.18759) + 767573.1875850001.round(5, half: :down).should eql(767573.18759) + 767573.1875850001.round(5, half: :even).should eql(767573.18759) + -767573.1875850001.round(5, half: nil).should eql(-767573.18759) + -767573.1875850001.round(5, half: :up).should eql(-767573.18759) + -767573.1875850001.round(5, half: :down).should eql(-767573.18759) + -767573.1875850001.round(5, half: :even).should eql(-767573.18759) + 767573.187585.round(5, half: nil).should eql(767573.18759) + 767573.187585.round(5, half: :up).should eql(767573.18759) + 767573.187585.round(5, half: :down).should eql(767573.18758) + 767573.187585.round(5, half: :even).should eql(767573.18758) + -767573.187585.round(5, half: nil).should eql(-767573.18759) + -767573.187585.round(5, half: :up).should eql(-767573.18759) + -767573.187585.round(5, half: :down).should eql(-767573.18758) + -767573.187585.round(5, half: :even).should eql(-767573.18758) + 767573.1875849998.round(5, half: nil).should eql(767573.18758) + 767573.1875849998.round(5, half: :up).should eql(767573.18758) + 767573.1875849998.round(5, half: :down).should eql(767573.18758) + 767573.1875849998.round(5, half: :even).should eql(767573.18758) + -767573.1875849998.round(5, half: nil).should eql(-767573.18758) + -767573.1875849998.round(5, half: :up).should eql(-767573.18758) + -767573.1875849998.round(5, half: :down).should eql(-767573.18758) + -767573.1875849998.round(5, half: :even).should eql(-767573.18758) + end end it "raises FloatDomainError for exceptional values with a half option" do diff --git a/spec/ruby/core/float/shared/equal.rb b/spec/ruby/core/float/shared/equal.rb index 668aa069b5..4d524e1cf2 100644 --- a/spec/ruby/core/float/shared/equal.rb +++ b/spec/ruby/core/float/shared/equal.rb @@ -14,4 +14,25 @@ describe :float_equal, shared: true do 1.0.send(@method, x).should == false 2.0.send(@method, x).should == true end + + it "returns false if one side is NaN" do + [1.0, 42, bignum_value].each { |n| + (nan_value.send(@method, n)).should == false + (n.send(@method, nan_value)).should == false + } + end + + it "handles positive infinity" do + [1.0, 42, bignum_value].each { |n| + (infinity_value.send(@method, n)).should == false + (n.send(@method, infinity_value)).should == false + } + end + + it "handles negative infinity" do + [1.0, 42, bignum_value].each { |n| + ((-infinity_value).send(@method, n)).should == false + (n.send(@method, -infinity_value)).should == false + } + end end diff --git a/spec/ruby/core/float/shared/to_i.rb b/spec/ruby/core/float/shared/to_i.rb index 960295f095..33b32ca533 100644 --- a/spec/ruby/core/float/shared/to_i.rb +++ b/spec/ruby/core/float/shared/to_i.rb @@ -7,4 +7,8 @@ describe :float_to_i, shared: true do -9223372036854775808.1.send(@method).should eql(-9223372036854775808) 9223372036854775808.1.send(@method).should eql(9223372036854775808) end + + it "raises a FloatDomainError for NaN" do + -> { nan_value.send(@method) }.should raise_error(FloatDomainError) + end end diff --git a/spec/ruby/core/gc/auto_compact_spec.rb b/spec/ruby/core/gc/auto_compact_spec.rb new file mode 100644 index 0000000000..33ad1cb56c --- /dev/null +++ b/spec/ruby/core/gc/auto_compact_spec.rb @@ -0,0 +1,24 @@ +require_relative '../../spec_helper' + +describe "GC.auto_compact" do + it "can set and get a boolean value" do + begin + GC.auto_compact = GC.auto_compact + rescue NotImplementedError # platform does not support autocompact + skip + end + + original = GC.auto_compact + begin + GC.auto_compact = !original + rescue NotImplementedError # platform does not support autocompact + skip + end + + begin + GC.auto_compact.should == !original + ensure + GC.auto_compact = original + end + end +end diff --git a/spec/ruby/core/gc/measure_total_time_spec.rb b/spec/ruby/core/gc/measure_total_time_spec.rb new file mode 100644 index 0000000000..05d4598ebc --- /dev/null +++ b/spec/ruby/core/gc/measure_total_time_spec.rb @@ -0,0 +1,19 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + describe "GC.measure_total_time" do + before :each do + @default = GC.measure_total_time + end + + after :each do + GC.measure_total_time = @default + end + + it "can set and get a boolean value" do + original = GC.measure_total_time + GC.measure_total_time = !original + GC.measure_total_time.should == !original + end + end +end diff --git a/spec/ruby/core/gc/stat_spec.rb b/spec/ruby/core/gc/stat_spec.rb index 34656c401c..3b43b28a92 100644 --- a/spec/ruby/core/gc/stat_spec.rb +++ b/spec/ruby/core/gc/stat_spec.rb @@ -4,7 +4,21 @@ describe "GC.stat" do it "returns hash of values" do stat = GC.stat stat.should be_kind_of(Hash) - stat.keys.should include(:count) + stat.keys.should.include?(:count) + end + + it "updates the given hash values" do + hash = { count: "hello", __other__: "world" } + stat = GC.stat(hash) + + stat.should be_kind_of(Hash) + stat.should equal hash + stat[:count].should be_kind_of(Integer) + stat[:__other__].should == "world" + end + + it "the values are all Integer since rb_gc_stat() returns size_t" do + GC.stat.values.each { |value| value.should be_kind_of(Integer) } end it "can return a single value" do @@ -37,4 +51,12 @@ describe "GC.stat" do GC.stat(:total_allocated_objects).should be_kind_of(Integer) GC.stat[:total_allocated_objects].should be_kind_of(Integer) end + + it "raises an error if argument is not nil, a symbol, or a hash" do + -> { GC.stat(7) }.should raise_error(TypeError, "non-hash or symbol given") + end + + it "raises an error if an unknown key is given" do + -> { GC.stat(:foo) }.should raise_error(ArgumentError, "unknown key: foo") + end end diff --git a/spec/ruby/core/gc/total_time_spec.rb b/spec/ruby/core/gc/total_time_spec.rb new file mode 100644 index 0000000000..fcc8f45a83 --- /dev/null +++ b/spec/ruby/core/gc/total_time_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + describe "GC.total_time" do + it "returns an Integer" do + GC.total_time.should be_kind_of(Integer) + end + + it "increases as collections are run" do + time_before = GC.total_time + GC.start + GC.total_time.should >= time_before + end + end +end diff --git a/spec/ruby/core/hash/assoc_spec.rb b/spec/ruby/core/hash/assoc_spec.rb index 64442918d1..62b2a11b30 100644 --- a/spec/ruby/core/hash/assoc_spec.rb +++ b/spec/ruby/core/hash/assoc_spec.rb @@ -22,11 +22,11 @@ describe "Hash#assoc" do end it "only returns the first matching key-value pair for identity hashes" do - # Avoid literal String keys in Hash#[]= due to https://bugs.ruby-lang.org/issues/12855 + # Avoid literal String keys since string literals can be frozen and interned e.g. with --enable-frozen-string-literal h = {}.compare_by_identity - k1 = 'pear' + k1 = 'pear'.dup h[k1] = :red - k2 = 'pear' + k2 = 'pear'.dup h[k2] = :green h.size.should == 2 h.keys.grep(/pear/).size.should == 2 diff --git a/spec/ruby/core/hash/compact_spec.rb b/spec/ruby/core/hash/compact_spec.rb index 2989afc8b7..76aa43949d 100644 --- a/spec/ruby/core/hash/compact_spec.rb +++ b/spec/ruby/core/hash/compact_spec.rb @@ -18,6 +18,30 @@ describe "Hash#compact" do @hash.compact @hash.should == @initial_pairs end + + ruby_version_is '3.3' do + it "retains the default value" do + hash = Hash.new(1) + hash.compact.default.should == 1 + hash[:a] = 1 + hash.compact.default.should == 1 + end + + it "retains the default_proc" do + pr = proc { |h, k| h[k] = [] } + hash = Hash.new(&pr) + hash.compact.default_proc.should == pr + hash[:a] = 1 + hash.compact.default_proc.should == pr + end + + it "retains compare_by_identity_flag" do + hash = {}.compare_by_identity + hash.compact.compare_by_identity?.should == true + hash[:a] = 1 + hash.compact.compare_by_identity?.should == true + end + end end describe "Hash#compact!" do diff --git a/spec/ruby/core/hash/compare_by_identity_spec.rb b/spec/ruby/core/hash/compare_by_identity_spec.rb index 874cd46eb7..2975526a97 100644 --- a/spec/ruby/core/hash/compare_by_identity_spec.rb +++ b/spec/ruby/core/hash/compare_by_identity_spec.rb @@ -85,19 +85,21 @@ describe "Hash#compare_by_identity" do -> { @h.compare_by_identity }.should raise_error(FrozenError) end - # Behaviour confirmed in bug #1871 + # Behaviour confirmed in https://bugs.ruby-lang.org/issues/1871 it "persists over #dups" do - @idh['foo'] = :bar - @idh['foo'] = :glark + @idh['foo'.dup] = :bar + @idh['foo'.dup] = :glark @idh.dup.should == @idh @idh.dup.size.should == @idh.size + @idh.dup.should.compare_by_identity? end it "persists over #clones" do - @idh['foo'] = :bar - @idh['foo'] = :glark + @idh['foo'.dup] = :bar + @idh['foo'.dup] = :glark @idh.clone.should == @idh @idh.clone.size.should == @idh.size + @idh.dup.should.compare_by_identity? end it "does not copy string keys" do @@ -108,9 +110,16 @@ describe "Hash#compare_by_identity" do @idh.keys.first.should equal foo end + # Check `#[]=` call with a String literal. + # Don't use `#+` because with `#+` it's no longer a String literal. + # + # See https://bugs.ruby-lang.org/issues/12855 it "gives different identity for string literals" do + eval <<~RUBY + # frozen_string_literal: false @idh['foo'] = 1 @idh['foo'] = 2 + RUBY @idh.values.should == [1, 2] @idh.size.should == 2 end diff --git a/spec/ruby/core/hash/constructor_spec.rb b/spec/ruby/core/hash/constructor_spec.rb index ad67274802..8d29773909 100644 --- a/spec/ruby/core/hash/constructor_spec.rb +++ b/spec/ruby/core/hash/constructor_spec.rb @@ -42,26 +42,13 @@ describe "Hash.[]" do Hash[ary].should == { a: :b } end - ruby_version_is "" ... "2.7" do - it "ignores elements that are not arrays" do - -> { - Hash[[:a]].should == {} - }.should complain(/ignoring wrong elements/) - -> { - Hash[[:nil]].should == {} - }.should complain(/ignoring wrong elements/) - end - end - - ruby_version_is "2.7" do - it "raises for elements that are not arrays" do - -> { - Hash[[:a]].should == {} - }.should raise_error(ArgumentError) - -> { - Hash[[:nil]].should == {} - }.should raise_error(ArgumentError) - end + it "raises for elements that are not arrays" do + -> { + Hash[[:a]].should == {} + }.should raise_error(ArgumentError) + -> { + Hash[[:nil]].should == {} + }.should raise_error(ArgumentError) end it "raises an ArgumentError for arrays of more than 2 elements" do @@ -116,8 +103,26 @@ describe "Hash.[]" do HashSpecs::MyInitializerHash[Hash[1, 2]].should be_an_instance_of(HashSpecs::MyInitializerHash) end + it "removes the default value" do + hash = Hash.new(1) + Hash[hash].default.should be_nil + hash[:a] = 1 + Hash[hash].default.should be_nil + end + it "removes the default_proc" do hash = Hash.new { |h, k| h[k] = [] } Hash[hash].default_proc.should be_nil + hash[:a] = 1 + Hash[hash].default_proc.should be_nil + end + + ruby_version_is '3.3' do + it "does not retain compare_by_identity_flag" do + hash = {}.compare_by_identity + Hash[hash].compare_by_identity?.should == false + hash[:a] = 1 + Hash[hash].compare_by_identity?.should == false + end end end diff --git a/spec/ruby/core/hash/deconstruct_keys_spec.rb b/spec/ruby/core/hash/deconstruct_keys_spec.rb index b265732616..bbcd8932e5 100644 --- a/spec/ruby/core/hash/deconstruct_keys_spec.rb +++ b/spec/ruby/core/hash/deconstruct_keys_spec.rb @@ -1,25 +1,23 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Hash#deconstruct_keys" do - it "returns self" do - hash = {a: 1, b: 2} +describe "Hash#deconstruct_keys" do + it "returns self" do + hash = {a: 1, b: 2} - hash.deconstruct_keys([:a, :b]).should equal hash - end + hash.deconstruct_keys([:a, :b]).should equal hash + end - it "requires one argument" do - -> { - {a: 1}.deconstruct_keys - }.should raise_error(ArgumentError, /wrong number of arguments \(given 0, expected 1\)/) - end + it "requires one argument" do + -> { + {a: 1}.deconstruct_keys + }.should raise_error(ArgumentError, /wrong number of arguments \(given 0, expected 1\)/) + end - it "ignores argument" do - hash = {a: 1, b: 2} + it "ignores argument" do + hash = {a: 1, b: 2} - hash.deconstruct_keys([:a]).should == {a: 1, b: 2} - hash.deconstruct_keys(0 ).should == {a: 1, b: 2} - hash.deconstruct_keys('' ).should == {a: 1, b: 2} - end + hash.deconstruct_keys([:a]).should == {a: 1, b: 2} + hash.deconstruct_keys(0 ).should == {a: 1, b: 2} + hash.deconstruct_keys('' ).should == {a: 1, b: 2} end end diff --git a/spec/ruby/core/hash/delete_spec.rb b/spec/ruby/core/hash/delete_spec.rb index b262e8846b..3e3479c69c 100644 --- a/spec/ruby/core/hash/delete_spec.rb +++ b/spec/ruby/core/hash/delete_spec.rb @@ -24,7 +24,7 @@ describe "Hash#delete" do it "allows removing a key while iterating" do h = { a: 1, b: 2 } visited = [] - h.each_pair { |k,v| + h.each_pair { |k, v| visited << k h.delete(k) } @@ -32,13 +32,27 @@ describe "Hash#delete" do h.should == {} end + it "allows removing a key while iterating for big hashes" do + h = { a: 1, b: 2, c: 3, d: 4, e: 5, f: 6, g: 7, h: 8, i: 9, j: 10, + k: 11, l: 12, m: 13, n: 14, o: 15, p: 16, q: 17, r: 18, s: 19, t: 20, + u: 21, v: 22, w: 23, x: 24, y: 25, z: 26 } + visited = [] + h.each_pair { |k, v| + visited << k + h.delete(k) + } + visited.should == [:a, :b, :c, :d, :e, :f, :g, :h, :i, :j, :k, :l, :m, + :n, :o, :p, :q, :r, :s, :t, :u, :v, :w, :x, :y, :z] + h.should == {} + end + it "accepts keys with private #hash method" do key = HashSpecs::KeyWithPrivateHash.new { key => 5 }.delete(key).should == 5 end it "raises a FrozenError if called on a frozen instance" do - -> { HashSpecs.frozen_hash.delete("foo") }.should raise_error(FrozenError) + -> { HashSpecs.frozen_hash.delete("foo") }.should raise_error(FrozenError) -> { HashSpecs.empty_frozen_hash.delete("foo") }.should raise_error(FrozenError) end end diff --git a/spec/ruby/core/hash/element_reference_spec.rb b/spec/ruby/core/hash/element_reference_spec.rb index e271f37ea6..94e8237839 100644 --- a/spec/ruby/core/hash/element_reference_spec.rb +++ b/spec/ruby/core/hash/element_reference_spec.rb @@ -30,7 +30,7 @@ describe "Hash#[]" do end it "does not create copies of the immediate default value" do - str = "foo" + str = +"foo" h = Hash.new(str) a = h[:a] b = h[:b] diff --git a/spec/ruby/core/hash/except_spec.rb b/spec/ruby/core/hash/except_spec.rb index 82cfced72f..ac84f9975c 100644 --- a/spec/ruby/core/hash/except_spec.rb +++ b/spec/ruby/core/hash/except_spec.rb @@ -1,34 +1,32 @@ require_relative '../../spec_helper' -ruby_version_is "3.0" do - describe "Hash#except" do - before :each do - @hash = { a: 1, b: 2, c: 3 } - end +describe "Hash#except" do + before :each do + @hash = { a: 1, b: 2, c: 3 } + end - it "returns a new duplicate hash without arguments" do - ret = @hash.except - ret.should_not equal(@hash) - ret.should == @hash - end + it "returns a new duplicate hash without arguments" do + ret = @hash.except + ret.should_not equal(@hash) + ret.should == @hash + end - it "returns a hash without the requested subset" do - @hash.except(:c, :a).should == { b: 2 } - end + it "returns a hash without the requested subset" do + @hash.except(:c, :a).should == { b: 2 } + end - it "ignores keys not present in the original hash" do - @hash.except(:a, :chunky_bacon).should == { b: 2, c: 3 } - end + it "ignores keys not present in the original hash" do + @hash.except(:a, :chunky_bacon).should == { b: 2, c: 3 } + end - it "always returns a Hash without a default" do - klass = Class.new(Hash) - h = klass.new(:default) - h[:bar] = 12 - h[:foo] = 42 - r = h.except(:foo) - r.should == {bar: 12} - r.class.should == Hash - r.default.should == nil - end + it "always returns a Hash without a default" do + klass = Class.new(Hash) + h = klass.new(:default) + h[:bar] = 12 + h[:foo] = 42 + r = h.except(:foo) + r.should == {bar: 12} + r.class.should == Hash + r.default.should == nil end end diff --git a/spec/ruby/core/hash/fetch_spec.rb b/spec/ruby/core/hash/fetch_spec.rb index 753167f709..6e0d207224 100644 --- a/spec/ruby/core/hash/fetch_spec.rb +++ b/spec/ruby/core/hash/fetch_spec.rb @@ -4,7 +4,7 @@ require_relative '../../shared/hash/key_error' describe "Hash#fetch" do context "when the key is not found" do - it_behaves_like :key_error, -> obj, key { obj.fetch(key) }, Hash.new(a: 5) + it_behaves_like :key_error, -> obj, key { obj.fetch(key) }, Hash.new({ a: 5 }) it_behaves_like :key_error, -> obj, key { obj.fetch(key) }, {} it_behaves_like :key_error, -> obj, key { obj.fetch(key) }, Hash.new { 5 } it_behaves_like :key_error, -> obj, key { obj.fetch(key) }, Hash.new(5) diff --git a/spec/ruby/core/hash/fetch_values_spec.rb b/spec/ruby/core/hash/fetch_values_spec.rb index af3673f6ef..0cd48565af 100644 --- a/spec/ruby/core/hash/fetch_values_spec.rb +++ b/spec/ruby/core/hash/fetch_values_spec.rb @@ -19,7 +19,7 @@ describe "Hash#fetch_values" do end describe "with unmatched keys" do - it_behaves_like :key_error, -> obj, key { obj.fetch_values(key) }, Hash.new(a: 5) + it_behaves_like :key_error, -> obj, key { obj.fetch_values(key) }, Hash.new({ a: 5 }) it "returns the default value from block" do @hash.fetch_values(:z) { |key| "`#{key}' is not found" }.should == ["`z' is not found"] diff --git a/spec/ruby/core/hash/hash_spec.rb b/spec/ruby/core/hash/hash_spec.rb index 3649d4d8de..19eb806dc4 100644 --- a/spec/ruby/core/hash/hash_spec.rb +++ b/spec/ruby/core/hash/hash_spec.rb @@ -41,4 +41,13 @@ describe "Hash#hash" do h.hash.should == {x: [h]}.hash # Like above, because h.eql?(x: [h]) end + + ruby_version_is "3.1" do + it "allows omitting values" do + a = 1 + b = 2 + + eval('{a:, b:}.should == { a: 1, b: 2 }') + end + end end diff --git a/spec/ruby/core/hash/index_spec.rb b/spec/ruby/core/hash/index_spec.rb deleted file mode 100644 index be4e2cc6ab..0000000000 --- a/spec/ruby/core/hash/index_spec.rb +++ /dev/null @@ -1,9 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'fixtures/classes' -require_relative 'shared/index' - -ruby_version_is ''...'3.0' do - describe "Hash#index" do - it_behaves_like :hash_index, :index - end -end diff --git a/spec/ruby/core/hash/new_spec.rb b/spec/ruby/core/hash/new_spec.rb index 6054b69bdd..6279815fd6 100644 --- a/spec/ruby/core/hash/new_spec.rb +++ b/spec/ruby/core/hash/new_spec.rb @@ -33,4 +33,17 @@ describe "Hash.new" do -> { Hash.new(5) { 0 } }.should raise_error(ArgumentError) -> { Hash.new(nil) { 0 } }.should raise_error(ArgumentError) end + + ruby_version_is "3.3" do + it "emits a deprecation warning if keyword arguments are passed" do + -> { Hash.new(unknown: true) }.should complain( + Regexp.new(Regexp.escape("Calling Hash.new with keyword arguments is deprecated and will be removed in Ruby 3.4; use Hash.new({ key: value }) instead")) + ) + + -> { Hash.new(1, unknown: true) }.should raise_error(ArgumentError) + -> { Hash.new(unknown: true) { 0 } }.should raise_error(ArgumentError) + + Hash.new({ unknown: true }).default.should == { unknown: true } + end + end end diff --git a/spec/ruby/core/hash/rehash_spec.rb b/spec/ruby/core/hash/rehash_spec.rb index 0049080456..db3e91b166 100644 --- a/spec/ruby/core/hash/rehash_spec.rb +++ b/spec/ruby/core/hash/rehash_spec.rb @@ -77,6 +77,36 @@ describe "Hash#rehash" do h.keys.should_not.include? [1] end + it "iterates keys in insertion order" do + key = Class.new do + attr_reader :name + + def initialize(name) + @name = name + end + + def hash + 123 + end + end + + a, b, c, d = key.new('a'), key.new('b'), key.new('c'), key.new('d') + h = { a => 1, b => 2, c => 3, d => 4 } + h.size.should == 4 + + key.class_exec do + def eql?(other) + true + end + end + + h.rehash + h.size.should == 1 + k, v = h.first + k.name.should == 'a' + v.should == 4 + end + it "raises a FrozenError if called on a frozen instance" do -> { HashSpecs.frozen_hash.rehash }.should raise_error(FrozenError) -> { HashSpecs.empty_frozen_hash.rehash }.should raise_error(FrozenError) diff --git a/spec/ruby/core/hash/reject_spec.rb b/spec/ruby/core/hash/reject_spec.rb index 397000ab67..dd8e817237 100644 --- a/spec/ruby/core/hash/reject_spec.rb +++ b/spec/ruby/core/hash/reject_spec.rb @@ -31,13 +31,6 @@ describe "Hash#reject" do HashSpecs::MyHash[1 => 2, 3 => 4].reject { false }.should be_kind_of(Hash) HashSpecs::MyHash[1 => 2, 3 => 4].reject { true }.should be_kind_of(Hash) end - - ruby_version_is ''...'2.7' do - it "does not taint the resulting hash" do - h = { a: 1 }.taint - h.reject {false}.should_not.tainted? - end - end end it "processes entries with the same order as reject!" do diff --git a/spec/ruby/core/hash/ruby2_keywords_hash_spec.rb b/spec/ruby/core/hash/ruby2_keywords_hash_spec.rb index 005886a482..7dbb9c0a98 100644 --- a/spec/ruby/core/hash/ruby2_keywords_hash_spec.rb +++ b/spec/ruby/core/hash/ruby2_keywords_hash_spec.rb @@ -1,47 +1,83 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is "2.7" do - describe "Hash.ruby2_keywords_hash?" do - it "returns false if the Hash is not a keywords Hash" do - Hash.ruby2_keywords_hash?({}).should == false - end +describe "Hash.ruby2_keywords_hash?" do + it "returns false if the Hash is not a keywords Hash" do + Hash.ruby2_keywords_hash?({}).should == false + end - it "returns true if the Hash is a keywords Hash marked by Module#ruby2_keywords" do - obj = Class.new { - ruby2_keywords def m(*args) - args.last - end - }.new - Hash.ruby2_keywords_hash?(obj.m(a: 1)).should == true - end + it "returns true if the Hash is a keywords Hash marked by Module#ruby2_keywords" do + obj = Class.new { + ruby2_keywords def m(*args) + args.last + end + }.new + Hash.ruby2_keywords_hash?(obj.m(a: 1)).should == true + end - it "raises TypeError for non-Hash" do - -> { Hash.ruby2_keywords_hash?(nil) }.should raise_error(TypeError) - end + it "raises TypeError for non-Hash" do + -> { Hash.ruby2_keywords_hash?(nil) }.should raise_error(TypeError) end +end - describe "Hash.ruby2_keywords_hash" do - it "returns a copy of a Hash and marks the copy as a keywords Hash" do - h = {a: 1}.freeze - kw = Hash.ruby2_keywords_hash(h) - Hash.ruby2_keywords_hash?(h).should == false - Hash.ruby2_keywords_hash?(kw).should == true - kw.should == h - end +describe "Hash.ruby2_keywords_hash" do + it "returns a copy of a Hash and marks the copy as a keywords Hash" do + h = {a: 1}.freeze + kw = Hash.ruby2_keywords_hash(h) + Hash.ruby2_keywords_hash?(h).should == false + Hash.ruby2_keywords_hash?(kw).should == true + kw.should == h + end - it "returns an instance of the subclass if called on an instance of a subclass of Hash" do - h = HashSpecs::MyHash.new - h[:a] = 1 - kw = Hash.ruby2_keywords_hash(h) - kw.class.should == HashSpecs::MyHash - Hash.ruby2_keywords_hash?(h).should == false - Hash.ruby2_keywords_hash?(kw).should == true - kw.should == h - end + it "returns an instance of the subclass if called on an instance of a subclass of Hash" do + h = HashSpecs::MyHash.new + h[:a] = 1 + kw = Hash.ruby2_keywords_hash(h) + kw.class.should == HashSpecs::MyHash + Hash.ruby2_keywords_hash?(h).should == false + Hash.ruby2_keywords_hash?(kw).should == true + kw.should == h + end + + it "copies instance variables" do + h = {a: 1} + h.instance_variable_set(:@foo, 42) + kw = Hash.ruby2_keywords_hash(h) + kw.instance_variable_get(:@foo).should == 42 + end + + it "copies the hash internals" do + h = {a: 1} + kw = Hash.ruby2_keywords_hash(h) + h[:a] = 2 + kw[:a].should == 1 + end + + it "raises TypeError for non-Hash" do + -> { Hash.ruby2_keywords_hash(nil) }.should raise_error(TypeError) + end + + it "retains the default value" do + hash = Hash.new(1) + Hash.ruby2_keywords_hash(hash).default.should == 1 + hash[:a] = 1 + Hash.ruby2_keywords_hash(hash).default.should == 1 + end + + it "retains the default_proc" do + pr = proc { |h, k| h[k] = [] } + hash = Hash.new(&pr) + Hash.ruby2_keywords_hash(hash).default_proc.should == pr + hash[:a] = 1 + Hash.ruby2_keywords_hash(hash).default_proc.should == pr + end - it "raises TypeError for non-Hash" do - -> { Hash.ruby2_keywords_hash(nil) }.should raise_error(TypeError) + ruby_version_is '3.3' do + it "retains compare_by_identity_flag" do + hash = {}.compare_by_identity + Hash.ruby2_keywords_hash(hash).compare_by_identity?.should == true + hash[:a] = 1 + Hash.ruby2_keywords_hash(hash).compare_by_identity?.should == true end end end diff --git a/spec/ruby/core/hash/shared/each.rb b/spec/ruby/core/hash/shared/each.rb index b2483c8116..f9839ff58f 100644 --- a/spec/ruby/core/hash/shared/each.rb +++ b/spec/ruby/core/hash/shared/each.rb @@ -21,37 +21,18 @@ describe :hash_each, shared: true do ary.sort.should == ["a", "b", "c"] end - ruby_version_is ""..."3.0" do - it "yields 2 values and not an Array of 2 elements when given a callable of arity 2" do - obj = Object.new - def obj.foo(key, value) - ScratchPad << key << value - end - - ScratchPad.record([]) - { "a" => 1 }.send(@method, &obj.method(:foo)) - ScratchPad.recorded.should == ["a", 1] - - ScratchPad.record([]) - { "a" => 1 }.send(@method, &-> key, value { ScratchPad << key << value }) - ScratchPad.recorded.should == ["a", 1] + it "always yields an Array of 2 elements, even when given a callable of arity 2" do + obj = Object.new + def obj.foo(key, value) end - end - - ruby_version_is "3.0" do - it "always yields an Array of 2 elements, even when given a callable of arity 2" do - obj = Object.new - def obj.foo(key, value) - end - -> { - { "a" => 1 }.send(@method, &obj.method(:foo)) - }.should raise_error(ArgumentError) + -> { + { "a" => 1 }.send(@method, &obj.method(:foo)) + }.should raise_error(ArgumentError) - -> { - { "a" => 1 }.send(@method, &-> key, value { }) - }.should raise_error(ArgumentError) - end + -> { + { "a" => 1 }.send(@method, &-> key, value { }) + }.should raise_error(ArgumentError) end it "yields an Array of 2 elements when given a callable of arity 1" do diff --git a/spec/ruby/core/hash/shared/eql.rb b/spec/ruby/core/hash/shared/eql.rb index e294edd764..68db49f76d 100644 --- a/spec/ruby/core/hash/shared/eql.rb +++ b/spec/ruby/core/hash/shared/eql.rb @@ -149,80 +149,34 @@ describe :hash_eql_additional, shared: true do h.send(@method, HashSpecs::MyHash[h]).should be_true end - ruby_version_is '2.7' do - # Why isn't this true of eql? too ? - it "compares keys with matching hash codes via eql?" do - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - return true if self.equal?(o) - false - end - - obj + # Why isn't this true of eql? too ? + it "compares keys with matching hash codes via eql?" do + a = Array.new(2) do + obj = mock('0') + obj.should_receive(:hash).at_least(1).and_return(0) + + def obj.eql?(o) + return true if self.equal?(o) + false end - { a[0] => 1 }.send(@method, { a[1] => 1 }).should be_false - - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - true - end - - obj - end - - { a[0] => 1 }.send(@method, { a[1] => 1 }).should be_true + obj end - end - ruby_version_is ''...'2.7' do - # Why isn't this true of eql? too ? - it "compares keys with matching hash codes via eql?" do - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) + { a[0] => 1 }.send(@method, { a[1] => 1 }).should be_false - # It's undefined whether the impl does a[0].eql?(a[1]) or - # a[1].eql?(a[0]) so we taint both. - def obj.eql?(o) - return true if self.equal?(o) - taint - o.taint - false - end + a = Array.new(2) do + obj = mock('0') + obj.should_receive(:hash).at_least(1).and_return(0) - obj + def obj.eql?(o) + true end - { a[0] => 1 }.send(@method, { a[1] => 1 }).should be_false - a[0].tainted?.should be_true - a[1].tainted?.should be_true - - a = Array.new(2) do - obj = mock('0') - obj.should_receive(:hash).at_least(1).and_return(0) - - def obj.eql?(o) - # It's undefined whether the impl does a[0].send(@method, a[1]) or - # a[1].send(@method, a[0]) so we taint both. - taint - o.taint - true - end - - obj - end - - { a[0] => 1 }.send(@method, { a[1] => 1 }).should be_true - a[0].tainted?.should be_true - a[1].tainted?.should be_true + obj end + + { a[0] => 1 }.send(@method, { a[1] => 1 }).should be_true end it "compares the values in self to values in other hash" do diff --git a/spec/ruby/core/hash/shared/equal.rb b/spec/ruby/core/hash/shared/equal.rb deleted file mode 100644 index 43606437fe..0000000000 --- a/spec/ruby/core/hash/shared/equal.rb +++ /dev/null @@ -1,90 +0,0 @@ -describe :hash_equal, shared: true do - it "does not compare values when keys don't match" do - value = mock('x') - value.should_not_receive(:==) - value.should_not_receive(:eql?) - { 1 => value }.send(@method, { 2 => value }).should be_false - end - - it "returns false when the numbers of keys differ without comparing any elements" do - obj = mock('x') - h = { obj => obj } - - obj.should_not_receive(:==) - obj.should_not_receive(:eql?) - - {}.send(@method, h).should be_false - h.send(@method, {}).should be_false - end - - it "first compares keys via hash" do - x = mock('x') - x.should_receive(:hash).and_return(0) - y = mock('y') - y.should_receive(:hash).and_return(0) - - { x => 1 }.send(@method, { y => 1 }).should be_false - end - - it "does not compare keys with different hash codes via eql?" do - x = mock('x') - y = mock('y') - x.should_not_receive(:eql?) - y.should_not_receive(:eql?) - - x.should_receive(:hash).and_return(0) - y.should_receive(:hash).and_return(1) - - def x.hash() 0 end - def y.hash() 1 end - - { x => 1 }.send(@method, { y => 1 }).should be_false - end - - it "computes equality for recursive hashes" do - h = {} - h[:a] = h - h.send(@method, h[:a]).should be_true - (h == h[:a]).should be_true - end - - it "computes equality for complex recursive hashes" do - a, b = {}, {} - a.merge! self: a, other: b - b.merge! self: b, other: a - a.send(@method, b).should be_true # they both have the same structure! - - c = {} - c.merge! other: c, self: c - c.send(@method, a).should be_true # subtle, but they both have the same structure! - a[:delta] = c[:delta] = a - c.send(@method, a).should be_false # not quite the same structure, as a[:other][:delta] = nil - c[:delta] = 42 - c.send(@method, a).should be_false - a[:delta] = 42 - c.send(@method, a).should be_false - b[:delta] = 42 - c.send(@method, a).should be_true - end - - it "computes equality for recursive hashes & arrays" do - x, y, z = [], [], [] - a, b, c = {foo: x, bar: 42}, {foo: y, bar: 42}, {foo: z, bar: 42} - x << a - y << c - z << b - b.send(@method, c).should be_true # they clearly have the same structure! - y.send(@method, z).should be_true - a.send(@method, b).should be_true # subtle, but they both have the same structure! - x.send(@method, y).should be_true - y << x - y.send(@method, z).should be_false - z << x - y.send(@method, z).should be_true - - a[:foo], a[:bar] = a[:bar], a[:foo] - a.send(@method, b).should be_false - b[:bar] = b[:foo] - b.send(@method, c).should be_false - end -end diff --git a/spec/ruby/core/hash/shared/store.rb b/spec/ruby/core/hash/shared/store.rb index b823ea45ca..dd1bb52bac 100644 --- a/spec/ruby/core/hash/shared/store.rb +++ b/spec/ruby/core/hash/shared/store.rb @@ -9,7 +9,7 @@ describe :hash_store, shared: true do it "duplicates string keys using dup semantics" do # dup doesn't copy singleton methods - key = "foo" + key = +"foo" def key.reverse() "bar" end h = {} h.send(@method, key, 0) @@ -44,7 +44,7 @@ describe :hash_store, shared: true do end it "duplicates and freezes string keys" do - key = "foo" + key = +"foo" h = {} h.send(@method, key, 0) key << "bar" @@ -75,8 +75,8 @@ describe :hash_store, shared: true do it "keeps the existing String key in the hash if there is a matching one" do h = { "a" => 1, "b" => 2, "c" => 3, "d" => 4 } - key1 = "foo" - key2 = "foo" + key1 = "foo".dup + key2 = "foo".dup key1.should_not equal(key2) h[key1] = 41 frozen_key = h.keys.last diff --git a/spec/ruby/core/hash/shared/to_s.rb b/spec/ruby/core/hash/shared/to_s.rb index b0e3705d01..7864d7cd4c 100644 --- a/spec/ruby/core/hash/shared/to_s.rb +++ b/spec/ruby/core/hash/shared/to_s.rb @@ -2,7 +2,6 @@ require_relative '../../../spec_helper' require_relative '../fixtures/classes' describe :hash_to_s, shared: true do - it "returns a string representation with same order as each()" do h = { a: [1, 2], b: -2, d: -6, nil => nil } @@ -25,7 +24,7 @@ describe :hash_to_s, shared: true do end it "does not call #to_s on a String returned from #inspect" do - str = "abc" + str = +"abc" str.should_not_receive(:to_s) { a: str }.send(@method).should == '{:a=>"abc"}' @@ -77,22 +76,14 @@ describe :hash_to_s, shared: true do y.send(@method).should == "{1=>{0=>{...}}}" end - ruby_version_is ''...'2.7' do - it "returns a tainted string if self is tainted and not empty" do - {}.taint.send(@method).tainted?.should be_false - { nil => nil }.taint.send(@method).tainted?.should be_true - end - - it "returns an untrusted string if self is untrusted and not empty" do - {}.untrust.send(@method).untrusted?.should be_false - { nil => nil }.untrust.send(@method).untrusted?.should be_true - end - end - it "does not raise if inspected result is not default external encoding" do utf_16be = mock("utf_16be") - utf_16be.should_receive(:inspect).and_return(%<"utf_16be \u3042">.encode!(Encoding::UTF_16BE)) + utf_16be.should_receive(:inspect).and_return(%<"utf_16be \u3042">.encode(Encoding::UTF_16BE)) {a: utf_16be}.send(@method).should == '{:a=>"utf_16be \u3042"}' end + + it "works for keys and values whose #inspect return a frozen String" do + { true => false }.to_s.should == "{true=>false}" + end end diff --git a/spec/ruby/core/hash/shift_spec.rb b/spec/ruby/core/hash/shift_spec.rb index 9d43e640f5..ea36488a04 100644 --- a/spec/ruby/core/hash/shift_spec.rb +++ b/spec/ruby/core/hash/shift_spec.rb @@ -30,23 +30,45 @@ describe "Hash#shift" do h.should == {} end - it "calls #default with nil if the Hash is empty" do - h = {} - def h.default(key) - key.should == nil - :foo + ruby_version_is '3.2' do + it "returns nil if the Hash is empty" do + h = {} + def h.default(key) + raise + end + h.shift.should == nil + end + end + + ruby_version_is ''...'3.2' do + it "calls #default with nil if the Hash is empty" do + h = {} + def h.default(key) + key.should == nil + :foo + end + h.shift.should == :foo end - h.shift.should == :foo end it "returns nil from an empty hash" do {}.shift.should == nil end - it "returns (computed) default for empty hashes" do - Hash.new(5).shift.should == 5 - h = Hash.new { |*args| args } - h.shift.should == [h, nil] + ruby_version_is '3.2' do + it "returns nil for empty hashes with defaults and default procs" do + Hash.new(5).shift.should == nil + h = Hash.new { |*args| args } + h.shift.should == nil + end + end + + ruby_version_is ''...'3.2' do + it "returns (computed) default for empty hashes" do + Hash.new(5).shift.should == 5 + h = Hash.new { |*args| args } + h.shift.should == [h, nil] + end end it "preserves Hash invariants when removing the last item" do diff --git a/spec/ruby/core/hash/to_a_spec.rb b/spec/ruby/core/hash/to_a_spec.rb index 46f871389a..5baf677929 100644 --- a/spec/ruby/core/hash/to_a_spec.rb +++ b/spec/ruby/core/hash/to_a_spec.rb @@ -26,14 +26,4 @@ describe "Hash#to_a" do ent.should be_kind_of(Array) ent.should == pairs end - - ruby_version_is ''...'2.7' do - it "returns a tainted array if self is tainted" do - {}.taint.to_a.tainted?.should be_true - end - - it "returns an untrusted array if self is untrusted" do - {}.untrust.to_a.untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/hash/to_proc_spec.rb b/spec/ruby/core/hash/to_proc_spec.rb index 8f5d21beb5..9dbc79e5eb 100644 --- a/spec/ruby/core/hash/to_proc_spec.rb +++ b/spec/ruby/core/hash/to_proc_spec.rb @@ -19,20 +19,12 @@ describe "Hash#to_proc" do @proc = @hash.to_proc end - ruby_version_is ""..."3.0" do - it "is not a lambda" do - @proc.should_not.lambda? - end + it "is a lambda" do + @proc.should.lambda? end - ruby_version_is "3.0" do - it "is a lambda" do - @proc.should.lambda? - end - - it "has an arity of 1" do - @proc.arity.should == 1 - end + it "has an arity of 1" do + @proc.arity.should == 1 end it "raises ArgumentError if not passed exactly one argument" do diff --git a/spec/ruby/core/hash/transform_keys_spec.rb b/spec/ruby/core/hash/transform_keys_spec.rb index 70a4cdde36..2fbb17a8e2 100644 --- a/spec/ruby/core/hash/transform_keys_spec.rb +++ b/spec/ruby/core/hash/transform_keys_spec.rb @@ -42,6 +42,18 @@ describe "Hash#transform_keys" do r.keys.should == [:xfoo] r.class.should == Hash end + + it "allows a hash argument" do + @hash.transform_keys({ a: :A, b: :B, c: :C }).should == { A: 1, B: 2, C: 3 } + end + + it "allows a partial transformation of keys when using a hash argument" do + @hash.transform_keys({ a: :A, c: :C }).should == { A: 1, b: 2, C: 3 } + end + + it "allows a combination of hash and block argument" do + @hash.transform_keys({ a: :A }, &:to_s).should == { A: 1, 'b' => 2, 'c' => 3 } + end end describe "Hash#transform_keys!" do @@ -59,14 +71,13 @@ describe "Hash#transform_keys!" do @hash.should == { 'a' => 1, 'b' => 2, 'c' => 3, 'd' => 4 } end - # https://bugs.ruby-lang.org/issues/14380 it "prevents conflicts between new keys and old ones" do @hash.transform_keys!(&:succ) @hash.should == { b: 1, c: 2, d: 3, e: 4 } end ruby_version_is ""..."3.0.2" do # https://bugs.ruby-lang.org/issues/17735 - it "returns the processed keys if we broke from the block" do + it "returns the processed keys if we break from the block" do @hash.transform_keys! do |v| break if v == :c v.succ @@ -76,7 +87,7 @@ describe "Hash#transform_keys!" do end ruby_version_is "3.0.2" do - it "returns the processed keys and non evaluated keys if we broke from the block" do + it "returns the processed keys and non evaluated keys if we break from the block" do @hash.transform_keys! do |v| break if v == :c v.succ @@ -98,6 +109,11 @@ describe "Hash#transform_keys!" do end end + it "allows a hash argument" do + @hash.transform_keys!({ a: :A, b: :B, c: :C, d: :D }) + @hash.should == { A: 1, B: 2, C: 3, D: 4 } + end + describe "on frozen instance" do before :each do @hash.freeze @@ -112,6 +128,10 @@ describe "Hash#transform_keys!" do @hash.should == @initial_pairs end + it "raises a FrozenError on hash argument" do + ->{ @hash.transform_keys!({ a: :A, b: :B, c: :C }) }.should raise_error(FrozenError) + end + context "when no block is given" do it "does not raise an exception" do @hash.transform_keys!.should be_an_instance_of(Enumerator) diff --git a/spec/ruby/core/hash/try_convert_spec.rb b/spec/ruby/core/hash/try_convert_spec.rb index 44195c5010..d359ae49d8 100644 --- a/spec/ruby/core/hash/try_convert_spec.rb +++ b/spec/ruby/core/hash/try_convert_spec.rb @@ -39,7 +39,7 @@ describe "Hash.try_convert" do it "sends #to_hash to the argument and raises TypeError if it's not a kind of Hash" do obj = mock("to_hash") obj.should_receive(:to_hash).and_return(Object.new) - -> { Hash.try_convert obj }.should raise_error(TypeError) + -> { Hash.try_convert obj }.should raise_error(TypeError, "can't convert MockObject to Hash (MockObject#to_hash gives Object)") end it "does not rescue exceptions raised by #to_hash" do diff --git a/spec/ruby/core/integer/bit_and_spec.rb b/spec/ruby/core/integer/bit_and_spec.rb index 15a8026855..e7face39ac 100644 --- a/spec/ruby/core/integer/bit_and_spec.rb +++ b/spec/ruby/core/integer/bit_and_spec.rb @@ -30,7 +30,7 @@ describe "Integer#&" do it "coerces the rhs and calls #coerce" do obj = mock("fixnum bit and") - obj.should_receive(:coerce).with(6).and_return([3, 6]) + obj.should_receive(:coerce).with(6).and_return([6, 3]) (6 & obj).should == 2 end @@ -55,24 +55,24 @@ describe "Integer#&" do @bignum = bignum_value(5) (@bignum & 3).should == 1 (@bignum & 52).should == 4 - (@bignum & bignum_value(9921)).should == 9223372036854775809 + (@bignum & bignum_value(9921)).should == 18446744073709551617 ((2*bignum_value) & 1).should == 0 - ((2*bignum_value) & (2*bignum_value)).should == 18446744073709551616 + ((2*bignum_value) & (2*bignum_value)).should == 36893488147419103232 end it "returns self bitwise AND other when one operand is negative" do ((2*bignum_value) & -1).should == (2*bignum_value) ((4*bignum_value) & -1).should == (4*bignum_value) - (@bignum & -0xffffffffffffff5).should == 9223372036854775809 + (@bignum & -0xffffffffffffff5).should == 18446744073709551617 (@bignum & -@bignum).should == 1 - (@bignum & -0x8000000000000000).should == 9223372036854775808 + (@bignum & -0x8000000000000000).should == 18446744073709551616 end it "returns self bitwise AND other when both operands are negative" do - (-@bignum & -0x4000000000000005).should == -13835058055282163717 - (-@bignum & -@bignum).should == -9223372036854775813 - (-@bignum & -0x4000000000000000).should == -13835058055282163712 + (-@bignum & -0x4000000000000005).should == -23058430092136939525 + (-@bignum & -@bignum).should == -18446744073709551621 + (-@bignum & -0x4000000000000000).should == -23058430092136939520 end it "returns self bitwise AND other when both are negative and a multiple in bitsize of Fixnum::MIN" do diff --git a/spec/ruby/core/integer/bit_or_spec.rb b/spec/ruby/core/integer/bit_or_spec.rb index e486eeec10..fdf8a191e5 100644 --- a/spec/ruby/core/integer/bit_or_spec.rb +++ b/spec/ruby/core/integer/bit_or_spec.rb @@ -7,13 +7,34 @@ describe "Integer#|" do (5 | 4).should == 5 (5 | 6).should == 7 (248 | 4096).should == 4344 - (0xffff | bignum_value + 0xf0f0).should == 0x8000_0000_0000_ffff + (0xffff | bignum_value + 0xf0f0).should == 0x1_0000_0000_0000_ffff + end + + it "returns self bitwise OR other when one operand is negative" do + ((1 << 33) | -1).should == -1 + (-1 | (1 << 33)).should == -1 + + ((-(1<<33)-1) | 5).should == -8589934593 + (5 | (-(1<<33)-1)).should == -8589934593 + end + + it "returns self bitwise OR other when both operands are negative" do + (-5 | -1).should == -1 + (-3 | -4).should == -3 + (-12 | -13).should == -9 + (-13 | -12).should == -9 end it "returns self bitwise OR a bignum" do (-1 | 2**64).should == -1 end + it "coerces the rhs and calls #coerce" do + obj = mock("fixnum bit or") + obj.should_receive(:coerce).with(6).and_return([6, 3]) + (6 | obj).should == 7 + end + it "raises a TypeError when passed a Float" do -> { (3 | 3.4) }.should raise_error(TypeError) end @@ -32,20 +53,20 @@ describe "Integer#|" do end it "returns self bitwise OR other" do - (@bignum | 2).should == 9223372036854775819 - (@bignum | 9).should == 9223372036854775819 - (@bignum | bignum_value).should == 9223372036854775819 + (@bignum | 2).should == 18446744073709551627 + (@bignum | 9).should == 18446744073709551627 + (@bignum | bignum_value).should == 18446744073709551627 end it "returns self bitwise OR other when one operand is negative" do - (@bignum | -0x40000000000000000).should == -64563604257983430645 + (@bignum | -0x40000000000000000).should == -55340232221128654837 (@bignum | -@bignum).should == -1 (@bignum | -0x8000000000000000).should == -9223372036854775797 end it "returns self bitwise OR other when both operands are negative" do (-@bignum | -0x4000000000000005).should == -1 - (-@bignum | -@bignum).should == -9223372036854775819 + (-@bignum | -@bignum).should == -18446744073709551627 (-@bignum | -0x4000000000000000).should == -11 end diff --git a/spec/ruby/core/integer/bit_xor_spec.rb b/spec/ruby/core/integer/bit_xor_spec.rb index ac8826a52f..1f46bc52f3 100644 --- a/spec/ruby/core/integer/bit_xor_spec.rb +++ b/spec/ruby/core/integer/bit_xor_spec.rb @@ -5,13 +5,34 @@ describe "Integer#^" do it "returns self bitwise EXCLUSIVE OR other" do (3 ^ 5).should == 6 (-2 ^ -255).should == 255 - (5 ^ bignum_value + 0xffff_ffff).should == 0x8000_0000_ffff_fffa + (5 ^ bignum_value + 0xffff_ffff).should == 0x1_0000_0000_ffff_fffa + end + + it "returns self bitwise XOR other when one operand is negative" do + ((1 << 33) ^ -1).should == -8589934593 + (-1 ^ (1 << 33)).should == -8589934593 + + ((-(1<<33)-1) ^ 5).should == -8589934598 + (5 ^ (-(1<<33)-1)).should == -8589934598 + end + + it "returns self bitwise XOR other when both operands are negative" do + (-5 ^ -1).should == 4 + (-3 ^ -4).should == 1 + (-12 ^ -13).should == 7 + (-13 ^ -12).should == 7 end it "returns self bitwise EXCLUSIVE OR a bignum" do (-1 ^ 2**64).should == -18446744073709551617 end + it "coerces the rhs and calls #coerce" do + obj = mock("fixnum bit xor") + obj.should_receive(:coerce).with(6).and_return([6, 3]) + (6 ^ obj).should == 5 + end + it "raises a TypeError when passed a Float" do -> { (3 ^ 3.4) }.should raise_error(TypeError) end @@ -30,21 +51,21 @@ describe "Integer#^" do end it "returns self bitwise EXCLUSIVE OR other" do - (@bignum ^ 2).should == 9223372036854775824 + (@bignum ^ 2).should == 18446744073709551632 (@bignum ^ @bignum).should == 0 - (@bignum ^ 14).should == 9223372036854775836 + (@bignum ^ 14).should == 18446744073709551644 end it "returns self bitwise EXCLUSIVE OR other when one operand is negative" do - (@bignum ^ -0x40000000000000000).should == -64563604257983430638 + (@bignum ^ -0x40000000000000000).should == -55340232221128654830 (@bignum ^ -@bignum).should == -4 - (@bignum ^ -0x8000000000000000).should == -18446744073709551598 + (@bignum ^ -0x8000000000000000).should == -27670116110564327406 end it "returns self bitwise EXCLUSIVE OR other when both operands are negative" do - (-@bignum ^ -0x40000000000000000).should == 64563604257983430638 + (-@bignum ^ -0x40000000000000000).should == 55340232221128654830 (-@bignum ^ -@bignum).should == 0 - (-@bignum ^ -0x4000000000000000).should == 13835058055282163694 + (-@bignum ^ -0x4000000000000000).should == 23058430092136939502 end it "returns self bitwise EXCLUSIVE OR other when all bits are 1 and other value is negative" do diff --git a/spec/ruby/core/integer/ceildiv_spec.rb b/spec/ruby/core/integer/ceildiv_spec.rb new file mode 100644 index 0000000000..18d07c66d0 --- /dev/null +++ b/spec/ruby/core/integer/ceildiv_spec.rb @@ -0,0 +1,22 @@ +require_relative '../../spec_helper' + +describe "Integer#ceildiv" do + ruby_version_is '3.2' do + it "returns a quotient of division which is rounded up to the nearest integer" do + 0.ceildiv(3).should eql(0) + 1.ceildiv(3).should eql(1) + 3.ceildiv(3).should eql(1) + 4.ceildiv(3).should eql(2) + + 4.ceildiv(-3).should eql(-1) + -4.ceildiv(3).should eql(-1) + -4.ceildiv(-3).should eql(2) + + 3.ceildiv(1.2).should eql(3) + 3.ceildiv(6/5r).should eql(3) + + (10**100-11).ceildiv(10**99-1).should eql(10) + (10**100-9).ceildiv(10**99-1).should eql(11) + end + end +end diff --git a/spec/ruby/core/integer/chr_spec.rb b/spec/ruby/core/integer/chr_spec.rb index 9f105e4241..8fe20ff812 100644 --- a/spec/ruby/core/integer/chr_spec.rb +++ b/spec/ruby/core/integer/chr_spec.rb @@ -11,7 +11,11 @@ describe "Integer#chr without argument" do it "raises a RangeError is self is less than 0" do -> { -1.chr }.should raise_error(RangeError) - -> { -bignum_value.chr }.should raise_error(RangeError) + -> { (-bignum_value).chr }.should raise_error(RangeError) + end + + it "raises a RangeError if self is too large" do + -> { 2206368128.chr(Encoding::UTF_8) }.should raise_error(RangeError) end describe "when Encoding.default_internal is nil" do @@ -162,7 +166,7 @@ describe "Integer#chr with an encoding argument" do # http://redmine.ruby-lang.org/issues/4869 it "raises a RangeError is self is less than 0" do -> { -1.chr(Encoding::UTF_8) }.should raise_error(RangeError) - -> { -bignum_value.chr(Encoding::EUC_JP) }.should raise_error(RangeError) + -> { (-bignum_value).chr(Encoding::EUC_JP) }.should raise_error(RangeError) end it "raises a RangeError if self is too large" do @@ -219,38 +223,35 @@ describe "Integer#chr with an encoding argument" do # #5864 it "raises RangeError if self is invalid as a codepoint in the specified encoding" do - [ [0x80, "US-ASCII"], - [0x0100, "BINARY"], - [0x0100, "EUC-JP"], - [0xA1A0, "EUC-JP"], - [0xA1, "EUC-JP"], - [0x80, "SHIFT_JIS"], - [0xE0, "SHIFT_JIS"], - [0x0100, "ISO-8859-9"], - [620, "TIS-620"], - [0xD800, "UTF-8"], - [0xDBFF, "UTF-8"], - [0xDC00, "UTF-8"], - [0xDFFF, "UTF-8"], - [0xD800, "UTF-16"], - [0xDBFF, "UTF-16"], - [0xDC00, "UTF-16"], - [0xDFFF, "UTF-16"], - ].each do |integer, encoding_name| - -> { integer.chr(encoding_name) }.should raise_error(RangeError) - end + -> { 0x80.chr("US-ASCII") }.should raise_error(RangeError) + -> { 0x0100.chr("BINARY") }.should raise_error(RangeError) + -> { 0x0100.chr("EUC-JP") }.should raise_error(RangeError) + -> { 0xA1A0.chr("EUC-JP") }.should raise_error(RangeError) + -> { 0xA1.chr("EUC-JP") }.should raise_error(RangeError) + -> { 0x80.chr("SHIFT_JIS") }.should raise_error(RangeError) + -> { 0xE0.chr("SHIFT_JIS") }.should raise_error(RangeError) + -> { 0x0100.chr("ISO-8859-9") }.should raise_error(RangeError) + -> { 620.chr("TIS-620") }.should raise_error(RangeError) + # UTF-16 surrogate range + -> { 0xD800.chr("UTF-8") }.should raise_error(RangeError) + -> { 0xDBFF.chr("UTF-8") }.should raise_error(RangeError) + -> { 0xDC00.chr("UTF-8") }.should raise_error(RangeError) + -> { 0xDFFF.chr("UTF-8") }.should raise_error(RangeError) + # UTF-16 surrogate range + -> { 0xD800.chr("UTF-16") }.should raise_error(RangeError) + -> { 0xDBFF.chr("UTF-16") }.should raise_error(RangeError) + -> { 0xDC00.chr("UTF-16") }.should raise_error(RangeError) + -> { 0xDFFF.chr("UTF-16") }.should raise_error(RangeError) end - ruby_version_is "2.7" do - it 'returns a String encoding self interpreted as a codepoint in the CESU-8 encoding' do - # see more details here https://en.wikipedia.org/wiki/CESU-8 - # code points from U+0000 to U+FFFF is encoded in the same way as in UTF-8 - 0x0045.chr(Encoding::CESU_8).bytes.should == 0x0045.chr(Encoding::UTF_8).bytes + it 'returns a String encoding self interpreted as a codepoint in the CESU-8 encoding' do + # see more details here https://en.wikipedia.org/wiki/CESU-8 + # code points from U+0000 to U+FFFF is encoded in the same way as in UTF-8 + 0x0045.chr(Encoding::CESU_8).bytes.should == 0x0045.chr(Encoding::UTF_8).bytes - # code points in range from U+10000 to U+10FFFF is CESU-8 data containing a 6-byte surrogate pair, - # which decodes to a 4-byte UTF-8 string - 0x10400.chr(Encoding::CESU_8).bytes.should != 0x10400.chr(Encoding::UTF_8).bytes - 0x10400.chr(Encoding::CESU_8).bytes.to_a.should == [0xED, 0xA0, 0x81, 0xED, 0xB0, 0x80] - end + # code points in range from U+10000 to U+10FFFF is CESU-8 data containing a 6-byte surrogate pair, + # which decodes to a 4-byte UTF-8 string + 0x10400.chr(Encoding::CESU_8).bytes.should != 0x10400.chr(Encoding::UTF_8).bytes + 0x10400.chr(Encoding::CESU_8).bytes.to_a.should == [0xED, 0xA0, 0x81, 0xED, 0xB0, 0x80] end end diff --git a/spec/ruby/core/integer/coerce_spec.rb b/spec/ruby/core/integer/coerce_spec.rb index f1f3256032..1d6dc9713f 100644 --- a/spec/ruby/core/integer/coerce_spec.rb +++ b/spec/ruby/core/integer/coerce_spec.rb @@ -1,7 +1,5 @@ require_relative '../../spec_helper' -require 'bigdecimal' - describe "Integer#coerce" do context "fixnum" do describe "when given a Fixnum" do @@ -90,15 +88,4 @@ describe "Integer#coerce" do ary.should == [1.2, a.to_f] end end - - context "bigdecimal" do - it "produces Floats" do - x, y = 3.coerce(BigDecimal("3.4")) - x.class.should == Float - x.should == 3.4 - y.class.should == Float - y.should == 3.0 - end - end - end diff --git a/spec/ruby/core/integer/complement_spec.rb b/spec/ruby/core/integer/complement_spec.rb index eafa5c263f..baf5e6c457 100644 --- a/spec/ruby/core/integer/complement_spec.rb +++ b/spec/ruby/core/integer/complement_spec.rb @@ -12,9 +12,9 @@ describe "Integer#~" do context "bignum" do it "returns self with each bit flipped" do - (~bignum_value(48)).should == -9223372036854775857 - (~(-bignum_value(21))).should == 9223372036854775828 - (~bignum_value(1)).should == -9223372036854775810 + (~bignum_value(48)).should == -18446744073709551665 + (~(-bignum_value(21))).should == 18446744073709551636 + (~bignum_value(1)).should == -18446744073709551618 end end end diff --git a/spec/ruby/core/integer/constants_spec.rb b/spec/ruby/core/integer/constants_spec.rb index 3b8b01e330..2077ad451e 100644 --- a/spec/ruby/core/integer/constants_spec.rb +++ b/spec/ruby/core/integer/constants_spec.rb @@ -1,25 +1,41 @@ require_relative '../../spec_helper' describe "Fixnum" do - it "is unified into Integer" do - suppress_warning do - Fixnum.should equal(Integer) + ruby_version_is ""..."3.2" do + it "is unified into Integer" do + suppress_warning do + Fixnum.should equal(Integer) + end + end + + it "is deprecated" do + -> { Fixnum }.should complain(/constant ::Fixnum is deprecated/) end end - it "is deprecated" do - -> { Fixnum }.should complain(/constant ::Fixnum is deprecated/) + ruby_version_is "3.2" do + it "is no longer defined" do + Object.should_not.const_defined?(:Fixnum) + end end end describe "Bignum" do - it "is unified into Integer" do - suppress_warning do - Bignum.should equal(Integer) + ruby_version_is ""..."3.2" do + it "is unified into Integer" do + suppress_warning do + Bignum.should equal(Integer) + end + end + + it "is deprecated" do + -> { Bignum }.should complain(/constant ::Bignum is deprecated/) end end - it "is deprecated" do - -> { Bignum }.should complain(/constant ::Bignum is deprecated/) + ruby_version_is "3.2" do + it "is no longer defined" do + Object.should_not.const_defined?(:Bignum) + end end end diff --git a/spec/ruby/core/integer/div_spec.rb b/spec/ruby/core/integer/div_spec.rb index bc1c4363d4..2eb9c0623b 100644 --- a/spec/ruby/core/integer/div_spec.rb +++ b/spec/ruby/core/integer/div_spec.rb @@ -70,8 +70,8 @@ describe "Integer#div" do end it "returns self divided by other" do - @bignum.div(4).should == 2305843009213693974 - @bignum.div(Rational(4, 1)).should == 2305843009213693974 + @bignum.div(4).should == 4611686018427387926 + @bignum.div(Rational(4, 1)).should == 4611686018427387926 @bignum.div(bignum_value(2)).should == 1 (-(10**50)).div(-(10**40 + 1)).should == 9999999999 @@ -124,11 +124,11 @@ describe "Integer#div" do end it "returns a result of integer division of self by a float argument" do - @bignum.div(4294967295.5).should eql(2147483648) + @bignum.div(4294967295.5).should eql(4294967296) not_supported_on :opal do - @bignum.div(4294967295.0).should eql(2147483648) + @bignum.div(4294967295.0).should eql(4294967297) @bignum.div(bignum_value(88).to_f).should eql(1) - @bignum.div(-bignum_value(88).to_f).should eql(-1) + @bignum.div((-bignum_value(88)).to_f).should eql(-1) end end @@ -143,4 +143,12 @@ describe "Integer#div" do -> { @bignum.div(-0) }.should raise_error(ZeroDivisionError) end end + + context "rational" do + it "returns self divided by the given argument as an Integer" do + 2.div(6/5r).should == 1 + 1.div(6/5r).should == 0 + 5.div(6/5r).should == 4 + end + end end diff --git a/spec/ruby/core/integer/divide_spec.rb b/spec/ruby/core/integer/divide_spec.rb index 5ac2dc538d..a878c4668c 100644 --- a/spec/ruby/core/integer/divide_spec.rb +++ b/spec/ruby/core/integer/divide_spec.rb @@ -47,7 +47,7 @@ describe "Integer#/" do end it "returns self divided by other" do - (@bignum / 4).should == 2305843009213693974 + (@bignum / 4).should == 4611686018427387926 (@bignum / bignum_value(2)).should == 1 @@ -60,15 +60,15 @@ describe "Integer#/" do it "returns self divided by Float" do not_supported_on :opal do - (bignum_value(88) / 4294967295.0).should be_close(2147483648.5, TOLERANCE) + (bignum_value(88) / 4294967295.0).should be_close(4294967297.0, TOLERANCE) end - (bignum_value(88) / 4294967295.5).should be_close(2147483648.25, TOLERANCE) + (bignum_value(88) / 4294967295.5).should be_close(4294967296.5, TOLERANCE) end it "returns result the same class as the argument" do - (@bignum / 4).should == 2305843009213693974 - (@bignum / 4.0).should be_close(2305843009213693974, TOLERANCE) - (@bignum / Rational(4, 1)).should == Rational(2305843009213693974, 1) + (@bignum / 4).should == 4611686018427387926 + (@bignum / 4.0).should be_close(4611686018427387926, TOLERANCE) + (@bignum / Rational(4, 1)).should == Rational(4611686018427387926, 1) end it "does NOT raise ZeroDivisionError if other is zero and is a Float" do diff --git a/spec/ruby/core/integer/divmod_spec.rb b/spec/ruby/core/integer/divmod_spec.rb index d88925caad..7a489e9344 100644 --- a/spec/ruby/core/integer/divmod_spec.rb +++ b/spec/ruby/core/integer/divmod_spec.rb @@ -46,16 +46,16 @@ describe "Integer#divmod" do # assert(0 < b ? (0 <= r && r < b) : (b < r && r <= 0)) # So, r is always between 0 and b. it "returns an Array containing quotient and modulus obtained from dividing self by the given argument" do - @bignum.divmod(4).should == [2305843009213693965, 3] - @bignum.divmod(13).should == [709490156681136604, 11] + @bignum.divmod(4).should == [4611686018427387917, 3] + @bignum.divmod(13).should == [1418980313362273205, 6] - @bignum.divmod(4.5).should == [2049638230412172288, 3.5] + @bignum.divmod(4.5).should == [4099276460824344576, 2.5] not_supported_on :opal do - @bignum.divmod(4.0).should == [2305843009213693952, 0.0] - @bignum.divmod(13.0).should == [709490156681136640, 8.0] + @bignum.divmod(4.0).should == [4611686018427387904, 0.0] + @bignum.divmod(13.0).should == [1418980313362273280, 3.0] - @bignum.divmod(2.0).should == [4611686018427387904, 0.0] + @bignum.divmod(2.0).should == [9223372036854775808, 0.0] end @bignum.divmod(bignum_value).should == [1, 55] diff --git a/spec/ruby/core/integer/element_reference_spec.rb b/spec/ruby/core/integer/element_reference_spec.rb index 7197ecdc03..cb7e0dc9b0 100644 --- a/spec/ruby/core/integer/element_reference_spec.rb +++ b/spec/ruby/core/integer/element_reference_spec.rb @@ -79,81 +79,79 @@ describe "Integer#[]" do 3[bignum_value.to_f].should == 0 end - ruby_version_is "2.7" do - context "when index and length passed" do - it "returns specified number of bits from specified position" do - 0b101001101[2, 4].should == 0b0011 - 0b101001101[2, 5].should == 0b10011 - 0b101001101[2, 7].should == 0b1010011 - end + context "when index and length passed" do + it "returns specified number of bits from specified position" do + 0b101001101[2, 4].should == 0b0011 + 0b101001101[2, 5].should == 0b10011 + 0b101001101[2, 7].should == 0b1010011 + end - it "ensures n[i, len] equals to (n >> i) & ((1 << len) - 1)" do - n = 0b101001101; i = 2; len = 4 - n[i, len].should == (n >> i) & ((1 << len) - 1) - end + it "ensures n[i, len] equals to (n >> i) & ((1 << len) - 1)" do + n = 0b101001101; i = 2; len = 4 + n[i, len].should == (n >> i) & ((1 << len) - 1) + end - it "moves start position to the most significant bits when negative index passed" do - 0b000001[-1, 4].should == 0b10 - 0b000001[-2, 4].should == 0b100 - 0b000001[-3, 4].should == 0b1000 - end + it "moves start position to the most significant bits when negative index passed" do + 0b000001[-1, 4].should == 0b10 + 0b000001[-2, 4].should == 0b100 + 0b000001[-3, 4].should == 0b1000 + end - it "ignores negative length" do - 0b101001101[1, -1].should == 0b10100110 - 0b101001101[2, -1].should == 0b1010011 - 0b101001101[3, -1].should == 0b101001 + it "ignores negative length" do + 0b101001101[1, -1].should == 0b10100110 + 0b101001101[2, -1].should == 0b1010011 + 0b101001101[3, -1].should == 0b101001 - 0b101001101[3, -5].should == 0b101001 - 0b101001101[3, -15].should == 0b101001 - 0b101001101[3, -125].should == 0b101001 - end + 0b101001101[3, -5].should == 0b101001 + 0b101001101[3, -15].should == 0b101001 + 0b101001101[3, -125].should == 0b101001 end + end - context "when range passed" do - it "returns bits specified by range" do - 0b101001101[2..5].should == 0b0011 - 0b101001101[2..6].should == 0b10011 - 0b101001101[2..8].should == 0b1010011 - end + context "when range passed" do + it "returns bits specified by range" do + 0b101001101[2..5].should == 0b0011 + 0b101001101[2..6].should == 0b10011 + 0b101001101[2..8].should == 0b1010011 + end - it "ensures n[i..j] equals to (n >> i) & ((1 << (j - i + 1)) - 1)" do - n = 0b101001101; i = 2; j = 5 - n[i..j].should == (n >> i) & ((1 << (j - i + 1)) - 1) - end + it "ensures n[i..j] equals to (n >> i) & ((1 << (j - i + 1)) - 1)" do + n = 0b101001101; i = 2; j = 5 + n[i..j].should == (n >> i) & ((1 << (j - i + 1)) - 1) + end - it "ensures n[i..] equals to (n >> i)" do - eval("0b101001101[3..]").should == 0b101001101 >> 3 - end + it "ensures n[i..] equals to (n >> i)" do + eval("0b101001101[3..]").should == 0b101001101 >> 3 + end - it "moves lower boundary to the most significant bits when negative value passed" do - 0b000001[-1, 4].should == 0b10 - 0b000001[-2, 4].should == 0b100 - 0b000001[-3, 4].should == 0b1000 - end + it "moves lower boundary to the most significant bits when negative value passed" do + 0b000001[-1, 4].should == 0b10 + 0b000001[-2, 4].should == 0b100 + 0b000001[-3, 4].should == 0b1000 + end - it "ignores upper boundary smaller than lower boundary" do - 0b101001101[4..1].should == 0b10100 - 0b101001101[4..2].should == 0b10100 - 0b101001101[-4..-5].should == 0b1010011010000 - end + it "ignores upper boundary smaller than lower boundary" do + 0b101001101[4..1].should == 0b10100 + 0b101001101[4..2].should == 0b10100 + 0b101001101[-4..-5].should == 0b1010011010000 + end + + it "raises FloatDomainError if any boundary is infinity" do + -> { 0x0001[3..Float::INFINITY] }.should raise_error(FloatDomainError, /Infinity/) + -> { 0x0001[-Float::INFINITY..3] }.should raise_error(FloatDomainError, /-Infinity/) + end - it "raises FloatDomainError if any boundary is infinity" do - -> { 0x0001[3..Float::INFINITY] }.should raise_error(FloatDomainError, /Infinity/) - -> { 0x0001[-Float::INFINITY..3] }.should raise_error(FloatDomainError, /-Infinity/) + context "when passed (..i)" do + it "returns 0 if all i bits equal 0" do + eval("0b10000[..1]").should == 0 + eval("0b10000[..2]").should == 0 + eval("0b10000[..3]").should == 0 end - context "when passed (..i)" do - it "returns 0 if all i bits equal 0" do - eval("0b10000[..1]").should == 0 - eval("0b10000[..2]").should == 0 - eval("0b10000[..3]").should == 0 - end - - it "raises ArgumentError if any of i bit equals 1" do - -> { - eval("0b111110[..3]") - }.should raise_error(ArgumentError, /The beginless range for Integer#\[\] results in infinity/) - end + it "raises ArgumentError if any of i bit equals 1" do + -> { + eval("0b111110[..3]") + }.should raise_error(ArgumentError, /The beginless range for Integer#\[\] results in infinity/) end end end diff --git a/spec/ruby/core/integer/fdiv_spec.rb b/spec/ruby/core/integer/fdiv_spec.rb index 6de170278f..d9ea2fdf8d 100644 --- a/spec/ruby/core/integer/fdiv_spec.rb +++ b/spec/ruby/core/integer/fdiv_spec.rb @@ -9,6 +9,57 @@ describe "Integer#fdiv" do 8.fdiv(bignum_value).should be_close(8.673617379884035e-19, TOLERANCE) end + it "performs floating-point division between self bignum and a bignum" do + num = 1000000000000000000000000000000000048148248609680896326399448564623182963452541226153892315137780403285956264146010000000000000000000000000000000000048148248609680896326399448564623182963452541226153892315137780403285956264146010000000000000000000000000000000000048148248609680896326399448564623182963452541226153892315137780403285956264146009 + den = 2000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000 + num.fdiv(den).should == 500.0 + end + + it "rounds to the correct value for bignums" do + den = 9 * 10**342 + + num = 1 * 10**344 + num.fdiv(den).should == 11.11111111111111 + + num = 1 * 10**343 + num.fdiv(den).should == 1.1111111111111112 + + num = 1 * 10**342 + num.fdiv(den).should == 0.1111111111111111 + + num = 2 * 10**342 + num.fdiv(den).should == 0.2222222222222222 + + num = 3 * 10**342 + num.fdiv(den).should == 0.3333333333333333 + + num = 4 * 10**342 + num.fdiv(den).should == 0.4444444444444444 + + num = 5 * 10**342 + num.fdiv(den).should == 0.5555555555555556 + + num = 6 * 10**342 + num.fdiv(den).should == 0.6666666666666666 + + num = 7 * 10**342 + num.fdiv(den).should == 0.7777777777777778 + + num = 8 * 10**342 + num.fdiv(den).should == 0.8888888888888888 + + num = 9 * 10**342 + num.fdiv(den).should == 1.0 + + num = -5 * 10**342 + num.fdiv(den).should == -0.5555555555555556 + end + + it "rounds to the correct float for bignum denominators" do + 1.fdiv(10**324).should == 0.0 + 1.fdiv(10**323).should == 1.0e-323 + end + it "performs floating-point division between self and a Float" do 8.fdiv(9.0).should be_close(0.888888888888889, TOLERANCE) end diff --git a/spec/ruby/core/integer/left_shift_spec.rb b/spec/ruby/core/integer/left_shift_spec.rb index 4efcbef334..0781371d93 100644 --- a/spec/ruby/core/integer/left_shift_spec.rb +++ b/spec/ruby/core/integer/left_shift_spec.rb @@ -56,13 +56,13 @@ describe "Integer#<< (with n << m)" do (3 << -bignum_value).should == 0 end - it "returns an Bignum == fixnum_max * 2 when fixnum_max << 1 and n > 0" do + it "returns a Bignum == fixnum_max * 2 when fixnum_max << 1 and n > 0" do result = fixnum_max << 1 result.should be_an_instance_of(Integer) result.should == fixnum_max * 2 end - it "returns an Bignum == fixnum_min * 2 when fixnum_min << 1 and n < 0" do + it "returns a Bignum == fixnum_min * 2 when fixnum_min << 1 and n < 0" do result = fixnum_min << 1 result.should be_an_instance_of(Integer) result.should == fixnum_min * 2 @@ -96,7 +96,7 @@ describe "Integer#<< (with n << m)" do context "bignum" do before :each do - @bignum = bignum_value * 16 + @bignum = bignum_value * 8 # 2 ** 67 end it "returns n shifted left m bits when n > 0, m > 0" do @@ -127,10 +127,6 @@ describe "Integer#<< (with n << m)" do (@bignum << -68).should == 0 end - it "returns 0 when m < 0 and m is a Bignum" do - (@bignum << -bignum_value).should == 0 - end - it "returns a Fixnum == fixnum_max when (fixnum_max * 2) << -1 and n > 0" do result = (fixnum_max * 2) << -1 result.should be_an_instance_of(Integer) @@ -165,4 +161,53 @@ describe "Integer#<< (with n << m)" do -> { @bignum << "4" }.should raise_error(TypeError) end end + + context "when m is a bignum or larger than int" do + it "returns -1 when m < 0 and n < 0" do + (-1 << -bignum_value).should == -1 + (-1 << -(2**40)).should == -1 + + (-bignum_value << -bignum_value).should == -1 + (-bignum_value << -(2**40)).should == -1 + end + + it "returns 0 when m < 0 and n >= 0" do + (0 << -bignum_value).should == 0 + (1 << -bignum_value).should == 0 + (bignum_value << -bignum_value).should == 0 + + (0 << -(2**40)).should == 0 + (1 << -(2**40)).should == 0 + (bignum_value << -(2**40)).should == 0 + end + + ruby_bug "#18517", ""..."3.2" do + it "returns 0 when m > 0 long and n == 0" do + (0 << (2**40)).should == 0 + end + end + + it "returns 0 when m > 0 bignum and n == 0" do + (0 << bignum_value).should == 0 + end + + it "raises RangeError when m > 0 and n != 0" do + # https://bugs.ruby-lang.org/issues/18518#note-9 + limit = RUBY_ENGINE == 'ruby' ? 2**67 : 2**32 + + coerce_long = mock("long") + coerce_long.stub!(:to_int).and_return(limit) + coerce_bignum = mock("bignum") + coerce_bignum.stub!(:to_int).and_return(bignum_value) + exps = [limit, coerce_long] + exps << bignum_value << coerce_bignum if bignum_value >= limit + + exps.each { |exp| + -> { (1 << exp) }.should raise_error(RangeError, 'shift width too big') + -> { (-1 << exp) }.should raise_error(RangeError, 'shift width too big') + -> { (bignum_value << exp) }.should raise_error(RangeError, 'shift width too big') + -> { (-bignum_value << exp) }.should raise_error(RangeError, 'shift width too big') + } + end + end end diff --git a/spec/ruby/core/integer/minus_spec.rb b/spec/ruby/core/integer/minus_spec.rb index ce50c8752f..aadf416a05 100644 --- a/spec/ruby/core/integer/minus_spec.rb +++ b/spec/ruby/core/integer/minus_spec.rb @@ -10,7 +10,7 @@ describe "Integer#-" do (9237212 - 5_280).should == 9231932 (781 - 0.5).should == 780.5 - (2_560_496 - bignum_value).should == -9223372036852215312 + (2_560_496 - bignum_value).should == -18446744073706991120 end it "raises a TypeError when given a non-Integer" do @@ -29,8 +29,8 @@ describe "Integer#-" do end it "returns self minus the given Integer" do - (@bignum - 9).should == 9223372036854776113 - (@bignum - 12.57).should be_close(9223372036854776109.43, TOLERANCE) + (@bignum - 9).should == 18446744073709551921 + (@bignum - 12.57).should be_close(18446744073709551917.43, TOLERANCE) (@bignum - bignum_value(42)).should == 272 end diff --git a/spec/ruby/core/integer/multiply_spec.rb b/spec/ruby/core/integer/multiply_spec.rb index d1e9c2640d..5037d27458 100644 --- a/spec/ruby/core/integer/multiply_spec.rb +++ b/spec/ruby/core/integer/multiply_spec.rb @@ -10,7 +10,7 @@ describe "Integer#*" do (1342177 * 800).should == 1073741600 (65536 * 65536).should == 4294967296 - (256 * bignum_value).should == 2361183241434822606848 + (256 * bignum_value).should == 4722366482869645213696 (6712 * 0.25).should == 1678.0 end @@ -32,8 +32,8 @@ describe "Integer#*" do it "returns self multiplied by the given Integer" do (@bignum * (1/bignum_value(0xffff).to_f)).should be_close(1.0, TOLERANCE) (@bignum * (1/bignum_value(0xffff).to_f)).should be_close(1.0, TOLERANCE) - (@bignum * 10).should == 92233720368547765800 - (@bignum * (@bignum - 40)).should == 85070591730234629737795195287525433200 + (@bignum * 10).should == 184467440737095523880 + (@bignum * (@bignum - 40)).should == 340282366920938491207277694290934407024 end it "raises a TypeError when given a non-Integer" do diff --git a/spec/ruby/core/integer/plus_spec.rb b/spec/ruby/core/integer/plus_spec.rb index be626c3305..d01a76ab58 100644 --- a/spec/ruby/core/integer/plus_spec.rb +++ b/spec/ruby/core/integer/plus_spec.rb @@ -9,7 +9,7 @@ describe "Integer#+" do (491 + 2).should == 493 (90210 + 10).should == 90220 - (9 + bignum_value).should == 9223372036854775817 + (9 + bignum_value).should == 18446744073709551625 (1001 + 5.219).should == 1006.219 end @@ -29,9 +29,9 @@ describe "Integer#+" do end it "returns self plus the given Integer" do - (@bignum + 4).should == 9223372036854775888 - (@bignum + 4.2).should be_close(9223372036854775888.2, TOLERANCE) - (@bignum + bignum_value(3)).should == 18446744073709551695 + (@bignum + 4).should == 18446744073709551696 + (@bignum + 4.2).should be_close(18446744073709551696.2, TOLERANCE) + (@bignum + bignum_value(3)).should == 36893488147419103311 end it "raises a TypeError when given a non-Integer" do @@ -40,4 +40,19 @@ describe "Integer#+" do -> { @bignum + :symbol}.should raise_error(TypeError) end end + + it "can be redefined" do + code = <<~RUBY + class Integer + alias_method :old_plus, :+ + def +(other) + self - other + end + end + result = 1 + 2 + Integer.alias_method :+, :old_plus + print result + RUBY + ruby_exe(code).should == "-1" + end end diff --git a/spec/ruby/core/integer/remainder_spec.rb b/spec/ruby/core/integer/remainder_spec.rb index cd10dad6f2..96268b3af5 100644 --- a/spec/ruby/core/integer/remainder_spec.rb +++ b/spec/ruby/core/integer/remainder_spec.rb @@ -33,7 +33,7 @@ describe "Integer#remainder" do it "returns the remainder of dividing self by other" do a = bignum_value(79) a.remainder(2).should == 1 - a.remainder(97.345).should be_close(46.5674996147722, TOLERANCE) + a.remainder(97.345).should be_close(93.1349992295444, TOLERANCE) a.remainder(bignum_value).should == 79 end diff --git a/spec/ruby/core/integer/right_shift_spec.rb b/spec/ruby/core/integer/right_shift_spec.rb index 6abcd8d714..e91613d8d1 100644 --- a/spec/ruby/core/integer/right_shift_spec.rb +++ b/spec/ruby/core/integer/right_shift_spec.rb @@ -52,17 +52,13 @@ describe "Integer#>> (with n >> m)" do (-7 >> 64).should == -1 end - it "returns 0 when m is a bignum" do - (3 >> bignum_value).should == 0 - end - - it "returns an Bignum == fixnum_max * 2 when fixnum_max >> -1 and n > 0" do + it "returns a Bignum == fixnum_max * 2 when fixnum_max >> -1 and n > 0" do result = fixnum_max >> -1 result.should be_an_instance_of(Integer) result.should == fixnum_max * 2 end - it "returns an Bignum == fixnum_min * 2 when fixnum_min >> -1 and n < 0" do + it "returns a Bignum == fixnum_min * 2 when fixnum_min >> -1 and n < 0" do result = fixnum_min >> -1 result.should be_an_instance_of(Integer) result.should == fixnum_min * 2 @@ -96,7 +92,7 @@ describe "Integer#>> (with n >> m)" do context "bignum" do before :each do - @bignum = bignum_value * 16 + @bignum = bignum_value * 8 # 2 ** 67 end it "returns n shifted right m bits when n > 0, m > 0" do @@ -153,10 +149,6 @@ describe "Integer#>> (with n >> m)" do (@bignum >> 68).should == 0 end - it "returns 0 when m is a Bignum" do - (@bignum >> bignum_value).should == 0 - end - it "returns a Fixnum == fixnum_max when (fixnum_max * 2) >> 1 and n > 0" do result = (fixnum_max * 2) >> 1 result.should be_an_instance_of(Integer) @@ -191,4 +183,53 @@ describe "Integer#>> (with n >> m)" do -> { @bignum >> "4" }.should raise_error(TypeError) end end + + context "when m is a bignum or larger than int" do + it "returns -1 when m > 0 and n < 0" do + (-1 >> bignum_value).should == -1 + (-1 >> (2**40)).should == -1 + + (-bignum_value >> bignum_value).should == -1 + (-bignum_value >> (2**40)).should == -1 + end + + it "returns 0 when m > 0 and n >= 0" do + (0 >> bignum_value).should == 0 + (1 >> bignum_value).should == 0 + (bignum_value >> bignum_value).should == 0 + + (0 >> (2**40)).should == 0 + (1 >> (2**40)).should == 0 + (bignum_value >> (2**40)).should == 0 + end + + ruby_bug "#18517", ""..."3.2" do + it "returns 0 when m < 0 long and n == 0" do + (0 >> -(2**40)).should == 0 + end + end + + it "returns 0 when m < 0 bignum and n == 0" do + (0 >> -bignum_value).should == 0 + end + + it "raises RangeError when m < 0 and n != 0" do + # https://bugs.ruby-lang.org/issues/18518#note-9 + limit = RUBY_ENGINE == 'ruby' ? 2**67 : 2**32 + + coerce_long = mock("long") + coerce_long.stub!(:to_int).and_return(-limit) + coerce_bignum = mock("bignum") + coerce_bignum.stub!(:to_int).and_return(-bignum_value) + exps = [-limit, coerce_long] + exps << -bignum_value << coerce_bignum if bignum_value >= limit + + exps.each { |exp| + -> { (1 >> exp) }.should raise_error(RangeError, 'shift width too big') + -> { (-1 >> exp) }.should raise_error(RangeError, 'shift width too big') + -> { (bignum_value >> exp) }.should raise_error(RangeError, 'shift width too big') + -> { (-bignum_value >> exp) }.should raise_error(RangeError, 'shift width too big') + } + end + end end diff --git a/spec/ruby/core/integer/shared/abs.rb b/spec/ruby/core/integer/shared/abs.rb index 946aa21864..43844c9065 100644 --- a/spec/ruby/core/integer/shared/abs.rb +++ b/spec/ruby/core/integer/shared/abs.rb @@ -11,8 +11,8 @@ describe :integer_abs, shared: true do context "bignum" do it "returns the absolute bignum value" do - bignum_value(39).send(@method).should == 9223372036854775847 - (-bignum_value(18)).send(@method).should == 9223372036854775826 + bignum_value(39).send(@method).should == 18446744073709551655 + (-bignum_value(18)).send(@method).should == 18446744073709551634 end end end diff --git a/spec/ruby/core/integer/shared/arithmetic_coerce.rb b/spec/ruby/core/integer/shared/arithmetic_coerce.rb index 4c0cbcb999..1260192df1 100644 --- a/spec/ruby/core/integer/shared/arithmetic_coerce.rb +++ b/spec/ruby/core/integer/shared/arithmetic_coerce.rb @@ -1,25 +1,5 @@ require_relative '../fixtures/classes' -describe :integer_arithmetic_coerce_rescue, shared: true do - it "rescues exception (StandardError and subclasses) raised in other#coerce and raises TypeError" do - b = mock("numeric with failed #coerce") - b.should_receive(:coerce).and_raise(IntegerSpecs::CoerceError) - - # e.g. 1 + b - -> { 1.send(@method, b) }.should raise_error(TypeError, /MockObject can't be coerced into Integer/) - end - - it "does not rescue Exception and StandardError siblings raised in other#coerce" do - [Exception, NoMemoryError].each do |exception| - b = mock("numeric with failed #coerce") - b.should_receive(:coerce).and_raise(exception) - - # e.g. 1 + b - -> { 1.send(@method, b) }.should raise_error(exception) - end - end -end - describe :integer_arithmetic_coerce_not_rescue, shared: true do it "does not rescue exception raised in other#coerce" do b = mock("numeric with failed #coerce") diff --git a/spec/ruby/core/integer/shared/exponent.rb b/spec/ruby/core/integer/shared/exponent.rb index f949c514c8..15df518b7e 100644 --- a/spec/ruby/core/integer/shared/exponent.rb +++ b/spec/ruby/core/integer/shared/exponent.rb @@ -30,11 +30,13 @@ describe :integer_exponent, shared: true do (-2).send(@method, 30).should eql(1073741824) (-2).send(@method, 31).should eql(-2147483648) (-2).send(@method, 32).should eql(4294967296) + (-2).send(@method, 33).should eql(-8589934592) (-2).send(@method, 61).should eql(-2305843009213693952) (-2).send(@method, 62).should eql(4611686018427387904) (-2).send(@method, 63).should eql(-9223372036854775808) (-2).send(@method, 64).should eql(18446744073709551616) + (-2).send(@method, 65).should eql(-36893488147419103232) end it "can raise 1 to a bignum safely" do @@ -96,8 +98,8 @@ describe :integer_exponent, shared: true do end it "returns self raised to other power" do - (@bignum.send(@method, 4)).should == 7237005577332262361485077344629993318496048279512298547155833600056910050625 - (@bignum.send(@method, 1.2)).should be_close(57262152889751597425762.57804, TOLERANCE) + (@bignum.send(@method, 4)).should == 115792089237316196603666111261383895964500887398800252671052694326794607293761 + (@bignum.send(@method, 1.3)).should be_close(11109528802438156839288832.0, TOLERANCE) end it "raises a TypeError when given a non-Integer" do @@ -116,8 +118,9 @@ describe :integer_exponent, shared: true do end it "returns a complex number when negative and raised to a fractional power" do - ((-@bignum).send(@method, (1.0/3))) .should be_close(Complex(1048576,1816186.907597341), TOLERANCE) - ((-@bignum).send(@method, Rational(1,3))).should be_close(Complex(1048576,1816186.907597341), TOLERANCE) + (-bignum_value).send(@method, (1.0/2)).should be_close(Complex(0.0, 4294967296.0), TOLERANCE) + (-@bignum).send(@method, (1.0/3)) .should be_close(Complex(1321122.9748145656, 2288252.1154253655), TOLERANCE) + (-@bignum).send(@method, Rational(1,3)).should be_close(Complex(1321122.9748145656, 2288252.1154253655), TOLERANCE) end end end diff --git a/spec/ruby/core/integer/shared/modulo.rb b/spec/ruby/core/integer/shared/modulo.rb index b06d81e17d..f678a10806 100644 --- a/spec/ruby/core/integer/shared/modulo.rb +++ b/spec/ruby/core/integer/shared/modulo.rb @@ -48,11 +48,11 @@ describe :integer_modulo, shared: true do end it "returns the modulus obtained from dividing self by the given argument" do - @bignum.send(@method, 5).should == 3 - @bignum.send(@method, -5).should == -2 - @bignum.send(@method, -100).should == -92 - @bignum.send(@method, 2.22).should be_close(0.780180180180252, TOLERANCE) - @bignum.send(@method, bignum_value(10)).should == 9223372036854775808 + @bignum.send(@method, 5).should == 1 + @bignum.send(@method, -5).should == -4 + @bignum.send(@method, -100).should == -84 + @bignum.send(@method, 2.22).should be_close(1.5603603603605034, TOLERANCE) + @bignum.send(@method, bignum_value(10)).should == 18446744073709551616 end it "raises a ZeroDivisionError when the given argument is 0" do diff --git a/spec/ruby/core/integer/to_f_spec.rb b/spec/ruby/core/integer/to_f_spec.rb index 06092eaa92..9f1df9ada9 100644 --- a/spec/ruby/core/integer/to_f_spec.rb +++ b/spec/ruby/core/integer/to_f_spec.rb @@ -11,9 +11,9 @@ describe "Integer#to_f" do context "bignum" do it "returns self converted to a Float" do - bignum_value(0x4000_0aa0_0bb0_0000).to_f.should eql(13_835_069_737_789_292_544.00) - bignum_value(0x8000_0000_0000_0ccc).to_f.should eql(18_446_744_073_709_555_712.00) - (-bignum_value(99)).to_f.should eql(-9_223_372_036_854_775_808.00) + bignum_value(0x4000_0aa0_0bb0_0000).to_f.should eql(23_058_441_774_644_068_352.0) + bignum_value(0x8000_0000_0000_0ccc).to_f.should eql(27_670_116_110_564_330_700.0) + (-bignum_value(99)).to_f.should eql(-18_446_744_073_709_551_715.0) end it "converts number close to Float::MAX without exceeding MAX or producing NaN" do diff --git a/spec/ruby/core/integer/to_s_spec.rb b/spec/ruby/core/integer/to_s_spec.rb index 7988bfde7a..ca08dad95c 100644 --- a/spec/ruby/core/integer/to_s_spec.rb +++ b/spec/ruby/core/integer/to_s_spec.rb @@ -68,9 +68,9 @@ describe "Integer#to_s" do describe "when given no base" do it "returns self converted to a String using base 10" do - bignum_value(9).to_s.should == "9223372036854775817" - bignum_value.to_s.should == "9223372036854775808" - (-bignum_value(675)).to_s.should == "-9223372036854776483" + bignum_value(9).to_s.should == "18446744073709551625" + bignum_value.to_s.should == "18446744073709551616" + (-bignum_value(675)).to_s.should == "-18446744073709552291" end end diff --git a/spec/ruby/core/integer/try_convert_spec.rb b/spec/ruby/core/integer/try_convert_spec.rb index 45c66eec79..4bc7d3851a 100644 --- a/spec/ruby/core/integer/try_convert_spec.rb +++ b/spec/ruby/core/integer/try_convert_spec.rb @@ -28,7 +28,17 @@ ruby_version_is "3.1" do it "sends #to_int to the argument and raises TypeError if it's not a kind of Integer" do obj = mock("to_int") obj.should_receive(:to_int).and_return(Object.new) - -> { Integer.try_convert obj }.should raise_error(TypeError) + -> { + Integer.try_convert obj + }.should raise_error(TypeError, "can't convert MockObject to Integer (MockObject#to_int gives Object)") + end + + it "responds with a different error message when it raises a TypeError, depending on the type of the non-Integer object :to_int returns" do + obj = mock("to_int") + obj.should_receive(:to_int).and_return("A String") + -> { + Integer.try_convert obj + }.should raise_error(TypeError, "can't convert MockObject to Integer (MockObject#to_int gives String)") end it "does not rescue exceptions raised by #to_int" do diff --git a/spec/ruby/core/integer/uminus_spec.rb b/spec/ruby/core/integer/uminus_spec.rb index b6b110dec4..7a9cfe89bf 100644 --- a/spec/ruby/core/integer/uminus_spec.rb +++ b/spec/ruby/core/integer/uminus_spec.rb @@ -20,11 +20,11 @@ describe "Integer#-@" do context "bignum" do it "returns self as a negative value" do - bignum_value.send(:-@).should == -9223372036854775808 - (-bignum_value).send(:-@).should == 9223372036854775808 + bignum_value.send(:-@).should == -18446744073709551616 + (-bignum_value).send(:-@).should == 18446744073709551616 - bignum_value(921).send(:-@).should == -9223372036854776729 - (-bignum_value(921).send(:-@)).should == 9223372036854776729 + bignum_value(921).send(:-@).should == -18446744073709552537 + (-bignum_value(921).send(:-@)).should == 18446744073709552537 end end end diff --git a/spec/ruby/core/integer/zero_spec.rb b/spec/ruby/core/integer/zero_spec.rb new file mode 100644 index 0000000000..bd362c4181 --- /dev/null +++ b/spec/ruby/core/integer/zero_spec.rb @@ -0,0 +1,13 @@ +require_relative '../../spec_helper' + +describe "Integer#zero?" do + it "returns true if self is 0" do + 0.should.zero? + 1.should_not.zero? + -1.should_not.zero? + end + + it "Integer#zero? overrides Numeric#zero?" do + 42.method(:zero?).owner.should == Integer + end +end diff --git a/spec/ruby/core/io/advise_spec.rb b/spec/ruby/core/io/advise_spec.rb index 0a845487e2..651fc52378 100644 --- a/spec/ruby/core/io/advise_spec.rb +++ b/spec/ruby/core/io/advise_spec.rb @@ -73,19 +73,9 @@ describe "IO#advise" do end end - platform_is :linux do + guard -> { platform_is :linux and kernel_version_is '3.6' } do # [ruby-core:65355] tmpfs is not supported it "supports the willneed advice type" do - require 'etc' - uname = if Etc.respond_to?(:uname) - Etc.uname[:release] - else - `uname -r`.chomp - end - if (uname.split('.').map(&:to_i) <=> [3,6]) < 0 - skip "[ruby-core:65355] tmpfs is not supported" - else - @io.advise(:willneed).should be_nil - end + @io.advise(:willneed).should be_nil end end diff --git a/spec/ruby/core/io/binread_spec.rb b/spec/ruby/core/io/binread_spec.rb index a3f752d8f9..418e89213b 100644 --- a/spec/ruby/core/io/binread_spec.rb +++ b/spec/ruby/core/io/binread_spec.rb @@ -44,4 +44,14 @@ describe "IO.binread" do it "raises an Errno::EINVAL when not passed a valid offset" do -> { IO.binread @fname, 0, -1 }.should raise_error(Errno::EINVAL) end + + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19630 + it "warns about deprecation given a path with a pipe" do + cmd = "|echo ok" + -> { + IO.binread(cmd) + }.should complain(/IO process creation with a leading '\|'/) + end + end end diff --git a/spec/ruby/core/io/bytes_spec.rb b/spec/ruby/core/io/bytes_spec.rb deleted file mode 100644 index 6e328983f2..0000000000 --- a/spec/ruby/core/io/bytes_spec.rb +++ /dev/null @@ -1,47 +0,0 @@ -# -*- encoding: utf-8 -*- -require_relative '../../spec_helper' -require_relative 'fixtures/classes' - -ruby_version_is ''...'3.0' do - describe "IO#bytes" do - before :each do - @io = IOSpecs.io_fixture "lines.txt" - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - @io.close unless @io.closed? - end - - it "returns an enumerator of the next bytes from the stream" do - enum = @io.bytes - enum.should be_an_instance_of(Enumerator) - @io.readline.should == "Voici la ligne une.\n" - enum.first(5).should == [81, 117, 105, 32, 195] - end - - it "yields each byte" do - count = 0 - ScratchPad.record [] - @io.each_byte do |byte| - ScratchPad << byte - break if 4 < count += 1 - end - - ScratchPad.recorded.should == [86, 111, 105, 99, 105] - end - - it "raises an IOError on closed stream" do - enum = IOSpecs.closed_io.bytes - -> { enum.first }.should raise_error(IOError) - end - - it "raises an IOError on an enumerator for a stream that has been closed" do - enum = @io.bytes - enum.first.should == 86 - @io.close - -> { enum.first }.should raise_error(IOError) - end - end -end diff --git a/spec/ruby/core/io/chars_spec.rb b/spec/ruby/core/io/chars_spec.rb deleted file mode 100644 index 15db595aed..0000000000 --- a/spec/ruby/core/io/chars_spec.rb +++ /dev/null @@ -1,30 +0,0 @@ -# -*- encoding: utf-8 -*- -require_relative '../../spec_helper' -require_relative 'fixtures/classes' -require_relative 'shared/chars' - -ruby_version_is ''...'3.0' do - describe "IO#chars" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :io_chars, :chars - end - - describe "IO#chars" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :io_chars_empty, :chars - end -end diff --git a/spec/ruby/core/io/close_read_spec.rb b/spec/ruby/core/io/close_read_spec.rb index 26454bfddd..e700e85bd9 100644 --- a/spec/ruby/core/io/close_read_spec.rb +++ b/spec/ruby/core/io/close_read_spec.rb @@ -4,7 +4,8 @@ require_relative 'fixtures/classes' describe "IO#close_read" do before :each do - @io = IO.popen 'cat', "r+" + cmd = platform_is(:windows) ? 'rem' : 'cat' + @io = IO.popen cmd, "r+" @path = tmp('io.close.txt') end diff --git a/spec/ruby/core/io/close_spec.rb b/spec/ruby/core/io/close_spec.rb index eb560eaf67..3a44cc8b17 100644 --- a/spec/ruby/core/io/close_spec.rb +++ b/spec/ruby/core/io/close_spec.rb @@ -44,6 +44,12 @@ describe "IO#close" do @io.close.should be_nil end + it "does not call the #flush method but flushes the stream internally" do + @io.should_not_receive(:flush) + @io.close + @io.should.closed? + end + it 'raises an IOError with a clear message' do matching_exception = nil diff --git a/spec/ruby/core/io/close_write_spec.rb b/spec/ruby/core/io/close_write_spec.rb index 14835e4e2c..70610a3e9d 100644 --- a/spec/ruby/core/io/close_write_spec.rb +++ b/spec/ruby/core/io/close_write_spec.rb @@ -3,7 +3,8 @@ require_relative 'fixtures/classes' describe "IO#close_write" do before :each do - @io = IO.popen 'cat', 'r+' + cmd = platform_is(:windows) ? 'rem' : 'cat' + @io = IO.popen cmd, 'r+' @path = tmp('io.close.txt') end @@ -48,12 +49,15 @@ describe "IO#close_write" do io.should.closed? end - it "flushes and closes the write stream" do - @io.puts '12345' + # Windows didn't have command like cat + platform_is_not :windows do + it "flushes and closes the write stream" do + @io.puts '12345' - @io.close_write + @io.close_write - @io.read.should == "12345\n" + @io.read.should == "12345\n" + end end it "does nothing on closed stream" do diff --git a/spec/ruby/core/io/codepoints_spec.rb b/spec/ruby/core/io/codepoints_spec.rb deleted file mode 100644 index 04c115dd3f..0000000000 --- a/spec/ruby/core/io/codepoints_spec.rb +++ /dev/null @@ -1,38 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'fixtures/classes' -require_relative 'shared/codepoints' - -ruby_version_is ''...'3.0' do - - # See redmine #1667 - describe "IO#codepoints" do - before :each do - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - end - - it_behaves_like :io_codepoints, :codepoints - end - - describe "IO#codepoints" do - before :each do - @io = IOSpecs.io_fixture "lines.txt" - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - @io.close unless @io.closed? - end - - it "calls the given block" do - r = [] - @io.codepoints { |c| r << c } - r[24].should == 232 - r.last.should == 10 - end - end -end diff --git a/spec/ruby/core/io/copy_stream_spec.rb b/spec/ruby/core/io/copy_stream_spec.rb index df9c5c7390..ffa2ea992c 100644 --- a/spec/ruby/core/io/copy_stream_spec.rb +++ b/spec/ruby/core/io/copy_stream_spec.rb @@ -69,9 +69,12 @@ describe :io_copy_stream_to_io, shared: true do end it "raises an IOError if the destination IO is not open for writing" do - @to_io.close - @to_io = new_io @to_name, "r" - -> { IO.copy_stream @object.from, @to_io }.should raise_error(IOError) + to_io = new_io __FILE__, "r" + begin + -> { IO.copy_stream @object.from, to_io }.should raise_error(IOError) + ensure + to_io.close + end end it "does not close the destination IO" do @@ -109,7 +112,8 @@ describe "IO.copy_stream" do end after :each do - rm_r @to_name, @from_bigfile + rm_r @to_name if @to_name + rm_r @from_bigfile end describe "from an IO" do @@ -164,6 +168,25 @@ describe "IO.copy_stream" do it_behaves_like :io_copy_stream_to_io, nil, IOSpecs::CopyStream it_behaves_like :io_copy_stream_to_io_with_offset, nil, IOSpecs::CopyStream end + + describe "to a Tempfile" do + before :all do + require 'tempfile' + end + + before :each do + @to_io = Tempfile.new("rubyspec_copy_stream", encoding: Encoding::BINARY, mode: File::RDONLY) + @to_name = @to_io.path + end + + after :each do + @to_io.close! + @to_name = nil # do not rm_r it, already done by Tempfile#close! + end + + it_behaves_like :io_copy_stream_to_io, nil, IOSpecs::CopyStream + it_behaves_like :io_copy_stream_to_io_with_offset, nil, IOSpecs::CopyStream + end end describe "from a file name" do @@ -277,10 +300,8 @@ describe "IO.copy_stream" do @io.should_not_receive(:pos) IO.copy_stream(@io, @to_name) end - end - describe "with a destination that does partial reads" do before do @from_out, @from_in = IO.pipe diff --git a/spec/ruby/core/io/eof_spec.rb b/spec/ruby/core/io/eof_spec.rb index 315345d942..b4850df437 100644 --- a/spec/ruby/core/io/eof_spec.rb +++ b/spec/ruby/core/io/eof_spec.rb @@ -76,7 +76,7 @@ describe "IO#eof?" do end it "returns true on one-byte stream after single-byte read" do - File.open(File.dirname(__FILE__) + '/fixtures/one_byte.txt') { |one_byte| + File.open(__dir__ + '/fixtures/one_byte.txt') { |one_byte| one_byte.read(1) one_byte.should.eof? } diff --git a/spec/ruby/core/io/external_encoding_spec.rb b/spec/ruby/core/io/external_encoding_spec.rb index c1b727d930..2fcf1c7218 100644 --- a/spec/ruby/core/io/external_encoding_spec.rb +++ b/spec/ruby/core/io/external_encoding_spec.rb @@ -94,8 +94,12 @@ describe "IO#external_encoding" do rm_r @name end - it "raises an IOError on closed stream" do - -> { IOSpecs.closed_io.external_encoding }.should raise_error(IOError) + ruby_version_is '3.1' do + it "can be retrieved from a closed stream" do + io = IOSpecs.io_fixture("lines.txt", "r") + io.close + io.external_encoding.should equal(Encoding.default_external) + end end describe "with 'r' mode" do diff --git a/spec/ruby/core/io/fixtures/classes.rb b/spec/ruby/core/io/fixtures/classes.rb index 5d81d5fcd9..204a2a101b 100644 --- a/spec/ruby/core/io/fixtures/classes.rb +++ b/spec/ruby/core/io/fixtures/classes.rb @@ -7,6 +7,18 @@ module IOSpecs class SubIO < IO end + class SubIOWithRedefinedNew < IO + def self.new(...) + ScratchPad << :redefined_new_called + super + end + + def initialize(...) + ScratchPad << :call_original_initialize + super + end + end + def self.collector Proc.new { |x| ScratchPad << x } end @@ -108,6 +120,14 @@ module IOSpecs "linha ", "cinco.\nHere ", "is ", "line ", "six.\n" ] end + def self.lines_space_separator_without_trailing_spaces + [ "Voici", "la", "ligne", "une.\nQui", + "\303\250", "la", "linea", "due.\n\n\nAqu\303\255", + "est\303\241", "la", "l\303\255nea", "tres.\nHier", + "ist", "Zeile", "vier.\n\nEst\303\241", "aqui", "a", + "linha", "cinco.\nHere", "is", "line", "six.\n" ] + end + def self.lines_arbitrary_separator [ "Voici la ligne une.\nQui \303\250", " la linea due.\n\n\nAqu\303\255 est\303\241 la l\303\255nea tres.\nHier ist Zeile vier.\n\nEst\303\241 aqui a linha cinco.\nHere is line six.\n" ] @@ -119,6 +139,12 @@ module IOSpecs "Est\303\241 aqui a linha cinco.\nHere is line six.\n" ] end + def self.paragraphs_without_trailing_new_line_characters + [ "Voici la ligne une.\nQui \303\250 la linea due.", + "Aqu\303\255 est\303\241 la l\303\255nea tres.\nHier ist Zeile vier.", + "Est\303\241 aqui a linha cinco.\nHere is line six.\n" ] + end + # Creates an IO instance for an existing fixture file. The # file should obviously not be deleted. def self.io_fixture(name, mode = "r:utf-8") diff --git a/spec/ruby/core/io/flush_spec.rb b/spec/ruby/core/io/flush_spec.rb index 8de373a0bd..f7d5ba77fc 100644 --- a/spec/ruby/core/io/flush_spec.rb +++ b/spec/ruby/core/io/flush_spec.rb @@ -19,11 +19,11 @@ describe "IO#flush" do end end - # [ruby-core:90895] MJIT worker may leave fd open in a forked child. - # For instance, MJIT creates a worker before @r.close with fork(), @r.close happens, - # and the MJIT worker keeps the pipe open until the worker execve(). - # TODO: consider acquiring GVL from MJIT worker. - guard_not -> { defined?(RubyVM::JIT) && RubyVM::JIT.enabled? } do + # [ruby-core:90895] RJIT worker may leave fd open in a forked child. + # For instance, RJIT creates a worker before @r.close with fork(), @r.close happens, + # and the RJIT worker keeps the pipe open until the worker execve(). + # TODO: consider acquiring GVL from RJIT worker. + guard_not -> { defined?(RubyVM::RJIT) && RubyVM::RJIT.enabled? } do it "raises Errno::EPIPE if sync=false and the read end is closed" do @w.sync = false @w.write "foo" diff --git a/spec/ruby/core/io/foreach_spec.rb b/spec/ruby/core/io/foreach_spec.rb index c2276cf544..c361d27879 100644 --- a/spec/ruby/core/io/foreach_spec.rb +++ b/spec/ruby/core/io/foreach_spec.rb @@ -20,7 +20,10 @@ describe "IO.foreach" do platform_is :windows do cmd = "|cmd.exe /C echo hello&echo line2" end - IO.foreach(cmd) { |l| ScratchPad << l } + + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + IO.foreach(cmd) { |l| ScratchPad << l } + end ScratchPad.recorded.should == ["hello\n", "line2\n"] end @@ -28,7 +31,9 @@ describe "IO.foreach" do it "gets data from a fork when passed -" do parent_pid = $$ - IO.foreach("|-") { |l| ScratchPad << l } + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + IO.foreach("|-") { |l| ScratchPad << l } + end if $$ == parent_pid ScratchPad.recorded.should == ["hello\n", "from a fork\n"] @@ -39,6 +44,16 @@ describe "IO.foreach" do end end end + + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19630 + it "warns about deprecation given a path with a pipe" do + cmd = "|echo ok" + -> { + IO.foreach(cmd).to_a + }.should complain(/IO process creation with a leading '\|'/) + end + end end end diff --git a/spec/ruby/core/io/getbyte_spec.rb b/spec/ruby/core/io/getbyte_spec.rb index 6ba8f0a3e0..b4351160e6 100644 --- a/spec/ruby/core/io/getbyte_spec.rb +++ b/spec/ruby/core/io/getbyte_spec.rb @@ -40,3 +40,19 @@ describe "IO#getbyte" do @io.getbyte.should == nil end end + +describe "IO#getbyte" do + before :each do + @name = tmp("io_getbyte.txt") + @io = new_io(@name, 'w') + end + + after :each do + @io.close if @io + rm_r @name if @name + end + + it "raises an IOError if the stream is not readable" do + -> { @io.getbyte }.should raise_error(IOError) + end +end diff --git a/spec/ruby/core/io/gets_spec.rb b/spec/ruby/core/io/gets_spec.rb index a3cd180b66..ca64bf860e 100644 --- a/spec/ruby/core/io/gets_spec.rb +++ b/spec/ruby/core/io/gets_spec.rb @@ -24,6 +24,12 @@ describe "IO#gets" do end end + it "sets $_ to nil after the last line has been read" do + while @io.gets + end + $_.should be_nil + end + it "returns nil if called at the end of the stream" do IOSpecs.lines.length.times { @io.gets } @io.gets.should == nil @@ -38,14 +44,6 @@ describe "IO#gets" do IOSpecs.lines.each { |line| line.should == @io.gets } end - ruby_version_is ''...'2.7' do - it "returns tainted strings" do - while line = @io.gets - line.should.tainted? - end - end - end - it "updates lineno with each invocation" do while @io.gets @io.lineno.should == @count += 1 @@ -64,14 +62,6 @@ describe "IO#gets" do @io.gets(nil).should == IOSpecs.lines.join("") end - ruby_version_is ''...'2.7' do - it "returns tainted strings" do - while line = @io.gets(nil) - line.should.tainted? - end - end - end - it "updates lineno with each invocation" do while @io.gets(nil) @io.lineno.should == @count += 1 @@ -100,14 +90,6 @@ describe "IO#gets" do @io.gets.should == IOSpecs.lines[4] end - ruby_version_is ''...'2.7' do - it "returns tainted strings" do - while line = @io.gets("") - line.should.tainted? - end - end - end - it "updates lineno with each invocation" do while @io.gets("") @io.lineno.should == @count += 1 @@ -126,14 +108,6 @@ describe "IO#gets" do @io.gets("la linea").should == "Voici la ligne une.\nQui \303\250 la linea" end - ruby_version_is ''...'2.7' do - it "returns tainted strings" do - while line = @io.gets("la") - line.should.tainted? - end - end - end - it "updates lineno with each invocation" do while (@io.gets("la")) @io.lineno.should == @count += 1 @@ -145,12 +119,49 @@ describe "IO#gets" do $..should == @count += 1 end end + + describe "that consists of multiple bytes" do + platform_is_not :windows do + it "should match the separator even if the buffer is filled over successive reads" do + IO.pipe do |read, write| + + # Write part of the string with the separator split between two write calls. We want + # the read to intertwine such that when the read starts the full data isn't yet + # available in the buffer. + write.write("Aquà está la lÃnea tres\r\n") + + t = Thread.new do + # Continue reading until the separator is encountered or the pipe is closed. + read.gets("\r\n\r\n") + end + + # Write the other half of the separator, which should cause the `gets` call to now + # match. Explicitly close the pipe for good measure so a bug in `gets` doesn't block forever. + Thread.pass until t.stop? + + write.write("\r\nelse\r\n\r\n") + write.close + + t.value.bytes.should == "Aquà está la lÃnea tres\r\n\r\n".bytes + read.read(8).bytes.should == "else\r\n\r\n".bytes + end + end + end + end end describe "when passed chomp" do it "returns the first line without a trailing newline character" do @io.gets(chomp: true).should == IOSpecs.lines_without_newline_characters[0] end + + it "raises exception when options passed as Hash" do + -> { @io.gets({ chomp: true }) }.should raise_error(TypeError) + + -> { + @io.gets("\n", 1, { chomp: true }) + }.should raise_error(ArgumentError, "wrong number of arguments (given 3, expected 0..2)") + end end end @@ -232,6 +243,16 @@ describe "IO#gets" do it "reads all bytes when pass a separator and reading more than all bytes" do @io.gets("\t", 100).should == "one\n\ntwo\n\nthree\nfour\n" end + + it "returns empty string when 0 passed as a limit" do + @io.gets(0).should == "" + @io.gets(nil, 0).should == "" + @io.gets("", 0).should == "" + end + + it "does not accept limit that doesn't fit in a C off_t" do + -> { @io.gets(2**128) }.should raise_error(RangeError) + end end describe "IO#gets" do @@ -317,11 +338,23 @@ describe "IO#gets" do @io.gets.encoding.should == Encoding::BINARY end - it "transcodes to internal encoding if the IO object's external encoding is BINARY" do - Encoding.default_external = Encoding::BINARY - Encoding.default_internal = Encoding::UTF_8 - @io = new_io @name, 'r' - @io.set_encoding Encoding::BINARY, Encoding::UTF_8 - @io.gets.encoding.should == Encoding::UTF_8 + ruby_version_is ''...'3.3' do + it "transcodes to internal encoding if the IO object's external encoding is BINARY" do + Encoding.default_external = Encoding::BINARY + Encoding.default_internal = Encoding::UTF_8 + @io = new_io @name, 'r' + @io.set_encoding Encoding::BINARY, Encoding::UTF_8 + @io.gets.encoding.should == Encoding::UTF_8 + end + end + + ruby_version_is '3.3' do + it "ignores the internal encoding if the IO object's external encoding is BINARY" do + Encoding.default_external = Encoding::BINARY + Encoding.default_internal = Encoding::UTF_8 + @io = new_io @name, 'r' + @io.set_encoding Encoding::BINARY, Encoding::UTF_8 + @io.gets.encoding.should == Encoding::BINARY + end end end diff --git a/spec/ruby/core/io/initialize_spec.rb b/spec/ruby/core/io/initialize_spec.rb index ba5bc117b7..026252a13d 100644 --- a/spec/ruby/core/io/initialize_spec.rb +++ b/spec/ruby/core/io/initialize_spec.rb @@ -27,6 +27,17 @@ describe "IO#initialize" do @io.fileno.should == fd end + it "accepts options as keyword arguments" do + fd = new_fd @name, "w:utf-8" + + @io.send(:initialize, fd, "w", flags: File::CREAT) + @io.fileno.should == fd + + -> { + @io.send(:initialize, fd, "w", {flags: File::CREAT}) + }.should raise_error(ArgumentError, "wrong number of arguments (given 3, expected 1..2)") + end + it "raises a TypeError when passed an IO" do -> { @io.send :initialize, STDOUT, 'w' }.should raise_error(TypeError) end diff --git a/spec/ruby/core/io/internal_encoding_spec.rb b/spec/ruby/core/io/internal_encoding_spec.rb index 210e969c7b..60afaf2ebd 100644 --- a/spec/ruby/core/io/internal_encoding_spec.rb +++ b/spec/ruby/core/io/internal_encoding_spec.rb @@ -113,8 +113,12 @@ describe "IO#internal_encoding" do Encoding.default_internal = @internal end - it "raises an IOError on closed stream" do - -> { IOSpecs.closed_io.internal_encoding }.should raise_error(IOError) + ruby_version_is '3.1' do + it "can be retrieved from a closed stream" do + io = IOSpecs.io_fixture("lines.txt", "r") + io.close + io.internal_encoding.should equal(Encoding.default_internal) + end end describe "with 'r' mode" do diff --git a/spec/ruby/core/io/ioctl_spec.rb b/spec/ruby/core/io/ioctl_spec.rb index 8dcd9eb2c6..3f7b5ad5d7 100644 --- a/spec/ruby/core/io/ioctl_spec.rb +++ b/spec/ruby/core/io/ioctl_spec.rb @@ -12,7 +12,7 @@ describe "IO#ioctl" do guard -> { RUBY_PLATFORM.include?("86") } do # x86 / x86_64 it "resizes an empty String to match the output size" do File.open(__FILE__, 'r') do |f| - buffer = '' + buffer = +'' # FIONREAD in /usr/include/asm-generic/ioctls.h f.ioctl 0x541B, buffer buffer.unpack('I').first.should be_kind_of(Integer) diff --git a/spec/ruby/core/io/lineno_spec.rb b/spec/ruby/core/io/lineno_spec.rb index 99266ecca1..e82cdd9f17 100644 --- a/spec/ruby/core/io/lineno_spec.rb +++ b/spec/ruby/core/io/lineno_spec.rb @@ -26,7 +26,8 @@ describe "IO#lineno" do end it "raises an IOError on a duplexed stream with the read side closed" do - IO.popen('cat', 'r+') do |p| + cmd = platform_is(:windows) ? 'rem' : 'cat' + IO.popen(cmd, 'r+') do |p| p.close_read -> { p.lineno }.should raise_error(IOError) end @@ -70,7 +71,8 @@ describe "IO#lineno=" do end it "raises an IOError on a duplexed stream with the read side closed" do - IO.popen('cat', 'r+') do |p| + cmd = platform_is(:windows) ? 'rem' : 'cat' + IO.popen(cmd, 'r+') do |p| p.close_read -> { p.lineno = 0 }.should raise_error(IOError) end @@ -92,8 +94,13 @@ describe "IO#lineno=" do @io.lineno.should == 92233 end - it "raises TypeError on nil argument" do - -> { @io.lineno = nil }.should raise_error(TypeError) + it "raises TypeError if cannot convert argument to Integer implicitly" do + -> { @io.lineno = "1" }.should raise_error(TypeError, 'no implicit conversion of String into Integer') + -> { @io.lineno = nil }.should raise_error(TypeError, 'no implicit conversion from nil to integer') + end + + it "does not accept Integers that don't fit in a C int" do + -> { @io.lineno = 2**32 }.should raise_error(RangeError) end it "sets the current line number to the given value" do diff --git a/spec/ruby/core/io/lines_spec.rb b/spec/ruby/core/io/lines_spec.rb deleted file mode 100644 index 5b29a1d07e..0000000000 --- a/spec/ruby/core/io/lines_spec.rb +++ /dev/null @@ -1,46 +0,0 @@ -# -*- encoding: utf-8 -*- -require_relative '../../spec_helper' -require_relative 'fixtures/classes' - -ruby_version_is ''...'3.0' do - describe "IO#lines" do - before :each do - @io = IOSpecs.io_fixture "lines.txt" - @verbose, $VERBOSE = $VERBOSE, nil - end - - after :each do - $VERBOSE = @verbose - @io.close if @io - end - - it "returns an Enumerator" do - @io.lines.should be_an_instance_of(Enumerator) - end - - describe "when no block is given" do - it "returns an Enumerator" do - @io.lines.should be_an_instance_of(Enumerator) - end - - describe "returned Enumerator" do - describe "size" do - it "should return nil" do - @io.lines.size.should == nil - end - end - end - end - - it "returns a line when accessed" do - enum = @io.lines - enum.first.should == IOSpecs.lines[0] - end - - it "yields each line to the passed block" do - ScratchPad.record [] - @io.lines { |s| ScratchPad << s } - ScratchPad.recorded.should == IOSpecs.lines - end - end -end diff --git a/spec/ruby/core/io/new_spec.rb b/spec/ruby/core/io/new_spec.rb index 3597098caf..979ac0efcb 100644 --- a/spec/ruby/core/io/new_spec.rb +++ b/spec/ruby/core/io/new_spec.rb @@ -1,8 +1,16 @@ require_relative '../../spec_helper' require_relative 'shared/new' +# NOTE: should be synchronized with library/stringio/initialize_spec.rb + describe "IO.new" do it_behaves_like :io_new, :new + + it "does not use the given block and warns to use IO::open" do + -> { + @io = IO.send(@method, @fd) { raise } + }.should complain(/warning: IO::new\(\) does not take block; use IO::open\(\) instead/) + end end describe "IO.new" do diff --git a/spec/ruby/core/io/nonblock_spec.rb b/spec/ruby/core/io/nonblock_spec.rb new file mode 100644 index 0000000000..99dc0cafd0 --- /dev/null +++ b/spec/ruby/core/io/nonblock_spec.rb @@ -0,0 +1,48 @@ +require_relative '../../spec_helper' + +platform_is_not :windows do + describe "IO#nonblock?" do + before :all do + require 'io/nonblock' + end + + it "returns false for a file by default" do + File.open(__FILE__) do |f| + f.nonblock?.should == false + end + end + + it "returns true for pipe by default" do + r, w = IO.pipe + begin + r.nonblock?.should == true + w.nonblock?.should == true + ensure + r.close + w.close + end + end + + it "returns true for socket by default" do + require 'socket' + TCPServer.open(0) do |socket| + socket.nonblock?.should == true + end + end + end + + describe "IO#nonblock=" do + before :all do + require 'io/nonblock' + end + + it "changes the IO to non-blocking mode" do + File.open(__FILE__) do |f| + f.nonblock = true + f.nonblock?.should == true + f.nonblock = false + f.nonblock?.should == false + end + end + end +end diff --git a/spec/ruby/core/io/open_spec.rb b/spec/ruby/core/io/open_spec.rb index 94df5a5ef6..d151da9ce5 100644 --- a/spec/ruby/core/io/open_spec.rb +++ b/spec/ruby/core/io/open_spec.rb @@ -37,6 +37,19 @@ describe "IO.open" do ScratchPad.recorded.should == :called end + it "propagate an exception in the block after calling #close" do + -> do + IO.open(@fd, "w") do |io| + IOSpecs.io_mock(io, :close) do + super() + ScratchPad.record :called + end + raise Exception + end + end.should raise_error(Exception) + ScratchPad.recorded.should == :called + end + it "propagates an exception raised by #close that is not a StandardError" do -> do IO.open(@fd, "w") do |io| @@ -63,7 +76,7 @@ describe "IO.open" do ScratchPad.recorded.should == :called end - it "does not propagate a IOError with 'closed stream' message raised by #close" do + it "does not propagate an IOError with 'closed stream' message raised by #close" do IO.open(@fd, "w") do |io| IOSpecs.io_mock(io, :close) do super() @@ -74,7 +87,7 @@ describe "IO.open" do ScratchPad.recorded.should == :called end - it "does not set last error when a IOError with 'closed stream' raised by #close" do + it "does not set last error when an IOError with 'closed stream' raised by #close" do IO.open(@fd, "w") do |io| IOSpecs.io_mock(io, :close) do super() diff --git a/spec/ruby/core/io/path_spec.rb b/spec/ruby/core/io/path_spec.rb new file mode 100644 index 0000000000..8145c32f39 --- /dev/null +++ b/spec/ruby/core/io/path_spec.rb @@ -0,0 +1,14 @@ +require_relative '../../spec_helper' + +describe "IO#path" do + ruby_version_is "3.2" do + it "returns the path of the file associated with the IO object" do + path = tmp("io_path.txt") + File.open(path, "w") do |file| + IO.new(file.fileno, path: file.path, autoclose: false).path.should == file.path + end + ensure + File.unlink(path) + end + end +end diff --git a/spec/ruby/core/io/pipe_spec.rb b/spec/ruby/core/io/pipe_spec.rb index 2f2cf06f4d..aee0d9003f 100644 --- a/spec/ruby/core/io/pipe_spec.rb +++ b/spec/ruby/core/io/pipe_spec.rb @@ -25,6 +25,17 @@ describe "IO.pipe" do @r.should be_an_instance_of(IOSpecs::SubIO) @w.should be_an_instance_of(IOSpecs::SubIO) end + + it "does not use IO.new method to create pipes and allows its overriding" do + ScratchPad.record [] + + # so redefined .new is not called, but original #initialize is + @r, @w = IOSpecs::SubIOWithRedefinedNew.pipe + ScratchPad.recorded.should == [:call_original_initialize, :call_original_initialize] # called 2 times - for each pipe (r and w) + + @r.should be_an_instance_of(IOSpecs::SubIOWithRedefinedNew) + @w.should be_an_instance_of(IOSpecs::SubIOWithRedefinedNew) + end end describe "IO.pipe" do diff --git a/spec/ruby/core/io/pread_spec.rb b/spec/ruby/core/io/pread_spec.rb index 43071d6a31..28afc80e5c 100644 --- a/spec/ruby/core/io/pread_spec.rb +++ b/spec/ruby/core/io/pread_spec.rb @@ -1,7 +1,7 @@ # -*- encoding: utf-8 -*- require_relative '../../spec_helper' -platform_is_not :windows do +guard -> { platform_is_not :windows or ruby_version_is "3.3" } do describe "IO#pread" do before :each do @fname = tmp("io_pread.txt") @@ -21,16 +21,93 @@ platform_is_not :windows do end it "accepts a length, an offset, and an output buffer" do - buffer = "foo" + buffer = +"foo" @file.pread(3, 4, buffer) buffer.should == "567" end + it "shrinks the buffer in case of less bytes read" do + buffer = +"foo" + @file.pread(1, 0, buffer) + buffer.should == "1" + end + + it "grows the buffer in case of more bytes read" do + buffer = +"foo" + @file.pread(5, 0, buffer) + buffer.should == "12345" + end + it "does not advance the file pointer" do @file.pread(4, 0).should == "1234" @file.read.should == "1234567890" end + it "ignores the current offset" do + @file.pos = 3 + @file.pread(4, 0).should == "1234" + end + + it "returns an empty string for maxlen = 0" do + @file.pread(0, 4).should == "" + end + + it "ignores the offset for maxlen = 0, even if it is out of file bounds" do + @file.pread(0, 400).should == "" + end + + it "does not reset the buffer when reading with maxlen = 0" do + buffer = +"foo" + @file.pread(0, 4, buffer) + buffer.should == "foo" + + @file.pread(0, 400, buffer) + buffer.should == "foo" + end + + it "converts maxlen to Integer using #to_int" do + maxlen = mock('maxlen') + maxlen.should_receive(:to_int).and_return(4) + @file.pread(maxlen, 0).should == "1234" + end + + it "converts offset to Integer using #to_int" do + offset = mock('offset') + offset.should_receive(:to_int).and_return(0) + @file.pread(4, offset).should == "1234" + end + + it "converts a buffer to String using to_str" do + buffer = mock('buffer') + buffer.should_receive(:to_str).at_least(1).and_return(+"foo") + @file.pread(4, 0, buffer) + buffer.should_not.is_a?(String) + buffer.to_str.should == "1234" + end + + it "raises TypeError if maxlen is not an Integer and cannot be coerced into Integer" do + maxlen = Object.new + -> { @file.pread(maxlen, 0) }.should raise_error(TypeError, 'no implicit conversion of Object into Integer') + end + + it "raises TypeError if offset is not an Integer and cannot be coerced into Integer" do + offset = Object.new + -> { @file.pread(4, offset) }.should raise_error(TypeError, 'no implicit conversion of Object into Integer') + end + + it "raises ArgumentError for negative values of maxlen" do + -> { @file.pread(-4, 0) }.should raise_error(ArgumentError, 'negative string size (or size too big)') + end + + it "raised Errno::EINVAL for negative values of offset" do + -> { @file.pread(4, -1) }.should raise_error(Errno::EINVAL, /Invalid argument/) + end + + it "raises TypeError if the buffer is not a String and cannot be coerced into String" do + buffer = Object.new + -> { @file.pread(4, 0, buffer) }.should raise_error(TypeError, 'no implicit conversion of Object into String') + end + it "raises EOFError if end-of-file is reached" do -> { @file.pread(1, 10) }.should raise_error(EOFError) end diff --git a/spec/ruby/core/io/print_spec.rb b/spec/ruby/core/io/print_spec.rb index 04e971ef6d..085852024c 100644 --- a/spec/ruby/core/io/print_spec.rb +++ b/spec/ruby/core/io/print_spec.rb @@ -3,16 +3,27 @@ require_relative 'fixtures/classes' describe "IO#print" do before :each do - @old_separator = $\ - suppress_warning {$\ = '->'} + @old_record_separator = $\ + @old_field_separator = $, + suppress_warning { + $\ = '->' + $, = '^^' + } @name = tmp("io_print") end after :each do - suppress_warning {$\ = @old_separator} + suppress_warning { + $\ = @old_record_separator + $, = @old_field_separator + } rm_r @name end + it "returns nil" do + touch(@name) { |f| f.print.should be_nil } + end + it "writes $_.to_s followed by $\\ (if any) to the stream if no arguments given" do o = mock('o') o.should_receive(:to_s).and_return("mockmockmock") @@ -38,13 +49,15 @@ describe "IO#print" do IO.read(@name).should == "hello#{$\}" end - it "writes each obj.to_s to the stream and appends $\\ (if any) given multiple objects" do + it "writes each obj.to_s to the stream separated by $, (if any) and appends $\\ (if any) given multiple objects" do o, o2 = Object.new, Object.new def o.to_s(); 'o'; end def o2.to_s(); 'o2'; end - touch(@name) { |f| f.print(o, o2) } - IO.read(@name).should == "#{o.to_s}#{o2.to_s}#{$\}" + suppress_warning { + touch(@name) { |f| f.print(o, o2) } + } + IO.read(@name).should == "#{o.to_s}#{$,}#{o2.to_s}#{$\}" end it "raises IOError on closed stream" do diff --git a/spec/ruby/core/io/puts_spec.rb b/spec/ruby/core/io/puts_spec.rb index 9a708fffef..9ed343c94c 100644 --- a/spec/ruby/core/io/puts_spec.rb +++ b/spec/ruby/core/io/puts_spec.rb @@ -6,7 +6,7 @@ describe "IO#puts" do @before_separator = $/ @name = tmp("io_puts.txt") @io = new_io @name - ScratchPad.record "" + ScratchPad.record(+"") def @io.write(str) ScratchPad << str end diff --git a/spec/ruby/core/io/pwrite_spec.rb b/spec/ruby/core/io/pwrite_spec.rb index fe29d1e1f6..2bc508b37d 100644 --- a/spec/ruby/core/io/pwrite_spec.rb +++ b/spec/ruby/core/io/pwrite_spec.rb @@ -1,7 +1,7 @@ # -*- encoding: utf-8 -*- require_relative '../../spec_helper' -platform_is_not :windows do +guard -> { platform_is_not :windows or ruby_version_is "3.3" } do describe "IO#pwrite" do before :each do @fname = tmp("io_pwrite.txt") @@ -28,16 +28,42 @@ platform_is_not :windows do @file.pread(6, 0).should == "foobar" end + it "calls #to_s on the object to be written" do + object = mock("to_s") + object.should_receive(:to_s).and_return("foo") + @file.pwrite(object, 0) + @file.pread(3, 0).should == "foo" + end + + it "calls #to_int on the offset" do + offset = mock("to_int") + offset.should_receive(:to_int).and_return(2) + @file.pwrite("foo", offset) + @file.pread(3, 2).should == "foo" + end + it "raises IOError when file is not open in write mode" do File.open(@fname, "r") do |file| - -> { file.pwrite("foo", 1) }.should raise_error(IOError) + -> { file.pwrite("foo", 1) }.should raise_error(IOError, "not opened for writing") end end it "raises IOError when file is closed" do file = File.open(@fname, "w+") file.close - -> { file.pwrite("foo", 1) }.should raise_error(IOError) + -> { file.pwrite("foo", 1) }.should raise_error(IOError, "closed stream") + end + + it "raises a NoMethodError if object does not respond to #to_s" do + -> { + @file.pwrite(BasicObject.new, 0) + }.should raise_error(NoMethodError, /undefined method [`']to_s'/) + end + + it "raises a TypeError if the offset cannot be converted to an Integer" do + -> { + @file.pwrite("foo", Object.new) + }.should raise_error(TypeError, "no implicit conversion of Object into Integer") end end end diff --git a/spec/ruby/core/io/read_nonblock_spec.rb b/spec/ruby/core/io/read_nonblock_spec.rb index e50531d336..51e7cd6bd2 100644 --- a/spec/ruby/core/io/read_nonblock_spec.rb +++ b/spec/ruby/core/io/read_nonblock_spec.rb @@ -55,6 +55,27 @@ describe "IO#read_nonblock" do @read.read_nonblock(4).should == "hell" end + it "reads after ungetc with data in the buffer" do + @write.write("foobar") + @read.set_encoding( + 'utf-8', universal_newline: false + ) + c = @read.getc + @read.ungetc(c) + @read.read_nonblock(3).should == "foo" + @read.read_nonblock(3).should == "bar" + end + + it "raises an exception after ungetc with data in the buffer and character conversion enabled" do + @write.write("foobar") + @read.set_encoding( + 'utf-8', universal_newline: true + ) + c = @read.getc + @read.ungetc(c) + -> { @read.read_nonblock(3).should == "foo" }.should raise_error(IOError) + end + it "returns less data if that is all that is available" do @write << "hello" @read.read_nonblock(10).should == "hello" @@ -70,20 +91,39 @@ describe "IO#read_nonblock" do @read.read_nonblock(1).should == "1" end + it "raises ArgumentError when length is less than 0" do + -> { @read.read_nonblock(-1) }.should raise_error(ArgumentError) + end + it "reads into the passed buffer" do - buffer = "" + buffer = +"" @write.write("1") @read.read_nonblock(1, buffer) buffer.should == "1" end it "returns the passed buffer" do - buffer = "" + buffer = +"" @write.write("1") output = @read.read_nonblock(1, buffer) output.should equal(buffer) end + it "discards the existing buffer content upon successful read" do + buffer = +"existing content" + @write.write("hello world") + @write.close + @read.read_nonblock(11, buffer) + buffer.should == "hello world" + end + + it "discards the existing buffer content upon error" do + buffer = +"existing content" + @write.close + -> { @read.read_nonblock(1, buffer) }.should raise_error(EOFError) + buffer.should be_empty + end + it "raises IOError on closed stream" do -> { IOSpecs.closed_io.read_nonblock(5) }.should raise_error(IOError) end @@ -96,4 +136,13 @@ describe "IO#read_nonblock" do -> { @read.read_nonblock(5) }.should raise_error(EOFError) end + + it "preserves the encoding of the given buffer" do + buffer = ''.encode(Encoding::ISO_8859_1) + @write.write("abc") + @write.close + @read.read_nonblock(10, buffer) + + buffer.encoding.should == Encoding::ISO_8859_1 + end end diff --git a/spec/ruby/core/io/read_spec.rb b/spec/ruby/core/io/read_spec.rb index 841e693f37..eb3652e692 100644 --- a/spec/ruby/core/io/read_spec.rb +++ b/spec/ruby/core/io/read_spec.rb @@ -23,6 +23,15 @@ describe "IO.read" do IO.read(p) end + # https://bugs.ruby-lang.org/issues/19354 + it "accepts options as keyword arguments" do + IO.read(@fname, 3, 0, mode: "r+").should == @contents[0, 3] + + -> { + IO.read(@fname, 3, 0, {mode: "r+"}) + }.should raise_error(ArgumentError, /wrong number of arguments/) + end + it "accepts an empty options Hash" do IO.read(@fname, **{}).should == @contents end @@ -55,6 +64,33 @@ describe "IO.read" do IO.read(@fname, mode: "a+").should == @contents end + platform_is_not :windows do + ruby_version_is ""..."3.3" do + it "uses an :open_args option" do + string = IO.read(@fname, nil, 0, open_args: ["r", nil, {encoding: Encoding::US_ASCII}]) + string.encoding.should == Encoding::US_ASCII + + string = IO.read(@fname, nil, 0, open_args: ["r", nil, {}]) + string.encoding.should == Encoding::UTF_8 + end + end + end + + it "disregards other options if :open_args is given" do + string = IO.read(@fname,mode: "w", encoding: Encoding::UTF_32LE, open_args: ["r", encoding: Encoding::UTF_8]) + string.encoding.should == Encoding::UTF_8 + end + + it "doesn't require mode to be specified in :open_args" do + string = IO.read(@fname, nil, 0, open_args: [{encoding: Encoding::US_ASCII}]) + string.encoding.should == Encoding::US_ASCII + end + + it "doesn't require mode to be specified in :open_args even if flags option passed" do + string = IO.read(@fname, nil, 0, open_args: [{encoding: Encoding::US_ASCII, flags: File::CREAT}]) + string.encoding.should == Encoding::US_ASCII + end + it "treats second nil argument as no length limit" do IO.read(@fname, nil).should == @contents IO.read(@fname, nil, 5).should == IO.read(@fname, @contents.length, 5) @@ -77,6 +113,15 @@ describe "IO.read" do IO.read(@fname, 1, 10).should == nil end + it "returns an empty string when reading zero bytes" do + IO.read(@fname, 0).should == '' + end + + it "returns a String in BINARY when passed a size" do + IO.read(@fname, 1).encoding.should == Encoding::BINARY + IO.read(@fname, 0).encoding.should == Encoding::BINARY + end + it "raises an Errno::ENOENT when the requested file does not exist" do rm_r @fname -> { IO.read @fname }.should raise_error(Errno::ENOENT) @@ -90,9 +135,18 @@ describe "IO.read" do -> { IO.read @fname, -1 }.should raise_error(ArgumentError) end - it "raises an Errno::EINVAL when not passed a valid offset" do - -> { IO.read @fname, 0, -1 }.should raise_error(Errno::EINVAL) - -> { IO.read @fname, -1, -1 }.should raise_error(Errno::EINVAL) + ruby_version_is ''...'3.3' do + it "raises an Errno::EINVAL when not passed a valid offset" do + -> { IO.read @fname, 0, -1 }.should raise_error(Errno::EINVAL) + -> { IO.read @fname, -1, -1 }.should raise_error(Errno::EINVAL) + end + end + + ruby_version_is '3.3' do + it "raises an ArgumentError when not passed a valid offset" do + -> { IO.read @fname, 0, -1 }.should raise_error(ArgumentError) + -> { IO.read @fname, -1, -1 }.should raise_error(ArgumentError) + end end it "uses the external encoding specified via the :external_encoding option" do @@ -104,6 +158,14 @@ describe "IO.read" do str = IO.read(@fname, encoding: Encoding::ISO_8859_1) str.encoding.should == Encoding::ISO_8859_1 end + + platform_is :windows do + it "reads the file in text mode" do + # 0x1A is CTRL+Z and is EOF in Windows text mode. + File.binwrite(@fname, "\x1Abbb") + IO.read(@fname).should.empty? + end + end end describe "IO.read from a pipe" do @@ -112,12 +174,19 @@ describe "IO.read from a pipe" do platform_is :windows do cmd = "|cmd.exe /C echo hello" end - IO.read(cmd).should == "hello\n" + + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + IO.read(cmd).should == "hello\n" + end end platform_is_not :windows do it "opens a pipe to a fork if the rest is -" do - str = IO.read("|-") + str = nil + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + str = IO.read("|-") + end + if str # parent str.should == "hello from child\n" else #child @@ -132,13 +201,18 @@ describe "IO.read from a pipe" do platform_is :windows do cmd = "|cmd.exe /C echo hello" end - IO.read(cmd, 1).should == "h" + + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + IO.read(cmd, 1).should == "h" + end end platform_is_not :windows do it "raises Errno::ESPIPE if passed an offset" do -> { - IO.read("|sh -c 'echo hello'", 1, 1) + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + IO.read("|sh -c 'echo hello'", 1, 1) + end }.should raise_error(Errno::ESPIPE) end end @@ -149,11 +223,23 @@ quarantine! do # The process tried to write to a nonexistent pipe. # once https://bugs.ruby-lang.org/issues/12230 is fixed. it "raises Errno::EINVAL if passed an offset" do -> { - IO.read("|cmd.exe /C echo hello", 1, 1) + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + IO.read("|cmd.exe /C echo hello", 1, 1) + end }.should raise_error(Errno::EINVAL) end end end + + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19630 + it "warns about deprecation given a path with a pipe" do + cmd = "|echo ok" + -> { + IO.read(cmd) + }.should complain(/IO process creation with a leading '\|'/) + end + end end describe "IO.read on an empty file" do @@ -197,21 +283,55 @@ describe "IO#read" do @io.read(4).should == '7890' end + it "treats first nil argument as no length limit" do + @io.read(nil).should == @contents + end + + it "raises an ArgumentError when not passed a valid length" do + -> { @io.read(-1) }.should raise_error(ArgumentError) + end + it "clears the output buffer if there is nothing to read" do @io.pos = 10 - buf = 'non-empty string' + buf = +'non-empty string' @io.read(10, buf).should == nil buf.should == '' + + buf = +'non-empty string' + + @io.read(nil, buf).should == "" + + buf.should == '' + + buf = +'non-empty string' + + @io.read(0, buf).should == "" + + buf.should == '' + end + + it "raise FrozenError if the output buffer is frozen" do + @io.read + -> { @io.read(0, 'frozen-string'.freeze) }.should raise_error(FrozenError) + -> { @io.read(1, 'frozen-string'.freeze) }.should raise_error(FrozenError) + -> { @io.read(nil, 'frozen-string'.freeze) }.should raise_error(FrozenError) + end + + ruby_bug "", ""..."3.3" do + it "raise FrozenError if the output buffer is frozen (2)" do + @io.read + -> { @io.read(1, ''.freeze) }.should raise_error(FrozenError) + end end it "consumes zero bytes when reading zero bytes" do @io.read(0).should == '' @io.pos.should == 0 - @io.getc.chr.should == '1' + @io.getc.should == '1' end it "is at end-of-file when everything has been read" do @@ -224,46 +344,53 @@ describe "IO#read" do end it "places the specified number of bytes in the buffer" do - buf = "" + buf = +"" @io.read 5, buf buf.should == "12345" end it "expands the buffer when too small" do - buf = "ABCDE" + buf = +"ABCDE" @io.read nil, buf buf.should == @contents end it "overwrites the buffer" do - buf = "ABCDEFGHIJ" + buf = +"ABCDEFGHIJ" @io.read nil, buf buf.should == @contents end it "truncates the buffer when too big" do - buf = "ABCDEFGHIJKLMNO" + buf = +"ABCDEFGHIJKLMNO" @io.read nil, buf buf.should == @contents @io.rewind - buf = "ABCDEFGHIJKLMNO" + buf = +"ABCDEFGHIJKLMNO" @io.read 5, buf buf.should == @contents[0..4] end it "returns the given buffer" do - buf = "" + buf = +"" @io.read(nil, buf).should equal buf end + it "returns the given buffer when there is nothing to read" do + buf = +"" + + @io.read + @io.read(nil, buf).should equal buf + end + it "coerces the second argument to string and uses it as a buffer" do - buf = "ABCDE" + buf = +"ABCDE" obj = mock("buff") obj.should_receive(:to_str).any_number_of_times.and_return(buf) @@ -304,6 +431,9 @@ describe "IO#read" do -> { IOSpecs.closed_io.read }.should raise_error(IOError) end + it "raises ArgumentError when length is less than 0" do + -> { @io.read(-1) }.should raise_error(ArgumentError) + end platform_is_not :windows do it "raises IOError when stream is closed by another thread" do @@ -384,13 +514,6 @@ describe "IO#read in binary mode" do xE2 = [226].pack('C*') result.should == ("abc" + xE2 + "def").force_encoding(Encoding::BINARY) end - - it "does not transcode file contents when an internal encoding is specified" do - result = File.open(@name, "r:binary:utf-8") { |f| f.read }.chomp - result.encoding.should == Encoding::BINARY - xE2 = [226].pack('C*') - result.should == ("abc" + xE2 + "def").force_encoding(Encoding::BINARY) - end end describe "IO#read in text mode" do @@ -465,13 +588,13 @@ describe :io_read_internal_encoding, shared: true do describe "when passed nil for limit" do it "sets the buffer to a transcoded String" do - result = @io.read(nil, buf = "") + result = @io.read(nil, buf = +"") buf.should equal(result) buf.should == "ã‚ã‚ŠãŒã¨ã†\n" end it "sets the buffer's encoding to the internal encoding" do - buf = "".force_encoding Encoding::ISO_8859_1 + buf = "".dup.force_encoding Encoding::ISO_8859_1 @io.read(nil, buf) buf.encoding.should equal(Encoding::UTF_8) end @@ -485,17 +608,18 @@ describe :io_read_size_internal_encoding, shared: true do it "returns a String in BINARY when passed a size" do @io.read(4).encoding.should equal(Encoding::BINARY) + @io.read(0).encoding.should equal(Encoding::BINARY) end it "does not change the buffer's encoding when passed a limit" do - buf = "".force_encoding Encoding::ISO_8859_1 + buf = "".dup.force_encoding Encoding::ISO_8859_1 @io.read(4, buf) buf.should == [164, 162, 164, 234].pack('C*').force_encoding(Encoding::ISO_8859_1) buf.encoding.should equal(Encoding::ISO_8859_1) end it "truncates the buffer but does not change the buffer's encoding when no data remains" do - buf = "abc".force_encoding Encoding::ISO_8859_1 + buf = "abc".dup.force_encoding Encoding::ISO_8859_1 @io.read @io.read(1, buf).should be_nil diff --git a/spec/ruby/core/io/readchar_spec.rb b/spec/ruby/core/io/readchar_spec.rb index b5f762a846..a66773851a 100644 --- a/spec/ruby/core/io/readchar_spec.rb +++ b/spec/ruby/core/io/readchar_spec.rb @@ -1,6 +1,16 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +describe :io_readchar_internal_encoding, shared: true do + it "returns a transcoded String" do + @io.readchar.should == "ã‚" + end + + it "sets the String encoding to the internal encoding" do + @io.readchar.encoding.should equal(Encoding::UTF_8) + end +end + describe "IO#readchar" do before :each do @io = IOSpecs.io_fixture "lines.txt" @@ -29,6 +39,62 @@ describe "IO#readchar" do end end +describe "IO#readchar with internal encoding" do + after :each do + @io.close if @io + end + + describe "not specified" do + before :each do + @io = IOSpecs.io_fixture "read_euc_jp.txt", "r:euc-jp" + end + + it "does not transcode the String" do + @io.readchar.should == ("ã‚").encode(Encoding::EUC_JP) + end + + it "sets the String encoding to the external encoding" do + @io.readchar.encoding.should equal(Encoding::EUC_JP) + end + end + + describe "specified by open mode" do + before :each do + @io = IOSpecs.io_fixture "read_euc_jp.txt", "r:euc-jp:utf-8" + end + + it_behaves_like :io_readchar_internal_encoding, nil + end + + describe "specified by mode: option" do + before :each do + @io = IOSpecs.io_fixture "read_euc_jp.txt", mode: "r:euc-jp:utf-8" + end + + it_behaves_like :io_readchar_internal_encoding, nil + end + + describe "specified by internal_encoding: option" do + before :each do + options = { mode: "r", + internal_encoding: "utf-8", + external_encoding: "euc-jp" } + @io = IOSpecs.io_fixture "read_euc_jp.txt", options + end + + it_behaves_like :io_readchar_internal_encoding, nil + end + + describe "specified by encoding: option" do + before :each do + options = { mode: "r", encoding: "euc-jp:utf-8" } + @io = IOSpecs.io_fixture "read_euc_jp.txt", options + end + + it_behaves_like :io_readchar_internal_encoding, nil + end +end + describe "IO#readchar" do before :each do @io = IOSpecs.io_fixture "empty.txt" diff --git a/spec/ruby/core/io/readline_spec.rb b/spec/ruby/core/io/readline_spec.rb index 7cb1601816..a814c1be90 100644 --- a/spec/ruby/core/io/readline_spec.rb +++ b/spec/ruby/core/io/readline_spec.rb @@ -43,9 +43,42 @@ describe "IO#readline" do end end + describe "when passed limit" do + it "reads limit bytes" do + @io.readline(3).should == "Voi" + end + + it "returns an empty string when passed 0 as a limit" do + @io.readline(0).should == "" + end + + it "does not accept Integers that don't fit in a C off_t" do + -> { @io.readline(2**128) }.should raise_error(RangeError) + end + end + + describe "when passed separator and limit" do + it "reads limit bytes till the separator" do + # Voici la ligne une.\ + @io.readline(" ", 4).should == "Voic" + @io.readline(" ", 4).should == "i " + @io.readline(" ", 4).should == "la " + @io.readline(" ", 4).should == "lign" + @io.readline(" ", 4).should == "e " + end + end + describe "when passed chomp" do it "returns the first line without a trailing newline character" do @io.readline(chomp: true).should == IOSpecs.lines_without_newline_characters[0] end + + it "raises exception when options passed as Hash" do + -> { @io.readline({ chomp: true }) }.should raise_error(TypeError) + + -> { + @io.readline("\n", 1, { chomp: true }) + }.should raise_error(ArgumentError, "wrong number of arguments (given 3, expected 0..2)") + end end end diff --git a/spec/ruby/core/io/readlines_spec.rb b/spec/ruby/core/io/readlines_spec.rb index 254f2927b5..3a6ff3d0f3 100644 --- a/spec/ruby/core/io/readlines_spec.rb +++ b/spec/ruby/core/io/readlines_spec.rb @@ -101,6 +101,36 @@ describe "IO#readlines" do @io.readlines(obj).should == IOSpecs.lines_r_separator end end + + describe "when passed limit" do + it "raises ArgumentError when passed 0 as a limit" do + -> { @io.readlines(0) }.should raise_error(ArgumentError) + end + + it "does not accept Integers that don't fit in a C off_t" do + -> { @io.readlines(2**128) }.should raise_error(RangeError) + end + end + + describe "when passed chomp" do + it "returns the first line without a trailing newline character" do + @io.readlines(chomp: true).should == IOSpecs.lines_without_newline_characters + end + + it "raises exception when options passed as Hash" do + -> { @io.readlines({ chomp: true }) }.should raise_error(TypeError) + + -> { + @io.readlines("\n", 1, { chomp: true }) + }.should raise_error(ArgumentError, "wrong number of arguments (given 3, expected 0..2)") + end + end + + describe "when passed arbitrary keyword argument" do + it "tolerates it" do + @io.readlines(chomp: true, foo: :bar).should == IOSpecs.lines_without_newline_characters + end + end end describe "IO#readlines" do @@ -150,13 +180,20 @@ describe "IO.readlines" do platform_is :windows do cmd = "|cmd.exe /C echo hello&echo line2" end - lines = IO.readlines(cmd) + + lines = nil + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + lines = IO.readlines(cmd) + end lines.should == ["hello\n", "line2\n"] end platform_is_not :windows do it "gets data from a fork when passed -" do - lines = IO.readlines("|-") + lines = nil + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + lines = IO.readlines("|-") + end if lines # parent lines.should == ["hello\n", "from a fork\n"] @@ -169,6 +206,16 @@ describe "IO.readlines" do end end + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19630 + it "warns about deprecation given a path with a pipe" do + cmd = "|echo ok" + -> { + IO.readlines(cmd) + }.should complain(/IO process creation with a leading '\|'/) + end + end + it_behaves_like :io_readlines, :readlines it_behaves_like :io_readlines_options_19, :readlines end diff --git a/spec/ruby/core/io/readpartial_spec.rb b/spec/ruby/core/io/readpartial_spec.rb index 2b33a0d5b1..0060beb545 100644 --- a/spec/ruby/core/io/readpartial_spec.rb +++ b/spec/ruby/core/io/readpartial_spec.rb @@ -59,7 +59,7 @@ describe "IO#readpartial" do end it "discards the existing buffer content upon successful read" do - buffer = "existing" + buffer = +"existing content" @wr.write("hello world") @wr.close @rd.readpartial(11, buffer) @@ -74,7 +74,7 @@ describe "IO#readpartial" do end it "discards the existing buffer content upon error" do - buffer = 'hello' + buffer = +'hello' @wr.close -> { @rd.readpartial(1, buffer) }.should raise_error(EOFError) buffer.should be_empty @@ -93,4 +93,19 @@ describe "IO#readpartial" do @rd.readpartial(0).should == "" end + ruby_bug "#18421", ""..."3.0.4" do + it "clears and returns the given buffer if the length argument is 0" do + buffer = +"existing content" + @rd.readpartial(0, buffer).should == buffer + buffer.should == "" + end + end + + it "preserves the encoding of the given buffer" do + buffer = ''.encode(Encoding::ISO_8859_1) + @wr.write("abc") + @wr.close + @rd.readpartial(10, buffer) + buffer.encoding.should == Encoding::ISO_8859_1 + end end diff --git a/spec/ruby/core/io/rewind_spec.rb b/spec/ruby/core/io/rewind_spec.rb index 649041afaf..5579cbd988 100644 --- a/spec/ruby/core/io/rewind_spec.rb +++ b/spec/ruby/core/io/rewind_spec.rb @@ -18,6 +18,17 @@ describe "IO#rewind" do @io.readline.should == "Voici la ligne une.\n" end + it "positions the instance to the beginning of output for write-only IO" do + name = tmp("io_rewind_spec") + io = File.open(name, "w") + io.write("Voici la ligne une.\n") + io.rewind + io.pos.should == 0 + ensure + io.close + rm_r name + end + it "positions the instance to the beginning of input and clears EOF" do value = @io.read @io.rewind @@ -32,6 +43,10 @@ describe "IO#rewind" do @io.lineno.should == 0 end + it "returns 0" do + @io.rewind.should == 0 + end + it "raises IOError on closed stream" do -> { IOSpecs.closed_io.rewind }.should raise_error(IOError) end diff --git a/spec/ruby/core/io/select_spec.rb b/spec/ruby/core/io/select_spec.rb index 4603c1fbbc..3893e7620f 100644 --- a/spec/ruby/core/io/select_spec.rb +++ b/spec/ruby/core/io/select_spec.rb @@ -55,8 +55,8 @@ describe "IO.select" do end end - it "returns supplied objects correctly even when monitoring the same object in different arrays" do - filename = tmp("IO_select_pipe_file") + $$.to_s + it "returns supplied objects correctly when monitoring the same object in different arrays" do + filename = tmp("IO_select_pipe_file") io = File.open(filename, 'w+') result = IO.select [io], [io], nil, 0 result.should == [[io], [io], []] @@ -64,6 +64,17 @@ describe "IO.select" do rm_r filename end + it "returns the pipe read end in read set if the pipe write end is closed concurrently" do + main = Thread.current + t = Thread.new { + Thread.pass until main.stop? + @wr.close + } + IO.select([@rd]).should == [[@rd], [], []] + ensure + t.join + end + it "invokes to_io on supplied objects that are not IO and returns the supplied objects" do # make some data available @wr.write("foobar") @@ -103,6 +114,39 @@ describe "IO.select" do it "raises an ArgumentError when passed a negative timeout" do -> { IO.select(nil, nil, nil, -5)}.should raise_error(ArgumentError) end + + describe "returns the available descriptors when the file descriptor" do + it "is in both read and error arrays" do + @wr.write("foobar") + result = IO.select([@rd], nil, [@rd]) + result.should == [[@rd], [], []] + end + + it "is in both write and error arrays" do + result = IO.select(nil, [@wr], [@wr]) + result.should == [[], [@wr], []] + end + + it "is in both read and write arrays" do + filename = tmp("IO_select_read_write_file") + w = File.open(filename, 'w+') + begin + IO.select([w], [w], []).should == [[w], [w], []] + ensure + w.close + rm_r filename + end + + IO.select([@wr], [@wr], []).should == [[], [@wr], []] + + @wr.write("foobar") + # CRuby on macOS returns [[@rd], [@rd], []], weird but we accept it here, probably only for pipe read-end + [ + [[@rd], [], []], + [[@rd], [@rd], []] + ].should.include? IO.select([@rd], [@rd], []) + end + end end describe "IO.select when passed nil for timeout" do diff --git a/spec/ruby/core/io/set_encoding_by_bom_spec.rb b/spec/ruby/core/io/set_encoding_by_bom_spec.rb index 7368ec7677..92433d6640 100644 --- a/spec/ruby/core/io/set_encoding_by_bom_spec.rb +++ b/spec/ruby/core/io/set_encoding_by_bom_spec.rb @@ -12,66 +12,251 @@ describe "IO#set_encoding_by_bom" do rm_r @name end - ruby_version_is "2.7" do - it "returns the result encoding if found BOM UTF-8 sequence" do - File.binwrite(@name, "\u{FEFF}abc") + it "returns nil if not readable" do + not_readable_io = new_io(@name, 'wb') - @io.set_encoding_by_bom.should == Encoding::UTF_8 - @io.external_encoding.should == Encoding::UTF_8 - end + not_readable_io.set_encoding_by_bom.should be_nil + not_readable_io.external_encoding.should == Encoding::ASCII_8BIT + ensure + not_readable_io.close + end + + it "returns the result encoding if found BOM UTF-8 sequence" do + File.binwrite(@name, "\u{FEFF}") + + @io.set_encoding_by_bom.should == Encoding::UTF_8 + @io.external_encoding.should == Encoding::UTF_8 + @io.read.b.should == "".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.binwrite(@name, "\u{FEFF}abc") + + @io.set_encoding_by_bom.should == Encoding::UTF_8 + @io.external_encoding.should == Encoding::UTF_8 + @io.read.b.should == "abc".b + end + + it "returns the result encoding if found BOM UTF_16LE sequence" do + File.binwrite(@name, "\xFF\xFE") + + @io.set_encoding_by_bom.should == Encoding::UTF_16LE + @io.external_encoding.should == Encoding::UTF_16LE + @io.read.b.should == "".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.binwrite(@name, "\xFF\xFEabc") + + @io.set_encoding_by_bom.should == Encoding::UTF_16LE + @io.external_encoding.should == Encoding::UTF_16LE + @io.read.b.should == "abc".b + end + + it "returns the result encoding if found BOM UTF_16BE sequence" do + File.binwrite(@name, "\xFE\xFF") + + @io.set_encoding_by_bom.should == Encoding::UTF_16BE + @io.external_encoding.should == Encoding::UTF_16BE + @io.read.b.should == "".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.binwrite(@name, "\xFE\xFFabc") + + @io.set_encoding_by_bom.should == Encoding::UTF_16BE + @io.external_encoding.should == Encoding::UTF_16BE + @io.read.b.should == "abc".b + end + + it "returns the result encoding if found BOM UTF_32LE sequence" do + File.binwrite(@name, "\xFF\xFE\x00\x00") + + @io.set_encoding_by_bom.should == Encoding::UTF_32LE + @io.external_encoding.should == Encoding::UTF_32LE + @io.read.b.should == "".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.binwrite(@name, "\xFF\xFE\x00\x00abc") + + @io.set_encoding_by_bom.should == Encoding::UTF_32LE + @io.external_encoding.should == Encoding::UTF_32LE + @io.read.b.should == "abc".b + end + + it "returns the result encoding if found BOM UTF_32BE sequence" do + File.binwrite(@name, "\x00\x00\xFE\xFF") + + @io.set_encoding_by_bom.should == Encoding::UTF_32BE + @io.external_encoding.should == Encoding::UTF_32BE + @io.read.b.should == "".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.binwrite(@name, "\x00\x00\xFE\xFFabc") + + @io.set_encoding_by_bom.should == Encoding::UTF_32BE + @io.external_encoding.should == Encoding::UTF_32BE + @io.read.b.should == "abc".b + end + + it "returns nil if io is empty" do + @io.set_encoding_by_bom.should be_nil + @io.external_encoding.should == Encoding::ASCII_8BIT + end + + it "returns nil if UTF-8 BOM sequence is incomplete" do + File.write(@name, "\xEF") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xEF".b + @io.rewind + + File.write(@name, "\xEFa") - it "returns the result encoding if found BOM UTF_16LE sequence" do - File.binwrite(@name, "\xFF\xFEabc") + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xEFa".b + @io.rewind - @io.set_encoding_by_bom.should == Encoding::UTF_16LE - @io.external_encoding.should == Encoding::UTF_16LE - end + File.write(@name, "\xEF\xBB") - it "returns the result encoding if found BOM UTF_16BE sequence" do - File.binwrite(@name, "\xFE\xFFabc") + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xEF\xBB".b + @io.rewind - @io.set_encoding_by_bom.should == Encoding::UTF_16BE - @io.external_encoding.should == Encoding::UTF_16BE - end + File.write(@name, "\xEF\xBBa") - it "returns the result encoding if found BOM UTF_32LE sequence" do - File.binwrite(@name, "\xFF\xFE\x00\x00abc") + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xEF\xBBa".b + end + + it "returns nil if UTF-16BE BOM sequence is incomplete" do + File.write(@name, "\xFE") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xFE".b + @io.rewind + + File.write(@name, "\xFEa") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xFEa".b + end + + it "returns nil if UTF-16LE/UTF-32LE BOM sequence is incomplete" do + File.write(@name, "\xFF") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xFF".b + @io.rewind - @io.set_encoding_by_bom.should == Encoding::UTF_32LE - @io.external_encoding.should == Encoding::UTF_32LE - end + File.write(@name, "\xFFa") - it "returns the result encoding if found BOM UTF_32BE sequence" do - File.binwrite(@name, "\x00\x00\xFE\xFFabc") + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\xFFa".b + end + + it "returns UTF-16LE if UTF-32LE BOM sequence is incomplete" do + File.write(@name, "\xFF\xFE") + + @io.set_encoding_by_bom.should == Encoding::UTF_16LE + @io.external_encoding.should == Encoding::UTF_16LE + @io.read.b.should == "".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.write(@name, "\xFF\xFE\x00") + + @io.set_encoding_by_bom.should == Encoding::UTF_16LE + @io.external_encoding.should == Encoding::UTF_16LE + @io.read.b.should == "\x00".b + @io.rewind + @io.set_encoding(Encoding::ASCII_8BIT) + + File.write(@name, "\xFF\xFE\x00a") + + @io.set_encoding_by_bom.should == Encoding::UTF_16LE + @io.external_encoding.should == Encoding::UTF_16LE + @io.read.b.should == "\x00a".b + end - @io.set_encoding_by_bom.should == Encoding::UTF_32BE - @io.external_encoding.should == Encoding::UTF_32BE - end + it "returns nil if UTF-32BE BOM sequence is incomplete" do + File.write(@name, "\x00") - it "returns nil if found BOM sequence not provided" do - File.write(@name, "abc") + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\x00".b + @io.rewind - @io.set_encoding_by_bom.should == nil - end + File.write(@name, "\x00a") - it 'returns exception if io not in binary mode' do - not_binary_io = new_io(@name, 'r') + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\x00a".b + @io.rewind - -> { not_binary_io.set_encoding_by_bom }.should raise_error(ArgumentError, 'ASCII incompatible encoding needs binmode') - ensure - not_binary_io.close - end + File.write(@name, "\x00\x00") - it 'returns exception if encoding already set' do - @io.set_encoding("utf-8") + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\x00\x00".b + @io.rewind - -> { @io.set_encoding_by_bom }.should raise_error(ArgumentError, 'encoding is set to UTF-8 already') - end + File.write(@name, "\x00\x00a") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\x00\x00a".b + @io.rewind + + File.write(@name, "\x00\x00\xFE") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\x00\x00\xFE".b + @io.rewind + + File.write(@name, "\x00\x00\xFEa") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read.b.should == "\x00\x00\xFEa".b + end + + it "returns nil if found BOM sequence not provided" do + File.write(@name, "abc") + + @io.set_encoding_by_bom.should == nil + @io.external_encoding.should == Encoding::ASCII_8BIT + @io.read(3).should == "abc".b + end + + it 'returns exception if io not in binary mode' do + not_binary_io = new_io(@name, 'r') + + -> { not_binary_io.set_encoding_by_bom }.should raise_error(ArgumentError, 'ASCII incompatible encoding needs binmode') + ensure + not_binary_io.close + end + + it 'returns exception if encoding already set' do + @io.set_encoding("utf-8") + + -> { @io.set_encoding_by_bom }.should raise_error(ArgumentError, 'encoding is set to UTF-8 already') + end - it 'returns exception if encoding conversion is already set' do - @io.set_encoding(Encoding::UTF_8, Encoding::UTF_16BE) + it 'returns exception if encoding conversion is already set' do + @io.set_encoding(Encoding::UTF_8, Encoding::UTF_16BE) - -> { @io.set_encoding_by_bom }.should raise_error(ArgumentError, 'encoding conversion is set') - end + -> { @io.set_encoding_by_bom }.should raise_error(ArgumentError, 'encoding conversion is set') end end diff --git a/spec/ruby/core/io/set_encoding_spec.rb b/spec/ruby/core/io/set_encoding_spec.rb index 5aec6a96c3..22d9017635 100644 --- a/spec/ruby/core/io/set_encoding_spec.rb +++ b/spec/ruby/core/io/set_encoding_spec.rb @@ -1,7 +1,7 @@ require_relative '../../spec_helper' describe :io_set_encoding_write, shared: true do - it "sets the encodings to nil" do + it "sets the encodings to nil when they were set previously" do @io = new_io @name, "#{@object}:ibm437:ibm866" @io.set_encoding nil, nil @@ -9,6 +9,19 @@ describe :io_set_encoding_write, shared: true do @io.internal_encoding.should be_nil end + it "sets the encodings to nil when the IO is built with no explicit encoding" do + @io = new_io @name, @object + + # Checking our assumptions first + @io.external_encoding.should be_nil + @io.internal_encoding.should be_nil + + @io.set_encoding nil, nil + + @io.external_encoding.should be_nil + @io.internal_encoding.should be_nil + end + it "prevents the encodings from changing when Encoding defaults are changed" do @io = new_io @name, "#{@object}:utf-8:us-ascii" @io.set_encoding nil, nil @@ -38,6 +51,7 @@ describe "IO#set_encoding when passed nil, nil" do @external = Encoding.default_external @internal = Encoding.default_internal + # The defaults Encoding.default_external = Encoding::UTF_8 Encoding.default_internal = nil @@ -113,6 +127,22 @@ describe "IO#set_encoding when passed nil, nil" do describe "with 'a+' mode" do it_behaves_like :io_set_encoding_write, nil, "a+" end + + describe "with standard IOs" do + it "correctly resets them" do + STDOUT.external_encoding.should == nil + STDOUT.internal_encoding.should == nil + + begin + STDOUT.set_encoding(Encoding::US_ASCII, Encoding::ISO_8859_1) + ensure + STDOUT.set_encoding(nil, nil) + end + + STDOUT.external_encoding.should == nil + STDOUT.internal_encoding.should == nil + end + end end describe "IO#set_encoding" do @@ -188,4 +218,21 @@ describe "IO#set_encoding" do @io.external_encoding.should == Encoding::UTF_8 @io.internal_encoding.should == Encoding::UTF_16BE end + + it "saves encoding options passed as a hash in the last argument" do + File.write(@name, "\xff") + io = File.open(@name) + io.set_encoding(Encoding::EUC_JP, Encoding::SHIFT_JIS, invalid: :replace, replace: ".") + io.read.should == "." + ensure + io.close + end + + it "raises ArgumentError when no arguments are given" do + -> { @io.set_encoding() }.should raise_error(ArgumentError) + end + + it "raises ArgumentError when too many arguments are given" do + -> { @io.set_encoding(1, 2, 3) }.should raise_error(ArgumentError) + end end diff --git a/spec/ruby/core/io/shared/binwrite.rb b/spec/ruby/core/io/shared/binwrite.rb index 3649bb47ff..e51093329b 100644 --- a/spec/ruby/core/io/shared/binwrite.rb +++ b/spec/ruby/core/io/shared/binwrite.rb @@ -21,6 +21,14 @@ describe :io_binwrite, shared: true do IO.send(@method, @filename, "abcde").should == 5 end + it "accepts options as a keyword argument" do + IO.send(@method, @filename, "hi", 0, flags: File::CREAT).should == 2 + + -> { + IO.send(@method, @filename, "hi", 0, {flags: File::CREAT}) + }.should raise_error(ArgumentError, "wrong number of arguments (given 4, expected 2..3)") + end + it "creates a file if missing" do fn = @filename + "xxx" begin @@ -67,6 +75,11 @@ describe :io_binwrite, shared: true do File.read(@filename).should == "\0\0foo" end + it "accepts a :flags option without :mode one" do + IO.send(@method, @filename, "hello, world!", flags: File::CREAT) + File.read(@filename).should == "hello, world!" + end + it "raises an error if readonly mode is specified" do -> { IO.send(@method, @filename, "abcde", mode: "r") }.should raise_error(IOError) end diff --git a/spec/ruby/core/io/shared/each.rb b/spec/ruby/core/io/shared/each.rb index 91766fbe03..aca622834f 100644 --- a/spec/ruby/core/io/shared/each.rb +++ b/spec/ruby/core/io/shared/each.rb @@ -33,10 +33,6 @@ describe :io_each, shared: true do $_.should == "test" end - it "returns self" do - @io.send(@method) { |l| l }.should equal(@io) - end - it "raises an IOError when self is not readable" do -> { IOSpecs.closed_io.send(@method) {} }.should raise_error(IOError) end @@ -77,6 +73,10 @@ describe :io_each, shared: true do -> { @io.send(@method, 0){} }.should raise_error(ArgumentError) end end + + it "does not accept Integers that don't fit in a C off_t" do + -> { @io.send(@method, 2**128){} }.should raise_error(RangeError) + end end describe "when passed a String containing one space as a separator" do @@ -113,6 +113,13 @@ describe :io_each, shared: true do @io.send(@method, "") { |s| ScratchPad << s } ScratchPad.recorded.should == IOSpecs.paragraphs end + + it "discards leading newlines" do + @io.readline + @io.readline + @io.send(@method, "") { |s| ScratchPad << s } + ScratchPad.recorded.should == IOSpecs.paragraphs[1..-1] + end end describe "with both separator and limit" do @@ -152,6 +159,13 @@ describe :io_each, shared: true do @io.send(@method, "", 1024) { |s| ScratchPad << s } ScratchPad.recorded.should == IOSpecs.paragraphs end + + it "discards leading newlines" do + @io.readline + @io.readline + @io.send(@method, "", 1024) { |s| ScratchPad << s } + ScratchPad.recorded.should == IOSpecs.paragraphs[1..-1] + end end end end @@ -161,6 +175,70 @@ describe :io_each, shared: true do @io.send(@method, chomp: true) { |s| ScratchPad << s } ScratchPad.recorded.should == IOSpecs.lines_without_newline_characters end + + it "raises exception when options passed as Hash" do + -> { + @io.send(@method, { chomp: true }) { |s| } + }.should raise_error(TypeError) + + -> { + @io.send(@method, "\n", 1, { chomp: true }) { |s| } + }.should raise_error(ArgumentError, "wrong number of arguments (given 3, expected 0..2)") + end + end + + describe "when passed chomp and a separator" do + it "yields each line without separator to the passed block" do + @io.send(@method, " ", chomp: true) { |s| ScratchPad << s } + ScratchPad.recorded.should == IOSpecs.lines_space_separator_without_trailing_spaces + end + end + + describe "when passed chomp and empty line as a separator" do + it "yields each paragraph without trailing new line characters" do + @io.send(@method, "", 1024, chomp: true) { |s| ScratchPad << s } + ScratchPad.recorded.should == IOSpecs.paragraphs_without_trailing_new_line_characters + end + end + + describe "when passed chomp and nil as a separator" do + ruby_version_is "3.2" do + it "yields self's content" do + @io.pos = 100 + @io.send(@method, nil, chomp: true) { |s| ScratchPad << s } + ScratchPad.recorded.should == ["qui a linha cinco.\nHere is line six.\n"] + end + end + + ruby_version_is ""..."3.2" do + it "yields self's content without trailing new line character" do + @io.pos = 100 + @io.send(@method, nil, chomp: true) { |s| ScratchPad << s } + ScratchPad.recorded.should == ["qui a linha cinco.\nHere is line six."] + end + end + end + + describe "when passed chomp, nil as a separator, and a limit" do + it "yields each line of limit size without truncating trailing new line character" do + # 43 - is a size of the 1st paragraph in the file + @io.send(@method, nil, 43, chomp: true) { |s| ScratchPad << s } + + ScratchPad.recorded.should == [ + "Voici la ligne une.\nQui è la linea due.\n\n\n", + "Aquà está la lÃnea tres.\n" + "Hier ist Zeile ", + "vier.\n\nEstá aqui a linha cinco.\nHere is li", + "ne six.\n" + ] + end + end + + describe "when passed too many arguments" do + it "raises ArgumentError" do + -> { + @io.send(@method, "", 1, "excess argument", chomp: true) {} + }.should raise_error(ArgumentError) + end end end diff --git a/spec/ruby/core/io/shared/new.rb b/spec/ruby/core/io/shared/new.rb index f2a0970a40..cba5f33ebf 100644 --- a/spec/ruby/core/io/shared/new.rb +++ b/spec/ruby/core/io/shared/new.rb @@ -1,5 +1,7 @@ require_relative '../fixtures/classes' +# NOTE: should be synchronized with library/stringio/initialize_spec.rb + # This group of specs may ONLY contain specs that do successfully create # an IO instance from the file descriptor returned by #new_fd helper. describe :io_new, shared: true do @@ -62,6 +64,15 @@ describe :io_new, shared: true do @io.should be_an_instance_of(IO) end + it "accepts options as keyword arguments" do + @io = IO.send(@method, @fd, "w", flags: File::CREAT) + @io.write("foo").should == 3 + + -> { + IO.send(@method, @fd, "w", {flags: File::CREAT}) + }.should raise_error(ArgumentError, "wrong number of arguments (given 3, expected 1..2)") + end + it "accepts a :mode option" do @io = IO.send(@method, @fd, mode: "w") @io.write("foo").should == 3 @@ -197,21 +208,10 @@ describe :io_new, shared: true do @io.internal_encoding.to_s.should == 'IBM866' end - ruby_version_is ''...'3.0' do - it "accepts nil options" do - @io = suppress_keyword_warning do - IO.send(@method, @fd, 'w', nil) - end - @io.write("foo").should == 3 - end - end - - ruby_version_is '3.0' do - it "raises ArgumentError for nil options" do - -> { - IO.send(@method, @fd, 'w', nil) - }.should raise_error(ArgumentError) - end + it "raises ArgumentError for nil options" do + -> { + IO.send(@method, @fd, 'w', nil) + }.should raise_error(ArgumentError) end it "coerces mode with #to_str" do @@ -382,21 +382,9 @@ describe :io_new_errors, shared: true do }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it "raises TypeError if passed a hash for mode and nil for options" do - -> { - suppress_keyword_warning do - @io = IO.send(@method, @fd, {mode: 'w'}, nil) - end - }.should raise_error(TypeError) - end - end - - ruby_version_is '3.0' do - it "raises ArgumentError if passed a hash for mode and nil for options" do - -> { - @io = IO.send(@method, @fd, {mode: 'w'}, nil) - }.should raise_error(ArgumentError) - end + it "raises ArgumentError if passed a hash for mode and nil for options" do + -> { + @io = IO.send(@method, @fd, {mode: 'w'}, nil) + }.should raise_error(ArgumentError) end end diff --git a/spec/ruby/core/io/shared/pos.rb b/spec/ruby/core/io/shared/pos.rb index d83a6c6692..3fdd3eb2b3 100644 --- a/spec/ruby/core/io/shared/pos.rb +++ b/spec/ruby/core/io/shared/pos.rb @@ -60,7 +60,13 @@ describe :io_set_pos, shared: true do end end - it "does not accept Integers that don't fit in a C long" do + it "raises TypeError when cannot convert implicitly argument to Integer" do + File.open @fname do |io| + -> { io.send @method, Object.new }.should raise_error(TypeError, "no implicit conversion of Object into Integer") + end + end + + it "does not accept Integers that don't fit in a C off_t" do File.open @fname do |io| -> { io.send @method, 2**128 }.should raise_error(RangeError) end diff --git a/spec/ruby/core/io/shared/readlines.rb b/spec/ruby/core/io/shared/readlines.rb index 8e4a73bb98..6c1fa11a59 100644 --- a/spec/ruby/core/io/shared/readlines.rb +++ b/spec/ruby/core/io/shared/readlines.rb @@ -73,6 +73,23 @@ describe :io_readlines_options_19, shared: true do result = IO.send(@method, @name, 10, &@object) (result ? result : ScratchPad.recorded).should == IOSpecs.lines_limit end + + it "ignores the object as a limit if it is negative" do + result = IO.send(@method, @name, -2, &@object) + (result ? result : ScratchPad.recorded).should == IOSpecs.lines + end + + it "does not accept Integers that don't fit in a C off_t" do + -> { IO.send(@method, @name, 2**128, &@object) }.should raise_error(RangeError) + end + + ruby_bug "#18767", ""..."3.3" do + describe "when passed limit" do + it "raises ArgumentError when passed 0 as a limit" do + -> { IO.send(@method, @name, 0, &@object) }.should raise_error(ArgumentError) + end + end + end end describe "when the object is a String" do @@ -82,36 +99,38 @@ describe :io_readlines_options_19, shared: true do end it "accepts non-ASCII data as separator" do - result = IO.send(@method, @name, "\303\250".force_encoding("utf-8"), &@object) + result = IO.send(@method, @name, "\303\250".dup.force_encoding("utf-8"), &@object) (result ? result : ScratchPad.recorded).should == IOSpecs.lines_arbitrary_separator end end - describe "when the object is a Hash" do - it "uses the value as the options hash" do - result = IO.send(@method, @name, mode: "r", &@object) - (result ? result : ScratchPad.recorded).should == IOSpecs.lines + describe "when the object is an options Hash" do + it "raises TypeError exception" do + -> { + IO.send(@method, @name, { chomp: true }, &@object) + }.should raise_error(TypeError) end end - end - describe "when passed name, object, object" do - describe "when the first object is an Integer" do - it "uses the second object as an options Hash" do - -> do - IO.send(@method, @filename, 10, mode: "w", &@object) - end.should raise_error(IOError) - end + describe "when the object is neither Integer nor String" do + it "raises TypeError exception" do + obj = mock("not io readlines limit") - it "calls #to_hash to convert the second object to a Hash" do - options = mock("io readlines options Hash") - options.should_receive(:to_hash).and_return({ mode: "w" }) - -> do - IO.send(@method, @filename, 10, **options, &@object) - end.should raise_error(IOError) + -> { + IO.send(@method, @name, obj, &@object) + }.should raise_error(TypeError) end end + end + + describe "when passed name, keyword arguments" do + it "uses the keyword arguments as options" do + result = IO.send(@method, @name, mode: "r", &@object) + (result ? result : ScratchPad.recorded).should == IOSpecs.lines + end + end + describe "when passed name, object, object" do describe "when the first object is a String" do it "uses the second object as a limit if it is an Integer" do result = IO.send(@method, @name, " ", 10, &@object) @@ -124,32 +143,18 @@ describe :io_readlines_options_19, shared: true do result = IO.send(@method, @name, " ", limit, &@object) (result ? result : ScratchPad.recorded).should == IOSpecs.lines_space_separator_limit end - - it "uses the second object as an options Hash" do - -> do - IO.send(@method, @filename, " ", mode: "w", &@object) - end.should raise_error(IOError) - end - - it "calls #to_hash to convert the second object to a Hash" do - options = mock("io readlines options Hash") - options.should_receive(:to_hash).and_return({ mode: "w" }) - -> do - IO.send(@method, @filename, " ", **options, &@object) - end.should raise_error(IOError) - end end describe "when the first object is not a String or Integer" do it "calls #to_str to convert the object to a String" do sep = mock("io readlines separator") sep.should_receive(:to_str).at_least(1).and_return(" ") - result = IO.send(@method, @name, sep, 10, mode: "r", &@object) + result = IO.send(@method, @name, sep, 10, &@object) (result ? result : ScratchPad.recorded).should == IOSpecs.lines_space_separator_limit end it "uses the second object as a limit if it is an Integer" do - result = IO.send(@method, @name, " ", 10, mode: "r", &@object) + result = IO.send(@method, @name, " ", 10, &@object) (result ? result : ScratchPad.recorded).should == IOSpecs.lines_space_separator_limit end @@ -159,24 +164,57 @@ describe :io_readlines_options_19, shared: true do result = IO.send(@method, @name, " ", limit, &@object) (result ? result : ScratchPad.recorded).should == IOSpecs.lines_space_separator_limit end + end + + describe "when the second object is neither Integer nor String" do + it "raises TypeError exception" do + obj = mock("not io readlines limit") + + -> { + IO.send(@method, @name, " ", obj, &@object) + }.should raise_error(TypeError) + end + end - it "uses the second object as an options Hash" do + describe "when the second object is an options Hash" do + it "raises TypeError exception" do + -> { + IO.send(@method, @name, "", { chomp: true }, &@object) + }.should raise_error(TypeError) + end + end + end + + describe "when passed name, object, keyword arguments" do + describe "when the first object is an Integer" do + it "uses the keyword arguments as options" do + -> do + IO.send(@method, @filename, 10, mode: "w", &@object) + end.should raise_error(IOError) + end + end + + describe "when the first object is a String" do + it "uses the keyword arguments as options" do -> do IO.send(@method, @filename, " ", mode: "w", &@object) end.should raise_error(IOError) end + end + + describe "when the first object is not a String or Integer" do + it "uses the keyword arguments as options" do + sep = mock("io readlines separator") + sep.should_receive(:to_str).at_least(1).and_return(" ") - it "calls #to_hash to convert the second object to a Hash" do - options = mock("io readlines options Hash") - options.should_receive(:to_hash).and_return({ mode: "w" }) -> do - IO.send(@method, @filename, " ", **options, &@object) + IO.send(@method, @filename, sep, mode: "w", &@object) end.should raise_error(IOError) end end end - describe "when passed name, separator, limit, options" do + describe "when passed name, separator, limit, keyword arguments" do it "calls #to_path to convert the name object" do name = mock("io name to_path") name.should_receive(:to_path).and_return(@name) @@ -198,12 +236,24 @@ describe :io_readlines_options_19, shared: true do (result ? result : ScratchPad.recorded).should == IOSpecs.lines_space_separator_limit end - it "calls #to_hash to convert the options object" do - options = mock("io readlines options Hash") - options.should_receive(:to_hash).and_return({ mode: "w" }) + it "uses the keyword arguments as options" do -> do - IO.send(@method, @filename, " ", 10, **options, &@object) + IO.send(@method, @filename, " ", 10, mode: "w", &@object) end.should raise_error(IOError) end + + describe "when passed chomp, nil as a separator, and a limit" do + it "yields each line of limit size without truncating trailing new line character" do + # 43 - is a size of the 1st paragraph in the file + result = IO.send(@method, @name, nil, 43, chomp: true, &@object) + + (result ? result : ScratchPad.recorded).should == [ + "Voici la ligne une.\nQui è la linea due.\n\n\n", + "Aquà está la lÃnea tres.\n" + "Hier ist Zeile ", + "vier.\n\nEstá aqui a linha cinco.\nHere is li", + "ne six.\n" + ] + end + end end end diff --git a/spec/ruby/core/io/shared/write.rb b/spec/ruby/core/io/shared/write.rb index 5e53d981c5..964064746a 100644 --- a/spec/ruby/core/io/shared/write.rb +++ b/spec/ruby/core/io/shared/write.rb @@ -69,16 +69,6 @@ describe :io_write, shared: true do -> { IOSpecs.closed_io.send(@method, "hello") }.should raise_error(IOError) end - it "does not modify the passed argument" do - File.open(@filename, "w") do |f| - f.set_encoding(Encoding::IBM437) - # A character whose codepoint differs between UTF-8 and IBM437 - f.write "Æ’".freeze - end - - File.binread(@filename).bytes.should == [159] - end - describe "on a pipe" do before :each do @r, @w = IO.pipe @@ -95,11 +85,11 @@ describe :io_write, shared: true do @r.read.should == "foo" end - # [ruby-core:90895] MJIT worker may leave fd open in a forked child. - # For instance, MJIT creates a worker before @r.close with fork(), @r.close happens, - # and the MJIT worker keeps the pipe open until the worker execve(). - # TODO: consider acquiring GVL from MJIT worker. - guard_not -> { defined?(RubyVM::JIT) && RubyVM::JIT.enabled? } do + # [ruby-core:90895] RJIT worker may leave fd open in a forked child. + # For instance, RJIT creates a worker before @r.close with fork(), @r.close happens, + # and the RJIT worker keeps the pipe open until the worker execve(). + # TODO: consider acquiring GVL from RJIT worker. + guard_not -> { defined?(RubyVM::RJIT) && RubyVM::RJIT.enabled? } do it "raises Errno::EPIPE if the read end is closed and does not die from SIGPIPE" do @r.close -> { @w.send(@method, "foo") }.should raise_error(Errno::EPIPE, /Broken pipe/) @@ -107,3 +97,58 @@ describe :io_write, shared: true do end end end + +describe :io_write_transcode, shared: true do + before :each do + @transcode_filename = tmp("io_write_transcode") + end + + after :each do + rm_r @transcode_filename + end + + it "transcodes the given string when the external encoding is set and neither is BINARY" do + utf8_str = "hello" + + File.open(@transcode_filename, "w", external_encoding: Encoding::UTF_16BE) do |file| + file.external_encoding.should == Encoding::UTF_16BE + file.send(@method, utf8_str) + end + + result = File.binread(@transcode_filename) + expected = [0, 104, 0, 101, 0, 108, 0, 108, 0, 111] # UTF-16BE bytes for "hello" + + result.bytes.should == expected + end + + it "transcodes the given string when the external encoding is set and the string encoding is BINARY" do + str = "été".b + + File.open(@transcode_filename, "w", external_encoding: Encoding::UTF_16BE) do |file| + file.external_encoding.should == Encoding::UTF_16BE + -> { file.send(@method, str) }.should raise_error(Encoding::UndefinedConversionError) + end + end +end + +describe :io_write_no_transcode, shared: true do + before :each do + @transcode_filename = tmp("io_write_no_transcode") + end + + after :each do + rm_r @transcode_filename + end + + it "does not transcode the given string even when the external encoding is set" do + utf8_str = "hello" + + File.open(@transcode_filename, "w", external_encoding: Encoding::UTF_16BE) do |file| + file.external_encoding.should == Encoding::UTF_16BE + file.send(@method, utf8_str) + end + + result = File.binread(@transcode_filename) + result.bytes.should == utf8_str.bytes + end +end diff --git a/spec/ruby/core/io/stat_spec.rb b/spec/ruby/core/io/stat_spec.rb index 58eba02b8f..717c45d0a3 100644 --- a/spec/ruby/core/io/stat_spec.rb +++ b/spec/ruby/core/io/stat_spec.rb @@ -3,7 +3,8 @@ require_relative 'fixtures/classes' describe "IO#stat" do before :each do - @io = IO.popen 'cat', "r+" + cmd = platform_is(:windows) ? 'rem' : 'cat' + @io = IO.popen cmd, "r+" end after :each do diff --git a/spec/ruby/core/io/sysread_spec.rb b/spec/ruby/core/io/sysread_spec.rb index 8201ad47ca..003bb9eb94 100644 --- a/spec/ruby/core/io/sysread_spec.rb +++ b/spec/ruby/core/io/sysread_spec.rb @@ -6,7 +6,7 @@ describe "IO#sysread on a file" do @file_name = tmp("IO_sysread_file") + $$.to_s File.open(@file_name, "w") do |f| # write some stuff - f.write("012345678901234567890123456789") + f.write("012345678901234567890123456789\nabcdef") end @file = File.open(@file_name, "r+") end @@ -21,25 +21,25 @@ describe "IO#sysread on a file" do end it "reads the specified number of bytes from the file to the buffer" do - buf = "" # empty buffer + buf = +"" # empty buffer @file.sysread(15, buf).should == buf buf.should == "012345678901234" @file.rewind - buf = "ABCDE" # small buffer + buf = +"ABCDE" # small buffer @file.sysread(15, buf).should == buf buf.should == "012345678901234" @file.rewind - buf = "ABCDE" * 5 # large buffer + buf = +"ABCDE" * 5 # large buffer @file.sysread(15, buf).should == buf buf.should == "012345678901234" end it "coerces the second argument to string and uses it as a buffer" do - buf = "ABCDE" + buf = +"ABCDE" (obj = mock("buff")).should_receive(:to_str).any_number_of_times.and_return(buf) @file.sysread(15, obj).should == buf buf.should == "012345678901234" @@ -84,6 +84,29 @@ describe "IO#sysread on a file" do it "raises IOError on closed stream" do -> { IOSpecs.closed_io.sysread(5) }.should raise_error(IOError) end + + it "immediately returns an empty string if the length argument is 0" do + @file.sysread(0).should == "" + end + + it "immediately returns the given buffer if the length argument is 0" do + buffer = +"existing content" + @file.sysread(0, buffer).should == buffer + buffer.should == "existing content" + end + + it "discards the existing buffer content upon successful read" do + buffer = +"existing content" + @file.sysread(11, buffer) + buffer.should == "01234567890" + end + + it "discards the existing buffer content upon error" do + buffer = +"existing content" + @file.seek(0, :END) + -> { @file.sysread(1, buffer) }.should raise_error(EOFError) + buffer.should be_empty + end end describe "IO#sysread" do @@ -100,4 +123,10 @@ describe "IO#sysread" do @write.syswrite "ab" @read.sysread(3).should == "ab" end + + guard_not -> { platform_is :windows and ruby_version_is ""..."3.2" } do # https://bugs.ruby-lang.org/issues/18880 + it "raises ArgumentError when length is less than 0" do + -> { @read.sysread(-1) }.should raise_error(ArgumentError) + end + end end diff --git a/spec/ruby/core/io/sysseek_spec.rb b/spec/ruby/core/io/sysseek_spec.rb index e631939bce..002f2a14eb 100644 --- a/spec/ruby/core/io/sysseek_spec.rb +++ b/spec/ruby/core/io/sysseek_spec.rb @@ -4,7 +4,7 @@ require_relative 'fixtures/classes' require_relative 'shared/pos' describe "IO#sysseek" do - it_behaves_like :io_set_pos, :seek + it_behaves_like :io_set_pos, :sysseek end describe "IO#sysseek" do diff --git a/spec/ruby/core/io/syswrite_spec.rb b/spec/ruby/core/io/syswrite_spec.rb index a28cc62174..8bf61a27c3 100644 --- a/spec/ruby/core/io/syswrite_spec.rb +++ b/spec/ruby/core/io/syswrite_spec.rb @@ -29,6 +29,16 @@ describe "IO#syswrite on a file" do end end + it "does not modify the passed argument" do + File.open(@filename, "w") do |f| + f.set_encoding(Encoding::IBM437) + # A character whose codepoint differs between UTF-8 and IBM437 + f.syswrite("Æ’".freeze) + end + + File.binread(@filename).bytes.should == [198, 146] + end + it "warns if called immediately after a buffered IO#write" do @file.write("abcde") -> { @file.syswrite("fghij") }.should complain(/syswrite/) @@ -68,4 +78,5 @@ end describe "IO#syswrite" do it_behaves_like :io_write, :syswrite + it_behaves_like :io_write_no_transcode, :syswrite end diff --git a/spec/ruby/core/io/try_convert_spec.rb b/spec/ruby/core/io/try_convert_spec.rb index 5fbd10b6fa..a9e99de7aa 100644 --- a/spec/ruby/core/io/try_convert_spec.rb +++ b/spec/ruby/core/io/try_convert_spec.rb @@ -38,7 +38,7 @@ describe "IO.try_convert" do it "raises a TypeError if the object does not return an IO from #to_io" do obj = mock("io") obj.should_receive(:to_io).and_return("io") - -> { IO.try_convert(obj) }.should raise_error(TypeError) + -> { IO.try_convert(obj) }.should raise_error(TypeError, "can't convert MockObject to IO (MockObject#to_io gives String)") end it "propagates an exception raised by #to_io" do diff --git a/spec/ruby/core/io/ungetbyte_spec.rb b/spec/ruby/core/io/ungetbyte_spec.rb index 776707205a..716743a6af 100644 --- a/spec/ruby/core/io/ungetbyte_spec.rb +++ b/spec/ruby/core/io/ungetbyte_spec.rb @@ -36,20 +36,10 @@ describe "IO#ungetbyte" do @io.getbyte.should == 97 end - ruby_version_is ''...'2.6.1' do - it "is an RangeError if the integer is not in 8bit" do - for i in [4095, 0x4f7574206f6620636861722072616e6765] do - -> { @io.ungetbyte(i) }.should raise_error(RangeError) - end - end - end - - ruby_version_is '2.6.1' do - it "never raises RangeError" do - for i in [4095, 0x4f7574206f6620636861722072616e67ff] do - @io.ungetbyte(i).should be_nil - @io.getbyte.should == 255 - end + it "never raises RangeError" do + for i in [4095, 0x4f7574206f6620636861722072616e67ff] do + @io.ungetbyte(i).should be_nil + @io.getbyte.should == 255 end end diff --git a/spec/ruby/core/io/ungetc_spec.rb b/spec/ruby/core/io/ungetc_spec.rb index a05d80ee9c..47a4e99ebf 100644 --- a/spec/ruby/core/io/ungetc_spec.rb +++ b/spec/ruby/core/io/ungetc_spec.rb @@ -103,19 +103,9 @@ describe "IO#ungetc" do -> { @io.sysread(1) }.should raise_error(IOError) end - ruby_version_is "0"..."3.0" do - it "does not affect the stream and returns nil when passed nil" do - @io.getc.should == ?V - @io.ungetc(nil) - @io.getc.should == ?o - end - end - - ruby_version_is "3.0" do - it "raises TypeError if passed nil" do - @io.getc.should == ?V - proc{@io.ungetc(nil)}.should raise_error(TypeError) - end + it "raises TypeError if passed nil" do + @io.getc.should == ?V + proc{@io.ungetc(nil)}.should raise_error(TypeError) end it "puts one or more characters back in the stream" do diff --git a/spec/ruby/core/io/write_nonblock_spec.rb b/spec/ruby/core/io/write_nonblock_spec.rb index a8b9ce0a36..c403c864fd 100644 --- a/spec/ruby/core/io/write_nonblock_spec.rb +++ b/spec/ruby/core/io/write_nonblock_spec.rb @@ -31,6 +31,16 @@ platform_is_not :windows do end end + it "does not modify the passed argument" do + File.open(@filename, "w") do |f| + f.set_encoding(Encoding::IBM437) + # A character whose codepoint differs between UTF-8 and IBM437 + f.write_nonblock("Æ’".freeze) + end + + File.binread(@filename).bytes.should == [198, 146] + end + it "checks if the file is writable if writing zero bytes" do -> { @readonly_file.write_nonblock("") @@ -40,6 +50,7 @@ platform_is_not :windows do describe "IO#write_nonblock" do it_behaves_like :io_write, :write_nonblock + it_behaves_like :io_write_no_transcode, :write_nonblock end end diff --git a/spec/ruby/core/io/write_spec.rb b/spec/ruby/core/io/write_spec.rb index 60e66e998f..4a26f8dbaf 100644 --- a/spec/ruby/core/io/write_spec.rb +++ b/spec/ruby/core/io/write_spec.rb @@ -24,10 +24,6 @@ describe "IO#write on a file" do -> { @readonly_file.write("") }.should_not raise_error end - it "returns a length of 0 when writing a blank string" do - @file.write('').should == 0 - end - before :each do @external = Encoding.default_external @internal = Encoding.default_internal @@ -40,10 +36,44 @@ describe "IO#write on a file" do Encoding.default_internal = @internal end + it "returns a length of 0 when writing a blank string" do + @file.write('').should == 0 + end + + it "returns a length of 0 when writing blank strings" do + @file.write('', '', '').should == 0 + end + + it "returns a length of 0 when passed no arguments" do + @file.write().should == 0 + end + it "returns the number of bytes written" do @file.write("hellø").should == 6 end + it "does not modify the passed argument" do + File.open(@filename, "w") do |f| + f.set_encoding(Encoding::IBM437) + # A character whose codepoint differs between UTF-8 and IBM437 + f.write("Æ’".freeze) + end + + File.binread(@filename).bytes.should == [159] + end + + it "does not modify arguments when passed multiple arguments and external encoding not set" do + a, b = "a".freeze, "b".freeze + + File.open(@filename, "w") do |f| + f.write(a, b) + end + + File.binread(@filename).bytes.should == [97, 98] + a.encoding.should == Encoding::UTF_8 + b.encoding.should == Encoding::UTF_8 + end + it "uses the encoding from the given option for non-ascii encoding" do File.open(@filename, "w", encoding: Encoding::UTF_32LE) do |file| file.write("hi").should == 8 @@ -51,8 +81,25 @@ describe "IO#write on a file" do File.binread(@filename).should == "h\u0000\u0000\u0000i\u0000\u0000\u0000" end - it "uses an :open_args option" do - IO.write(@filename, 'hi', open_args: ["w", nil, {encoding: Encoding::UTF_32LE}]).should == 8 + it "uses the encoding from the given option for non-ascii encoding even if in binary mode" do + File.open(@filename, "w", encoding: Encoding::UTF_32LE, binmode: true) do |file| + file.should.binmode? + file.write("hi").should == 8 + end + File.binread(@filename).should == "h\u0000\u0000\u0000i\u0000\u0000\u0000" + + File.open(@filename, "wb", encoding: Encoding::UTF_32LE) do |file| + file.should.binmode? + file.write("hi").should == 8 + end + File.binread(@filename).should == "h\u0000\u0000\u0000i\u0000\u0000\u0000" + end + + it "uses the encoding from the given option for non-ascii encoding when multiple arguments passes" do + File.open(@filename, "w", encoding: Encoding::UTF_32LE) do |file| + file.write("h", "i").should == 8 + end + File.binread(@filename).should == "h\u0000\u0000\u0000i\u0000\u0000\u0000" end it "raises a invalid byte sequence error if invalid bytes are being written" do @@ -72,6 +119,20 @@ describe "IO#write on a file" do res = "H#{ë}ll#{ö}" File.binread(@filename).should == res.force_encoding(Encoding::BINARY) end + + platform_is_not :windows do + it "writes binary data if no encoding is given and multiple arguments passed" do + File.open(@filename, "w") do |file| + file.write("\x87".b, "Ä…") # 0x87 isn't a valid UTF-8 binary representation of a character + end + File.binread(@filename).bytes.should == [0x87, 0xC4, 0x85] + + File.open(@filename, "w") do |file| + file.write("\x61".encode("utf-32le"), "Ä…") + end + File.binread(@filename).bytes.should == [0x61, 0x00, 0x00, 0x00, 0xC4, 0x85] + end + end end describe "IO.write" do @@ -86,10 +147,38 @@ describe "IO.write" do File.read(@filename).should == "\0\0hi" end + it "requires mode to be specified in :open_args" do + -> { + IO.write(@filename, 'hi', open_args: [{encoding: Encoding::UTF_32LE, binmode: true}]) + }.should raise_error(IOError, "not opened for writing") + + IO.write(@filename, 'hi', open_args: ["w", {encoding: Encoding::UTF_32LE, binmode: true}]).should == 8 + IO.write(@filename, 'hi', open_args: [{encoding: Encoding::UTF_32LE, binmode: true, mode: "w"}]).should == 8 + end + + it "requires mode to be specified in :open_args even if flags option passed" do + -> { + IO.write(@filename, 'hi', open_args: [{encoding: Encoding::UTF_32LE, binmode: true, flags: File::CREAT}]) + }.should raise_error(IOError, "not opened for writing") + + IO.write(@filename, 'hi', open_args: ["w", {encoding: Encoding::UTF_32LE, binmode: true, flags: File::CREAT}]).should == 8 + IO.write(@filename, 'hi', open_args: [{encoding: Encoding::UTF_32LE, binmode: true, flags: File::CREAT, mode: "w"}]).should == 8 + end + it "uses the given encoding and returns the number of bytes written" do IO.write(@filename, 'hi', mode: "w", encoding: Encoding::UTF_32LE).should == 8 end + it "raises ArgumentError if encoding is specified in mode parameter and is given as :encoding option" do + -> { + IO.write(@filename, 'hi', mode: "w:UTF-16LE:UTF-16BE", encoding: Encoding::UTF_32LE) + }.should raise_error(ArgumentError, "encoding specified twice") + + -> { + IO.write(@filename, 'hi', mode: "w:UTF-16BE", encoding: Encoding::UTF_32LE) + }.should raise_error(ArgumentError, "encoding specified twice") + end + it "writes the file with the permissions in the :perm parameter" do rm_r @filename IO.write(@filename, 'write :perm spec', mode: "w", perm: 0o755).should == 16 @@ -114,23 +203,39 @@ describe "IO.write" do rm_r @fifo end - it "writes correctly" do - thr = Thread.new do - IO.read(@fifo) - end - begin - string = "hi" - IO.write(@fifo, string).should == string.length - ensure - thr.join + # rb_cloexec_open() is currently missing a retry on EINTR. + # @ioquatix is looking into fixing it. Quarantined until it's done. + quarantine! do + it "writes correctly" do + thr = Thread.new do + IO.read(@fifo) + end + begin + string = "hi" + IO.write(@fifo, string).should == string.length + ensure + thr.join + end end end end + + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19630 + it "warns about deprecation given a path with a pipe" do + -> { + -> { + IO.write("|cat", "xxx") + }.should output_to_fd("xxx") + }.should complain(/IO process creation with a leading '\|'/) + end + end end end describe "IO#write" do it_behaves_like :io_write, :write + it_behaves_like :io_write_transcode, :write it "accepts multiple arguments" do IO.pipe do |r, w| @@ -168,3 +273,25 @@ platform_is :windows do end end end + +describe "IO#write on STDOUT" do + # https://bugs.ruby-lang.org/issues/14413 + platform_is_not :windows do + it "raises SignalException SIGPIPE if the stream is closed instead of Errno::EPIPE like other IOs" do + stderr_file = tmp("stderr") + begin + IO.popen([*ruby_exe, "-e", "loop { puts :ok }"], "r", err: stderr_file) do |io| + io.gets.should == "ok\n" + io.close + end + status = $? + status.should_not.success? + status.should.signaled? + Signal.signame(status.termsig).should == 'PIPE' + File.read(stderr_file).should.empty? + ensure + rm_r stderr_file + end + end + end +end diff --git a/spec/ruby/core/kernel/Complex_spec.rb b/spec/ruby/core/kernel/Complex_spec.rb index 4f043526b8..346d50ab5e 100644 --- a/spec/ruby/core/kernel/Complex_spec.rb +++ b/spec/ruby/core/kernel/Complex_spec.rb @@ -1,4 +1,6 @@ require_relative '../../spec_helper' +require_relative '../../shared/kernel/complex' +require_relative 'fixtures/Complex' describe "Kernel.Complex()" do describe "when passed [Complex, Complex]" do @@ -58,7 +60,92 @@ describe "Kernel.Complex()" do end end - describe "when passed a String" do + describe "when passed [String]" do + it_behaves_like :kernel_complex, :Complex_method, KernelSpecs + + context "invalid argument" do + it "raises Encoding::CompatibilityError if String is in not ASCII-compatible encoding" do + -> { + Complex("79+4i".encode("UTF-16")) + }.should raise_error(Encoding::CompatibilityError, "ASCII incompatible encoding: UTF-16") + end + + it "raises ArgumentError for unrecognised Strings" do + -> { + Complex("ruby") + }.should raise_error(ArgumentError, 'invalid value for convert(): "ruby"') + end + + it "raises ArgumentError for trailing garbage" do + -> { + Complex("79+4iruby") + }.should raise_error(ArgumentError, 'invalid value for convert(): "79+4iruby"') + end + + it "does not understand Float::INFINITY" do + -> { + Complex("Infinity") + }.should raise_error(ArgumentError, 'invalid value for convert(): "Infinity"') + + -> { + Complex("-Infinity") + }.should raise_error(ArgumentError, 'invalid value for convert(): "-Infinity"') + end + + it "does not understand Float::NAN" do + -> { + Complex("NaN") + }.should raise_error(ArgumentError, 'invalid value for convert(): "NaN"') + end + + it "does not understand a sequence of _" do + -> { + Complex("7__9+4__0i") + }.should raise_error(ArgumentError, 'invalid value for convert(): "7__9+4__0i"') + end + + it "does not allow null-byte" do + -> { + Complex("1-2i\0") + }.should raise_error(ArgumentError, "string contains null byte") + end + end + + context "invalid argument and exception: false passed" do + it "raises Encoding::CompatibilityError if String is in not ASCII-compatible encoding" do + -> { + Complex("79+4i".encode("UTF-16"), exception: false) + }.should raise_error(Encoding::CompatibilityError, "ASCII incompatible encoding: UTF-16") + end + + it "returns nil for unrecognised Strings" do + Complex("ruby", exception: false).should == nil + end + + it "returns nil when trailing garbage" do + Complex("79+4iruby", exception: false).should == nil + end + + it "returns nil for Float::INFINITY" do + Complex("Infinity", exception: false).should == nil + Complex("-Infinity", exception: false).should == nil + end + + it "returns nil for Float::NAN" do + Complex("NaN", exception: false).should == nil + end + + it "returns nil when there is a sequence of _" do + Complex("7__9+4__0i", exception: false).should == nil + end + + it "returns nil when String contains null-byte" do + Complex("1-2i\0", exception: false).should == nil + end + end + end + + describe "when passes [String, String]" do it "needs to be reviewed for spec completeness" end @@ -182,4 +269,8 @@ describe "Kernel.Complex()" do end end end + + it "freezes its result" do + Complex(1).frozen?.should == true + end end diff --git a/spec/ruby/core/kernel/Float_spec.rb b/spec/ruby/core/kernel/Float_spec.rb index 015bcb33d6..0f83cb5824 100644 --- a/spec/ruby/core/kernel/Float_spec.rb +++ b/spec/ruby/core/kernel/Float_spec.rb @@ -41,7 +41,7 @@ describe :kernel_float, shared: true do end it "converts Strings to floats without calling #to_f" do - string = "10" + string = +"10" string.should_not_receive(:to_f) @object.send(:Float, string).should == 10.0 end diff --git a/spec/ruby/core/kernel/Integer_spec.rb b/spec/ruby/core/kernel/Integer_spec.rb index 2c78e27428..74dd3e0dd2 100644 --- a/spec/ruby/core/kernel/Integer_spec.rb +++ b/spec/ruby/core/kernel/Integer_spec.rb @@ -145,7 +145,7 @@ describe :kernel_integer, shared: true do end end -describe "Integer() given a String", shared: true do +describe :kernel_integer_string, shared: true do it "raises an ArgumentError if the String is a null byte" do -> { Integer("\0") }.should raise_error(ArgumentError) end @@ -348,7 +348,7 @@ describe "Integer() given a String", shared: true do end end -describe "Integer() given a String and base", shared: true do +describe :kernel_integer_string_base, shared: true do it "raises an ArgumentError if the String is a null byte" do -> { Integer("\0", 2) }.should raise_error(ArgumentError) end @@ -573,9 +573,31 @@ describe "Integer() given a String and base", shared: true do -> { Integer("0#{d}1", base) }.should raise_error(ArgumentError) end end + end + + it "raises an ArgumentError if a base is given for a non-String value" do + -> { Integer(98, 15) }.should raise_error(ArgumentError) + end + + it "tries to convert the base to an integer using to_int" do + obj = mock('8') + obj.should_receive(:to_int).and_return(8) + + Integer("777", obj).should == 0777 + end + + # https://bugs.ruby-lang.org/issues/19349 + ruby_version_is ''...'3.3' do + it "ignores the base if it is not an integer and does not respond to #to_i" do + Integer("777", "8").should == 777 + end + end - it "raises an ArgumentError if a base is given for a non-String value" do - -> { Integer(98, 15) }.should raise_error(ArgumentError) + ruby_version_is '3.3' do + it "raises a TypeError if it is not an integer and does not respond to #to_i" do + -> { + Integer("777", "8") + }.should raise_error(TypeError, "no implicit conversion of String into Integer") end end @@ -777,9 +799,9 @@ describe "Kernel.Integer" do # TODO: fix these specs it_behaves_like :kernel_integer, :Integer, Kernel - it_behaves_like "Integer() given a String", :Integer + it_behaves_like :kernel_integer_string, :Integer - it_behaves_like "Integer() given a String and base", :Integer + it_behaves_like :kernel_integer_string_base, :Integer it "is a public method" do Kernel.Integer(10).should == 10 @@ -791,9 +813,9 @@ describe "Kernel#Integer" do # TODO: fix these specs it_behaves_like :kernel_integer, :Integer, Object.new - it_behaves_like "Integer() given a String", :Integer + it_behaves_like :kernel_integer_string, :Integer - it_behaves_like "Integer() given a String and base", :Integer + it_behaves_like :kernel_integer_string_base, :Integer it "is a private method" do Kernel.should have_private_instance_method(:Integer) diff --git a/spec/ruby/core/kernel/String_spec.rb b/spec/ruby/core/kernel/String_spec.rb index 47ee797be5..7caec6eda5 100644 --- a/spec/ruby/core/kernel/String_spec.rb +++ b/spec/ruby/core/kernel/String_spec.rb @@ -78,7 +78,7 @@ describe :kernel_String, shared: true do end it "returns the same object if it is already a String" do - string = "Hello" + string = +"Hello" string.should_not_receive(:to_s) string2 = @object.send(@method, string) string.should equal(string2) diff --git a/spec/ruby/core/kernel/__dir___spec.rb b/spec/ruby/core/kernel/__dir___spec.rb index 324792a408..242adbf48b 100644 --- a/spec/ruby/core/kernel/__dir___spec.rb +++ b/spec/ruby/core/kernel/__dir___spec.rb @@ -19,19 +19,9 @@ describe "Kernel#__dir__" do end end - ruby_version_is ""..."3.0" do - context "when used in eval with top level binding" do - it "returns the real name of the directory containing the currently-executing file" do - eval("__dir__", binding).should == File.realpath(File.dirname(__FILE__)) - end - end - end - - ruby_version_is "3.0" do - context "when used in eval with top level binding" do - it "returns nil" do - eval("__dir__", binding).should == nil - end + context "when used in eval with top level binding" do + it "returns nil" do + eval("__dir__", binding).should == nil end end end diff --git a/spec/ruby/core/kernel/at_exit_spec.rb b/spec/ruby/core/kernel/at_exit_spec.rb index a784c1ae17..ebd9a71d15 100644 --- a/spec/ruby/core/kernel/at_exit_spec.rb +++ b/spec/ruby/core/kernel/at_exit_spec.rb @@ -1,67 +1,16 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative '../../shared/kernel/at_exit' describe "Kernel.at_exit" do + it_behaves_like :kernel_at_exit, :at_exit + it "is a private method" do Kernel.should have_private_instance_method(:at_exit) end - it "runs after all other code" do - ruby_exe("at_exit {print 5}; print 6").should == "65" - end - - it "runs in reverse order of registration" do - code = "at_exit {print 4};at_exit {print 5}; print 6; at_exit {print 7}" - ruby_exe(code).should == "6754" - end - - it "allows calling exit inside at_exit handler" do - code = "at_exit {print 3}; at_exit {print 4; exit; print 5}; at_exit {print 6}" - ruby_exe(code).should == "643" - end - - it "gives access to the last raised exception" do - code = <<-EOC - at_exit do - puts "The exception matches: \#{$! == $exception} (message=\#{$!.message})" - end - - begin - raise "foo" - rescue => $exception - raise - end - EOC - - result = ruby_exe(code, args: "2>&1", exit_status: 1) - result.lines.should.include?("The exception matches: true (message=foo)\n") - end - - it "both exceptions in at_exit and in the main script are printed" do - code = 'at_exit { raise "at_exit_error" }; raise "main_script_error"' - result = ruby_exe(code, args: "2>&1", exit_status: 1) - result.should.include?('at_exit_error (RuntimeError)') - result.should.include?('main_script_error (RuntimeError)') - end - - it "decides the exit status if both at_exit and the main script raise SystemExit" do - ruby_exe('at_exit { exit 43 }; exit 42', args: "2>&1", exit_status: 43) - $?.exitstatus.should == 43 - end - - it "runs all at_exit even if some raise exceptions" do - code = 'at_exit { STDERR.puts "last" }; at_exit { exit 43 }; at_exit { STDERR.puts "first" }; exit 42' - result = ruby_exe(code, args: "2>&1", exit_status: 43) - result.should == "first\nlast\n" - $?.exitstatus.should == 43 - end - - it "runs at_exit handlers even if the main script fails to parse" do - script = fixture(__FILE__, "at_exit.rb") - result = ruby_exe('{', options: "-r#{script}", args: "2>&1", exit_status: 1) - $?.should_not.success? - result.should.include?("at_exit ran\n") - result.should.include?("syntax error") + it "raises ArgumentError if called without a block" do + -> { at_exit }.should raise_error(ArgumentError, "called without a block") end end diff --git a/spec/ruby/core/kernel/caller_locations_spec.rb b/spec/ruby/core/kernel/caller_locations_spec.rb index 3ec8f0f432..aaacd9a910 100644 --- a/spec/ruby/core/kernel/caller_locations_spec.rb +++ b/spec/ruby/core/kernel/caller_locations_spec.rb @@ -34,12 +34,10 @@ describe 'Kernel#caller_locations' do locations2.map(&:to_s).should == locations1[2..-1].map(&:to_s) end - ruby_version_is "2.7" do - it "works with beginless ranges" do - locations1 = caller_locations(0) - locations2 = caller_locations(eval("(...5)")) - locations2.map(&:to_s)[eval("(2..)")].should == locations1[eval("(...5)")].map(&:to_s)[eval("(2..)")] - end + it "works with beginless ranges" do + locations1 = caller_locations(0) + locations2 = caller_locations((...5)) + locations2.map(&:to_s)[eval("(2..)")].should == locations1[(...5)].map(&:to_s)[eval("(2..)")] end it "can be called with a range whose end is negative" do @@ -73,14 +71,28 @@ describe 'Kernel#caller_locations' do end guard -> { Kernel.instance_method(:tap).source_location } do - it "includes core library methods defined in Ruby" do - file, line = Kernel.instance_method(:tap).source_location - file.should.start_with?('<internal:') - - loc = nil - tap { loc = caller_locations(1, 1)[0] } - loc.label.should == "tap" - loc.path.should.start_with? "<internal:" + ruby_version_is ""..."3.4" do + it "includes core library methods defined in Ruby" do + file, line = Kernel.instance_method(:tap).source_location + file.should.start_with?('<internal:') + + loc = nil + tap { loc = caller_locations(1, 1)[0] } + loc.label.should == "tap" + loc.path.should.start_with? "<internal:" + end + end + + ruby_version_is "3.4" do + it "includes core library methods defined in Ruby" do + file, line = Kernel.instance_method(:tap).source_location + file.should.start_with?('<internal:') + + loc = nil + tap { loc = caller_locations(1, 1)[0] } + loc.label.should == "Kernel#tap" + loc.path.should.start_with? "<internal:" + end end end end diff --git a/spec/ruby/core/kernel/caller_spec.rb b/spec/ruby/core/kernel/caller_spec.rb index dba65ddcb0..c3d63ccb00 100644 --- a/spec/ruby/core/kernel/caller_spec.rb +++ b/spec/ruby/core/kernel/caller_spec.rb @@ -38,10 +38,9 @@ describe 'Kernel#caller' do it "returns an Array with the block given to #at_exit at the base of the stack" do path = fixture(__FILE__, "caller_at_exit.rb") lines = ruby_exe(path).lines - lines.should == [ - "#{path}:6:in `foo'\n", - "#{path}:2:in `block in <main>'\n" - ] + lines.size.should == 2 + lines[0].should =~ /\A#{path}:6:in [`'](?:Object#)?foo'\n\z/ + lines[1].should =~ /\A#{path}:2:in [`']block in <main>'\n\z/ end it "works with endless ranges" do @@ -50,12 +49,10 @@ describe 'Kernel#caller' do locations2.map(&:to_s).should == locations1[2..-1].map(&:to_s) end - ruby_version_is "2.7" do - it "works with beginless ranges" do - locations1 = KernelSpecs::CallerTest.locations(0) - locations2 = KernelSpecs::CallerTest.locations(eval("(..5)")) - locations2.map(&:to_s)[eval("(2..)")].should == locations1[eval("(..5)")].map(&:to_s)[eval("(2..)")] - end + it "works with beginless ranges" do + locations1 = KernelSpecs::CallerTest.locations(0) + locations2 = KernelSpecs::CallerTest.locations((..5)) + locations2.map(&:to_s)[eval("(2..)")].should == locations1[(..5)].map(&:to_s)[eval("(2..)")] end guard -> { Kernel.instance_method(:tap).source_location } do @@ -65,8 +62,7 @@ describe 'Kernel#caller' do loc = nil tap { loc = caller(1, 1)[0] } - loc.should.end_with? "in `tap'" - loc.should.start_with? "<internal:" + loc.should =~ /\A<internal:.*in [`'](?:Kernel#)?tap'\z/ end end end diff --git a/spec/ruby/core/kernel/catch_spec.rb b/spec/ruby/core/kernel/catch_spec.rb index 4060172429..9f59d3b384 100644 --- a/spec/ruby/core/kernel/catch_spec.rb +++ b/spec/ruby/core/kernel/catch_spec.rb @@ -35,7 +35,7 @@ describe "Kernel.catch" do end it "raises an ArgumentError if a String with different identity is thrown" do - -> { catch("exit") { throw "exit" } }.should raise_error(ArgumentError) + -> { catch("exit".dup) { throw "exit".dup } }.should raise_error(ArgumentError) end it "catches a Symbol when thrown a matching Symbol" do diff --git a/spec/ruby/core/kernel/class_spec.rb b/spec/ruby/core/kernel/class_spec.rb index 2725bde19b..b1d9df1671 100644 --- a/spec/ruby/core/kernel/class_spec.rb +++ b/spec/ruby/core/kernel/class_spec.rb @@ -19,7 +19,7 @@ describe "Kernel#class" do end it "returns the first non-singleton class" do - a = "hello" + a = +"hello" def a.my_singleton_method; end a.class.should equal(String) end diff --git a/spec/ruby/core/kernel/clone_spec.rb b/spec/ruby/core/kernel/clone_spec.rb index c18af4a490..5adcbbe603 100644 --- a/spec/ruby/core/kernel/clone_spec.rb +++ b/spec/ruby/core/kernel/clone_spec.rb @@ -28,27 +28,88 @@ describe "Kernel#clone" do clone.class.should equal klass end - it "copies frozen state from the original" do - o2 = @obj.clone - @obj.freeze - o3 = @obj.clone + describe "with no arguments" do + it "copies frozen state from the original" do + o2 = @obj.clone + o2.should_not.frozen? - o2.should_not.frozen? - o3.should.frozen? + @obj.freeze + o3 = @obj.clone + o3.should.frozen? + end + + it 'copies frozen?' do + o = ''.freeze.clone + o.frozen?.should be_true + end end - ruby_version_is '3.0' do - it 'takes an freeze: true option to frozen copy' do - @obj.clone(freeze: true).should.frozen? + describe "with freeze: nil" do + it "copies frozen state from the original, like #clone without arguments" do + o2 = @obj.clone(freeze: nil) + o2.should_not.frozen? + + @obj.freeze + o3 = @obj.clone(freeze: nil) + o3.should.frozen? + end + + it "copies frozen?" do + o = "".freeze.clone(freeze: nil) + o.frozen?.should be_true + end + end + + describe "with freeze: true" do + it 'makes a frozen copy if the original is frozen' do @obj.freeze @obj.clone(freeze: true).should.frozen? end + + it 'freezes the copy even if the original was not frozen' do + @obj.clone(freeze: true).should.frozen? + end + + it "calls #initialize_clone with kwargs freeze: true" do + obj = KernelSpecs::CloneFreeze.new + obj.clone(freeze: true) + ScratchPad.recorded.should == [obj, { freeze: true }] + end + + it "calls #initialize_clone with kwargs freeze: true even if #initialize_clone only takes a single argument" do + obj = KernelSpecs::Clone.new + -> { obj.clone(freeze: true) }.should raise_error(ArgumentError, 'wrong number of arguments (given 2, expected 1)') + end end - it 'takes an freeze: false option to not return frozen copy' do - @obj.clone(freeze: false).should_not.frozen? - @obj.freeze - @obj.clone(freeze: false).should_not.frozen? + describe "with freeze: false" do + it 'does not freeze the copy if the original is frozen' do + @obj.freeze + @obj.clone(freeze: false).should_not.frozen? + end + + it 'does not freeze the copy if the original is not frozen' do + @obj.clone(freeze: false).should_not.frozen? + end + + it "calls #initialize_clone with kwargs freeze: false" do + obj = KernelSpecs::CloneFreeze.new + obj.clone(freeze: false) + ScratchPad.recorded.should == [obj, { freeze: false }] + end + + it "calls #initialize_clone with kwargs freeze: false even if #initialize_clone only takes a single argument" do + obj = KernelSpecs::Clone.new + -> { obj.clone(freeze: false) }.should raise_error(ArgumentError, 'wrong number of arguments (given 2, expected 1)') + end + end + + describe "with freeze: anything else" do + it 'raises ArgumentError when passed not true/false/nil' do + -> { @obj.clone(freeze: 1) }.should raise_error(ArgumentError, /unexpected value for freeze: Integer/) + -> { @obj.clone(freeze: "") }.should raise_error(ArgumentError, /unexpected value for freeze: String/) + -> { @obj.clone(freeze: Object.new) }.should raise_error(ArgumentError, /unexpected value for freeze: Object/) + end end it "copies instance variables" do @@ -113,16 +174,4 @@ describe "Kernel#clone" do cloned.bar.should == ['a'] end - - it 'copies frozen?' do - o = ''.freeze.clone - o.frozen?.should be_true - end - - ruby_version_is ''...'2.7' do - it 'copies tainted?' do - o = ''.taint.clone - o.tainted?.should be_true - end - end end diff --git a/spec/ruby/core/kernel/define_singleton_method_spec.rb b/spec/ruby/core/kernel/define_singleton_method_spec.rb index dc77c3e6f8..24acec84f5 100644 --- a/spec/ruby/core/kernel/define_singleton_method_spec.rb +++ b/spec/ruby/core/kernel/define_singleton_method_spec.rb @@ -96,4 +96,25 @@ describe "Kernel#define_singleton_method" do o.define(:foo) { raise "not used" } }.should raise_error(ArgumentError) end + + it "always defines the method with public visibility" do + cls = Class.new + def cls.define(name, &block) + private + define_singleton_method(name, &block) + end + + -> { + suppress_warning do + cls.define(:foo) { :ok } + end + cls.foo.should == :ok + }.should_not raise_error(NoMethodError) + end + + it "cannot define a singleton method with a frozen singleton class" do + o = Object.new + o.freeze + -> { o.define_singleton_method(:foo) { 1 } }.should raise_error(FrozenError) + end end diff --git a/spec/ruby/core/kernel/eval_spec.rb b/spec/ruby/core/kernel/eval_spec.rb index 1e2764a4de..454bc4a58e 100644 --- a/spec/ruby/core/kernel/eval_spec.rb +++ b/spec/ruby/core/kernel/eval_spec.rb @@ -135,7 +135,7 @@ describe "Kernel#eval" do it "includes file and line information in syntax error" do expected = 'speccing.rb' -> { - eval('if true',TOPLEVEL_BINDING, expected) + eval('if true', TOPLEVEL_BINDING, expected) }.should raise_error(SyntaxError) { |e| e.message.should =~ /#{expected}:1:.+/ } @@ -144,7 +144,7 @@ describe "Kernel#eval" do it "evaluates string with given filename and negative linenumber" do expected_file = 'speccing.rb' -> { - eval('if true',TOPLEVEL_BINDING, expected_file, -100) + eval('if true', TOPLEVEL_BINDING, expected_file, -100) }.should raise_error(SyntaxError) { |e| e.message.should =~ /#{expected_file}:-100:.+/ } @@ -159,18 +159,7 @@ describe "Kernel#eval" do end end - ruby_version_is ""..."3.0" do - it "uses the filename of the binding if none is provided" do - eval("__FILE__").should == "(eval)" - suppress_warning {eval("__FILE__", binding)}.should == __FILE__ - eval("__FILE__", binding, "success").should == "success" - suppress_warning {eval("eval '__FILE__', binding")}.should == "(eval)" - suppress_warning {eval("eval '__FILE__', binding", binding)}.should == __FILE__ - suppress_warning {eval("eval '__FILE__', binding", binding, 'success')}.should == 'success' - end - end - - ruby_version_is "3.0" do + ruby_version_is ""..."3.3" do it "uses (eval) filename if none is provided" do eval("__FILE__").should == "(eval)" eval("__FILE__", binding).should == "(eval)" @@ -180,8 +169,27 @@ describe "Kernel#eval" do eval("eval '__FILE__', binding", binding, 'success').should == '(eval)' eval("eval '__FILE__', binding, 'success'", binding).should == 'success' end + + it 'uses (eval) for __FILE__ and 1 for __LINE__ with a binding argument' do + eval("[__FILE__, __LINE__]", binding).should == ["(eval)", 1] + end end + ruby_version_is "3.3" do + it "uses (eval at __FILE__:__LINE__) if none is provided" do + eval("__FILE__").should == "(eval at #{__FILE__}:#{__LINE__})" + eval("__FILE__", binding).should == "(eval at #{__FILE__}:#{__LINE__})" + eval("__FILE__", binding, "success").should == "success" + eval("eval '__FILE__', binding").should == "(eval at (eval at #{__FILE__}:#{__LINE__}):1)" + eval("eval '__FILE__', binding", binding).should == "(eval at (eval at #{__FILE__}:#{__LINE__}):1)" + eval("eval '__FILE__', binding", binding, 'success').should == "(eval at success:1)" + eval("eval '__FILE__', binding, 'success'", binding).should == 'success' + end + + it 'uses (eval at __FILE__:__LINE__) for __FILE__ and 1 for __LINE__ with a binding argument' do + eval("[__FILE__, __LINE__]", binding).should == ["(eval at #{__FILE__}:#{__LINE__})", 1] + end + end # Found via Rubinius bug github:#149 it "does not alter the value of __FILE__ in the binding" do first_time = EvalSpecs.call_eval @@ -218,6 +226,20 @@ describe "Kernel#eval" do -> { eval("return :eval") }.call.should == :eval end + it "returns from the method calling #eval when evaluating 'return'" do + def eval_return(n) + eval("return n*2") + end + -> { eval_return(3) }.call.should == 6 + end + + it "returns from the method calling #eval when evaluating 'return' in BEGIN" do + def eval_return(n) + eval("BEGIN {return n*3}") + end + -> { eval_return(4) }.call.should == 12 + end + it "unwinds through a Proc-style closure and returns from a lambda-style closure in the closure chain" do code = fixture __FILE__, "eval_return_with_lambda.rb" ruby_exe(code).chomp.should == "a,b,c,eval,f" @@ -239,6 +261,19 @@ describe "Kernel#eval" do end end + it "makes flip-flop operator work correctly" do + ScratchPad.record [] + + eval "10.times { |i| ScratchPad << i if (i == 4)...(i == 4) }" + ScratchPad.recorded.should == [4, 5, 6, 7, 8, 9] + + ScratchPad.clear + end + + it "returns nil if given an empty string" do + eval("").should == nil + end + # See language/magic_comment_spec.rb for more magic comments specs describe "with a magic encoding comment" do it "uses the magic comment encoding for the encoding of literal strings" do @@ -315,12 +350,11 @@ CODE end it "allows a magic encoding comment and a subsequent frozen_string_literal magic comment" do - # Make sure frozen_string_literal is not default true - eval("'foo'".b).frozen?.should be_false + frozen_string_default = "test".frozen? code = <<CODE.b # encoding: UTF-8 -# frozen_string_literal: true +# frozen_string_literal: #{!frozen_string_default} class EvalSpecs VÏ€string = "frozen" end @@ -330,7 +364,7 @@ CODE EvalSpecs.constants(false).should include(:"VÏ€string") EvalSpecs::VÏ€string.should == "frozen" EvalSpecs::VÏ€string.encoding.should == Encoding::UTF_8 - EvalSpecs::VÏ€string.frozen?.should be_true + EvalSpecs::VÏ€string.frozen?.should == !frozen_string_default end it "allows a magic encoding comment and a frozen_string_literal magic comment on the same line in emacs style" do @@ -349,8 +383,9 @@ CODE end it "ignores the magic encoding comment if it is after a frozen_string_literal magic comment" do + frozen_string_default = "test".frozen? code = <<CODE.b -# frozen_string_literal: true +# frozen_string_literal: #{!frozen_string_default} # encoding: UTF-8 class EvalSpecs VÏ€frozen_first = "frozen" @@ -364,23 +399,24 @@ CODE value = EvalSpecs.const_get(binary_constant) value.should == "frozen" value.encoding.should == Encoding::BINARY - value.frozen?.should be_true + value.frozen?.should == !frozen_string_default end it "ignores the frozen_string_literal magic comment if it appears after a token and warns if $VERBOSE is true" do + frozen_string_default = "test".frozen? code = <<CODE some_token_before_magic_comment = :anything -# frozen_string_literal: true +# frozen_string_literal: #{!frozen_string_default} class EvalSpecs VÏ€string_not_frozen = "not frozen" end CODE - -> { eval(code) }.should complain(/warning: `frozen_string_literal' is ignored after any tokens/, verbose: true) - EvalSpecs::VÏ€string_not_frozen.frozen?.should be_false + -> { eval(code) }.should complain(/warning: [`']frozen_string_literal' is ignored after any tokens/, verbose: true) + EvalSpecs::VÏ€string_not_frozen.frozen?.should == frozen_string_default EvalSpecs.send :remove_const, :VÏ€string_not_frozen -> { eval(code) }.should_not complain(verbose: false) - EvalSpecs::VÏ€string_not_frozen.frozen?.should be_false + EvalSpecs::VÏ€string_not_frozen.frozen?.should == frozen_string_default EvalSpecs.send :remove_const, :VÏ€string_not_frozen end end diff --git a/spec/ruby/core/kernel/exec_spec.rb b/spec/ruby/core/kernel/exec_spec.rb index 1b4a7ae6f4..3d9520ad67 100644 --- a/spec/ruby/core/kernel/exec_spec.rb +++ b/spec/ruby/core/kernel/exec_spec.rb @@ -7,12 +7,12 @@ describe "Kernel#exec" do end it "runs the specified command, replacing current process" do - ruby_exe('exec "echo hello"; puts "fail"', escape: true).should == "hello\n" + ruby_exe('exec "echo hello"; puts "fail"').should == "hello\n" end end describe "Kernel.exec" do it "runs the specified command, replacing current process" do - ruby_exe('Kernel.exec "echo hello"; puts "fail"', escape: true).should == "hello\n" + ruby_exe('Kernel.exec "echo hello"; puts "fail"').should == "hello\n" end end diff --git a/spec/ruby/core/kernel/exit_spec.rb b/spec/ruby/core/kernel/exit_spec.rb index f168cb375e..93cec3fee5 100644 --- a/spec/ruby/core/kernel/exit_spec.rb +++ b/spec/ruby/core/kernel/exit_spec.rb @@ -10,6 +10,10 @@ describe "Kernel#exit" do it_behaves_like :process_exit, :exit, KernelSpecs::Method.new end +describe "Kernel.exit" do + it_behaves_like :process_exit, :exit, Kernel +end + describe "Kernel#exit!" do it "is a private method" do Kernel.should have_private_instance_method(:exit!) @@ -18,10 +22,6 @@ describe "Kernel#exit!" do it_behaves_like :process_exit!, :exit!, "self" end -describe "Kernel.exit" do - it_behaves_like :process_exit, :exit, Kernel -end - describe "Kernel.exit!" do - it_behaves_like :process_exit!, :exit!, Kernel + it_behaves_like :process_exit!, :exit!, "Kernel" end diff --git a/spec/ruby/core/kernel/fixtures/Complex.rb b/spec/ruby/core/kernel/fixtures/Complex.rb new file mode 100644 index 0000000000..bf14d55ad5 --- /dev/null +++ b/spec/ruby/core/kernel/fixtures/Complex.rb @@ -0,0 +1,5 @@ +module KernelSpecs + def self.Complex_method(string) + Complex(string) + end +end diff --git a/spec/ruby/core/kernel/fixtures/at_exit.rb b/spec/ruby/core/kernel/fixtures/at_exit.rb deleted file mode 100644 index 9c11a7ad6c..0000000000 --- a/spec/ruby/core/kernel/fixtures/at_exit.rb +++ /dev/null @@ -1,3 +0,0 @@ -at_exit do - STDERR.puts "at_exit ran" -end diff --git a/spec/ruby/core/kernel/fixtures/classes.rb b/spec/ruby/core/kernel/fixtures/classes.rb index 1bf5715c50..541a4c075e 100644 --- a/spec/ruby/core/kernel/fixtures/classes.rb +++ b/spec/ruby/core/kernel/fixtures/classes.rb @@ -281,14 +281,25 @@ module KernelSpecs @two = two end - def initialize_copy(other) + def initialize_copy(other, **kw) ScratchPad.record object_id end + + # define to support calling #clone with optional :freeze keyword argument + def initialize_clone(other, **kw) + super(other) # to call #initialize_copy + end end class Clone def initialize_clone(other) - ScratchPad.record other.object_id + ScratchPad.record other + end + end + + class CloneFreeze + def initialize_clone(other, **kwargs) + ScratchPad.record([other, kwargs]) end end diff --git a/spec/ruby/core/kernel/fixtures/warn_core_method.rb b/spec/ruby/core/kernel/fixtures/warn_core_method.rb index f5dee6b668..fd82562404 100644 --- a/spec/ruby/core/kernel/fixtures/warn_core_method.rb +++ b/spec/ruby/core/kernel/fixtures/warn_core_method.rb @@ -1,6 +1,6 @@ raise 'should be run without RubyGems' if defined?(Gem) -def deprecated(n=1) +public def deprecated(n=1) # puts nil, caller(0), nil warn "use X instead", uplevel: n end diff --git a/spec/ruby/core/kernel/initialize_clone_spec.rb b/spec/ruby/core/kernel/initialize_clone_spec.rb new file mode 100644 index 0000000000..21a90c19f0 --- /dev/null +++ b/spec/ruby/core/kernel/initialize_clone_spec.rb @@ -0,0 +1,26 @@ +require_relative '../../spec_helper' + +describe "Kernel#initialize_clone" do + it "is a private instance method" do + Kernel.should have_private_instance_method(:initialize_clone) + end + + it "returns the receiver" do + a = Object.new + b = Object.new + a.send(:initialize_clone, b).should == a + end + + it "calls #initialize_copy" do + a = Object.new + b = Object.new + a.should_receive(:initialize_copy).with(b) + a.send(:initialize_clone, b) + end + + it "accepts a :freeze keyword argument for obj.clone(freeze: value)" do + a = Object.new + b = Object.new + a.send(:initialize_clone, b, freeze: true).should == a + end +end diff --git a/spec/ruby/core/kernel/initialize_copy_spec.rb b/spec/ruby/core/kernel/initialize_copy_spec.rb index fe08d184ad..d71ca9f60f 100644 --- a/spec/ruby/core/kernel/initialize_copy_spec.rb +++ b/spec/ruby/core/kernel/initialize_copy_spec.rb @@ -1,11 +1,18 @@ require_relative '../../spec_helper' describe "Kernel#initialize_copy" do + it "returns self" do + obj = Object.new + obj.send(:initialize_copy, obj).should.equal?(obj) + end + it "does nothing if the argument is the same as the receiver" do obj = Object.new obj.send(:initialize_copy, obj).should.equal?(obj) - obj.freeze + + obj = Object.new.freeze obj.send(:initialize_copy, obj).should.equal?(obj) + 1.send(:initialize_copy, 1).should.equal?(1) end diff --git a/spec/ruby/core/kernel/initialize_dup_spec.rb b/spec/ruby/core/kernel/initialize_dup_spec.rb new file mode 100644 index 0000000000..6dff34b7ad --- /dev/null +++ b/spec/ruby/core/kernel/initialize_dup_spec.rb @@ -0,0 +1,20 @@ +require_relative '../../spec_helper' + +describe "Kernel#initialize_dup" do + it "is a private instance method" do + Kernel.should have_private_instance_method(:initialize_dup) + end + + it "returns the receiver" do + a = Object.new + b = Object.new + a.send(:initialize_dup, b).should == a + end + + it "calls #initialize_copy" do + a = Object.new + b = Object.new + a.should_receive(:initialize_copy).with(b) + a.send(:initialize_dup, b) + end +end diff --git a/spec/ruby/core/kernel/inspect_spec.rb b/spec/ruby/core/kernel/inspect_spec.rb index e6fca8bf6f..1f9ce834ab 100644 --- a/spec/ruby/core/kernel/inspect_spec.rb +++ b/spec/ruby/core/kernel/inspect_spec.rb @@ -6,16 +6,6 @@ describe "Kernel#inspect" do Object.new.inspect.should be_an_instance_of(String) end - ruby_version_is ''...'2.7' do - it "returns a tainted string if self is tainted" do - Object.new.taint.inspect.tainted?.should be_true - end - - it "returns an untrusted string if self is untrusted" do - Object.new.untrust.inspect.untrusted?.should be_true - end - end - it "does not call #to_s if it is defined" do # We must use a bare Object here obj = Object.new diff --git a/spec/ruby/core/kernel/instance_variable_get_spec.rb b/spec/ruby/core/kernel/instance_variable_get_spec.rb index bb6f03d3bf..f1d2a45df8 100644 --- a/spec/ruby/core/kernel/instance_variable_get_spec.rb +++ b/spec/ruby/core/kernel/instance_variable_get_spec.rb @@ -67,6 +67,12 @@ describe "Kernel#instance_variable_get when passed Symbol" do it "raises a NameError when the passed Symbol is an invalid instance variable name" do -> { @obj.instance_variable_get(:"@0") }.should raise_error(NameError) end + + it "returns nil or raises for frozen objects" do + nil.instance_variable_get(:@foo).should == nil + -> { nil.instance_variable_get(:foo) }.should raise_error(NameError) + :foo.instance_variable_get(:@foo).should == nil + end end describe "Kernel#instance_variable_get when passed String" do diff --git a/spec/ruby/core/kernel/instance_variable_set_spec.rb b/spec/ruby/core/kernel/instance_variable_set_spec.rb index 7fda30f72c..2c25f4366f 100644 --- a/spec/ruby/core/kernel/instance_variable_set_spec.rb +++ b/spec/ruby/core/kernel/instance_variable_set_spec.rb @@ -89,5 +89,17 @@ describe "Kernel#instance_variable_set" do it "raises a FrozenError when passed replacement is different from stored object" do -> { @frozen.instance_variable_set(:@ivar, :replacement) }.should raise_error(FrozenError) end + + it "accepts unicode instance variable names" do + o = Object.new + o.instance_variable_set(:@💙, 42) + o.instance_variable_get(:@💙).should == 42 + end + + it "raises for frozen objects" do + -> { nil.instance_variable_set(:@foo, 42) }.should raise_error(FrozenError) + -> { nil.instance_variable_set(:foo, 42) }.should raise_error(NameError) + -> { :foo.instance_variable_set(:@foo, 42) }.should raise_error(FrozenError) + end end end diff --git a/spec/ruby/core/kernel/instance_variables_spec.rb b/spec/ruby/core/kernel/instance_variables_spec.rb index 831f0662a2..677d8bb7b2 100644 --- a/spec/ruby/core/kernel/instance_variables_spec.rb +++ b/spec/ruby/core/kernel/instance_variables_spec.rb @@ -25,5 +25,16 @@ describe "Kernel#instance_variables" do a.instance_variable_set("@test", 1) a.instance_variables.should == [:@test] end + + it "returns the instances variables in the order declared" do + c = Class.new do + def initialize + @c = 1 + @a = 2 + @b = 3 + end + end + c.new.instance_variables.should == [:@c, :@a, :@b] + end end end diff --git a/spec/ruby/core/kernel/iterator_spec.rb b/spec/ruby/core/kernel/iterator_spec.rb deleted file mode 100644 index 3fe8317f26..0000000000 --- a/spec/ruby/core/kernel/iterator_spec.rb +++ /dev/null @@ -1,14 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'fixtures/classes' - -ruby_version_is ""..."3.0" do - describe "Kernel#iterator?" do - it "is a private method" do - Kernel.should have_private_instance_method(:iterator?) - end - end - - describe "Kernel.iterator?" do - it "needs to be reviewed for spec completeness" - end -end diff --git a/spec/ruby/core/kernel/lambda_spec.rb b/spec/ruby/core/kernel/lambda_spec.rb index 9a960f3589..565536ac0d 100644 --- a/spec/ruby/core/kernel/lambda_spec.rb +++ b/spec/ruby/core/kernel/lambda_spec.rb @@ -26,42 +26,44 @@ describe "Kernel.lambda" do l.lambda?.should be_true end - it "creates a lambda-style Proc if given a literal block via Kernel.public_send" do - suppress_warning do - l = Kernel.public_send(:lambda) { 42 } - l.lambda?.should be_true + ruby_version_is ""..."3.3" do + it "creates a lambda-style Proc if given a literal block via Kernel.public_send" do + suppress_warning do + l = Kernel.public_send(:lambda) { 42 } + l.lambda?.should be_true + end end - end - it "returns the passed Proc if given an existing Proc" do - some_proc = proc {} - l = suppress_warning {lambda(&some_proc)} - l.should equal(some_proc) - l.lambda?.should be_false - end + it "returns the passed Proc if given an existing Proc" do + some_proc = proc {} + l = suppress_warning {lambda(&some_proc)} + l.should equal(some_proc) + l.lambda?.should be_false + end - it "creates a lambda-style Proc when called with zsuper" do - suppress_warning do - l = KernelSpecs::LambdaSpecs::ForwardBlockWithZSuper.new.lambda { 42 } - l.lambda?.should be_true - l.call.should == 42 + it "creates a lambda-style Proc when called with zsuper" do + suppress_warning do + l = KernelSpecs::LambdaSpecs::ForwardBlockWithZSuper.new.lambda { 42 } + l.lambda?.should be_true + l.call.should == 42 - lambda { l.call(:extra) }.should raise_error(ArgumentError) + lambda { l.call(:extra) }.should raise_error(ArgumentError) + end end - end - it "returns the passed Proc if given an existing Proc through super" do - some_proc = proc { } - l = KernelSpecs::LambdaSpecs::SuperAmpersand.new.lambda(&some_proc) - l.should equal(some_proc) - l.lambda?.should be_false - end + it "returns the passed Proc if given an existing Proc through super" do + some_proc = proc { } + l = KernelSpecs::LambdaSpecs::SuperAmpersand.new.lambda(&some_proc) + l.should equal(some_proc) + l.lambda?.should be_false + end - it "does not create lambda-style Procs when captured with #method" do - kernel_lambda = method(:lambda) - l = suppress_warning {kernel_lambda.call { 42 }} - l.lambda?.should be_false - l.call(:extra).should == 42 + it "does not create lambda-style Procs when captured with #method" do + kernel_lambda = method(:lambda) + l = suppress_warning {kernel_lambda.call { 42 }} + l.lambda?.should be_false + l.call(:extra).should == 42 + end end it "checks the arity of the call when no args are specified" do @@ -135,4 +137,22 @@ describe "Kernel.lambda" do klass.new.lambda { 42 }.should be_an_instance_of Proc klass.new.ret.should == 1 end + + context "when called without a literal block" do + ruby_version_is ""..."3.3" do + it "warns when proc isn't a lambda" do + -> { lambda(&proc{}) }.should complain("#{__FILE__}:#{__LINE__}: warning: lambda without a literal block is deprecated; use the proc without lambda instead\n") + end + end + + ruby_version_is "3.3" do + it "raises when proc isn't a lambda" do + -> { lambda(&proc{}) }.should raise_error(ArgumentError, /the lambda method requires a literal block/) + end + end + + it "doesn't warn when proc is lambda" do + -> { lambda(&lambda{}) }.should_not complain(verbose: true) + end + end end diff --git a/spec/ruby/core/kernel/match_spec.rb b/spec/ruby/core/kernel/match_spec.rb index fbfc77f959..aa25006163 100644 --- a/spec/ruby/core/kernel/match_spec.rb +++ b/spec/ruby/core/kernel/match_spec.rb @@ -1,22 +1,30 @@ require_relative '../../spec_helper' describe "Kernel#=~" do - it "returns nil matching any object" do - o = Object.new + ruby_version_is ''...'3.2' do + it "returns nil matching any object" do + o = Object.new - suppress_warning do - (o =~ /Object/).should be_nil - (o =~ 'Object').should be_nil - (o =~ Object).should be_nil - (o =~ Object.new).should be_nil - (o =~ nil).should be_nil - (o =~ true).should be_nil + suppress_warning do + (o =~ /Object/).should be_nil + (o =~ 'Object').should be_nil + (o =~ Object).should be_nil + (o =~ Object.new).should be_nil + (o =~ nil).should be_nil + (o =~ true).should be_nil + end + end + + it "is deprecated" do + -> do + Object.new =~ /regexp/ + end.should complain(/deprecated Object#=~ is called on Object/, verbose: true) end end - it "is deprecated" do - -> do - Object.new =~ /regexp/ - end.should complain(/deprecated Object#=~ is called on Object/, verbose: true) + ruby_version_is '3.2' do + it "is no longer defined" do + Object.new.should_not.respond_to?(:=~) + end end end diff --git a/spec/ruby/core/kernel/method_spec.rb b/spec/ruby/core/kernel/method_spec.rb index 25c6691e10..3fc566d6a6 100644 --- a/spec/ruby/core/kernel/method_spec.rb +++ b/spec/ruby/core/kernel/method_spec.rb @@ -29,9 +29,52 @@ describe "Kernel#method" do m.call.should == :defined end - it "can be called even if we only repond_to_missing? method, true" do + it "can be called even if we only respond_to_missing? method, true" do m = KernelSpecs::RespondViaMissing.new.method(:handled_privately) m.should be_an_instance_of(Method) m.call(1, 2, 3).should == "Done handled_privately([1, 2, 3])" end + + it "can call a #method_missing accepting zero or one arguments" do + cls = Class.new do + def respond_to_missing?(name, *) + name == :foo or super + end + def method_missing + :no_args + end + end + m = cls.new.method(:foo) + -> { m.call }.should raise_error(ArgumentError) + + cls = Class.new do + def respond_to_missing?(name, *) + name == :bar or super + end + def method_missing(m) + m + end + end + m = cls.new.method(:bar) + m.call.should == :bar + end + + describe "converts the given name to a String using #to_str" do + it "calls #to_str to convert the given name to a String" do + name = mock("method-name") + name.should_receive(:to_str).and_return("hash") + Object.method(name).should == Object.method(:hash) + end + + it "raises a TypeError if the given name can't be converted to a String" do + -> { Object.method(nil) }.should raise_error(TypeError) + -> { Object.method([]) }.should raise_error(TypeError) + end + + it "raises a NoMethodError if the given argument raises a NoMethodError during type coercion to a String" do + name = mock("method-name") + name.should_receive(:to_str).and_raise(NoMethodError) + -> { Object.method(name) }.should raise_error(NoMethodError) + end + end end diff --git a/spec/ruby/core/kernel/nil_spec.rb b/spec/ruby/core/kernel/nil_spec.rb index b63705f7bc..7418245f26 100644 --- a/spec/ruby/core/kernel/nil_spec.rb +++ b/spec/ruby/core/kernel/nil_spec.rb @@ -1,6 +1,12 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -describe "Kernel#nil?" do - it "needs to be reviewed for spec completeness" +describe 'Kernel#nil?' do + it 'returns false' do + Object.should_not.nil? + Object.new.should_not.nil? + ''.should_not.nil? + [].should_not.nil? + {}.should_not.nil? + end end diff --git a/spec/ruby/core/kernel/not_match_spec.rb b/spec/ruby/core/kernel/not_match_spec.rb index 906f18df2c..f8dd82fad8 100644 --- a/spec/ruby/core/kernel/not_match_spec.rb +++ b/spec/ruby/core/kernel/not_match_spec.rb @@ -14,6 +14,20 @@ describe "Kernel#!~" do (obj !~ :foo).should == false end + ruby_version_is ""..."3.2" do + it "returns true if self does not respond to #=~" do + suppress_warning do + (Object.new !~ :foo).should == true + end + end + end + + ruby_version_is "3.2" do + it "raises NoMethodError if self does not respond to #=~" do + -> { Object.new !~ :foo }.should raise_error(NoMethodError) + end + end + it 'can be overridden in subclasses' do obj = KernelSpecs::NotMatch.new (obj !~ :bar).should == :foo diff --git a/spec/ruby/core/kernel/open_spec.rb b/spec/ruby/core/kernel/open_spec.rb index 8d936d8ca0..bb42c31f31 100644 --- a/spec/ruby/core/kernel/open_spec.rb +++ b/spec/ruby/core/kernel/open_spec.rb @@ -27,9 +27,11 @@ describe "Kernel#open" do open(@name, "r") { |f| f.gets }.should == @content end - platform_is_not :windows do + platform_is_not :windows, :wasi do it "opens an io when path starts with a pipe" do - @io = open("|date") + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + @io = open("|date") + end begin @io.should be_kind_of(IO) @io.read @@ -39,21 +41,27 @@ describe "Kernel#open" do end it "opens an io when called with a block" do - @output = open("|date") { |f| f.read } + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + @output = open("|date") { |f| f.read } + end @output.should_not == '' end it "opens an io for writing" do - -> do - bytes = open("|cat", "w") { |io| io.write(".") } - bytes.should == 1 - end.should output_to_fd(".") + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + -> { + bytes = open("|cat", "w") { |io| io.write(".") } + bytes.should == 1 + }.should output_to_fd(".") + end end end platform_is :windows do it "opens an io when path starts with a pipe" do - @io = open("|date /t") + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + @io = open("|date /t") + end begin @io.should be_kind_of(IO) @io.read @@ -63,15 +71,36 @@ describe "Kernel#open" do end it "opens an io when called with a block" do - @output = open("|date /t") { |f| f.read } + suppress_warning do # https://bugs.ruby-lang.org/issues/19630 + @output = open("|date /t") { |f| f.read } + end @output.should_not == '' end end + ruby_version_is "3.3" do + # https://bugs.ruby-lang.org/issues/19630 + it "warns about deprecation given a path with a pipe" do + cmd = "|echo ok" + -> { + open(cmd) { |f| f.read } + }.should complain(/Kernel#open with a leading '\|'/) + end + end + it "raises an ArgumentError if not passed one argument" do -> { open }.should raise_error(ArgumentError) end + it "accepts options as keyword arguments" do + @file = open(@name, "r", 0666, flags: File::CREAT) + @file.should be_kind_of(File) + + -> { + open(@name, "r", 0666, {flags: File::CREAT}) + }.should raise_error(ArgumentError, "wrong number of arguments (given 4, expected 1..3)") + end + describe "when given an object that responds to to_open" do before :each do ScratchPad.clear @@ -109,11 +138,21 @@ describe "Kernel#open" do it "passes its arguments onto #to_open" do obj = mock('to_open') - obj.should_receive(:to_open).with(1,2,3) - + obj.should_receive(:to_open).with(1, 2, 3) open(obj, 1, 2, 3) end + it "passes keyword arguments onto #to_open as keyword arguments if to_open accepts them" do + obj = Object.new + def obj.to_open(*args, **kw) + ScratchPad << {args: args, kw: kw} + end + + ScratchPad.record [] + open(obj, 1, 2, 3, a: "b") + ScratchPad.recorded.should == [args: [1, 2, 3], kw: {a: "b"}] + end + it "passes the return value from #to_open to a block" do obj = mock('to_open') obj.should_receive(:to_open).and_return(:value) @@ -137,16 +176,14 @@ describe "Kernel#open" do open(@name, nil, nil) { |f| f.gets }.should == @content end - ruby_version_is ""..."3.0" do - it "works correctly when redefined by open-uri" do - code = <<~RUBY + it "is not redefined by open-uri" do + code = <<~RUBY + before = Kernel.instance_method(:open) require 'open-uri' - obj = Object.new - def obj.to_open; self; end - p open(obj) == obj - RUBY - ruby_exe(code, args: "2>&1").should == "true\n" - end + after = Kernel.instance_method(:open) + p before == after + RUBY + ruby_exe(code, args: "2>&1").should == "true\n" end end diff --git a/spec/ruby/core/kernel/p_spec.rb b/spec/ruby/core/kernel/p_spec.rb index 1bdd1740ca..eae191aa54 100644 --- a/spec/ruby/core/kernel/p_spec.rb +++ b/spec/ruby/core/kernel/p_spec.rb @@ -76,10 +76,8 @@ describe "Kernel#p" do -> { p(*[]) }.should output("") end -=begin Not sure how to spec this, but wanted to note the behavior here - it "does not flush if receiver is not a TTY or a File" do - end -=end + # Not sure how to spec this, but wanted to note the behavior here + it "does not flush if receiver is not a TTY or a File" end describe "Kernel.p" do diff --git a/spec/ruby/core/kernel/print_spec.rb b/spec/ruby/core/kernel/print_spec.rb index c8c4453d1e..7e7c9b822d 100644 --- a/spec/ruby/core/kernel/print_spec.rb +++ b/spec/ruby/core/kernel/print_spec.rb @@ -5,6 +5,18 @@ describe "Kernel#print" do it "is a private method" do Kernel.should have_private_instance_method(:print) end + + it "delegates to $stdout" do + -> { print :arg }.should output("arg") + end + + it "prints $_ when no arguments are given" do + orig_value = $_ + $_ = 'foo' + -> { print }.should output("foo") + ensure + $_ = orig_value + end end describe "Kernel.print" do diff --git a/spec/ruby/core/kernel/printf_spec.rb b/spec/ruby/core/kernel/printf_spec.rb index d8f93ce429..61bf955c25 100644 --- a/spec/ruby/core/kernel/printf_spec.rb +++ b/spec/ruby/core/kernel/printf_spec.rb @@ -31,6 +31,13 @@ describe "Kernel.printf" do object.should_receive(:write).with("string") Kernel.printf(object, "%s", "string") end + + it "calls #to_str to convert the format object to a String" do + object = mock('format string') + object.should_receive(:to_str).and_return("to_str: %i") + $stdout.should_receive(:write).with("to_str: 42") + Kernel.printf($stdout, object, 42) + end end describe "Kernel.printf" do diff --git a/spec/ruby/core/kernel/proc_spec.rb b/spec/ruby/core/kernel/proc_spec.rb index dfe178420b..6553b8fd04 100644 --- a/spec/ruby/core/kernel/proc_spec.rb +++ b/spec/ruby/core/kernel/proc_spec.rb @@ -40,27 +40,9 @@ describe "Kernel#proc" do proc end - ruby_version_is ""..."2.7" do - it "uses the implicit block from an enclosing method" do - prc = some_method { "hello" } - - prc.call.should == "hello" - end - end - - ruby_version_is "2.7"..."3.0" do - it "can be created when called with no block" do - -> { - some_method { "hello" } - }.should complain(/Capturing the given block using Kernel#proc is deprecated/) - end - end - - ruby_version_is "3.0" do - it "raises an ArgumentError when passed no block" do - -> { - some_method { "hello" } - }.should raise_error(ArgumentError, 'tried to create Proc object without a block') - end + it "raises an ArgumentError when passed no block" do + -> { + some_method { "hello" } + }.should raise_error(ArgumentError, 'tried to create Proc object without a block') end end diff --git a/spec/ruby/core/kernel/public_send_spec.rb b/spec/ruby/core/kernel/public_send_spec.rb index 4dae419ff9..b684b1729c 100644 --- a/spec/ruby/core/kernel/public_send_spec.rb +++ b/spec/ruby/core/kernel/public_send_spec.rb @@ -105,11 +105,11 @@ describe "Kernel#public_send" do end it "includes `public_send` in the backtrace when passed not enough arguments" do - -> { public_send() }.should raise_error(ArgumentError) { |e| e.backtrace[0].should.include?("`public_send'") } + -> { public_send() }.should raise_error(ArgumentError) { |e| e.backtrace[0].should =~ /[`'](?:Kernel#)?public_send'/ } end it "includes `public_send` in the backtrace when passed a single incorrect argument" do - -> { public_send(Object.new) }.should raise_error(TypeError) { |e| e.backtrace[0].should.include?("`public_send'") } + -> { public_send(Object.new) }.should raise_error(TypeError) { |e| e.backtrace[0].should =~ /[`'](?:Kernel#)?public_send'/ } end it_behaves_like :basicobject_send, :public_send diff --git a/spec/ruby/core/kernel/rand_spec.rb b/spec/ruby/core/kernel/rand_spec.rb index c52faee2c4..355e425792 100644 --- a/spec/ruby/core/kernel/rand_spec.rb +++ b/spec/ruby/core/kernel/rand_spec.rb @@ -1,7 +1,7 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -describe "Kernel.rand" do +describe "Kernel#rand" do it "is a private method" do Kernel.should have_private_instance_method(:rand) end @@ -192,6 +192,6 @@ describe "Kernel.rand" do end end -describe "Kernel#rand" do +describe "Kernel.rand" do it "needs to be reviewed for spec completeness" end diff --git a/spec/ruby/core/kernel/remove_instance_variable_spec.rb b/spec/ruby/core/kernel/remove_instance_variable_spec.rb index e90efc8aed..4e5ba5e018 100644 --- a/spec/ruby/core/kernel/remove_instance_variable_spec.rb +++ b/spec/ruby/core/kernel/remove_instance_variable_spec.rb @@ -41,6 +41,19 @@ describe "Kernel#remove_instance_variable" do end.should raise_error(TypeError) end + it "raises a FrozenError if self is frozen" do + o = Object.new + o.freeze + -> { o.remove_instance_variable(:@foo) }.should raise_error(FrozenError) + -> { o.remove_instance_variable(:foo) }.should raise_error(NameError) + end + + it "raises for frozen objects" do + -> { nil.remove_instance_variable(:@foo) }.should raise_error(FrozenError) + -> { nil.remove_instance_variable(:foo) }.should raise_error(NameError) + -> { :foo.remove_instance_variable(:@foo) }.should raise_error(FrozenError) + end + describe "when passed a String" do it_behaves_like :kernel_remove_instance_variable, nil, "@greeting" end diff --git a/spec/ruby/core/kernel/require_relative_spec.rb b/spec/ruby/core/kernel/require_relative_spec.rb index d4146eb3c8..6188d13a4e 100644 --- a/spec/ruby/core/kernel/require_relative_spec.rb +++ b/spec/ruby/core/kernel/require_relative_spec.rb @@ -5,9 +5,9 @@ describe "Kernel#require_relative with a relative path" do before :each do CodeLoadingSpecs.spec_setup @dir = "../../fixtures/code" - @abs_dir = File.realpath(@dir, File.dirname(__FILE__)) + @abs_dir = File.realpath(@dir, __dir__) @path = "#{@dir}/load_fixture.rb" - @abs_path = File.realpath(@path, File.dirname(__FILE__)) + @abs_path = File.realpath(@path, __dir__) end after :each do @@ -92,7 +92,7 @@ describe "Kernel#require_relative with a relative path" do it "raises a LoadError that includes the missing path" do missing_path = "#{@dir}/nonexistent.rb" - expanded_missing_path = File.expand_path(missing_path, File.dirname(__FILE__)) + expanded_missing_path = File.expand_path(missing_path, __dir__) -> { require_relative(missing_path) }.should raise_error(LoadError) { |e| e.message.should include(expanded_missing_path) e.path.should == expanded_missing_path @@ -207,7 +207,7 @@ describe "Kernel#require_relative with a relative path" do $LOADED_FEATURES.should include(@abs_path) end - platform_is_not :windows do + platform_is_not :windows, :wasi do describe "with symlinks" do before :each do @symlink_to_code_dir = tmp("codesymlink") @@ -277,7 +277,7 @@ end describe "Kernel#require_relative with an absolute path" do before :each do CodeLoadingSpecs.spec_setup - @dir = File.expand_path "../../fixtures/code", File.dirname(__FILE__) + @dir = File.expand_path "../../fixtures/code", __dir__ @abs_dir = @dir @path = File.join @dir, "load_fixture.rb" @abs_path = @path diff --git a/spec/ruby/core/kernel/require_spec.rb b/spec/ruby/core/kernel/require_spec.rb index dc3da4b7e6..4029e68725 100644 --- a/spec/ruby/core/kernel/require_spec.rb +++ b/spec/ruby/core/kernel/require_spec.rb @@ -16,6 +16,26 @@ describe "Kernel#require" do Kernel.should have_private_instance_method(:require) end + provided = %w[complex enumerator rational thread ruby2_keywords] + ruby_version_is "3.1" do + provided << "fiber" + end + + it "#{provided.join(', ')} are already required" do + out = ruby_exe("puts $LOADED_FEATURES", options: '--disable-gems --disable-did-you-mean') + features = out.lines.map { |line| File.basename(line.chomp, '.*') } + + # Ignore CRuby internals + features -= %w[encdb transdb windows_1252 windows_31j] + features.reject! { |feature| feature.end_with?('-fake') } + + features.sort.should == provided.sort + + code = provided.map { |f| "puts require #{f.inspect}\n" }.join + required = ruby_exe(code, options: '--disable-gems') + required.should == "false\n" * provided.size + end + it_behaves_like :kernel_require_basic, :require, CodeLoadingSpecs::Method.new it_behaves_like :kernel_require, :require, CodeLoadingSpecs::Method.new end diff --git a/spec/ruby/core/kernel/shared/dup_clone.rb b/spec/ruby/core/kernel/shared/dup_clone.rb index 84ad49cbde..4fac6006e1 100644 --- a/spec/ruby/core/kernel/shared/dup_clone.rb +++ b/spec/ruby/core/kernel/shared/dup_clone.rb @@ -52,18 +52,6 @@ describe :kernel_dup_clone, shared: true do o2.original.should equal(o) end - ruby_version_is ''...'2.7' do - it "preserves tainted state from the original" do - o = ObjectSpecDupInitCopy.new - o2 = o.send(@method) - o.taint - o3 = o.send(@method) - - o2.should_not.tainted? - o3.should.tainted? - end - end - it "does not preserve the object_id" do o1 = ObjectSpecDupInitCopy.new old_object_id = o1.object_id @@ -71,18 +59,6 @@ describe :kernel_dup_clone, shared: true do o2.object_id.should_not == old_object_id end - ruby_version_is ''...'2.7' do - it "preserves untrusted state from the original" do - o = ObjectSpecDupInitCopy.new - o2 = o.send(@method) - o.untrust - o3 = o.send(@method) - - o2.should_not.untrusted? - o3.should.untrusted? - end - end - it "returns nil for NilClass" do nil.send(@method).should == nil end diff --git a/spec/ruby/core/kernel/shared/load.rb b/spec/ruby/core/kernel/shared/load.rb index 120619abef..0fe2d5ce16 100644 --- a/spec/ruby/core/kernel/shared/load.rb +++ b/spec/ruby/core/kernel/shared/load.rb @@ -1,5 +1,6 @@ main = self +# The big difference is Kernel#load does not attempt to add an extension to the passed path, unlike Kernel#require describe :kernel_load, shared: true do before :each do CodeLoadingSpecs.spec_setup @@ -10,22 +11,31 @@ describe :kernel_load, shared: true do CodeLoadingSpecs.spec_cleanup end - it "loads a non-extensioned file as a Ruby source file" do - path = File.expand_path "load_fixture", CODE_LOADING_DIR - @object.load(path).should be_true - ScratchPad.recorded.should == [:no_ext] - end + describe "(path resolution)" do + # This behavior is specific to Kernel#load, it differs for Kernel#require + it "loads a non-extensioned file as a Ruby source file" do + path = File.expand_path "load_fixture", CODE_LOADING_DIR + @object.load(path).should be_true + ScratchPad.recorded.should == [:no_ext] + end - it "loads a non .rb extensioned file as a Ruby source file" do - path = File.expand_path "load_fixture.ext", CODE_LOADING_DIR - @object.load(path).should be_true - ScratchPad.recorded.should == [:no_rb_ext] - end + it "loads a non .rb extensioned file as a Ruby source file" do + path = File.expand_path "load_fixture.ext", CODE_LOADING_DIR + @object.load(path).should be_true + ScratchPad.recorded.should == [:no_rb_ext] + end - it "loads from the current working directory" do - Dir.chdir CODE_LOADING_DIR do - @object.load("load_fixture.rb").should be_true - ScratchPad.recorded.should == [:loaded] + it "loads from the current working directory" do + Dir.chdir CODE_LOADING_DIR do + @object.load("load_fixture.rb").should be_true + ScratchPad.recorded.should == [:loaded] + end + end + + # This behavior is specific to Kernel#load, it differs for Kernel#require + it "does not look for a c-extension file when passed a path without extension (when no .rb is present)" do + path = File.join CODE_LOADING_DIR, "a", "load_fixture" + -> { @object.send(@method, path) }.should raise_error(LoadError) end end @@ -88,12 +98,12 @@ describe :kernel_load, shared: true do describe "when passed true for 'wrap'" do it "loads from an existing path" do - path = File.expand_path "wrap_fixture.rb", CODE_LOADING_DIR + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR @object.load(path, true).should be_true end it "sets the enclosing scope to an anonymous module" do - path = File.expand_path "wrap_fixture.rb", CODE_LOADING_DIR + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR @object.load(path, true) Object.const_defined?(:LoadSpecWrap).should be_false @@ -103,14 +113,14 @@ describe :kernel_load, shared: true do end it "allows referencing outside namespaces" do - path = File.expand_path "wrap_fixture.rb", CODE_LOADING_DIR + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR @object.load(path, true) ScratchPad.recorded[0].should equal(String) end it "sets self as a copy of the top-level main" do - path = File.expand_path "wrap_fixture.rb", CODE_LOADING_DIR + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR @object.load(path, true) top_level = ScratchPad.recorded[2] @@ -127,7 +137,7 @@ describe :kernel_load, shared: true do main_ancestors = main.singleton_class.ancestors[1..-1] main_ancestors.first.should == mod - path = File.expand_path "wrap_fixture.rb", CODE_LOADING_DIR + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR @object.load(path, true) top_level = ScratchPad.recorded[2] @@ -154,6 +164,41 @@ describe :kernel_load, shared: true do end end + describe "when passed a module for 'wrap'" do + ruby_version_is "3.1" do + it "sets the enclosing scope to the supplied module" do + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR + mod = Module.new + @object.load(path, mod) + + Object.const_defined?(:LoadSpecWrap).should be_false + mod.const_defined?(:LoadSpecWrap).should be_true + + wrap_module = ScratchPad.recorded[1] + wrap_module.should == mod + end + + it "makes constants and instance methods in the source file reachable with the supplied module" do + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR + mod = Module.new + @object.load(path, mod) + + mod::LOAD_WRAP_SPECS_TOP_LEVEL_CONSTANT.should == 1 + obj = Object.new + obj.extend(mod) + obj.send(:load_wrap_specs_top_level_method).should == :load_wrap_specs_top_level_method + end + + it "makes instance methods in the source file private" do + path = File.expand_path "load_wrap_fixture.rb", CODE_LOADING_DIR + mod = Module.new + @object.load(path, mod) + + mod.private_instance_methods.include?(:load_wrap_specs_top_level_method).should == true + end + end + end + describe "(shell expansion)" do before :each do @env_home = ENV["HOME"] diff --git a/spec/ruby/core/kernel/shared/require.rb b/spec/ruby/core/kernel/shared/require.rb index 9a2c38be1a..250813191b 100644 --- a/spec/ruby/core/kernel/shared/require.rb +++ b/spec/ruby/core/kernel/shared/require.rb @@ -212,6 +212,34 @@ end describe :kernel_require, shared: true do describe "(path resolution)" do + it "loads .rb file when passed absolute path without extension" do + path = File.expand_path "load_fixture", CODE_LOADING_DIR + @object.send(@method, path).should be_true + # This should _not_ be [:no_ext] + ScratchPad.recorded.should == [:loaded] + end + + platform_is :linux, :darwin do + it "loads c-extension file when passed absolute path without extension when no .rb is present" do + # the error message is specific to what dlerror() returns + path = File.join CODE_LOADING_DIR, "a", "load_fixture" + -> { @object.send(@method, path) }.should raise_error(Exception, /file too short|not a mach-o file/) + end + end + + platform_is :darwin do + it "loads .bundle file when passed absolute path with .so" do + # the error message is specific to what dlerror() returns + path = File.join CODE_LOADING_DIR, "a", "load_fixture.so" + -> { @object.send(@method, path) }.should raise_error(Exception, /load_fixture\.bundle.+(file too short|not a mach-o file)/) + end + end + + it "does not try an extra .rb if the path already ends in .rb" do + path = File.join CODE_LOADING_DIR, "d", "load_fixture.rb" + -> { @object.send(@method, path) }.should raise_error(LoadError) + end + # For reference see [ruby-core:24155] in which matz confirms this feature is # intentional for security reasons. it "does not load a bare filename unless the current working directory is in $LOAD_PATH" do @@ -237,6 +265,17 @@ describe :kernel_require, shared: true do }.should complain(/circular require considered harmful/, verbose: true) ScratchPad.recorded.should == [:loaded] end + + ruby_bug "#17340", ''...'3.3' do + it "loads a file concurrently" do + path = File.expand_path "concurrent_require_fixture.rb", CODE_LOADING_DIR + ScratchPad.record(@object) + -> { + @object.require(path) + }.should_not complain(/circular require considered harmful/, verbose: true) + ScratchPad.recorded.join + end + end end describe "(non-extensioned path)" do @@ -251,13 +290,11 @@ describe :kernel_require, shared: true do ScratchPad.recorded.should == [:loaded] end - ruby_bug "#16926", "2.7"..."3.0" do - it "does not load a feature twice when $LOAD_PATH has been modified" do - $LOAD_PATH.replace [CODE_LOADING_DIR] - @object.require("load_fixture").should be_true - $LOAD_PATH.replace [File.expand_path("b", CODE_LOADING_DIR), CODE_LOADING_DIR] - @object.require("load_fixture").should be_false - end + it "does not load a feature twice when $LOAD_PATH has been modified" do + $LOAD_PATH.replace [CODE_LOADING_DIR] + @object.require("load_fixture").should be_true + $LOAD_PATH.replace [File.expand_path("b", CODE_LOADING_DIR), CODE_LOADING_DIR] + @object.require("load_fixture").should be_false end end @@ -546,22 +583,6 @@ describe :kernel_require, shared: true do ScratchPad.recorded.should == [] end - provided = %w[complex enumerator rational thread] - ruby_version_is "2.7" do - provided << 'ruby2_keywords' - end - - it "#{provided.join(', ')} are already required" do - features = ruby_exe("puts $LOADED_FEATURES", options: '--disable-gems') - provided.each { |feature| - features.should =~ /\b#{feature}\.(rb|so|jar)$/ - } - - code = provided.map { |f| "puts require #{f.inspect}\n" }.join - required = ruby_exe(code, options: '--disable-gems') - required.should == "false\n" * provided.size - end - it "unicode_normalize is part of core and not $LOADED_FEATURES" do features = ruby_exe("puts $LOADED_FEATURES", options: '--disable-gems') features.lines.each { |feature| @@ -570,6 +591,23 @@ describe :kernel_require, shared: true do -> { @object.require("unicode_normalize") }.should raise_error(LoadError) end + + it "does not load a file earlier on the $LOAD_PATH when other similar features were already loaded" do + Dir.chdir CODE_LOADING_DIR do + @object.send(@method, "../code/load_fixture").should be_true + end + ScratchPad.recorded.should == [:loaded] + + $LOAD_PATH.unshift "#{CODE_LOADING_DIR}/b" + # This loads because the above load was not on the $LOAD_PATH + @object.send(@method, "load_fixture").should be_true + ScratchPad.recorded.should == [:loaded, :loaded] + + $LOAD_PATH.unshift "#{CODE_LOADING_DIR}/c" + # This does not load because the above load was on the $LOAD_PATH + @object.send(@method, "load_fixture").should be_false + ScratchPad.recorded.should == [:loaded, :loaded] + end end describe "(shell expansion)" do diff --git a/spec/ruby/core/kernel/shared/sprintf.rb b/spec/ruby/core/kernel/shared/sprintf.rb index 6d62a65f7c..13dc6e97f0 100644 --- a/spec/ruby/core/kernel/shared/sprintf.rb +++ b/spec/ruby/core/kernel/shared/sprintf.rb @@ -289,21 +289,80 @@ describe :kernel_sprintf, shared: true do @method.call("%c", "a").should == "a" end - it "raises ArgumentError if argument is a string of several characters" do + ruby_version_is ""..."3.2" do + it "raises ArgumentError if argument is a string of several characters" do + -> { + @method.call("%c", "abc") + }.should raise_error(ArgumentError, /%c requires a character/) + end + + it "raises ArgumentError if argument is an empty string" do + -> { + @method.call("%c", "") + }.should raise_error(ArgumentError, /%c requires a character/) + end + end + + ruby_version_is "3.2" do + it "displays only the first character if argument is a string of several characters" do + @method.call("%c", "abc").should == "a" + end + + it "displays no characters if argument is an empty string" do + @method.call("%c", "").should == "" + end + end + + it "raises TypeError if argument is not String or Integer and cannot be converted to them" do -> { - @method.call("%c", "abc") - }.should raise_error(ArgumentError) + @method.call("%c", []) + }.should raise_error(TypeError, /no implicit conversion of Array into Integer/) end - it "raises ArgumentError if argument is an empty string" do + it "raises TypeError if argument is nil" do -> { - @method.call("%c", "") - }.should raise_error(ArgumentError) + @method.call("%c", nil) + }.should raise_error(TypeError, /no implicit conversion from nil to integer/) + end + + it "tries to convert argument to String with to_str" do + obj = BasicObject.new + def obj.to_str + "a" + end + + @method.call("%c", obj).should == "a" + end + + it "tries to convert argument to Integer with to_int" do + obj = BasicObject.new + def obj.to_int + 90 + end + + @method.call("%c", obj).should == "Z" + end + + it "raises TypeError if converting to String with to_str returns non-String" do + obj = BasicObject.new + def obj.to_str + :foo + end + + -> { + @method.call("%c", obj) + }.should raise_error(TypeError, /can't convert BasicObject to String/) end - it "supports Unicode characters" do - @method.call("%c", 1286).should == "Ô†" - @method.call("%c", "Ø´").should == "Ø´" + it "raises TypeError if converting to Integer with to_int returns non-Integer" do + obj = BasicObject.new + def obj.to_int + :foo + end + + -> { + @method.call("%c", obj) + }.should raise_error(TypeError, /can't convert BasicObject to Integer/) end end @@ -320,6 +379,10 @@ describe :kernel_sprintf, shared: true do @method.call("%s", "abc").should == "abc" end + it "substitutes '' for nil" do + @method.call("%s", nil).should == "" + end + it "converts argument to string with to_s" do obj = mock("string") obj.should_receive(:to_s).and_return("abc") @@ -348,6 +411,28 @@ describe :kernel_sprintf, shared: true do Kernel.format("%-3.3s", "hello").should == "hel" end + it "formats string with width" do + @method.call("%6s", "abc").should == " abc" + @method.call("%6s", "abcdefg").should == "abcdefg" + end + + it "formats string with width and precision" do + @method.call("%4.6s", "abc").should == " abc" + @method.call("%4.6s", "abcdefg").should == "abcdef" + end + + it "formats nil with width" do + @method.call("%6s", nil).should == " " + end + + it "formats nil with precision" do + @method.call("%.6s", nil).should == "" + end + + it "formats nil with width and precision" do + @method.call("%4.6s", nil).should == " " + end + it "formats multibyte string with precision" do Kernel.format("%.2s", "été").should == "ét" end @@ -901,4 +986,8 @@ describe :kernel_sprintf, shared: true do } end end + + it "does not raise error when passed more arguments than needed" do + sprintf("%s %d %c", "string", 2, "c", []).should == "string 2 c" + end end diff --git a/spec/ruby/core/kernel/shared/sprintf_encoding.rb b/spec/ruby/core/kernel/shared/sprintf_encoding.rb index 5ca66b9083..7ec0fe4c48 100644 --- a/spec/ruby/core/kernel/shared/sprintf_encoding.rb +++ b/spec/ruby/core/kernel/shared/sprintf_encoding.rb @@ -1,3 +1,5 @@ +# Keep encoding-related specs in a separate shared example to be able to skip them in IO/File/StringIO specs. +# It's difficult to check result's encoding in the test after writing to a file/io buffer. describe :kernel_sprintf_encoding, shared: true do it "can produce a string with valid encoding" do string = @method.call("good day %{valid}", valid: "e") @@ -12,20 +14,20 @@ describe :kernel_sprintf_encoding, shared: true do end it "returns a String in the same encoding as the format String if compatible" do - string = "%s".force_encoding(Encoding::KOI8_U) + string = "%s".dup.force_encoding(Encoding::KOI8_U) result = @method.call(string, "dogs") result.encoding.should equal(Encoding::KOI8_U) end it "returns a String in the argument's encoding if format encoding is more restrictive" do - string = "foo %s".force_encoding(Encoding::US_ASCII) - argument = "b\303\274r".force_encoding(Encoding::UTF_8) + string = "foo %s".dup.force_encoding(Encoding::US_ASCII) + argument = "b\303\274r".dup.force_encoding(Encoding::UTF_8) result = @method.call(string, argument) result.encoding.should equal(Encoding::UTF_8) end - it "raises Encoding::CompatibilityError if both encodings are ASCII compatible and there ano not ASCII characters" do + it "raises Encoding::CompatibilityError if both encodings are ASCII compatible and there are not ASCII characters" do string = "Ä %s".encode('windows-1252') argument = "Ђ".encode('windows-1251') @@ -33,4 +35,33 @@ describe :kernel_sprintf_encoding, shared: true do @method.call(string, argument) }.should raise_error(Encoding::CompatibilityError) end + + describe "%c" do + it "supports Unicode characters" do + result = @method.call("%c", 1286) + result.should == "Ô†" + result.bytes.should == [212, 134] + + result = @method.call("%c", "Ø´") + result.should == "Ø´" + result.bytes.should == [216, 180] + end + + it "raises error when a codepoint isn't representable in an encoding of a format string" do + format = "%c".encode("ASCII") + + -> { + @method.call(format, 1286) + }.should raise_error(RangeError, /out of char range/) + end + + it "uses the encoding of the format string to interpret codepoints" do + format = "%c".dup.force_encoding("euc-jp") + result = @method.call(format, 9415601) + + result.encoding.should == Encoding::EUC_JP + result.should == "é".encode(Encoding::EUC_JP) + result.bytes.should == [143, 171, 177] + end + end end diff --git a/spec/ruby/core/kernel/singleton_class_spec.rb b/spec/ruby/core/kernel/singleton_class_spec.rb index a8bcd916d1..23c400f9bd 100644 --- a/spec/ruby/core/kernel/singleton_class_spec.rb +++ b/spec/ruby/core/kernel/singleton_class_spec.rb @@ -1,3 +1,6 @@ +# truffleruby_primitives: true +require_relative '../../spec_helper' + describe "Kernel#singleton_class" do it "returns class extended from an object" do x = Object.new @@ -18,10 +21,54 @@ describe "Kernel#singleton_class" do end it "raises TypeError for Integer" do - -> { 123.singleton_class }.should raise_error(TypeError) + -> { 123.singleton_class }.should raise_error(TypeError, "can't define singleton") + end + + it "raises TypeError for Float" do + -> { 3.14.singleton_class }.should raise_error(TypeError, "can't define singleton") end it "raises TypeError for Symbol" do - -> { :foo.singleton_class }.should raise_error(TypeError) + -> { :foo.singleton_class }.should raise_error(TypeError, "can't define singleton") + end + + it "raises TypeError for a frozen deduplicated String" do + -> { (-"string").singleton_class }.should raise_error(TypeError, "can't define singleton") + -> { a = -"string"; a.singleton_class }.should raise_error(TypeError, "can't define singleton") + -> { a = "string"; (-a).singleton_class }.should raise_error(TypeError, "can't define singleton") + end + + it "returns a frozen singleton class if object is frozen" do + obj = Object.new + obj.freeze + obj.singleton_class.frozen?.should be_true + end + + context "for an IO object with a replaced singleton class" do + it "looks up singleton methods from the fresh singleton class after an object instance got a new one" do + proxy = -> io { io.foo } + if RUBY_ENGINE == 'truffleruby' + # We need an inline cache with only this object seen, the best way to do that is to use a Primitive + sclass = -> io { Primitive.singleton_class(io) } + else + sclass = -> io { io.singleton_class } + end + + io = File.new(__FILE__) + io.define_singleton_method(:foo) { "old" } + sclass1 = sclass.call(io) + proxy.call(io).should == "old" + + # IO#reopen is the only method which can replace an object's singleton class + io2 = File.new(__FILE__) + io.reopen(io2) + io.define_singleton_method(:foo) { "new" } + sclass2 = sclass.call(io) + sclass2.should_not.equal?(sclass1) + proxy.call(io).should == "new" + ensure + io2.close + io.close + end end end diff --git a/spec/ruby/core/kernel/sleep_spec.rb b/spec/ruby/core/kernel/sleep_spec.rb index 32da6344c1..0570629723 100644 --- a/spec/ruby/core/kernel/sleep_spec.rb +++ b/spec/ruby/core/kernel/sleep_spec.rb @@ -1,5 +1,4 @@ require_relative '../../spec_helper' -require_relative 'fixtures/classes' describe "Kernel#sleep" do it "is a private method" do @@ -33,10 +32,6 @@ describe "Kernel#sleep" do -> { sleep(-1) }.should raise_error(ArgumentError) end - it "raises a TypeError when passed nil" do - -> { sleep(nil) }.should raise_error(TypeError) - end - it "raises a TypeError when passed a String" do -> { sleep('2') }.should raise_error(TypeError) end @@ -55,6 +50,29 @@ describe "Kernel#sleep" do t.wakeup t.value.should == 5 end + + ruby_version_is ""..."3.3" do + it "raises a TypeError when passed nil" do + -> { sleep(nil) }.should raise_error(TypeError) + end + end + + ruby_version_is "3.3" do + it "accepts a nil duration" do + running = false + t = Thread.new do + running = true + sleep(nil) + 5 + end + + Thread.pass until running + Thread.pass while t.status and t.status != "sleep" + + t.wakeup + t.value.should == 5 + end + end end describe "Kernel.sleep" do diff --git a/spec/ruby/core/kernel/sprintf_spec.rb b/spec/ruby/core/kernel/sprintf_spec.rb index 7adf71be76..9ef7f86f16 100644 --- a/spec/ruby/core/kernel/sprintf_spec.rb +++ b/spec/ruby/core/kernel/sprintf_spec.rb @@ -3,6 +3,14 @@ require_relative 'fixtures/classes' require_relative 'shared/sprintf' require_relative 'shared/sprintf_encoding' +describe :kernel_sprintf_to_str, shared: true do + it "calls #to_str to convert the format object to a String" do + obj = mock('format string') + obj.should_receive(:to_str).and_return("to_str: %i") + @method.call(obj, 42).should == "to_str: 42" + end +end + describe "Kernel#sprintf" do it_behaves_like :kernel_sprintf, -> format, *args { sprintf(format, *args) @@ -11,6 +19,10 @@ describe "Kernel#sprintf" do it_behaves_like :kernel_sprintf_encoding, -> format, *args { sprintf(format, *args) } + + it_behaves_like :kernel_sprintf_to_str, -> format, *args { + sprintf(format, *args) + } end describe "Kernel.sprintf" do @@ -21,4 +33,8 @@ describe "Kernel.sprintf" do it_behaves_like :kernel_sprintf_encoding, -> format, *args { Kernel.sprintf(format, *args) } + + it_behaves_like :kernel_sprintf_to_str, -> format, *args { + Kernel.sprintf(format, *args) + } end diff --git a/spec/ruby/core/kernel/srand_spec.rb b/spec/ruby/core/kernel/srand_spec.rb index 6774d19284..95bb406f46 100644 --- a/spec/ruby/core/kernel/srand_spec.rb +++ b/spec/ruby/core/kernel/srand_spec.rb @@ -1,7 +1,15 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -describe "Kernel.srand" do +describe "Kernel#srand" do + before :each do + @seed = srand + end + + after :each do + srand(@seed) + end + it "is a private method" do Kernel.should have_private_instance_method(:srand) end @@ -11,8 +19,8 @@ describe "Kernel.srand" do srand(20).should == 10 end - it "returns the previous seed value on the first call" do - ruby_exe('p srand(10)', options: '--disable-gems').chomp.should =~ /\A\d+\z/ + it "returns the system-initialized seed value on the first call" do + ruby_exe('print srand(10)', options: '--disable-gems').should =~ /\A\d+\z/ end it "seeds the RNG correctly and repeatably" do @@ -60,6 +68,6 @@ describe "Kernel.srand" do end end -describe "Kernel#srand" do +describe "Kernel.srand" do it "needs to be reviewed for spec completeness" end diff --git a/spec/ruby/core/kernel/system_spec.rb b/spec/ruby/core/kernel/system_spec.rb index 9671a650cc..9bc03924dd 100644 --- a/spec/ruby/core/kernel/system_spec.rb +++ b/spec/ruby/core/kernel/system_spec.rb @@ -64,6 +64,23 @@ describe :kernel_system, shared: true do end end + platform_is_not :windows do + before :each do + require 'tmpdir' + @shell_command = File.join(Dir.mktmpdir, "noshebang.cmd") + File.write(@shell_command, %[echo "$PATH"\n], perm: 0o700) + end + + after :each do + File.unlink(@shell_command) + Dir.rmdir(File.dirname(@shell_command)) + end + + it "executes with `sh` if the command is executable but not binary and there is no shebang" do + -> { @object.system(@shell_command) }.should output_to_fd(ENV['PATH'] + "\n") + end + end + before :each do ENV['TEST_SH_EXPANSION'] = 'foo' @shell_var = '$TEST_SH_EXPANSION' diff --git a/spec/ruby/core/kernel/taint_spec.rb b/spec/ruby/core/kernel/taint_spec.rb index 8ba9869af2..0c16b1dbbf 100644 --- a/spec/ruby/core/kernel/taint_spec.rb +++ b/spec/ruby/core/kernel/taint_spec.rb @@ -2,54 +2,13 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Kernel#taint" do - ruby_version_is ''...'2.7' do - it "returns self" do - o = Object.new - o.taint.should equal(o) - end - - it "sets the tainted bit" do - o = Object.new - o.taint - o.should.tainted? - end - - it "raises FrozenError on an untainted, frozen object" do - o = Object.new.freeze - -> { o.taint }.should raise_error(FrozenError) - end - - it "does not raise an error on a tainted, frozen object" do - o = Object.new.taint.freeze - o.taint.should equal(o) - end - - it "has no effect on immediate values" do - [nil, true, false].each do |v| - v.taint - v.should_not.tainted? - end - end - - it "no raises a RuntimeError on symbols" do - v = :sym - -> { v.taint }.should_not raise_error(RuntimeError) - v.should_not.tainted? - end - - it "no raises error on integer values" do - [1].each do |v| - -> { v.taint }.should_not raise_error(RuntimeError) - v.should_not.tainted? - end - end - end - - ruby_version_is "2.7"..."3.0" do + ruby_version_is ""..."3.2" do it "is a no-op" do - o = Object.new - o.taint - o.should_not.tainted? + suppress_warning do + o = Object.new + o.taint + o.should_not.tainted? + end end it "warns in verbose mode" do @@ -59,4 +18,10 @@ describe "Kernel#taint" do }.should complain(/Object#taint is deprecated and will be removed in Ruby 3.2/, verbose: true) end end + + ruby_version_is "3.2" do + it "has been removed" do + Object.new.should_not.respond_to?(:taint) + end + end end diff --git a/spec/ruby/core/kernel/tainted_spec.rb b/spec/ruby/core/kernel/tainted_spec.rb index 022938bfc1..fcae433069 100644 --- a/spec/ruby/core/kernel/tainted_spec.rb +++ b/spec/ruby/core/kernel/tainted_spec.rb @@ -2,23 +2,15 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Kernel#tainted?" do - ruby_version_is ''...'2.7' do - it "returns true if Object is tainted" do - o = mock('o') - p = mock('p') - p.taint - o.should_not.tainted? - p.should.tainted? - end - end - - ruby_version_is "2.7"..."3.0" do + ruby_version_is ""..."3.2" do it "is a no-op" do - o = mock('o') - p = mock('p') - p.taint - o.should_not.tainted? - p.should_not.tainted? + suppress_warning do + o = mock('o') + p = mock('p') + p.taint + o.should_not.tainted? + p.should_not.tainted? + end end it "warns in verbose mode" do @@ -28,4 +20,10 @@ describe "Kernel#tainted?" do }.should complain(/Object#tainted\? is deprecated and will be removed in Ruby 3.2/, verbose: true) end end + + ruby_version_is "3.2" do + it "has been removed" do + Object.new.should_not.respond_to?(:tainted?) + end + end end diff --git a/spec/ruby/core/kernel/test_spec.rb b/spec/ruby/core/kernel/test_spec.rb index abb365aed2..d26dc06361 100644 --- a/spec/ruby/core/kernel/test_spec.rb +++ b/spec/ruby/core/kernel/test_spec.rb @@ -3,8 +3,8 @@ require_relative 'fixtures/classes' describe "Kernel#test" do before :all do - @file = File.dirname(__FILE__) + '/fixtures/classes.rb' - @dir = File.dirname(__FILE__) + '/fixtures' + @file = __dir__ + '/fixtures/classes.rb' + @dir = __dir__ + '/fixtures' end it "is a private method" do diff --git a/spec/ruby/core/kernel/to_s_spec.rb b/spec/ruby/core/kernel/to_s_spec.rb index 64b40f46e5..ea4b00151e 100644 --- a/spec/ruby/core/kernel/to_s_spec.rb +++ b/spec/ruby/core/kernel/to_s_spec.rb @@ -5,14 +5,4 @@ describe "Kernel#to_s" do it "returns a String containing the name of self's class" do Object.new.to_s.should =~ /Object/ end - - ruby_version_is ''...'2.7' do - it "returns a tainted result if self is tainted" do - Object.new.taint.to_s.tainted?.should be_true - end - - it "returns an untrusted result if self is untrusted" do - Object.new.untrust.to_s.untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/kernel/trust_spec.rb b/spec/ruby/core/kernel/trust_spec.rb index 399983f74d..db6f17e0fb 100644 --- a/spec/ruby/core/kernel/trust_spec.rb +++ b/spec/ruby/core/kernel/trust_spec.rb @@ -2,35 +2,14 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Kernel#trust" do - ruby_version_is ''...'2.7' do - it "returns self" do - o = Object.new - o.trust.should equal(o) - end - - it "clears the untrusted bit" do - o = Object.new.untrust - o.trust - o.should_not.untrusted? - end - - it "raises FrozenError on an untrusted, frozen object" do - o = Object.new.untrust.freeze - -> { o.trust }.should raise_error(FrozenError) - end - - it "does not raise an error on a trusted, frozen object" do - o = Object.new.freeze - o.trust.should equal(o) - end - end - - ruby_version_is "2.7"..."3.0" do + ruby_version_is ""..."3.2" do it "is a no-op" do - o = Object.new.untrust - o.should_not.untrusted? - o.trust - o.should_not.untrusted? + suppress_warning do + o = Object.new.untrust + o.should_not.untrusted? + o.trust + o.should_not.untrusted? + end end it "warns in verbose mode" do @@ -40,4 +19,10 @@ describe "Kernel#trust" do }.should complain(/Object#trust is deprecated and will be removed in Ruby 3.2/, verbose: true) end end + + ruby_version_is "3.2" do + it "has been removed" do + Object.new.should_not.respond_to?(:trust) + end + end end diff --git a/spec/ruby/core/kernel/untaint_spec.rb b/spec/ruby/core/kernel/untaint_spec.rb index 44d87da5d5..26b2aabbe9 100644 --- a/spec/ruby/core/kernel/untaint_spec.rb +++ b/spec/ruby/core/kernel/untaint_spec.rb @@ -2,35 +2,14 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Kernel#untaint" do - ruby_version_is ''...'2.7' do - it "returns self" do - o = Object.new - o.untaint.should equal(o) - end - - it "clears the tainted bit" do - o = Object.new.taint - o.untaint - o.should_not.tainted? - end - - it "raises FrozenError on a tainted, frozen object" do - o = Object.new.taint.freeze - -> { o.untaint }.should raise_error(FrozenError) - end - - it "does not raise an error on an untainted, frozen object" do - o = Object.new.freeze - o.untaint.should equal(o) - end - end - - ruby_version_is "2.7"..."3.0" do + ruby_version_is ""..."3.2" do it "is a no-op" do - o = Object.new.taint - o.should_not.tainted? - o.untaint - o.should_not.tainted? + suppress_warning do + o = Object.new.taint + o.should_not.tainted? + o.untaint + o.should_not.tainted? + end end it "warns in verbose mode" do @@ -40,4 +19,10 @@ describe "Kernel#untaint" do }.should complain(/Object#untaint is deprecated and will be removed in Ruby 3.2/, verbose: true) end end + + ruby_version_is "3.2" do + it "has been removed" do + Object.new.should_not.respond_to?(:untaint) + end + end end diff --git a/spec/ruby/core/kernel/untrust_spec.rb b/spec/ruby/core/kernel/untrust_spec.rb index aff0fec57b..5310cd8eb4 100644 --- a/spec/ruby/core/kernel/untrust_spec.rb +++ b/spec/ruby/core/kernel/untrust_spec.rb @@ -2,34 +2,13 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Kernel#untrust" do - ruby_version_is ''...'2.7' do - it "returns self" do - o = Object.new - o.untrust.should equal(o) - end - - it "sets the untrusted bit" do - o = Object.new - o.untrust - o.should.untrusted? - end - - it "raises FrozenError on a trusted, frozen object" do - o = Object.new.freeze - -> { o.untrust }.should raise_error(FrozenError) - end - - it "does not raise an error on an untrusted, frozen object" do - o = Object.new.untrust.freeze - o.untrust.should equal(o) - end - end - - ruby_version_is "2.7"..."3.0" do + ruby_version_is ""..."3.2" do it "is a no-op" do - o = Object.new - o.untrust - o.should_not.untrusted? + suppress_warning do + o = Object.new + o.untrust + o.should_not.untrusted? + end end it "warns in verbose mode" do @@ -39,4 +18,10 @@ describe "Kernel#untrust" do }.should complain(/Object#untrust is deprecated and will be removed in Ruby 3.2/, verbose: true) end end + + ruby_version_is "3.2" do + it "has been removed" do + Object.new.should_not.respond_to?(:untrust) + end + end end diff --git a/spec/ruby/core/kernel/untrusted_spec.rb b/spec/ruby/core/kernel/untrusted_spec.rb index 5347c90093..ea36d6c98c 100644 --- a/spec/ruby/core/kernel/untrusted_spec.rb +++ b/spec/ruby/core/kernel/untrusted_spec.rb @@ -2,38 +2,14 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Kernel#untrusted?" do - ruby_version_is ''...'2.7' do - it "returns the untrusted status of an object" do - o = mock('o') - o.should_not.untrusted? - o.untrust - o.should.untrusted? - end - - it "has no effect on immediate values" do - a = nil - b = true - c = false - a.untrust - b.untrust - c.untrust - a.should_not.untrusted? - b.should_not.untrusted? - c.should_not.untrusted? - end - - it "has effect on immediate values" do - d = 1 - -> { d.untrust }.should_not raise_error(RuntimeError) - end - end - - ruby_version_is "2.7"..."3.0" do + ruby_version_is ""..."3.2" do it "is a no-op" do - o = mock('o') - o.should_not.untrusted? - o.untrust - o.should_not.untrusted? + suppress_warning do + o = mock('o') + o.should_not.untrusted? + o.untrust + o.should_not.untrusted? + end end it "warns in verbose mode" do @@ -43,4 +19,10 @@ describe "Kernel#untrusted?" do }.should complain(/Object#untrusted\? is deprecated and will be removed in Ruby 3.2/, verbose: true) end end + + ruby_version_is "3.2" do + it "has been removed" do + Object.new.should_not.respond_to?(:untrusted?) + end + end end diff --git a/spec/ruby/core/kernel/warn_spec.rb b/spec/ruby/core/kernel/warn_spec.rb index 511e741f32..00164ad90b 100644 --- a/spec/ruby/core/kernel/warn_spec.rb +++ b/spec/ruby/core/kernel/warn_spec.rb @@ -128,36 +128,34 @@ describe "Kernel#warn" do end end - ruby_version_is "3.0" do - it "accepts :category keyword with a symbol" do - -> { - $VERBOSE = true - warn("message", category: :deprecated) - }.should output(nil, "message\n") - end + it "accepts :category keyword with a symbol" do + -> { + $VERBOSE = true + warn("message", category: :deprecated) + }.should output(nil, "message\n") + end - it "accepts :category keyword with nil" do - -> { - $VERBOSE = true - warn("message", category: nil) - }.should output(nil, "message\n") - end + it "accepts :category keyword with nil" do + -> { + $VERBOSE = true + warn("message", category: nil) + }.should output(nil, "message\n") + end - it "accepts :category keyword with object convertible to symbol" do - o = Object.new - def o.to_sym; :deprecated; end - -> { - $VERBOSE = true - warn("message", category: o) - }.should output(nil, "message\n") - end + it "accepts :category keyword with object convertible to symbol" do + o = Object.new + def o.to_sym; :deprecated; end + -> { + $VERBOSE = true + warn("message", category: o) + }.should output(nil, "message\n") + end - it "raises if :category keyword is not nil and not convertible to symbol" do - -> { - $VERBOSE = true - warn("message", category: Object.new) - }.should raise_error(TypeError) - end + it "raises if :category keyword is not nil and not convertible to symbol" do + -> { + $VERBOSE = true + warn("message", category: Object.new) + }.should raise_error(TypeError) end it "converts first arg using to_s" do @@ -212,6 +210,55 @@ describe "Kernel#warn" do -> { warn('foo', **h) }.should complain("foo\n") end + it "calls Warning.warn without keyword arguments if Warning.warn does not accept keyword arguments" do + verbose = $VERBOSE + $VERBOSE = false + class << Warning + alias_method :_warn, :warn + def warn(message) + ScratchPad.record(message) + end + end + + begin + ScratchPad.clear + Kernel.warn("Chunky bacon!") + ScratchPad.recorded.should == "Chunky bacon!\n" + + Kernel.warn("Deprecated bacon!", category: :deprecated) + ScratchPad.recorded.should == "Deprecated bacon!\n" + ensure + class << Warning + remove_method :warn + alias_method :warn, :_warn + remove_method :_warn + end + $VERBOSE = verbose + end + end + + it "calls Warning.warn with category: nil if Warning.warn accepts keyword arguments" do + Warning.should_receive(:warn).with("Chunky bacon!\n", category: nil) + verbose = $VERBOSE + $VERBOSE = false + begin + Kernel.warn("Chunky bacon!") + ensure + $VERBOSE = verbose + end + end + + it "calls Warning.warn with given category keyword converted to a symbol" do + Warning.should_receive(:warn).with("Chunky bacon!\n", category: :deprecated) + verbose = $VERBOSE + $VERBOSE = false + begin + Kernel.warn("Chunky bacon!", category: 'deprecated') + ensure + $VERBOSE = verbose + end + end + it "does not call Warning.warn if self is the Warning module" do # RubyGems redefines Kernel#warn so we need to use a subprocess and disable RubyGems here code = <<-RUBY diff --git a/spec/ruby/core/main/fixtures/using.rb b/spec/ruby/core/main/fixtures/using.rb new file mode 100644 index 0000000000..30713ef309 --- /dev/null +++ b/spec/ruby/core/main/fixtures/using.rb @@ -0,0 +1 @@ +using Module.new diff --git a/spec/ruby/core/main/fixtures/using_in_main.rb b/spec/ruby/core/main/fixtures/using_in_main.rb new file mode 100644 index 0000000000..a4a71c89cc --- /dev/null +++ b/spec/ruby/core/main/fixtures/using_in_main.rb @@ -0,0 +1,5 @@ +MAIN = self + +module X + MAIN.send(:using, Module.new) +end diff --git a/spec/ruby/core/main/fixtures/using_in_method.rb b/spec/ruby/core/main/fixtures/using_in_method.rb new file mode 100644 index 0000000000..d9ea2e9ef0 --- /dev/null +++ b/spec/ruby/core/main/fixtures/using_in_method.rb @@ -0,0 +1,5 @@ +def foo + using Module.new +end + +foo diff --git a/spec/ruby/core/main/private_spec.rb b/spec/ruby/core/main/private_spec.rb index 78c5d287d4..e8c1f3f44c 100644 --- a/spec/ruby/core/main/private_spec.rb +++ b/spec/ruby/core/main/private_spec.rb @@ -22,18 +22,24 @@ describe "main#private" do end end - ruby_version_is "3.0" do - context "when single argument is passed and is an array" do - it "sets the visibility of the given methods to private" do - eval "private [:main_public_method, :main_public_method2]", TOPLEVEL_BINDING - Object.should have_private_method(:main_public_method) - Object.should have_private_method(:main_public_method2) - end + context "when single argument is passed and is an array" do + it "sets the visibility of the given methods to private" do + eval "private [:main_public_method, :main_public_method2]", TOPLEVEL_BINDING + Object.should have_private_method(:main_public_method) + Object.should have_private_method(:main_public_method2) end end - it "returns Object" do - eval("private :main_public_method", TOPLEVEL_BINDING).should equal(Object) + ruby_version_is ''...'3.1' do + it "returns Object" do + eval("private :main_public_method", TOPLEVEL_BINDING).should equal(Object) + end + end + + ruby_version_is '3.1' do + it "returns argument" do + eval("private :main_public_method", TOPLEVEL_BINDING).should equal(:main_public_method) + end end it "raises a NameError when at least one of given method names is undefined" do diff --git a/spec/ruby/core/main/public_spec.rb b/spec/ruby/core/main/public_spec.rb index bfc27a9e80..31baad4583 100644 --- a/spec/ruby/core/main/public_spec.rb +++ b/spec/ruby/core/main/public_spec.rb @@ -22,20 +22,27 @@ describe "main#public" do end end - ruby_version_is "3.0" do - context "when single argument is passed and is an array" do - it "sets the visibility of the given methods to public" do - eval "public [:main_private_method, :main_private_method2]", TOPLEVEL_BINDING - Object.should_not have_private_method(:main_private_method) - Object.should_not have_private_method(:main_private_method2) - end + context "when single argument is passed and is an array" do + it "sets the visibility of the given methods to public" do + eval "public [:main_private_method, :main_private_method2]", TOPLEVEL_BINDING + Object.should_not have_private_method(:main_private_method) + Object.should_not have_private_method(:main_private_method2) + end + end + + ruby_version_is ''...'3.1' do + it "returns Object" do + eval("public :main_private_method", TOPLEVEL_BINDING).should equal(Object) end end - it "returns Object" do - eval("public :main_private_method", TOPLEVEL_BINDING).should equal(Object) + ruby_version_is '3.1' do + it "returns argument" do + eval("public :main_private_method", TOPLEVEL_BINDING).should equal(:main_private_method) + end end + it "raises a NameError when given an undefined name" do -> do eval "public :main_undefined_method", TOPLEVEL_BINDING diff --git a/spec/ruby/core/main/ruby2_keywords_spec.rb b/spec/ruby/core/main/ruby2_keywords_spec.rb index 0999cddeed..27ceae3253 100644 --- a/spec/ruby/core/main/ruby2_keywords_spec.rb +++ b/spec/ruby/core/main/ruby2_keywords_spec.rb @@ -1,11 +1,9 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is "2.7" do - describe "main.ruby2_keywords" do - it "is the same as Object.ruby2_keywords" do - main = TOPLEVEL_BINDING.receiver - main.should have_private_method(:ruby2_keywords) - end +describe "main.ruby2_keywords" do + it "is the same as Object.ruby2_keywords" do + main = TOPLEVEL_BINDING.receiver + main.should have_private_method(:ruby2_keywords) end end diff --git a/spec/ruby/core/main/using_spec.rb b/spec/ruby/core/main/using_spec.rb index f9f709f7dc..8a23970c4b 100644 --- a/spec/ruby/core/main/using_spec.rb +++ b/spec/ruby/core/main/using_spec.rb @@ -129,4 +129,24 @@ describe "main.using" do x.call_bar(cls2.new).should == 'bar' end + + it "raises error when called from method in wrapped script" do + -> do + load File.expand_path('../fixtures/using_in_method.rb', __FILE__), true + end.should raise_error(RuntimeError) + end + + it "raises error when called on toplevel from module" do + -> do + load File.expand_path('../fixtures/using_in_main.rb', __FILE__), true + end.should raise_error(RuntimeError) + end + + ruby_version_is "3.2" do + it "does not raise error when wrapped with module" do + -> do + load File.expand_path('../fixtures/using.rb', __FILE__), true + end.should_not raise_error + end + end end diff --git a/spec/ruby/core/marshal/dump_spec.rb b/spec/ruby/core/marshal/dump_spec.rb index a54a4c6735..0f77279a4f 100644 --- a/spec/ruby/core/marshal/dump_spec.rb +++ b/spec/ruby/core/marshal/dump_spec.rb @@ -1,5 +1,6 @@ # -*- encoding: binary -*- require_relative '../../spec_helper' +require_relative 'fixtures/classes' require_relative 'fixtures/marshal_data' describe "Marshal.dump" do @@ -75,7 +76,7 @@ describe "Marshal.dump" do end it "dumps a binary encoded Symbol" do - s = "\u2192".force_encoding("binary").to_sym + s = "\u2192".dup.force_encoding("binary").to_sym Marshal.dump(s).should == "\x04\b:\b\xE2\x86\x92" end @@ -84,8 +85,8 @@ describe "Marshal.dump" do symbol1 = "I:\t\xE2\x82\xACa\x06:\x06ET" symbol2 = "I:\t\xE2\x82\xACb\x06;\x06T" value = [ - "€a".force_encoding(Encoding::UTF_8).to_sym, - "€b".force_encoding(Encoding::UTF_8).to_sym + "€a".dup.force_encoding(Encoding::UTF_8).to_sym, + "€b".dup.force_encoding(Encoding::UTF_8).to_sym ] Marshal.dump(value).should == "\x04\b[\a#{symbol1}#{symbol2}" @@ -103,25 +104,76 @@ describe "Marshal.dump" do UserMarshal.should_not_receive(:name) Marshal.dump(UserMarshal.new) end + + it "raises TypeError if an Object is an instance of an anonymous class" do + -> { Marshal.dump(Class.new(UserMarshal).new) }.should raise_error(TypeError, /can't dump anonymous class/) + end end describe "with an object responding to #_dump" do - it "dumps the object returned by #marshal_dump" do + it "dumps the String returned by #_dump" do Marshal.dump(UserDefined.new).should == "\004\bu:\020UserDefined\022\004\b[\a:\nstuff;\000" end + it "dumps the String in non US-ASCII and non UTF-8 encoding" do + object = UserDefinedString.new("a".encode("windows-1251")) + Marshal.dump(object).should == "\x04\bIu:\x16UserDefinedString\x06a\x06:\rencoding\"\x11Windows-1251" + end + + it "dumps the String in multibyte encoding" do + object = UserDefinedString.new("a".encode("utf-32le")) + Marshal.dump(object).should == "\x04\bIu:\x16UserDefinedString\ta\x00\x00\x00\x06:\rencoding\"\rUTF-32LE" + end + + it "ignores overridden name method" do + obj = MarshalSpec::UserDefinedWithOverriddenName.new + Marshal.dump(obj).should == "\x04\bu:/MarshalSpec::UserDefinedWithOverriddenName\x12\x04\b[\a:\nstuff;\x00" + end + it "raises a TypeError if _dump returns a non-string" do m = mock("marshaled") m.should_receive(:_dump).and_return(0) -> { Marshal.dump(m) }.should raise_error(TypeError) end + it "raises TypeError if an Object is an instance of an anonymous class" do + -> { Marshal.dump(Class.new(UserDefined).new) }.should raise_error(TypeError, /can't dump anonymous class/) + end + it "favors marshal_dump over _dump" do m = mock("marshaled") m.should_receive(:marshal_dump).and_return(0) m.should_not_receive(:_dump) Marshal.dump(m) end + + it "indexes instance variables of a String returned by #_dump at first and then indexes the object itself" do + class MarshalSpec::M1::A + def _dump(level) + s = +"<dump>" + s.instance_variable_set(:@foo, "bar") + s + end + end + + a = MarshalSpec::M1::A.new + + # 0-based index of the object a = 2, that is encoded as \x07 and printed as "\a" character. + # Objects are serialized in the following order: Array, a, "bar". + # But they are indexed in different order: Array (index=0), "bar" (index=1), a (index=2) + # So the second occurenc of the object a is encoded as an index 2. + reference = "@\a" + Marshal.dump([a, a]).should == "\x04\b[\aIu:\x17MarshalSpec::M1::A\v<dump>\x06:\t@foo\"\bbar#{reference}" + end + + describe "Core library classes with #_dump returning a String with instance variables" do + it "indexes instance variables and then a Time object itself" do + t = Time.utc(2022) + reference = "@\a" + + Marshal.dump([t, t]).should == "\x04\b[\aIu:\tTime\r \x80\x1E\xC0\x00\x00\x00\x00\x06:\tzoneI\"\bUTC\x06:\x06EF#{reference}" + end + end end describe "with a Class" do @@ -137,8 +189,17 @@ describe "Marshal.dump" do Marshal.dump(UserDefined::Nested).should == "\004\bc\030UserDefined::Nested" end + it "ignores overridden name method" do + Marshal.dump(MarshalSpec::ClassWithOverriddenName).should == "\x04\bc)MarshalSpec::ClassWithOverriddenName" + end + + it "dumps a class with multibyte characters in name" do + source_object = eval("MarshalSpec::Multibyteãã‚ãƒã„Class".dup.force_encoding(Encoding::UTF_8)) + Marshal.dump(source_object).should == "\x04\bc,MarshalSpec::Multibyte\xE3\x81\x81\xE3\x81\x82\xE3\x81\x83\xE3\x81\x84Class" + end + it "raises TypeError with an anonymous Class" do - -> { Marshal.dump(Class.new) }.should raise_error(TypeError) + -> { Marshal.dump(Class.new) }.should raise_error(TypeError, /can't dump anonymous class/) end it "raises TypeError with a singleton Class" do @@ -151,8 +212,17 @@ describe "Marshal.dump" do Marshal.dump(Marshal).should == "\004\bm\fMarshal" end + it "ignores overridden name method" do + Marshal.dump(MarshalSpec::ModuleWithOverriddenName).should == "\x04\bc*MarshalSpec::ModuleWithOverriddenName" + end + + it "dumps a module with multibyte characters in name" do + source_object = eval("MarshalSpec::Multibyteã‘ã’ã“ã”Module".dup.force_encoding(Encoding::UTF_8)) + Marshal.dump(source_object).should == "\x04\bm-MarshalSpec::Multibyte\xE3\x81\x91\xE3\x81\x92\xE3\x81\x93\xE3\x81\x94Module" + end + it "raises TypeError with an anonymous Module" do - -> { Marshal.dump(Module.new) }.should raise_error(TypeError) + -> { Marshal.dump(Module.new) }.should raise_error(TypeError, /can't dump anonymous module/) end end @@ -185,15 +255,41 @@ describe "Marshal.dump" do [Marshal, -2**64, "\004\bl-\n\000\000\000\000\000\000\000\000\001\000"], ].should be_computed_by(:dump) end + + it "increases the object links counter" do + obj = Object.new + object_1_link = "\x06" # representing of (0-based) index=1 (by adding 5 for small Integers) + object_2_link = "\x07" # representing of index=2 + + # objects: Array, Object, Object + Marshal.dump([obj, obj]).should == "\x04\b[\ao:\vObject\x00@#{object_1_link}" + + # objects: Array, Bignum, Object, Object + Marshal.dump([2**64, obj, obj]).should == "\x04\b[\bl+\n\x00\x00\x00\x00\x00\x00\x00\x00\x01\x00o:\vObject\x00@#{object_2_link}" + Marshal.dump([2**48, obj, obj]).should == "\x04\b[\bl+\t\x00\x00\x00\x00\x00\x00\x01\x00o:\vObject\x00@#{object_2_link}" + Marshal.dump([2**32, obj, obj]).should == "\x04\b[\bl+\b\x00\x00\x00\x00\x01\x00o:\vObject\x00@#{object_2_link}" + end + end + + describe "with a Rational" do + it "dumps a Rational" do + Marshal.dump(Rational(2, 3)).should == "\x04\bU:\rRational[\ai\ai\b" + end + end + + describe "with a Complex" do + it "dumps a Complex" do + Marshal.dump(Complex(2, 3)).should == "\x04\bU:\fComplex[\ai\ai\b" + end end describe "with a String" do it "dumps a blank String" do - Marshal.dump("".force_encoding("binary")).should == "\004\b\"\000" + Marshal.dump("".dup.force_encoding("binary")).should == "\004\b\"\000" end it "dumps a short String" do - Marshal.dump("short".force_encoding("binary")).should == "\004\b\"\012short" + Marshal.dump("short".dup.force_encoding("binary")).should == "\004\b\"\012short" end it "dumps a long String" do @@ -201,7 +297,7 @@ describe "Marshal.dump" do end it "dumps a String extended with a Module" do - Marshal.dump("".extend(Meths).force_encoding("binary")).should == "\004\be:\nMeths\"\000" + Marshal.dump("".dup.extend(Meths).force_encoding("binary")).should == "\004\be:\nMeths\"\000" end it "dumps a String subclass" do @@ -212,24 +308,29 @@ describe "Marshal.dump" do Marshal.dump(UserString.new.extend(Meths).force_encoding("binary")).should == "\004\be:\nMethsC:\017UserString\"\000" end + it "ignores overridden name method when dumps a String subclass" do + obj = MarshalSpec::StringWithOverriddenName.new + Marshal.dump(obj).should == "\x04\bC:*MarshalSpec::StringWithOverriddenName\"\x00" + end + it "dumps a String with instance variables" do - str = "" + str = +"" str.instance_variable_set("@foo", "bar") Marshal.dump(str.force_encoding("binary")).should == "\x04\bI\"\x00\x06:\t@foo\"\bbar" end it "dumps a US-ASCII String" do - str = "abc".force_encoding("us-ascii") + str = "abc".dup.force_encoding("us-ascii") Marshal.dump(str).should == "\x04\bI\"\babc\x06:\x06EF" end it "dumps a UTF-8 String" do - str = "\x6d\xc3\xb6\x68\x72\x65".force_encoding("utf-8") + str = "\x6d\xc3\xb6\x68\x72\x65".dup.force_encoding("utf-8") Marshal.dump(str).should == "\x04\bI\"\vm\xC3\xB6hre\x06:\x06ET" end it "dumps a String in another encoding" do - str = "\x6d\x00\xf6\x00\x68\x00\x72\x00\x65\x00".force_encoding("utf-16le") + str = "\x6d\x00\xf6\x00\x68\x00\x72\x00\x65\x00".dup.force_encoding("utf-16le") result = "\x04\bI\"\x0Fm\x00\xF6\x00h\x00r\x00e\x00\x06:\rencoding\"\rUTF-16LE" Marshal.dump(str).should == result end @@ -263,18 +364,46 @@ describe "Marshal.dump" do end it "dumps a binary Regexp" do - o = Regexp.new("".force_encoding("binary"), Regexp::FIXEDENCODING) + o = Regexp.new("".dup.force_encoding("binary"), Regexp::FIXEDENCODING) Marshal.dump(o).should == "\x04\b/\x00\x10" end + it "dumps an ascii-compatible Regexp" do + o = Regexp.new("a".encode("us-ascii"), Regexp::FIXEDENCODING) + Marshal.dump(o).should == "\x04\bI/\x06a\x10\x06:\x06EF" + + o = Regexp.new("a".encode("us-ascii")) + Marshal.dump(o).should == "\x04\bI/\x06a\x00\x06:\x06EF" + + o = Regexp.new("a".encode("windows-1251"), Regexp::FIXEDENCODING) + Marshal.dump(o).should == "\x04\bI/\x06a\x10\x06:\rencoding\"\x11Windows-1251" + + o = Regexp.new("a".encode("windows-1251")) + Marshal.dump(o).should == "\x04\bI/\x06a\x00\x06:\x06EF" + end + it "dumps a UTF-8 Regexp" do - o = Regexp.new("".force_encoding("utf-8"), Regexp::FIXEDENCODING) + o = Regexp.new("".dup.force_encoding("utf-8"), Regexp::FIXEDENCODING) Marshal.dump(o).should == "\x04\bI/\x00\x10\x06:\x06ET" + + o = Regexp.new("a".dup.force_encoding("utf-8"), Regexp::FIXEDENCODING) + Marshal.dump(o).should == "\x04\bI/\x06a\x10\x06:\x06ET" + + o = Regexp.new("\u3042".dup.force_encoding("utf-8"), Regexp::FIXEDENCODING) + Marshal.dump(o).should == "\x04\bI/\b\xE3\x81\x82\x10\x06:\x06ET" end it "dumps a Regexp in another encoding" do - o = Regexp.new("".force_encoding("utf-16le"), Regexp::FIXEDENCODING) + o = Regexp.new("".dup.force_encoding("utf-16le"), Regexp::FIXEDENCODING) Marshal.dump(o).should == "\x04\bI/\x00\x10\x06:\rencoding\"\rUTF-16LE" + + o = Regexp.new("a".encode("utf-16le"), Regexp::FIXEDENCODING) + Marshal.dump(o).should == "\x04\bI/\aa\x00\x10\x06:\rencoding\"\rUTF-16LE" + end + + it "ignores overridden name method when dumps a Regexp subclass" do + obj = MarshalSpec::RegexpWithOverriddenName.new("") + Marshal.dump(obj).should == "\x04\bIC:*MarshalSpec::RegexpWithOverriddenName/\x00\x00\x06:\x06EF" end end @@ -306,6 +435,11 @@ describe "Marshal.dump" do it "dumps an extended Array" do Marshal.dump([].extend(Meths)).should == "\004\be:\nMeths[\000" end + + it "ignores overridden name method when dumps an Array subclass" do + obj = MarshalSpec::ArrayWithOverriddenName.new + Marshal.dump(obj).should == "\x04\bC:)MarshalSpec::ArrayWithOverriddenName[\x00" + end end describe "with a Hash" do @@ -313,6 +447,10 @@ describe "Marshal.dump" do Marshal.dump({}).should == "\004\b{\000" end + it "dumps a non-empty Hash" do + Marshal.dump({a: 1}).should == "\x04\b{\x06:\x06ai\x06" + end + it "dumps a Hash subclass" do Marshal.dump(UserHash.new).should == "\004\bC:\rUserHash{\000" end @@ -321,8 +459,24 @@ describe "Marshal.dump" do Marshal.dump(Hash.new(1)).should == "\004\b}\000i\006" end + ruby_version_is "3.1" do + it "dumps a Hash with compare_by_identity" do + h = {} + h.compare_by_identity + + Marshal.dump(h).should == "\004\bC:\tHash{\x00" + end + + it "dumps a Hash subclass with compare_by_identity" do + h = UserHash.new + h.compare_by_identity + + Marshal.dump(h).should == "\x04\bC:\rUserHashC:\tHash{\x00" + end + end + it "raises a TypeError with hash having default proc" do - -> { Marshal.dump(Hash.new {}) }.should raise_error(TypeError) + -> { Marshal.dump(Hash.new {}) }.should raise_error(TypeError, "can't dump hash with default proc") end it "dumps a Hash with instance variables" do @@ -338,6 +492,11 @@ describe "Marshal.dump" do it "dumps an Hash subclass with a parameter to initialize" do Marshal.dump(UserHashInitParams.new(1)).should == "\004\bIC:\027UserHashInitParams{\000\006:\a@ai\006" end + + it "ignores overridden name method when dumps a Hash subclass" do + obj = MarshalSpec::HashWithOverriddenName.new + Marshal.dump(obj).should == "\x04\bC:(MarshalSpec::HashWithOverriddenName{\x00" + end end describe "with a Struct" do @@ -366,6 +525,15 @@ describe "Marshal.dump" do Marshal.dump(obj).should == "\004\be:\nMethsS:\025Struct::Extended\a:\006a[\a;\a\"\ahi:\006b[\a;\000@\a" Struct.send(:remove_const, :Extended) end + + it "ignores overridden name method" do + obj = MarshalSpec::StructWithOverriddenName.new("member") + Marshal.dump(obj).should == "\x04\bS:*MarshalSpec::StructWithOverriddenName\x06:\x06a\"\vmember" + end + + it "raises TypeError with an anonymous Struct" do + -> { Marshal.dump(Struct.new(:a).new(1)) }.should raise_error(TypeError, /can't dump anonymous class/) + end end describe "with an Object" do @@ -385,7 +553,7 @@ describe "Marshal.dump" do it "dumps an Object with a non-US-ASCII instance variable" do obj = Object.new - ivar = "@é".force_encoding(Encoding::UTF_8).to_sym + ivar = "@é".dup.force_encoding(Encoding::UTF_8).to_sym obj.instance_variable_set(ivar, 1) Marshal.dump(obj).should == "\x04\bo:\vObject\x06I:\b@\xC3\xA9\x06:\x06ETi\x06" end @@ -397,13 +565,18 @@ describe "Marshal.dump" do Marshal.dump(obj).should == "\004\bo:\x0BObject\x00" end - it "dumps an Object if it has a singleton class but no singleton methods" do + it "dumps an Object if it has a singleton class but no singleton methods and no singleton instance variables" do obj = Object.new obj.singleton_class Marshal.dump(obj).should == "\004\bo:\x0BObject\x00" end - it "raises if an Object has a singleton class and singleton methods" do + it "ignores overridden name method" do + obj = MarshalSpec::ClassWithOverriddenName.new + Marshal.dump(obj).should == "\x04\bo:)MarshalSpec::ClassWithOverriddenName\x00" + end + + it "raises TypeError if an Object has a singleton class and singleton methods" do obj = Object.new def obj.foo; end -> { @@ -411,10 +584,45 @@ describe "Marshal.dump" do }.should raise_error(TypeError, "singleton can't be dumped") end + it "raises TypeError if an Object has a singleton class and singleton instance variables" do + obj = Object.new + class << obj + @v = 1 + end + + -> { + Marshal.dump(obj) + }.should raise_error(TypeError, "singleton can't be dumped") + end + + it "raises TypeError if an Object is an instance of an anonymous class" do + anonymous_class = Class.new + obj = anonymous_class.new + + -> { Marshal.dump(obj) }.should raise_error(TypeError, /can't dump anonymous class/) + end + + it "raises TypeError if an Object extends an anonymous module" do + anonymous_module = Module.new + obj = Object.new + obj.extend(anonymous_module) + + -> { Marshal.dump(obj) }.should raise_error(TypeError, /can't dump anonymous class/) + end + it "dumps a BasicObject subclass if it defines respond_to?" do obj = MarshalSpec::BasicObjectSubWithRespondToFalse.new Marshal.dump(obj).should == "\x04\bo:2MarshalSpec::BasicObjectSubWithRespondToFalse\x00" end + + it "dumps without marshaling any attached finalizer" do + obj = Object.new + finalizer = Object.new + def finalizer.noop(_) + end + ObjectSpace.define_finalizer(obj, finalizer.method(:noop)) + Marshal.load(Marshal.dump(obj)).class.should == Object + end end describe "with a Range" do @@ -430,15 +638,8 @@ describe "Marshal.dump" do load.should == (1...2) end - ruby_version_is ""..."3.0" do - it "dumps a Range with extra instance variables" do - range = (1...3) - range.instance_variable_set :@foo, 42 - dump = Marshal.dump(range) - load = Marshal.load(dump) - load.should == range - load.instance_variable_get(:@foo).should == 42 - end + it "raises TypeError with an anonymous Range subclass" do + -> { Marshal.dump(Class.new(Range).new(1, 2)) }.should raise_error(TypeError, /can't dump anonymous class/) end end @@ -477,6 +678,20 @@ describe "Marshal.dump" do zone = ":\tzoneI\"\bUTC\x06:\x06EF" # Last is 'F' (US-ASCII) dump.should == "\x04\bIu:\tTime\r#{@utc_dump}\x06#{zone}" end + + it "ignores overridden name method" do + obj = MarshalSpec::TimeWithOverriddenName.new + Marshal.dump(obj).should include("MarshalSpec::TimeWithOverriddenName") + end + + it "dumps a Time subclass with multibyte characters in name" do + source_object = eval("MarshalSpec::Multibyteãã‚ãƒã„Time".dup.force_encoding(Encoding::UTF_8)) + Marshal.dump(source_object).should == "\x04\bc+MarshalSpec::Multibyte\xE3\x81\x81\xE3\x81\x82\xE3\x81\x83\xE3\x81\x84Time" + end + + it "raises TypeError with an anonymous Time subclass" do + -> { Marshal.dump(Class.new(Time).now) }.should raise_error(TypeError) + end end describe "with an Exception" do @@ -517,6 +732,23 @@ describe "Marshal.dump" do reloaded.cause.should be_an_instance_of(StandardError) reloaded.cause.message.should == "the cause" end + + # NoMethodError uses an exception formatter on TruffleRuby and computes a message lazily + it "dumps the message for the raised NoMethodError exception" do + begin + "".foo + rescue => e + end + + Marshal.dump(e).should =~ /undefined method [`']foo' for ("":String|an instance of String)/ + end + + it "raises TypeError if an Object is an instance of an anonymous class" do + anonymous_class = Class.new(Exception) + obj = anonymous_class.new + + -> { Marshal.dump(obj) }.should raise_error(TypeError, /can't dump anonymous class/) + end end it "dumps subsequent appearances of a symbol as a link" do @@ -549,7 +781,6 @@ describe "Marshal.dump" do end describe "when passed an IO" do - it "writes the serialized data to the IO-Object" do (obj = mock('test')).should_receive(:write).at_least(1) Marshal.dump("test", obj) @@ -572,8 +803,6 @@ describe "Marshal.dump" do obj.should_receive(:binmode).at_least(1) Marshal.dump("test", obj) end - - end describe "when passed a StringIO" do @@ -604,30 +833,4 @@ describe "Marshal.dump" do m = Mutex.new -> { Marshal.dump(m) }.should raise_error(TypeError) end - - ruby_version_is ''...'2.7' do - it "returns an untainted string if object is untainted" do - Marshal.dump(Object.new).tainted?.should be_false - end - - it "returns a tainted string if object is tainted" do - Marshal.dump(Object.new.taint).tainted?.should be_true - end - - it "returns a tainted string if nested object is tainted" do - Marshal.dump([[Object.new.taint]]).tainted?.should be_true - end - - it "returns a trusted string if object is trusted" do - Marshal.dump(Object.new).untrusted?.should be_false - end - - it "returns an untrusted string if object is untrusted" do - Marshal.dump(Object.new.untrust).untrusted?.should be_true - end - - it "returns an untrusted string if nested object is untrusted" do - Marshal.dump([[Object.new.untrust]]).untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/marshal/fixtures/classes.rb b/spec/ruby/core/marshal/fixtures/classes.rb new file mode 100644 index 0000000000..7c81c64927 --- /dev/null +++ b/spec/ruby/core/marshal/fixtures/classes.rb @@ -0,0 +1,4 @@ +module MarshalSpec + # empty modules + module M1 end +end diff --git a/spec/ruby/core/marshal/fixtures/marshal_data.rb b/spec/ruby/core/marshal/fixtures/marshal_data.rb index 9373ef7ba8..a508b6bea1 100644 --- a/spec/ruby/core/marshal/fixtures/marshal_data.rb +++ b/spec/ruby/core/marshal/fixtures/marshal_data.rb @@ -38,7 +38,7 @@ class UserDefinedWithIvar attr_reader :a, :b, :c def initialize - @a = 'stuff' + @a = +'stuff' @a.instance_variable_set :@foo, :UserDefinedWithIvar @b = 'more' @c = @b @@ -78,6 +78,22 @@ class UserDefinedImmediate end end +class UserDefinedString + attr_reader :string + + def initialize(string) + @string = string + end + + def _dump(depth) + @string + end + + def self._load(data) + new(data) + end +end + class UserPreviouslyDefinedWithInitializedIvar attr_accessor :field1, :field2 end @@ -167,12 +183,17 @@ module MarshalSpec end end + StructToDump = Struct.new(:a, :b) + class BasicObjectSubWithRespondToFalse < BasicObject def respond_to?(method_name, include_all=false) false end end + module ModuleToExtendBy + end + def self.random_data randomizer = Random.new(42) 1000.times{randomizer.rand} # Make sure we exhaust his first state of 624 random words @@ -192,6 +213,81 @@ module MarshalSpec set_swapped_class(nil) end + class ClassWithOverriddenName + def self.name + "Foo" + end + end + + class ModuleWithOverriddenName + def self.name + "Foo" + end + end + + class TimeWithOverriddenName < Time + def self.name + "Foo" + end + end + + class StructWithOverriddenName < Struct.new(:a) + def self.name + "Foo" + end + end + + class UserDefinedWithOverriddenName < UserDefined + def self.name + "Foo" + end + end + + class StringWithOverriddenName < String + def self.name + "Foo" + end + end + + class ArrayWithOverriddenName < Array + def self.name + "Foo" + end + end + + class HashWithOverriddenName < Hash + def self.name + "Foo" + end + end + + class RegexpWithOverriddenName < Regexp + def self.name + "Foo" + end + end + + module_eval(<<~ruby.dup.force_encoding(Encoding::UTF_8)) + class Multibyteãã‚ãƒã„Class + end + + module Multibyteã‘ã’ã“ã”Module + end + + class Multibyteãã‚ãƒã„Time < Time + end + ruby + + class ObjectWithFreezeRaisingException < Object + def freeze + raise + end + end + + class ObjectWithoutFreeze < Object + undef freeze + end + DATA = { "nil" => [nil, "\004\b0"], "1..2" => [(1..2), @@ -217,7 +313,7 @@ module MarshalSpec "\004\b\"\012small"], "String big" => ['big' * 100, "\004\b\"\002,\001#{'big' * 100}"], - "String extended" => [''.extend(Meths), # TODO: check for module on load + "String extended" => [''.dup.extend(Meths), # TODO: check for module on load "\004\be:\nMeths\"\000"], "String subclass" => [UserString.new, "\004\bC:\017UserString\"\000"], @@ -324,7 +420,7 @@ module MarshalSpec "\x04\bI\"\nsmall\x06:\x06EF"], "String big" => ['big' * 100, "\x04\bI\"\x02,\x01bigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbigbig\x06:\x06EF"], - "String extended" => [''.extend(Meths), # TODO: check for module on load + "String extended" => [''.dup.extend(Meths), # TODO: check for module on load "\x04\bIe:\nMeths\"\x00\x06:\x06EF"], "String subclass" => [UserString.new, "\004\bC:\017UserString\"\000"], diff --git a/spec/ruby/core/marshal/shared/load.rb b/spec/ruby/core/marshal/shared/load.rb index a79fb51cd7..f599042529 100644 --- a/spec/ruby/core/marshal/shared/load.rb +++ b/spec/ruby/core/marshal/shared/load.rb @@ -8,7 +8,11 @@ describe :marshal_load, shared: true do it "raises an ArgumentError when the dumped data is truncated" do obj = {first: 1, second: 2, third: 3} - -> { Marshal.send(@method, Marshal.dump(obj)[0, 5]) }.should raise_error(ArgumentError) + -> { Marshal.send(@method, Marshal.dump(obj)[0, 5]) }.should raise_error(ArgumentError, "marshal data too short") + end + + it "raises an ArgumentError when the argument is empty String" do + -> { Marshal.send(@method, "") }.should raise_error(ArgumentError, "marshal data too short") end it "raises an ArgumentError when the dumped class is missing" do @@ -19,43 +23,272 @@ describe :marshal_load, shared: true do -> { Marshal.send(@method, kaboom) }.should raise_error(ArgumentError) end - describe "when called with a proc" do - it "returns the value of the proc" do - Marshal.send(@method, Marshal.dump([1,2]), proc { [3,4] }).should == [3,4] + ruby_version_is "3.1" do + describe "when called with freeze: true" do + it "returns frozen strings" do + string = Marshal.send(@method, Marshal.dump("foo"), freeze: true) + string.should == "foo" + string.should.frozen? + + utf8_string = "foo".encode(Encoding::UTF_8) + string = Marshal.send(@method, Marshal.dump(utf8_string), freeze: true) + string.should == utf8_string + string.should.frozen? + end + + it "returns frozen arrays" do + array = Marshal.send(@method, Marshal.dump([1, 2, 3]), freeze: true) + array.should == [1, 2, 3] + array.should.frozen? + end + + it "returns frozen hashes" do + hash = Marshal.send(@method, Marshal.dump({foo: 42}), freeze: true) + hash.should == {foo: 42} + hash.should.frozen? + end + + it "returns frozen regexps" do + regexp = Marshal.send(@method, Marshal.dump(/foo/), freeze: true) + regexp.should == /foo/ + regexp.should.frozen? + end + + it "returns frozen structs" do + struct = Marshal.send(@method, Marshal.dump(MarshalSpec::StructToDump.new(1, 2)), freeze: true) + struct.should == MarshalSpec::StructToDump.new(1, 2) + struct.should.frozen? + end + + it "returns frozen objects" do + source_object = Object.new + + object = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + object.should.frozen? + end + + describe "deep freezing" do + it "returns hashes with frozen keys and values" do + key = Object.new + value = Object.new + source_object = {key => value} + + hash = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + hash.size.should == 1 + hash.keys[0].should.frozen? + hash.values[0].should.frozen? + end + + it "returns arrays with frozen elements" do + object = Object.new + source_object = [object] + + array = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + array.size.should == 1 + array[0].should.frozen? + end + + it "returns structs with frozen members" do + object1 = Object.new + object2 = Object.new + source_object = MarshalSpec::StructToDump.new(object1, object2) + + struct = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + struct.a.should.frozen? + struct.b.should.frozen? + end + + it "returns objects with frozen instance variables" do + source_object = Object.new + instance_variable = Object.new + source_object.instance_variable_set(:@a, instance_variable) + + object = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + object.instance_variable_get(:@a).should != nil + object.instance_variable_get(:@a).should.frozen? + end + + it "deduplicates frozen strings" do + source_object = ["foo" + "bar", "foobar"] + object = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + + object[0].should equal(object[1]) + end + end + + it "does not freeze modules" do + object = Marshal.send(@method, Marshal.dump(Kernel), freeze: true) + object.should_not.frozen? + Kernel.should_not.frozen? + end + + it "does not freeze classes" do + object = Marshal.send(@method, Marshal.dump(Object), freeze: true) + object.should_not.frozen? + Object.should_not.frozen? + end + + ruby_bug "#19427", ""..."3.3" do + it "does freeze extended objects" do + object = Marshal.load("\x04\be:\x0FEnumerableo:\vObject\x00", freeze: true) + object.should.frozen? + end + + it "does freeze extended objects with instance variables" do + object = Marshal.load("\x04\be:\x0FEnumerableo:\vObject\x06:\n@ivarT", freeze: true) + object.should.frozen? + end + end + + ruby_bug "#19427", "3.1"..."3.3" do + it "returns frozen object having #_dump method" do + object = Marshal.send(@method, Marshal.dump(UserDefined.new), freeze: true) + object.should.frozen? + end + + it "returns frozen object responding to #marshal_dump and #marshal_load" do + object = Marshal.send(@method, Marshal.dump(UserMarshal.new), freeze: true) + object.should.frozen? + end + + it "returns frozen object extended by a module" do + object = Object.new + object.extend(MarshalSpec::ModuleToExtendBy) + + object = Marshal.send(@method, Marshal.dump(object), freeze: true) + object.should.frozen? + end + end + + it "does not call freeze method" do + object = MarshalSpec::ObjectWithFreezeRaisingException.new + object = Marshal.send(@method, Marshal.dump(object), freeze: true) + object.should.frozen? + end + + it "returns frozen object even if object does not respond to freeze method" do + object = MarshalSpec::ObjectWithoutFreeze.new + object = Marshal.send(@method, Marshal.dump(object), freeze: true) + object.should.frozen? + end + + it "returns a frozen object when is an instance of String/Array/Regexp/Hash subclass and has instance variables" do + source_object = UserString.new + source_object.instance_variable_set(:@foo, "bar") + + object = Marshal.send(@method, Marshal.dump(source_object), freeze: true) + object.should.frozen? + end + + describe "when called with a proc" do + it "call the proc with frozen objects" do + arr = [] + s = +'hi' + s.instance_variable_set(:@foo, 5) + st = Struct.new("Brittle", :a).new + st.instance_variable_set(:@clue, 'none') + st.a = 0.0 + h = Hash.new('def') + h['nine'] = 9 + a = [:a, :b, :c] + a.instance_variable_set(:@two, 2) + obj = [s, 10, s, s, st, a] + obj.instance_variable_set(:@zoo, 'ant') + proc = Proc.new { |o| arr << o; o} + + Marshal.send( + @method, + "\x04\bI[\vI\"\ahi\a:\x06EF:\t@fooi\ni\x0F@\x06@\x06IS:\x14Struct::Brittle\x06:\x06af\x060\x06:\n@clueI\"\tnone\x06;\x00FI[\b;\b:\x06b:\x06c\x06:\t@twoi\a\x06:\t@zooI\"\bant\x06;\x00F", + proc, + freeze: true, + ) + + arr.should == [ + false, 5, "hi", 10, "hi", "hi", 0.0, false, "none", st, + :b, :c, 2, a, false, "ant", ["hi", 10, "hi", "hi", st, [:a, :b, :c]], + ] + + arr.each do |v| + v.should.frozen? + end + + Struct.send(:remove_const, :Brittle) + end + + it "does not freeze the object returned by the proc" do + string = Marshal.send(@method, Marshal.dump("foo"), proc { |o| o.upcase }, freeze: true) + string.should == "FOO" + string.should_not.frozen? + end + end end + end - it "calls the proc for recursively visited data" do - a = [1] - a << a - ret = [] - Marshal.send(@method, Marshal.dump(a), proc { |arg| ret << arg; arg }) - ret.first.should == 1 - ret[1].should == [1,a] - ret[2].should == a - ret.size.should == 3 + describe "when called with a proc" do + ruby_bug "#18141", ""..."3.1" do + it "call the proc with fully initialized strings" do + utf8_string = "foo".encode(Encoding::UTF_8) + Marshal.send(@method, Marshal.dump(utf8_string), proc { |arg| + if arg.is_a?(String) + arg.should == utf8_string + arg.encoding.should == Encoding::UTF_8 + end + arg + }) + end + + it "no longer mutate the object after it was passed to the proc" do + string = Marshal.load(Marshal.dump("foo"), :freeze.to_proc) + string.should.frozen? + end end - it "loads an Array with proc" do - arr = [] - s = 'hi' - s.instance_variable_set(:@foo, 5) - st = Struct.new("Brittle", :a).new - st.instance_variable_set(:@clue, 'none') - st.a = 0.0 - h = Hash.new('def') - h['nine'] = 9 - a = [:a, :b, :c] - a.instance_variable_set(:@two, 2) - obj = [s, 10, s, s, st, a] - obj.instance_variable_set(:@zoo, 'ant') - proc = Proc.new { |o| arr << o; o} + ruby_bug "#19427", ""..."3.3" do + it "call the proc with extended objects" do + objs = [] + obj = Marshal.load("\x04\be:\x0FEnumerableo:\vObject\x00", Proc.new { |o| objs << o; o }) + objs.should == [obj] + end + end - Marshal.send(@method, "\x04\bI[\vI\"\ahi\a:\x06EF:\t@fooi\ni\x0F@\x06@\x06IS:\x14Struct::Brittle\x06:\x06af\x060\x06:\n@clueI\"\tnone\x06;\x00FI[\b;\b:\x06b:\x06c\x06:\t@twoi\a\x06:\t@zooI\"\bant\x06;\x00F", proc) + it "returns the value of the proc" do + Marshal.send(@method, Marshal.dump([1,2]), proc { [3,4] }).should == [3,4] + end - arr.should == ["hi", false, 5, 10, "hi", "hi", 0.0, st, "none", false, - :b, :c, a, 2, ["hi", 10, "hi", "hi", st, [:a, :b, :c]], "ant", false] + ruby_bug "#18141", ""..."3.1" do + it "calls the proc for recursively visited data" do + a = [1] + a << a + ret = [] + Marshal.send(@method, Marshal.dump(a), proc { |arg| ret << arg.inspect; arg }) + ret[0].should == 1.inspect + ret[1].should == a.inspect + ret.size.should == 2 + end - Struct.send(:remove_const, :Brittle) + it "loads an Array with proc" do + arr = [] + s = +'hi' + s.instance_variable_set(:@foo, 5) + st = Struct.new("Brittle", :a).new + st.instance_variable_set(:@clue, 'none') + st.a = 0.0 + h = Hash.new('def') + h['nine'] = 9 + a = [:a, :b, :c] + a.instance_variable_set(:@two, 2) + obj = [s, 10, s, s, st, a] + obj.instance_variable_set(:@zoo, 'ant') + proc = Proc.new { |o| arr << o.dup; o} + + Marshal.send(@method, "\x04\bI[\vI\"\ahi\a:\x06EF:\t@fooi\ni\x0F@\x06@\x06IS:\x14Struct::Brittle\x06:\x06af\x060\x06:\n@clueI\"\tnone\x06;\x00FI[\b;\b:\x06b:\x06c\x06:\t@twoi\a\x06:\t@zooI\"\bant\x06;\x00F", proc) + + arr.should == [ + false, 5, "hi", 10, "hi", "hi", 0.0, false, "none", st, + :b, :c, 2, a, false, "ant", ["hi", 10, "hi", "hi", st, [:a, :b, :c]], + ] + Struct.send(:remove_const, :Brittle) + end end end @@ -81,7 +314,19 @@ describe :marshal_load, shared: true do marshaled_obj.field2.should be_nil end - describe "that return an immediate value" do + it "loads the String in non US-ASCII and non UTF-8 encoding" do + source_object = UserDefinedString.new("a".encode("windows-1251")) + object = Marshal.send(@method, Marshal.dump(source_object)) + object.string.should == "a".encode("windows-1251") + end + + it "loads the String in multibyte encoding" do + source_object = UserDefinedString.new("a".encode("utf-32le")) + object = Marshal.send(@method, Marshal.dump(source_object)) + object.string.should == "a".encode("utf-32le") + end + + describe "that returns an immediate value" do it "loads an array containing an instance of the object, followed by multiple instances of another object" do str = "string" @@ -119,28 +364,39 @@ describe :marshal_load, shared: true do end end - it "loads an array containing objects having _dump method, and with proc" do - arr = [] - myproc = Proc.new { |o| arr << o; o } - o1 = UserDefined.new; - o2 = UserDefinedWithIvar.new - obj = [o1, o2, o1, o2] + ruby_bug "#18141", ""..."3.1" do + it "loads an array containing objects having _dump method, and with proc" do + arr = [] + myproc = Proc.new { |o| arr << o.dup; o } + o1 = UserDefined.new; + o2 = UserDefinedWithIvar.new + obj = [o1, o2, o1, o2] - Marshal.send(@method, "\x04\b[\tu:\x10UserDefined\x18\x04\b[\aI\"\nstuff\x06:\x06EF@\x06u:\x18UserDefinedWithIvar>\x04\b[\bI\"\nstuff\a:\x06EF:\t@foo:\x18UserDefinedWithIvarI\"\tmore\x06;\x00F@\a@\x06@\a", myproc) + Marshal.send(@method, "\x04\b[\tu:\x10UserDefined\x18\x04\b[\aI\"\nstuff\x06:\x06EF@\x06u:\x18UserDefinedWithIvar>\x04\b[\bI\"\nstuff\a:\x06EF:\t@foo:\x18UserDefinedWithIvarI\"\tmore\x06;\x00F@\a@\x06@\a", myproc) - arr.should == [o1, o2, o1, o2, obj] - end + arr[0].should == o1 + arr[1].should == o2 + arr[2].should == obj + arr.size.should == 3 + end + + it "loads an array containing objects having marshal_dump method, and with proc" do + arr = [] + proc = Proc.new { |o| arr << o.dup; o } + o1 = UserMarshal.new + o2 = UserMarshalWithIvar.new - it "loads an array containing objects having marshal_dump method, and with proc" do - arr = [] - proc = Proc.new { |o| arr << o; o } - o1 = UserMarshal.new - o2 = UserMarshalWithIvar.new - obj = [o1, o2, o1, o2] + Marshal.send(@method, "\004\b[\tU:\020UserMarshal\"\nstuffU:\030UserMarshalWithIvar[\006\"\fmy data@\006@\b", proc) - Marshal.send(@method, "\004\b[\tU:\020UserMarshal\"\nstuffU:\030UserMarshalWithIvar[\006\"\fmy data@\006@\b", proc) + arr[0].should == 'stuff' + arr[1].should == o1 + arr[2].should == 'my data' + arr[3].should == ['my data'] + arr[4].should == o2 + arr[5].should == [o1, o2, o1, o2] - arr.should == ['stuff', o1, 'my data', ['my data'], o2, o1, o2, obj] + arr.size.should == 6 + end end it "assigns classes to nested subclasses of Array correctly" do @@ -157,13 +413,13 @@ describe :marshal_load, shared: true do end it "raises a TypeError with bad Marshal version" do - marshal_data = '\xff\xff' + marshal_data = +'\xff\xff' marshal_data[0] = (Marshal::MAJOR_VERSION).chr marshal_data[1] = (Marshal::MINOR_VERSION + 1).chr -> { Marshal.send(@method, marshal_data) }.should raise_error(TypeError) - marshal_data = '\xff\xff' + marshal_data = +'\xff\xff' marshal_data[0] = (Marshal::MAJOR_VERSION - 1).chr marshal_data[1] = (Marshal::MINOR_VERSION).chr @@ -181,89 +437,6 @@ describe :marshal_load, shared: true do end end - ruby_version_is ''...'2.7' do - it "returns an untainted object if source is untainted" do - x = Object.new - y = Marshal.send(@method, Marshal.dump(x)) - y.tainted?.should be_false - end - - describe "when source is tainted" do - it "returns a tainted object" do - x = Object.new - x.taint - s = Marshal.dump(x) - y = Marshal.send(@method, s) - y.tainted?.should be_true - - # note that round-trip via Marshal does not preserve - # the taintedness at each level of the nested structure - y = Marshal.send(@method, Marshal.dump([[x]])) - y.tainted?.should be_true - y.first.tainted?.should be_true - y.first.first.tainted?.should be_true - end - - it "does not taint Symbols" do - x = [:x] - y = Marshal.send(@method, Marshal.dump(x).taint) - y.tainted?.should be_true - y.first.tainted?.should be_false - end - - it "does not taint Fixnums" do - x = [1] - y = Marshal.send(@method, Marshal.dump(x).taint) - y.tainted?.should be_true - y.first.tainted?.should be_false - end - - it "does not taint Bignums" do - x = [bignum_value] - y = Marshal.send(@method, Marshal.dump(x).taint) - y.tainted?.should be_true - y.first.tainted?.should be_false - end - - it "does not taint Floats" do - x = [1.2] - y = Marshal.send(@method, Marshal.dump(x).taint) - y.tainted?.should be_true - y.first.tainted?.should be_false - end - end - - it "preserves taintedness of nested structure" do - x = Object.new - a = [[x]] - x.taint - y = Marshal.send(@method, Marshal.dump(a)) - y.tainted?.should be_true - y.first.tainted?.should be_true - y.first.first.tainted?.should be_true - end - - it "returns a trusted object if source is trusted" do - x = Object.new - y = Marshal.send(@method, Marshal.dump(x)) - y.untrusted?.should be_false - end - - it "returns an untrusted object if source is untrusted" do - x = Object.new - x.untrust - y = Marshal.send(@method, Marshal.dump(x)) - y.untrusted?.should be_true - - # note that round-trip via Marshal does not preserve - # the untrustedness at each level of the nested structure - y = Marshal.send(@method, Marshal.dump([[x]])) - y.untrusted?.should be_true - y.first.untrusted?.should be_true - y.first.first.untrusted?.should be_true - end - end - # Note: Ruby 1.9 should be compatible with older marshal format MarshalSpec::DATA.each do |description, (object, marshal, attributes)| it "loads a #{description}" do @@ -297,7 +470,7 @@ describe :marshal_load, shared: true do end it "loads an array having ivar" do - s = 'well' + s = +'well' s.instance_variable_set(:@foo, 10) obj = ['5', s, 'hi'].extend(Meths, MethsMore) obj.instance_variable_set(:@mix, s) @@ -343,7 +516,7 @@ describe :marshal_load, shared: true do end it "preserves hash ivars when hash contains a string having ivar" do - s = 'string' + s = +'string' s.instance_variable_set :@string_ivar, 'string ivar' h = { key: s } h.instance_variable_set :@hash_ivar, 'hash ivar' @@ -352,6 +525,38 @@ describe :marshal_load, shared: true do unmarshalled.instance_variable_get(:@hash_ivar).should == 'hash ivar' unmarshalled[:key].instance_variable_get(:@string_ivar).should == 'string ivar' end + + ruby_version_is "3.1" do + it "preserves compare_by_identity behaviour" do + h = { a: 1 } + h.compare_by_identity + unmarshalled = Marshal.send(@method, Marshal.dump(h)) + unmarshalled.should.compare_by_identity? + + h = { a: 1 } + unmarshalled = Marshal.send(@method, Marshal.dump(h)) + unmarshalled.should_not.compare_by_identity? + end + + it "preserves compare_by_identity behaviour for a Hash subclass" do + h = UserHash.new({ a: 1 }) + h.compare_by_identity + unmarshalled = Marshal.send(@method, Marshal.dump(h)) + unmarshalled.should.compare_by_identity? + + h = UserHash.new({ a: 1 }) + unmarshalled = Marshal.send(@method, Marshal.dump(h)) + unmarshalled.should_not.compare_by_identity? + end + end + + it "allocates an instance of the proper class when Hash subclass with compare_by_identity behaviour" do + h = UserHash.new({ a: 1 }) + h.compare_by_identity + + unmarshalled = Marshal.send(@method, Marshal.dump(h)) + unmarshalled.should.kind_of?(UserHash) + end end describe "for a Symbol" do @@ -395,7 +600,7 @@ describe :marshal_load, shared: true do end it "loads a binary encoded Symbol" do - s = "\u2192".force_encoding("binary").to_sym + s = "\u2192".dup.force_encoding("binary").to_sym sym = Marshal.send(@method, "\x04\b:\b\xE2\x86\x92") sym.should == s sym.encoding.should == Encoding::BINARY @@ -409,8 +614,8 @@ describe :marshal_load, shared: true do value = Marshal.send(@method, dump) value.map(&:encoding).should == [Encoding::UTF_8, Encoding::UTF_8] expected = [ - "€a".force_encoding(Encoding::UTF_8).to_sym, - "€b".force_encoding(Encoding::UTF_8).to_sym + "€a".dup.force_encoding(Encoding::UTF_8).to_sym, + "€b".dup.force_encoding(Encoding::UTF_8).to_sym ] value.should == expected @@ -418,11 +623,19 @@ describe :marshal_load, shared: true do value.map(&:encoding).should == [Encoding::UTF_8, Encoding::UTF_8, Encoding::UTF_8] value.should == [*expected, expected[0]] end + + it "raises ArgumentError when end of byte sequence reached before symbol characters end" do + Marshal.dump(:hello).should == "\x04\b:\nhello" + + -> { + Marshal.send(@method, "\x04\b:\nhel") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for a String" do it "loads a string having ivar with ref to self" do - obj = 'hi' + obj = +'hi' obj.instance_variable_set(:@self, obj) Marshal.send(@method, "\004\bI\"\ahi\006:\n@self@\000").should == obj end @@ -433,6 +646,12 @@ describe :marshal_load, shared: true do Marshal.send(@method, StringIO.new(Marshal.dump(obj))).should == obj end + it "sets binmode if it is loading through StringIO stream" do + io = StringIO.new("\004\b:\vsymbol") + def io.binmode; raise "binmode"; end + -> { Marshal.load(io) }.should raise_error(RuntimeError, "binmode") + end + it "loads a string with an ivar" do str = Marshal.send(@method, "\x04\bI\"\x00\x06:\t@fooI\"\bbar\x06:\x06EF") str.instance_variable_get("@foo").should == "bar" @@ -444,7 +663,7 @@ describe :marshal_load, shared: true do end it "loads a US-ASCII String" do - str = "abc".force_encoding("us-ascii") + str = "abc".dup.force_encoding("us-ascii") data = "\x04\bI\"\babc\x06:\x06EF" result = Marshal.send(@method, data) result.should == str @@ -452,7 +671,7 @@ describe :marshal_load, shared: true do end it "loads a UTF-8 String" do - str = "\x6d\xc3\xb6\x68\x72\x65".force_encoding("utf-8") + str = "\x6d\xc3\xb6\x68\x72\x65".dup.force_encoding("utf-8") data = "\x04\bI\"\vm\xC3\xB6hre\x06:\x06ET" result = Marshal.send(@method, data) result.should == str @@ -460,7 +679,7 @@ describe :marshal_load, shared: true do end it "loads a String in another encoding" do - str = "\x6d\x00\xf6\x00\x68\x00\x72\x00\x65\x00".force_encoding("utf-16le") + str = "\x6d\x00\xf6\x00\x68\x00\x72\x00\x65\x00".dup.force_encoding("utf-16le") data = "\x04\bI\"\x0Fm\x00\xF6\x00h\x00r\x00e\x00\x06:\rencoding\"\rUTF-16LE" result = Marshal.send(@method, data) result.should == str @@ -468,12 +687,20 @@ describe :marshal_load, shared: true do end it "loads a String as BINARY if no encoding is specified at the end" do - str = "\xC3\xB8".force_encoding("BINARY") - data = "\x04\b\"\a\xC3\xB8".force_encoding("UTF-8") + str = "\xC3\xB8".dup.force_encoding("BINARY") + data = "\x04\b\"\a\xC3\xB8".dup.force_encoding("UTF-8") result = Marshal.send(@method, data) result.encoding.should == Encoding::BINARY result.should == str end + + it "raises ArgumentError when end of byte sequence reached before string characters end" do + Marshal.dump("hello").should == "\x04\b\"\nhello" + + -> { + Marshal.send(@method, "\x04\b\"\nhel") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for a Struct" do @@ -596,7 +823,7 @@ describe :marshal_load, shared: true do end it "loads an Object with a non-US-ASCII instance variable" do - ivar = "@é".force_encoding(Encoding::UTF_8).to_sym + ivar = "@é".dup.force_encoding(Encoding::UTF_8).to_sym obj = Marshal.send(@method, "\x04\bo:\vObject\x06I:\b@\xC3\xA9\x06:\x06ETi\x06") obj.instance_variables.should == [ivar] obj.instance_variables[0].encoding.should == Encoding::UTF_8 @@ -608,6 +835,14 @@ describe :marshal_load, shared: true do Marshal.send(@method, "\x04\bo:\tFile\001\001:\001\005@path\"\x10/etc/passwd") end.should raise_error(ArgumentError) end + + it "raises ArgumentError when end of byte sequence reached before class name end" do + Marshal.dump(Object.new).should == "\x04\bo:\vObject\x00" + + -> { + Marshal.send(@method, "\x04\bo:\vObj") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for an object responding to #marshal_dump and #marshal_load" do @@ -666,7 +901,7 @@ describe :marshal_load, shared: true do [Meths, MethsMore, Regexp] end - it "loads a extended_user_regexp having ivar" do + it "loads a Regexp subclass instance variables when it is extended with a module" do obj = UserRegexp.new('').extend(Meths) obj.instance_variable_set(:@noise, 'much') @@ -678,6 +913,33 @@ describe :marshal_load, shared: true do new_obj_metaclass_ancestors[@num_self_class, 3].should == [Meths, UserRegexp, Regexp] end + + ruby_bug "#19439", ""..."3.3" do + it "restore the regexp instance variables" do + obj = Regexp.new("hello") + obj.instance_variable_set(:@regexp_ivar, [42]) + + new_obj = Marshal.send(@method, "\x04\bI/\nhello\x00\a:\x06EF:\x11@regexp_ivar[\x06i/") + new_obj.instance_variables.should == [:@regexp_ivar] + new_obj.instance_variable_get(:@regexp_ivar).should == [42] + end + end + + it "preserves Regexp encoding" do + source_object = Regexp.new("a".encode("utf-32le")) + regexp = Marshal.send(@method, Marshal.dump(source_object)) + + regexp.encoding.should == Encoding::UTF_32LE + regexp.source.should == "a".encode("utf-32le") + end + + it "raises ArgumentError when end of byte sequence reached before source string end" do + Marshal.dump(/hello world/).should == "\x04\bI/\x10hello world\x00\x06:\x06EF" + + -> { + Marshal.send(@method, "\x04\bI/\x10hel") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for a Float" do @@ -699,6 +961,14 @@ describe :marshal_load, shared: true do obj = 1.1867345e+22 Marshal.send(@method, "\004\bf\0361.1867344999999999e+22\000\344@").should == obj end + + it "raises ArgumentError when end of byte sequence reached before float string representation end" do + Marshal.dump(1.3).should == "\x04\bf\b1.3" + + -> { + Marshal.send(@method, "\004\bf\v1") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for an Integer" do @@ -764,13 +1034,17 @@ describe :marshal_load, shared: true do describe "for a Rational" do it "loads" do - Marshal.send(@method, Marshal.dump(Rational(1, 3))).should == Rational(1, 3) + r = Marshal.send(@method, Marshal.dump(Rational(1, 3))) + r.should == Rational(1, 3) + r.should.frozen? end end describe "for a Complex" do it "loads" do - Marshal.send(@method, Marshal.dump(Complex(4, 3))).should == Complex(4, 3) + c = Marshal.send(@method, Marshal.dump(Complex(4, 3))) + c.should == Complex(4, 3) + c.should.frozen? end end @@ -811,17 +1085,47 @@ describe :marshal_load, shared: true do t1.should equal t2 end - it "loads the zone" do + it "keeps the local zone" do with_timezone 'AST', 3 do t = Time.local(2012, 1, 1) Marshal.send(@method, Marshal.dump(t)).zone.should == t.zone end end - it "loads nanoseconds" do + it "keeps UTC zone" do + t = Time.now.utc + t2 = Marshal.send(@method, Marshal.dump(t)) + t2.should.utc? + end + + it "keeps the zone" do + t = nil + + with_timezone 'AST', 4 do + t = Time.local(2012, 1, 1) + end + + with_timezone 'EET', -2 do + Marshal.send(@method, Marshal.dump(t)).zone.should == 'AST' + end + end + + it "keeps utc offset" do + t = Time.new(2007,11,1,15,25,0, "+09:00") + t2 = Marshal.send(@method, Marshal.dump(t)) + t2.utc_offset.should == 32400 + end + + it "keeps nanoseconds" do t = Time.now Marshal.send(@method, Marshal.dump(t)).nsec.should == t.nsec end + + it "does not add any additional instance variable" do + t = Time.now + t2 = Marshal.send(@method, Marshal.dump(t)) + t2.instance_variables.should.empty? + end end describe "for nil" do @@ -854,6 +1158,14 @@ describe :marshal_load, shared: true do it "raises ArgumentError if given a nonexistent class" do -> { Marshal.send(@method, "\x04\bc\vStrung") }.should raise_error(ArgumentError) end + + it "raises ArgumentError when end of byte sequence reached before class name end" do + Marshal.dump(String).should == "\x04\bc\vString" + + -> { + Marshal.send(@method, "\x04\bc\vStr") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for a Module" do @@ -868,6 +1180,14 @@ describe :marshal_load, shared: true do it "loads an old module" do Marshal.send(@method, "\x04\bM\vKernel").should == Kernel end + + it "raises ArgumentError when end of byte sequence reached before module name end" do + Marshal.dump(Kernel).should == "\x04\bm\vKernel" + + -> { + Marshal.send(@method, "\x04\bm\vKer") + }.should raise_error(ArgumentError, "marshal data too short") + end end describe "for a wrapped C pointer" do diff --git a/spec/ruby/core/matchdata/allocate_spec.rb b/spec/ruby/core/matchdata/allocate_spec.rb index 9f3ada4018..142ce639c2 100644 --- a/spec/ruby/core/matchdata/allocate_spec.rb +++ b/spec/ruby/core/matchdata/allocate_spec.rb @@ -1,10 +1,8 @@ require_relative '../../spec_helper' describe "MatchData.allocate" do - ruby_version_is "2.7" do - it "is undefined" do - # https://bugs.ruby-lang.org/issues/16294 - -> { MatchData.allocate }.should raise_error(NoMethodError) - end + it "is undefined" do + # https://bugs.ruby-lang.org/issues/16294 + -> { MatchData.allocate }.should raise_error(NoMethodError) end end diff --git a/spec/ruby/core/matchdata/begin_spec.rb b/spec/ruby/core/matchdata/begin_spec.rb index 85c454da56..54b4e0a33f 100644 --- a/spec/ruby/core/matchdata/begin_spec.rb +++ b/spec/ruby/core/matchdata/begin_spec.rb @@ -36,6 +36,18 @@ describe "MatchData#begin" do match_data = /(.)(.)(\d+)(\d)/.match("THX1138.") match_data.begin(obj).should == 2 end + + it "raises IndexError if index is out of bounds" do + match_data = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + match_data.begin(-1) + }.should raise_error(IndexError, "index -1 out of matches") + + -> { + match_data.begin(3) + }.should raise_error(IndexError, "index 3 out of matches") + end end context "when passed a String argument" do @@ -68,6 +80,14 @@ describe "MatchData#begin" do match_data = /(?<æ>.)(.)(?<b>\d+)(\d)/.match("THX1138.") match_data.begin("æ").should == 1 end + + it "raises IndexError if there is no group with the provided name" do + match_data = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + match_data.begin("y") + }.should raise_error(IndexError, "undefined group name reference: y") + end end context "when passed a Symbol argument" do @@ -100,5 +120,13 @@ describe "MatchData#begin" do match_data = /(?<æ>.)(.)(?<b>\d+)(\d)/.match("THX1138.") match_data.begin(:æ).should == 1 end + + it "raises IndexError if there is no group with the provided name" do + match_data = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + match_data.begin(:y) + }.should raise_error(IndexError, "undefined group name reference: y") + end end end diff --git a/spec/ruby/core/matchdata/byteoffset_spec.rb b/spec/ruby/core/matchdata/byteoffset_spec.rb new file mode 100644 index 0000000000..b27267fd0e --- /dev/null +++ b/spec/ruby/core/matchdata/byteoffset_spec.rb @@ -0,0 +1,95 @@ +require_relative '../../spec_helper' + +describe "MatchData#byteoffset" do + ruby_version_is "3.2" do + it "returns beginning and ending byte-based offset of whole matched substring for 0 element" do + m = /(.)(.)(\d+)(\d)/.match("THX1138.") + m.byteoffset(0).should == [1, 7] + end + + it "returns beginning and ending byte-based offset of n-th match, all the subsequent elements are capturing groups" do + m = /(.)(.)(\d+)(\d)/.match("THX1138.") + + m.byteoffset(2).should == [2, 3] + m.byteoffset(3).should == [3, 6] + m.byteoffset(4).should == [6, 7] + end + + it "accepts String as a reference to a named capture" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + m.byteoffset("f").should == [0, 3] + m.byteoffset("b").should == [3, 6] + end + + it "accepts Symbol as a reference to a named capture" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + m.byteoffset(:f).should == [0, 3] + m.byteoffset(:b).should == [3, 6] + end + + it "returns [nil, nil] if a capturing group is optional and doesn't match" do + m = /(?<x>q..)?/.match("foobarbaz") + + m.byteoffset("x").should == [nil, nil] + m.byteoffset(1).should == [nil, nil] + end + + it "returns correct beginning and ending byte-based offset for multi-byte strings" do + m = /\A\u3042(.)(.)?(.)\z/.match("\u3042\u3043\u3044") + + m.byteoffset(1).should == [3, 6] + m.byteoffset(3).should == [6, 9] + end + + it "returns [nil, nil] if a capturing group is optional and doesn't match for multi-byte string" do + m = /\A\u3042(.)(.)?(.)\z/.match("\u3042\u3043\u3044") + + m.byteoffset(2).should == [nil, nil] + end + + it "converts argument into integer if is not String nor Symbol" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + obj = Object.new + def obj.to_int; 2; end + + m.byteoffset(1r).should == [0, 3] + m.byteoffset(1.1).should == [0, 3] + m.byteoffset(obj).should == [3, 6] + end + + it "raises IndexError if there is no group with the provided name" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + m.byteoffset("y") + }.should raise_error(IndexError, "undefined group name reference: y") + + -> { + m.byteoffset(:y) + }.should raise_error(IndexError, "undefined group name reference: y") + end + + it "raises IndexError if index is out of bounds" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + m.byteoffset(-1) + }.should raise_error(IndexError, "index -1 out of matches") + + -> { + m.byteoffset(3) + }.should raise_error(IndexError, "index 3 out of matches") + end + + it "raises TypeError if can't convert argument into Integer" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + m.byteoffset([]) + }.should raise_error(TypeError, "no implicit conversion of Array into Integer") + end + end +end diff --git a/spec/ruby/core/matchdata/captures_spec.rb b/spec/ruby/core/matchdata/captures_spec.rb index 8c0d2978b7..f829a25481 100644 --- a/spec/ruby/core/matchdata/captures_spec.rb +++ b/spec/ruby/core/matchdata/captures_spec.rb @@ -1,7 +1,6 @@ require_relative '../../spec_helper' +require_relative 'shared/captures' describe "MatchData#captures" do - it "returns an array of the match captures" do - /(.)(.)(\d+)(\d)/.match("THX1138.").captures.should == ["H","X","113","8"] - end + it_behaves_like :matchdata_captures, :captures end diff --git a/spec/ruby/core/matchdata/deconstruct_keys_spec.rb b/spec/ruby/core/matchdata/deconstruct_keys_spec.rb new file mode 100644 index 0000000000..5b68f886c7 --- /dev/null +++ b/spec/ruby/core/matchdata/deconstruct_keys_spec.rb @@ -0,0 +1,65 @@ +require_relative '../../spec_helper' + +describe "MatchData#deconstruct_keys" do + ruby_version_is "3.2" do + it "returns whole hash for nil as an argument" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + m.deconstruct_keys(nil).should == { f: "foo", b: "bar" } + end + + it "returns only specified keys" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + m.deconstruct_keys([:f]).should == { f: "foo" } + end + + it "requires one argument" do + m = /l/.match("l") + + -> { + m.deconstruct_keys + }.should raise_error(ArgumentError, "wrong number of arguments (given 0, expected 1)") + end + + it "it raises error when argument is neither nil nor array" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { m.deconstruct_keys(1) }.should raise_error(TypeError, "wrong argument type Integer (expected Array)") + -> { m.deconstruct_keys("asd") }.should raise_error(TypeError, "wrong argument type String (expected Array)") + -> { m.deconstruct_keys(:x) }.should raise_error(TypeError, "wrong argument type Symbol (expected Array)") + -> { m.deconstruct_keys({}) }.should raise_error(TypeError, "wrong argument type Hash (expected Array)") + end + + it "returns {} when passed []" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + m.deconstruct_keys([]).should == {} + end + + it "does not accept non-Symbol keys" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + + -> { + m.deconstruct_keys(['year', :foo]) + }.should raise_error(TypeError, "wrong argument type String (expected Symbol)") + end + + it "process keys till the first non-existing one" do + m = /(?<f>foo)(?<b>bar)(?<c>baz)/.match("foobarbaz") + + m.deconstruct_keys([:f, :a, :b]).should == { f: "foo" } + end + + it "returns {} when there are no named captured groups at all" do + m = /foo.+/.match("foobar") + + m.deconstruct_keys(nil).should == {} + end + + it "returns {} when passed more keys than named captured groups" do + m = /(?<f>foo)(?<b>bar)/.match("foobar") + m.deconstruct_keys([:f, :b, :c]).should == {} + end + end +end diff --git a/spec/ruby/core/matchdata/deconstruct_spec.rb b/spec/ruby/core/matchdata/deconstruct_spec.rb new file mode 100644 index 0000000000..6af55113b6 --- /dev/null +++ b/spec/ruby/core/matchdata/deconstruct_spec.rb @@ -0,0 +1,8 @@ +require_relative '../../spec_helper' +require_relative 'shared/captures' + +describe "MatchData#deconstruct" do + ruby_version_is "3.2" do + it_behaves_like :matchdata_captures, :deconstruct + end +end diff --git a/spec/ruby/core/matchdata/element_reference_spec.rb b/spec/ruby/core/matchdata/element_reference_spec.rb index 26550ac94d..806db2d7b5 100644 --- a/spec/ruby/core/matchdata/element_reference_spec.rb +++ b/spec/ruby/core/matchdata/element_reference_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative 'fixtures/classes' describe "MatchData#[]" do it "acts as normal array indexing [index]" do @@ -15,10 +16,41 @@ describe "MatchData#[]" do it "supports accessors [start, length]" do /(.)(.)(\d+)(\d)/.match("THX1138.")[1, 2].should == %w|H X| /(.)(.)(\d+)(\d)/.match("THX1138.")[-3, 2].should == %w|X 113| + + # negative index is larger than the number of match values + /(.)(.)(\d+)(\d)/.match("THX1138.")[-30, 2].should == nil + + # length argument larger than number of match values is capped to match value length + /(.)(.)(\d+)(\d)/.match("THX1138.")[3, 10].should == %w|113 8| + + /(.)(.)(\d+)(\d)/.match("THX1138.")[3, 0].should == [] + + /(.)(.)(\d+)(\d)/.match("THX1138.")[3, -1].should == nil + /(.)(.)(\d+)(\d)/.match("THX1138.")[3, -30].should == nil end it "supports ranges [start..end]" do /(.)(.)(\d+)(\d)/.match("THX1138.")[1..3].should == %w|H X 113| + /(.)(.)(\d+)(\d)/.match("THX1138.")[3..10].should == %w|113 8| + /(.)(.)(\d+)(\d)/.match("THX1138.")[-30..2].should == nil + /(.)(.)(\d+)(\d)/.match("THX1138.")[3..1].should == [] + end + + it "supports endless ranges [start..]" do + /(.)(.)(\d+)(\d)/.match("THX1138.")[3..].should == %w|113 8| + end + + it "supports beginningless ranges [..end]" do + /(.)(.)(\d+)(\d)/.match("THX1138.")[..1].should == %w|HX1138 H| + end + + it "supports beginningless endless ranges [nil..nil]" do + /(.)(.)(\d+)(\d)/.match("THX1138.")[nil..nil].should == %w|HX1138 H X 113 8| + end + + it "returns instances of String when given a String subclass" do + str = MatchDataSpecs::MyString.new("THX1138.") + /(.)(.)(\d+)(\d)/.match(str)[0..-1].each { |m| m.should be_an_instance_of(String) } end end @@ -81,7 +113,7 @@ describe "MatchData#[Symbol]" do it "returns matches in the String's encoding" do rex = /(?<t>t(?<a>ack))/u - md = 'haystack'.force_encoding('euc-jp').match(rex) + md = 'haystack'.dup.force_encoding('euc-jp').match(rex) md[:t].encoding.should == Encoding::EUC_JP end end diff --git a/spec/ruby/core/matchdata/fixtures/classes.rb b/spec/ruby/core/matchdata/fixtures/classes.rb new file mode 100644 index 0000000000..54795636e5 --- /dev/null +++ b/spec/ruby/core/matchdata/fixtures/classes.rb @@ -0,0 +1,3 @@ +module MatchDataSpecs + class MyString < String; end +end diff --git a/spec/ruby/core/matchdata/match_length_spec.rb b/spec/ruby/core/matchdata/match_length_spec.rb new file mode 100644 index 0000000000..f7785ab1a0 --- /dev/null +++ b/spec/ruby/core/matchdata/match_length_spec.rb @@ -0,0 +1,34 @@ +# -*- encoding: utf-8 -*- + +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + describe "MatchData#match_length" do + it "returns the length of the corresponding match when given an Integer" do + md = /(.)(.)(\d+)(\d)/.match("THX1138.") + + md.match_length(0).should == 6 + md.match_length(1).should == 1 + md.match_length(2).should == 1 + md.match_length(3).should == 3 + md.match_length(4).should == 1 + end + + it "returns nil on non-matching index matches" do + md = /\d+(\w)?/.match("THX1138.") + md.match_length(1).should == nil + end + + it "returns the length of the corresponding named match when given a Symbol" do + md = 'haystack'.match(/(?<t>t(?<a>ack))/) + md.match_length(:a).should == 3 + md.match_length(:t).should == 4 + end + + it "returns nil on non-matching index matches" do + md = 'haystack'.match(/(?<t>t)(?<a>all)?/) + md.match_length(:t).should == 1 + md.match_length(:a).should == nil + end + end +end diff --git a/spec/ruby/core/matchdata/match_spec.rb b/spec/ruby/core/matchdata/match_spec.rb new file mode 100644 index 0000000000..545de6f93f --- /dev/null +++ b/spec/ruby/core/matchdata/match_spec.rb @@ -0,0 +1,34 @@ +# -*- encoding: utf-8 -*- + +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + describe "MatchData#match" do + it "returns the corresponding match when given an Integer" do + md = /(.)(.)(\d+)(\d)/.match("THX1138.") + + md.match(0).should == 'HX1138' + md.match(1).should == 'H' + md.match(2).should == 'X' + md.match(3).should == '113' + md.match(4).should == '8' + end + + it "returns nil on non-matching index matches" do + md = /\d+(\w)?/.match("THX1138.") + md.match(1).should == nil + end + + it "returns the corresponding named match when given a Symbol" do + md = 'haystack'.match(/(?<t>t(?<a>ack))/) + md.match(:a).should == 'ack' + md.match(:t).should == 'tack' + end + + it "returns nil on non-matching index matches" do + md = 'haystack'.match(/(?<t>t)(?<a>all)?/) + md.match(:t).should == 't' + md.match(:a).should == nil + end + end +end diff --git a/spec/ruby/core/matchdata/named_captures_spec.rb b/spec/ruby/core/matchdata/named_captures_spec.rb index 9b1e324a24..5e4693d62d 100644 --- a/spec/ruby/core/matchdata/named_captures_spec.rb +++ b/spec/ruby/core/matchdata/named_captures_spec.rb @@ -12,4 +12,16 @@ describe 'MatchData#named_captures' do it 'returns the latest matched capture, even if a later one that does not match exists' do /\A(?<a>.)(?<b>.)(?<b>.)(?<a>.)?\z/.match('012').named_captures.should == { 'a' => '0', 'b' => '2' } end + + ruby_version_is "3.3" do + it 'returns a Hash with Symbol keys when symbolize_names is provided a true value' do + /(?<a>.)(?<b>.)?/.match('0').named_captures(symbolize_names: true).should == { a: '0', b: nil } + /(?<a>.)(?<b>.)?/.match('0').named_captures(symbolize_names: "truly").should == { a: '0', b: nil } + end + + it 'returns a Hash with String keys when symbolize_names is provided a false value' do + /(?<a>.)(?<b>.)?/.match('02').named_captures(symbolize_names: false).should == { 'a' => '0', 'b' => '2' } + /(?<a>.)(?<b>.)?/.match('02').named_captures(symbolize_names: nil).should == { 'a' => '0', 'b' => '2' } + end + end end diff --git a/spec/ruby/core/matchdata/post_match_spec.rb b/spec/ruby/core/matchdata/post_match_spec.rb index 4ae51f107e..7bfe6df119 100644 --- a/spec/ruby/core/matchdata/post_match_spec.rb +++ b/spec/ruby/core/matchdata/post_match_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative 'fixtures/classes' describe "MatchData#post_match" do it "returns the string after the match equiv. special var $'" do @@ -6,31 +7,18 @@ describe "MatchData#post_match" do $'.should == ': The Movie' end - ruby_version_is ''...'2.7' do - it "keeps taint status from the source string" do - str = "THX1138: The Movie" - str.taint - res = /(.)(.)(\d+)(\d)/.match(str).post_match - res.tainted?.should be_true - $'.tainted?.should be_true - end - - it "keeps untrusted status from the source string" do - str = "THX1138: The Movie" - str.untrust - res = /(.)(.)(\d+)(\d)/.match(str).post_match - res.untrusted?.should be_true - $'.untrusted?.should be_true - end - end - it "sets the encoding to the encoding of the source String" do - str = "abc".force_encoding Encoding::EUC_JP + str = "abc".dup.force_encoding Encoding::EUC_JP str.match(/b/).post_match.encoding.should equal(Encoding::EUC_JP) end it "sets an empty result to the encoding of the source String" do - str = "abc".force_encoding Encoding::ISO_8859_1 + str = "abc".dup.force_encoding Encoding::ISO_8859_1 str.match(/c/).post_match.encoding.should equal(Encoding::ISO_8859_1) end + + it "returns an instance of String when given a String subclass" do + str = MatchDataSpecs::MyString.new("THX1138: The Movie") + /(.)(.)(\d+)(\d)/.match(str).post_match.should be_an_instance_of(String) + end end diff --git a/spec/ruby/core/matchdata/pre_match_spec.rb b/spec/ruby/core/matchdata/pre_match_spec.rb index 824612c84c..2f1ba9b8f6 100644 --- a/spec/ruby/core/matchdata/pre_match_spec.rb +++ b/spec/ruby/core/matchdata/pre_match_spec.rb @@ -1,4 +1,5 @@ require_relative '../../spec_helper' +require_relative 'fixtures/classes' describe "MatchData#pre_match" do it "returns the string before the match, equiv. special var $`" do @@ -6,31 +7,18 @@ describe "MatchData#pre_match" do $`.should == 'T' end - ruby_version_is ''...'2.7' do - it "keeps taint status from the source string" do - str = "THX1138: The Movie" - str.taint - res = /(.)(.)(\d+)(\d)/.match(str).pre_match - res.tainted?.should be_true - $`.tainted?.should be_true - end - - it "keeps untrusted status from the source string" do - str = "THX1138: The Movie" - str.untrust - res = /(.)(.)(\d+)(\d)/.match(str).pre_match - res.untrusted?.should be_true - $`.untrusted?.should be_true - end - end - it "sets the encoding to the encoding of the source String" do - str = "abc".force_encoding Encoding::EUC_JP + str = "abc".dup.force_encoding Encoding::EUC_JP str.match(/b/).pre_match.encoding.should equal(Encoding::EUC_JP) end it "sets an empty result to the encoding of the source String" do - str = "abc".force_encoding Encoding::ISO_8859_1 + str = "abc".dup.force_encoding Encoding::ISO_8859_1 str.match(/a/).pre_match.encoding.should equal(Encoding::ISO_8859_1) end + + it "returns an instance of String when given a String subclass" do + str = MatchDataSpecs::MyString.new("THX1138: The Movie") + /(.)(.)(\d+)(\d)/.match(str).pre_match.should be_an_instance_of(String) + end end diff --git a/spec/ruby/core/matchdata/shared/captures.rb b/spec/ruby/core/matchdata/shared/captures.rb new file mode 100644 index 0000000000..33f834561a --- /dev/null +++ b/spec/ruby/core/matchdata/shared/captures.rb @@ -0,0 +1,13 @@ +require_relative '../../../spec_helper' +require_relative '../fixtures/classes' + +describe :matchdata_captures, shared: true do + it "returns an array of the match captures" do + /(.)(.)(\d+)(\d)/.match("THX1138.").send(@method).should == ["H","X","113","8"] + end + + it "returns instances of String when given a String subclass" do + str = MatchDataSpecs::MyString.new("THX1138: The Movie") + /(.)(.)(\d+)(\d)/.match(str).send(@method).each { |c| c.should be_an_instance_of(String) } + end +end diff --git a/spec/ruby/core/matchdata/string_spec.rb b/spec/ruby/core/matchdata/string_spec.rb index 420233e1f3..952e953318 100644 --- a/spec/ruby/core/matchdata/string_spec.rb +++ b/spec/ruby/core/matchdata/string_spec.rb @@ -17,8 +17,9 @@ describe "MatchData#string" do md.string.should equal(md.string) end - it "returns a frozen copy of the matched string for gsub(String)" do - 'he[[o'.gsub!('[', ']') + it "returns a frozen copy of the matched string for gsub!(String)" do + s = +'he[[o' + s.gsub!('[', ']') $~.string.should == 'he[[o' $~.string.should.frozen? end diff --git a/spec/ruby/core/matchdata/to_a_spec.rb b/spec/ruby/core/matchdata/to_a_spec.rb index 6231d096fb..4fa11ff604 100644 --- a/spec/ruby/core/matchdata/to_a_spec.rb +++ b/spec/ruby/core/matchdata/to_a_spec.rb @@ -1,7 +1,13 @@ require_relative '../../spec_helper' +require_relative 'fixtures/classes' describe "MatchData#to_a" do it "returns an array of matches" do /(.)(.)(\d+)(\d)/.match("THX1138.").to_a.should == ["HX1138", "H", "X", "113", "8"] end + + it "returns instances of String when given a String subclass" do + str = MatchDataSpecs::MyString.new("THX1138.") + /(.)(.)(\d+)(\d)/.match(str)[0..-1].to_a.each { |m| m.should be_an_instance_of(String) } + end end diff --git a/spec/ruby/core/matchdata/to_s_spec.rb b/spec/ruby/core/matchdata/to_s_spec.rb index 9e213bb342..cd1c4dbca2 100644 --- a/spec/ruby/core/matchdata/to_s_spec.rb +++ b/spec/ruby/core/matchdata/to_s_spec.rb @@ -1,7 +1,13 @@ require_relative '../../spec_helper' +require_relative 'fixtures/classes' describe "MatchData#to_s" do it "returns the entire matched string" do /(.)(.)(\d+)(\d)/.match("THX1138.").to_s.should == "HX1138" end + + it "returns an instance of String when given a String subclass" do + str = MatchDataSpecs::MyString.new("THX1138.") + /(.)(.)(\d+)(\d)/.match(str).to_s.should be_an_instance_of(String) + end end diff --git a/spec/ruby/core/matchdata/values_at_spec.rb b/spec/ruby/core/matchdata/values_at_spec.rb index 8f7fdf557c..535719a2ee 100644 --- a/spec/ruby/core/matchdata/values_at_spec.rb +++ b/spec/ruby/core/matchdata/values_at_spec.rb @@ -1,21 +1,76 @@ require_relative '../../spec_helper' describe "MatchData#values_at" do - it "returns an array of the matching value" do - /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(0, 2, -2).should == ["HX1138", "X", "113"] + # Should be synchronized with core/array/values_at_spec.rb and core/struct/values_at_spec.rb + # + # /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").to_a # => ["HX1138", "H", "X", "113", "8"] + + context "when passed a list of Integers" do + it "returns an array containing each value given by one of integers" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(0, 2, -2).should == ["HX1138", "X", "113"] + end + + it "returns nil value for any integer that is out of range" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(5).should == [nil] + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(-6).should == [nil] + end end - describe "when passed a Range" do - it "returns an array of the matching value" do - /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(2..4, 0..1).should == ["X", "113", "8", "HX1138", "H"] + context "when passed an integer Range" do + it "returns an array containing each value given by the elements of the range" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(0..2).should == ["HX1138", "H", "X"] + end + + it "fills with nil values for range elements larger than the captured values number" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(0..5).should == ["HX1138", "H", "X", "113", "8", nil] + end + + it "raises RangeError if any element of the range is negative and out of range" do + -> { /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(-6..3) }.should raise_error(RangeError, "-6..3 out of range") + end + + it "supports endless Range" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(0..).should == ["HX1138", "H", "X", "113", "8"] + end + + it "supports beginningless Range" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(..2).should == ["HX1138", "H", "X"] + end + + it "returns an empty Array when Range is empty" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(2..0).should == [] + end + end + + context "when passed names" do + it 'slices captures with the given names' do + /(?<a>.)(?<b>.)(?<c>.)/.match('012').values_at(:c, :a).should == ['2', '0'] + end + + it 'slices captures with the given String names' do + /(?<a>.)(?<b>.)(?<c>.)/.match('012').values_at('c', 'a').should == ['2', '0'] end end - it 'slices captures with the given names' do - /(?<a>.)(?<b>.)(?<c>.)/.match('012').values_at(:c, :a).should == ['2', '0'] + it "supports multiple integer Ranges" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(1..2, 2..3).should == ["H", "X", "X", "113"] end - it 'takes names and indices' do + it "supports mixing integer Ranges and Integers" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(1..2, 4).should == ["H", "X", "8"] + end + + it 'supports mixing of names and indices' do /\A(?<a>.)(?<b>.)\z/.match('01').values_at(0, 1, 2, :a, :b).should == ['01', '0', '1', '0', '1'] end + + it "returns a new empty Array if no arguments given" do + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at().should == [] + end + + it "fails when passed arguments of unsupported types" do + -> { + /(.)(.)(\d+)(\d)/.match("THX1138: The Movie").values_at(Object.new) + }.should raise_error(TypeError, "no implicit conversion of Object into Integer") + end end diff --git a/spec/ruby/core/math/cos_spec.rb b/spec/ruby/core/math/cos_spec.rb index 3ba7a54c38..006afeb2cc 100644 --- a/spec/ruby/core/math/cos_spec.rb +++ b/spec/ruby/core/math/cos_spec.rb @@ -15,7 +15,6 @@ describe "Math.cos" do Math.cos(2*Math::PI).should be_close(1.0, TOLERANCE) end - it "raises a TypeError unless the argument is Numeric and has #to_f" do -> { Math.cos("test") }.should raise_error(TypeError) end @@ -24,14 +23,23 @@ describe "Math.cos" do Math.cos(nan_value).nan?.should be_true end - it "raises a TypeError if the argument is nil" do - -> { Math.cos(nil) }.should raise_error(TypeError) - end - - it "coerces its argument with #to_f" do - f = mock_numeric('8.2') - f.should_receive(:to_f).and_return(8.2) - Math.cos(f).should == Math.cos(8.2) + describe "coerces its argument with #to_f" do + it "coerces its argument with #to_f" do + f = mock_numeric('8.2') + f.should_receive(:to_f).and_return(8.2) + Math.cos(f).should == Math.cos(8.2) + end + + it "raises a TypeError if the given argument can't be converted to a Float" do + -> { Math.cos(nil) }.should raise_error(TypeError) + -> { Math.cos(:abc) }.should raise_error(TypeError) + end + + it "raises a NoMethodError if the given argument raises a NoMethodError during type coercion to a Float" do + object = mock_numeric('mock-float') + object.should_receive(:to_f).and_raise(NoMethodError) + -> { Math.cos(object) }.should raise_error(NoMethodError) + end end end diff --git a/spec/ruby/core/math/ldexp_spec.rb b/spec/ruby/core/math/ldexp_spec.rb index fb7799cf26..6dcf94a663 100644 --- a/spec/ruby/core/math/ldexp_spec.rb +++ b/spec/ruby/core/math/ldexp_spec.rb @@ -45,6 +45,12 @@ describe "Math.ldexp" do it "accepts any second argument that can be coerced with Integer()" do Math.ldexp(3.23, MathSpecs::Integer.new).should be_close(12.92, TOLERANCE) end + + it "returns correct value that closes to the max value of double type" do + Math.ldexp(0.5122058490966879, 1024).should == 9.207889385574391e+307 + Math.ldexp(0.9999999999999999, 1024).should == 1.7976931348623157e+308 + Math.ldexp(0.99999999999999999, 1024).should == Float::INFINITY + end end describe "Math#ldexp" do diff --git a/spec/ruby/core/math/log2_spec.rb b/spec/ruby/core/math/log2_spec.rb index 1594f2d7af..3d4d41d130 100644 --- a/spec/ruby/core/math/log2_spec.rb +++ b/spec/ruby/core/math/log2_spec.rb @@ -15,7 +15,7 @@ describe "Math.log2" do Math.log2((2**301+45677544234809571)).should == 301.0 end - it "raises an Errno::EDOM if the argument is less than 0" do + it "raises Math::DomainError if the argument is less than 0" do -> { Math.log2(-1e-15) }.should raise_error( Math::DomainError) end diff --git a/spec/ruby/core/math/sqrt_spec.rb b/spec/ruby/core/math/sqrt_spec.rb index 779aea2a0a..918e7c3a17 100644 --- a/spec/ruby/core/math/sqrt_spec.rb +++ b/spec/ruby/core/math/sqrt_spec.rb @@ -27,6 +27,10 @@ describe "Math.sqrt" do it "accepts any argument that can be coerced with Float()" do Math.sqrt(MathSpecs::Float.new).should be_close(1.0, TOLERANCE) end + + it "raises a Math::DomainError when given a negative number" do + -> { Math.sqrt(-1) }.should raise_error(Math::DomainError) + end end describe "Math#sqrt" do diff --git a/spec/ruby/core/method/clone_spec.rb b/spec/ruby/core/method/clone_spec.rb index 3fe4000fb7..b0eb5751a9 100644 --- a/spec/ruby/core/method/clone_spec.rb +++ b/spec/ruby/core/method/clone_spec.rb @@ -1,14 +1,13 @@ require_relative '../../spec_helper' -require_relative 'fixtures/classes' +require_relative 'shared/dup' describe "Method#clone" do - it "returns a copy of the method" do - m1 = MethodSpecs::Methods.new.method(:foo) - m2 = m1.clone + it_behaves_like :method_dup, :clone - m1.should == m2 - m1.should_not equal(m2) - - m1.call.should == m2.call + it "preserves frozen status" do + method = Object.new.method(:method) + method.freeze + method.frozen?.should == true + method.clone.frozen?.should == true end end diff --git a/spec/ruby/core/method/compose_spec.rb b/spec/ruby/core/method/compose_spec.rb index 87cf61f7ad..7506e33ea8 100644 --- a/spec/ruby/core/method/compose_spec.rb +++ b/spec/ruby/core/method/compose_spec.rb @@ -38,8 +38,7 @@ describe "Method#<<" do double = proc { |x| x + x } (pow_2 << double).is_a?(Proc).should == true - ruby_version_is(''...'3.0') { (pow_2 << double).should.lambda? } - ruby_version_is('3.0') { (pow_2 << double).should_not.lambda? } + (pow_2 << double).should_not.lambda? end it "may accept multiple arguments" do diff --git a/spec/ruby/core/method/dup_spec.rb b/spec/ruby/core/method/dup_spec.rb new file mode 100644 index 0000000000..e3e29d8a68 --- /dev/null +++ b/spec/ruby/core/method/dup_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' +require_relative 'shared/dup' + +describe "Method#dup" do + ruby_version_is "3.4" do + it_behaves_like :method_dup, :dup + + it "resets frozen status" do + method = Object.new.method(:method) + method.freeze + method.frozen?.should == true + method.dup.frozen?.should == false + end + end +end diff --git a/spec/ruby/core/method/fixtures/classes.rb b/spec/ruby/core/method/fixtures/classes.rb index be96f65e25..464a519aea 100644 --- a/spec/ruby/core/method/fixtures/classes.rb +++ b/spec/ruby/core/method/fixtures/classes.rb @@ -84,6 +84,12 @@ module MethodSpecs def two_req_one_opt_with_splat_and_block(a, b, c=nil, *d, &blk); end def one_req_two_opt_with_splat_and_block(a, b=nil, c=nil, *d, &blk); end + def my_public_method; end + def my_protected_method; end + def my_private_method; end + protected :my_protected_method + private :my_private_method + define_method(:zero_defined_method, Proc.new {||}) define_method(:zero_with_splat_defined_method, Proc.new {|*x|}) define_method(:one_req_defined_method, Proc.new {|x|}) @@ -213,4 +219,28 @@ module MethodSpecs n * m end end + + module InheritedMethods + module A + private + def derp(message) + 'A' + end + end + + module B + private + def derp + 'B' + super('superclass') + end + end + + class C + include A + include B + + public :derp + alias_method :meow, :derp + end + end end diff --git a/spec/ruby/core/method/owner_spec.rb b/spec/ruby/core/method/owner_spec.rb index ca5dff7295..05422f1697 100644 --- a/spec/ruby/core/method/owner_spec.rb +++ b/spec/ruby/core/method/owner_spec.rb @@ -23,4 +23,10 @@ describe "Method#owner" do @m.method(:handled_via_method_missing).owner.should == MethodSpecs::Methods end end + + ruby_version_is "3.2" do + it "returns the class on which public was called for a private method in ancestor" do + MethodSpecs::InheritedMethods::C.new.method(:derp).owner.should == MethodSpecs::InheritedMethods::C + end + end end diff --git a/spec/ruby/core/method/parameters_spec.rb b/spec/ruby/core/method/parameters_spec.rb index 3fdaf9ce6f..8495aef4d2 100644 --- a/spec/ruby/core/method/parameters_spec.rb +++ b/spec/ruby/core/method/parameters_spec.rb @@ -7,6 +7,7 @@ describe "Method#parameters" do def one_keyrest(**a); end def one_keyreq(a:); end + def one_nokey(**nil); end def one_splat_one_req(*a,b); end def one_splat_two_req(*a,b,c); end @@ -15,11 +16,16 @@ describe "Method#parameters" do def one_opt_with_stabby(a=-> b { true }); end def one_unnamed_splat(*); end + def one_unnamed_keyrest(**); end def one_splat_one_block(*args, &block) local_is_not_parameter = {} end + def forward_parameters(...) end + + def underscore_parameters(_, _, _ = 1, *_, _:, _: 2, **_, &_); end + define_method(:one_optional_defined_method) {|x = 1|} end @@ -176,6 +182,11 @@ describe "Method#parameters" do m.parameters.should == [[:keyreq,:a]] end + it "returns [[:nokey]] for a method with a single **nil parameter" do + m = MethodSpecs::Methods.instance_method(:one_nokey) + m.parameters.should == [[:nokey]] + end + it "works with ->(){} as the value of an optional argument" do m = MethodSpecs::Methods.instance_method(:one_opt_with_stabby) m.parameters.should == [[:opt,:a]] @@ -222,9 +233,54 @@ describe "Method#parameters" do m.method(:handled_via_method_missing).parameters.should == [[:rest]] end - it "adds nameless rest arg for \"star\" argument" do - m = MethodSpecs::Methods.new - m.method(:one_unnamed_splat).parameters.should == [[:rest]] + ruby_version_is '3.2' do + it "adds rest arg with name * for \"star\" argument" do + m = MethodSpecs::Methods.new + m.method(:one_unnamed_splat).parameters.should == [[:rest, :*]] + end + + it "adds keyrest arg with ** as a name for \"double star\" argument" do + m = MethodSpecs::Methods.new + m.method(:one_unnamed_keyrest).parameters.should == [[:keyrest, :**]] + end + end + + ruby_version_is ''...'3.2' do + it "adds nameless rest arg for \"star\" argument" do + m = MethodSpecs::Methods.new + m.method(:one_unnamed_splat).parameters.should == [[:rest]] + end + + it "adds nameless keyrest arg for \"double star\" argument" do + m = MethodSpecs::Methods.new + m.method(:one_unnamed_keyrest).parameters.should == [[:keyrest]] + end + end + + ruby_version_is '3.1' do + it "adds block arg with name & for anonymous block argument" do + object = Object.new + + eval(<<~RUBY).should == [[:block, :&]] + def object.foo(&) + end + object.method(:foo).parameters + RUBY + end + end + + ruby_version_is ""..."3.1" do + it "returns [:rest, :*], [:block, :&] for forward parameters operator" do + m = MethodSpecs::Methods.new + m.method(:forward_parameters).parameters.should == [[:rest, :*], [:block, :&]] + end + end + + ruby_version_is "3.1" do + it "returns [:rest, :*], [:keyrest, :**], [:block, :&] for forward parameters operator" do + m = MethodSpecs::Methods.new + m.method(:forward_parameters).parameters.should == [[:rest, :*], [:keyrest, :**], [:block, :&]] + end end it "returns the args and block for a splat and block argument" do @@ -242,6 +298,20 @@ describe "Method#parameters" do m.method(:writer=).parameters.should == [[:req]] end + it "returns all parameters defined with the name _ as _" do + m = MethodSpecs::Methods.instance_method(:underscore_parameters) + m.parameters.should == [ + [:req, :_], + [:req, :_], + [:opt, :_], + [:rest, :_], + [:keyreq, :_], + [:key, :_], + [:keyrest, :_], + [:block, :_] + ] + end + it "returns [[:rest]] for core methods with variable-length argument lists" do # delete! takes rest args "foo".method(:delete!).parameters.should == [[:rest]] diff --git a/spec/ruby/core/method/private_spec.rb b/spec/ruby/core/method/private_spec.rb new file mode 100644 index 0000000000..fd550036a3 --- /dev/null +++ b/spec/ruby/core/method/private_spec.rb @@ -0,0 +1,28 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "Method#private?" do + ruby_version_is "3.1"..."3.2" do + it "returns false when the method is public" do + obj = MethodSpecs::Methods.new + obj.method(:my_public_method).private?.should == false + end + + it "returns false when the method is protected" do + obj = MethodSpecs::Methods.new + obj.method(:my_protected_method).private?.should == false + end + + it "returns true when the method is private" do + obj = MethodSpecs::Methods.new + obj.method(:my_private_method).private?.should == true + end + end + + ruby_version_is "3.2" do + it "has been removed" do + obj = MethodSpecs::Methods.new + obj.method(:my_private_method).should_not.respond_to?(:private?) + end + end +end diff --git a/spec/ruby/core/method/protected_spec.rb b/spec/ruby/core/method/protected_spec.rb new file mode 100644 index 0000000000..8423e8c64c --- /dev/null +++ b/spec/ruby/core/method/protected_spec.rb @@ -0,0 +1,28 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "Method#protected?" do + ruby_version_is "3.1"..."3.2" do + it "returns false when the method is public" do + obj = MethodSpecs::Methods.new + obj.method(:my_public_method).protected?.should == false + end + + it "returns true when the method is protected" do + obj = MethodSpecs::Methods.new + obj.method(:my_protected_method).protected?.should == true + end + + it "returns false when the method is private" do + obj = MethodSpecs::Methods.new + obj.method(:my_private_method).protected?.should == false + end + end + + ruby_version_is "3.2" do + it "has been removed" do + obj = MethodSpecs::Methods.new + obj.method(:my_protected_method).should_not.respond_to?(:protected?) + end + end +end diff --git a/spec/ruby/core/method/public_spec.rb b/spec/ruby/core/method/public_spec.rb new file mode 100644 index 0000000000..20d0081a27 --- /dev/null +++ b/spec/ruby/core/method/public_spec.rb @@ -0,0 +1,28 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "Method#public?" do + ruby_version_is "3.1"..."3.2" do + it "returns true when the method is public" do + obj = MethodSpecs::Methods.new + obj.method(:my_public_method).public?.should == true + end + + it "returns false when the method is protected" do + obj = MethodSpecs::Methods.new + obj.method(:my_protected_method).public?.should == false + end + + it "returns false when the method is private" do + obj = MethodSpecs::Methods.new + obj.method(:my_private_method).public?.should == false + end + end + + ruby_version_is "3.2" do + it "has been removed" do + obj = MethodSpecs::Methods.new + obj.method(:my_public_method).should_not.respond_to?(:public?) + end + end +end diff --git a/spec/ruby/core/method/shared/dup.rb b/spec/ruby/core/method/shared/dup.rb new file mode 100644 index 0000000000..1a10b90689 --- /dev/null +++ b/spec/ruby/core/method/shared/dup.rb @@ -0,0 +1,32 @@ +describe :method_dup, shared: true do + it "returns a copy of self" do + a = Object.new.method(:method) + b = a.send(@method) + + a.should == b + a.should_not equal(b) + end + + ruby_version_is "3.4" do + it "copies instance variables" do + method = Object.new.method(:method) + method.instance_variable_set(:@ivar, 1) + cl = method.send(@method) + cl.instance_variables.should == [:@ivar] + end + + it "copies the finalizer" do + code = <<-RUBY + obj = Object.new.method(:method) + + ObjectSpace.define_finalizer(obj, Proc.new { STDOUT.write "finalized\n" }) + + obj.clone + + exit 0 + RUBY + + ruby_exe(code).lines.sort.should == ["finalized\n", "finalized\n"] + end + end +end diff --git a/spec/ruby/core/method/shared/to_s.rb b/spec/ruby/core/method/shared/to_s.rb index 0dcae41b59..b2d27d370f 100644 --- a/spec/ruby/core/method/shared/to_s.rb +++ b/spec/ruby/core/method/shared/to_s.rb @@ -24,19 +24,17 @@ describe :method_to_s, shared: true do @string.should =~ /\#bar/ end - ruby_version_is "2.7" do - it "returns a String containing method arguments" do - obj = MethodSpecs::Methods.new - obj.method(:zero).send(@method).should.include?("()") - obj.method(:one_req).send(@method).should.include?("(a)") - obj.method(:one_req_named).send(@method).should.include?("(a:)") - obj.method(:zero_with_block).send(@method).should.include?("(&blk)") - obj.method(:one_opt).send(@method).should.include?("(a=...)") - obj.method(:one_opt_named).send(@method).should.include?("(a: ...)") - obj.method(:zero_with_splat).send(@method).should.include?("(*a)") - obj.method(:zero_with_double_splat).send(@method).should.include?("(**a)") - obj.method(:one_req_one_opt_with_splat_and_block).send(@method).should.include?("(a, b=..., *c, &blk)") - end + it "returns a String containing method arguments" do + obj = MethodSpecs::Methods.new + obj.method(:zero).send(@method).should.include?("()") + obj.method(:one_req).send(@method).should.include?("(a)") + obj.method(:one_req_named).send(@method).should.include?("(a:)") + obj.method(:zero_with_block).send(@method).should.include?("(&blk)") + obj.method(:one_opt).send(@method).should.include?("(a=...)") + obj.method(:one_opt_named).send(@method).should.include?("(a: ...)") + obj.method(:zero_with_splat).send(@method).should.include?("(*a)") + obj.method(:zero_with_double_splat).send(@method).should.include?("(**a)") + obj.method(:one_req_one_opt_with_splat_and_block).send(@method).should.include?("(a, b=..., *c, &blk)") end it "returns a String containing the Module the method is defined in" do @@ -55,20 +53,18 @@ describe :method_to_s, shared: true do MethodSpecs::A.new.method(:baz).send(@method).should.start_with? "#<Method: MethodSpecs::A#baz" end - ruby_version_is '3.0' do - it "returns a String containing the Module containing the method if object has a singleton class but method is not defined in the singleton class" do - obj = MethodSpecs::MySub.new - obj.singleton_class - @m = obj.method(:bar) - @string = @m.send(@method) - @string.should.start_with? "#<Method: MethodSpecs::MySub(MethodSpecs::MyMod)#bar" + it "returns a String containing the Module containing the method if object has a singleton class but method is not defined in the singleton class" do + obj = MethodSpecs::MySub.new + obj.singleton_class + @m = obj.method(:bar) + @string = @m.send(@method) + @string.should.start_with? "#<Method: MethodSpecs::MySub(MethodSpecs::MyMod)#bar" - c = MethodSpecs::MySub.dup - m = Module.new{def bar; end} - c.extend(m) - @string = c.method(:bar).send(@method) - @string.should.start_with? "#<Method: #<Class:#{c.inspect}>(#{m.inspect})#bar" - end + c = MethodSpecs::MySub.dup + m = Module.new{def bar; end} + c.extend(m) + @string = c.method(:bar).send(@method) + @string.should.start_with? "#<Method: #<Class:#{c.inspect}>(#{m.inspect})#bar" end it "returns a String containing the singleton class if method is defined in the singleton class" do @@ -79,11 +75,7 @@ describe :method_to_s, shared: true do @string.should.start_with? "#<Method: #<MethodSpecs::MySub:0xXXXXXX>.bar" end - ruby_version_is '2.7' do - ruby_bug '#17428', '2.7'...'3.0' do - it "shows the metaclass and the owner for a Module instance method retrieved from a class" do - String.method(:include).inspect.should.start_with?("#<Method: #<Class:String>(Module)#include") - end - end + it "shows the metaclass and the owner for a Module instance method retrieved from a class" do + String.method(:include).inspect.should.start_with?("#<Method: #<Class:String>(Module)#include") end end diff --git a/spec/ruby/core/method/source_location_spec.rb b/spec/ruby/core/method/source_location_spec.rb index 1f476aaa9b..c5b296f6e2 100644 --- a/spec/ruby/core/method/source_location_spec.rb +++ b/spec/ruby/core/method/source_location_spec.rb @@ -13,7 +13,7 @@ describe "Method#source_location" do it "sets the first value to the path of the file in which the method was defined" do file = @method.source_location.first file.should be_an_instance_of(String) - file.should == File.realpath('../fixtures/classes.rb', __FILE__) + file.should == File.realpath('fixtures/classes.rb', __dir__) end it "sets the last value to an Integer representing the line on which the method was defined" do @@ -104,6 +104,13 @@ describe "Method#source_location" do end end + it "works for eval with a given line" do + c = Class.new do + eval('def self.m; end', nil, "foo", 100) + end + c.method(:m).source_location.should == ["foo", 100] + end + describe "for a Method generated by respond_to_missing?" do it "returns nil" do m = MethodSpecs::Methods.new diff --git a/spec/ruby/core/method/super_method_spec.rb b/spec/ruby/core/method/super_method_spec.rb index e5d8b87a06..c63a7aaa0f 100644 --- a/spec/ruby/core/method/super_method_spec.rb +++ b/spec/ruby/core/method/super_method_spec.rb @@ -42,4 +42,23 @@ describe "Method#super_method" do method.super_method.should == nil end + + # https://github.com/jruby/jruby/issues/7240 + context "after changing an inherited methods visibility" do + it "calls the proper super method" do + MethodSpecs::InheritedMethods::C.new.derp.should == 'BA' + end + + it "returns the expected super_method" do + method = MethodSpecs::InheritedMethods::C.new.method(:derp) + method.super_method.owner.should == MethodSpecs::InheritedMethods::A + end + end + + context "after aliasing an inherited method" do + it "returns the expected super_method" do + method = MethodSpecs::InheritedMethods::C.new.method(:meow) + method.super_method.owner.should == MethodSpecs::InheritedMethods::A + end + end end diff --git a/spec/ruby/core/method/to_proc_spec.rb b/spec/ruby/core/method/to_proc_spec.rb index 29b7bec2b3..4993cce239 100644 --- a/spec/ruby/core/method/to_proc_spec.rb +++ b/spec/ruby/core/method/to_proc_spec.rb @@ -35,7 +35,7 @@ describe "Method#to_proc" do end it "returns a proc that can be used by define_method" do - x = 'test' + x = +'test' to_s = class << x define_method :foo, method(:to_s).to_proc to_s diff --git a/spec/ruby/core/method/unbind_spec.rb b/spec/ruby/core/method/unbind_spec.rb index cdd3a808f2..bdedd513ce 100644 --- a/spec/ruby/core/method/unbind_spec.rb +++ b/spec/ruby/core/method/unbind_spec.rb @@ -27,8 +27,16 @@ describe "Method#unbind" do @string.should =~ /MethodSpecs::MyMod/ end - it "returns a String containing the Module the method is referenced from" do - @string.should =~ /MethodSpecs::MySub/ + ruby_version_is ""..."3.2" do + it "returns a String containing the Module the method is referenced from" do + @string.should =~ /MethodSpecs::MySub/ + end + end + + ruby_version_is "3.2" do + it "returns a String containing the Module the method is referenced from" do + @string.should =~ /MethodSpecs::MyMod/ + end end end diff --git a/spec/ruby/core/module/alias_method_spec.rb b/spec/ruby/core/module/alias_method_spec.rb index 5d3d0c23d9..c36dedd2d8 100644 --- a/spec/ruby/core/module/alias_method_spec.rb +++ b/spec/ruby/core/module/alias_method_spec.rb @@ -81,22 +81,20 @@ describe "Module#alias_method" do -> { @class.make_alias mock('x'), :public_one }.should raise_error(TypeError) end + it "raises a NoMethodError if the given name raises a NoMethodError during type coercion using to_str" do + obj = mock("mock-name") + obj.should_receive(:to_str).and_raise(NoMethodError) + -> { @class.make_alias obj, :public_one }.should raise_error(NoMethodError) + end + it "is a public method" do Module.should have_public_instance_method(:alias_method, false) end describe "returned value" do - ruby_version_is ""..."3.0" do - it "returns self" do - @class.send(:alias_method, :checking_return_value, :public_one).should equal(@class) - end - end - - ruby_version_is "3.0" do - it "returns symbol of the defined method name" do - @class.send(:alias_method, :checking_return_value, :public_one).should equal(:checking_return_value) - @class.send(:alias_method, 'checking_return_value', :public_one).should equal(:checking_return_value) - end + it "returns symbol of the defined method name" do + @class.send(:alias_method, :checking_return_value, :public_one).should equal(:checking_return_value) + @class.send(:alias_method, 'checking_return_value', :public_one).should equal(:checking_return_value) end end diff --git a/spec/ruby/core/module/allocate_spec.rb b/spec/ruby/core/module/allocate_spec.rb deleted file mode 100644 index 3b2c4119c3..0000000000 --- a/spec/ruby/core/module/allocate_spec.rb +++ /dev/null @@ -1,14 +0,0 @@ -require_relative '../../spec_helper' - -describe "Module.allocate" do - it "returns an instance of Module" do - mod = Module.allocate - mod.should be_an_instance_of(Module) - end - - it "returns a fully-formed instance of Module" do - mod = Module.allocate - mod.constants.should_not == nil - mod.methods.should_not == nil - end -end diff --git a/spec/ruby/core/module/append_features_spec.rb b/spec/ruby/core/module/append_features_spec.rb index d960798eef..1724cde5d6 100644 --- a/spec/ruby/core/module/append_features_spec.rb +++ b/spec/ruby/core/module/append_features_spec.rb @@ -47,20 +47,6 @@ describe "Module#append_features" do end - ruby_version_is ''...'2.7' do - it "copies own tainted status to the given module" do - other = Module.new - Module.new.taint.send :append_features, other - other.tainted?.should be_true - end - - it "copies own untrusted status to the given module" do - other = Module.new - Module.new.untrust.send :append_features, other - other.untrusted?.should be_true - end - end - describe "when other is frozen" do before :each do @receiver = Module.new diff --git a/spec/ruby/core/module/attr_accessor_spec.rb b/spec/ruby/core/module/attr_accessor_spec.rb index ba5289cbea..503dccc61e 100644 --- a/spec/ruby/core/module/attr_accessor_spec.rb +++ b/spec/ruby/core/module/attr_accessor_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/attr_added' describe "Module#attr_accessor" do it "creates a getter and setter for each given attribute name" do @@ -80,19 +81,9 @@ describe "Module#attr_accessor" do Module.should have_public_instance_method(:attr_accessor, false) end - ruby_version_is ""..."3.0" do - it "returns nil" do - Class.new do - (attr_accessor :foo, 'bar').should == nil - end - end - end - - ruby_version_is "3.0" do - it "returns an array of defined method names as symbols" do - Class.new do - (attr_accessor :foo, 'bar').should == [:foo, :foo=, :bar, :bar=] - end + it "returns an array of defined method names as symbols" do + Class.new do + (attr_accessor :foo, 'bar').should == [:foo, :foo=, :bar, :bar=] end end @@ -116,4 +107,6 @@ describe "Module#attr_accessor" do 1.foobar.should be_nil end end + + it_behaves_like :module_attr_added, :attr_accessor end diff --git a/spec/ruby/core/module/attr_reader_spec.rb b/spec/ruby/core/module/attr_reader_spec.rb index b0ae906ab5..37fd537ff5 100644 --- a/spec/ruby/core/module/attr_reader_spec.rb +++ b/spec/ruby/core/module/attr_reader_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/attr_added' describe "Module#attr_reader" do it "creates a getter for each given attribute name" do @@ -62,19 +63,11 @@ describe "Module#attr_reader" do Module.should have_public_instance_method(:attr_reader, false) end - ruby_version_is ""..."3.0" do - it "returns nil" do - Class.new do - (attr_reader :foo, 'bar').should == nil - end + it "returns an array of defined method names as symbols" do + Class.new do + (attr_reader :foo, 'bar').should == [:foo, :bar] end end - ruby_version_is "3.0" do - it "returns an array of defined method names as symbols" do - Class.new do - (attr_reader :foo, 'bar').should == [:foo, :bar] - end - end - end + it_behaves_like :module_attr_added, :attr_reader end diff --git a/spec/ruby/core/module/attr_spec.rb b/spec/ruby/core/module/attr_spec.rb index 33e0eb8628..2f9f4e26dc 100644 --- a/spec/ruby/core/module/attr_spec.rb +++ b/spec/ruby/core/module/attr_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/attr_added' describe "Module#attr" do before :each do @@ -146,23 +147,13 @@ describe "Module#attr" do Module.should have_public_instance_method(:attr, false) end - ruby_version_is ""..."3.0" do - it "returns nil" do - Class.new do - (attr :foo, 'bar').should == nil - (attr :baz, false).should == nil - (attr :qux, true).should == nil - end + it "returns an array of defined method names as symbols" do + Class.new do + (attr :foo, 'bar').should == [:foo, :bar] + (attr :baz, false).should == [:baz] + (attr :qux, true).should == [:qux, :qux=] end end - ruby_version_is "3.0" do - it "returns an array of defined method names as symbols" do - Class.new do - (attr :foo, 'bar').should == [:foo, :bar] - (attr :baz, false).should == [:baz] - (attr :qux, true).should == [:qux, :qux=] - end - end - end + it_behaves_like :module_attr_added, :attr end diff --git a/spec/ruby/core/module/attr_writer_spec.rb b/spec/ruby/core/module/attr_writer_spec.rb index 0e9d201317..5b863ef88c 100644 --- a/spec/ruby/core/module/attr_writer_spec.rb +++ b/spec/ruby/core/module/attr_writer_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/attr_added' describe "Module#attr_writer" do it "creates a setter for each given attribute name" do @@ -72,19 +73,11 @@ describe "Module#attr_writer" do Module.should have_public_instance_method(:attr_writer, false) end - ruby_version_is ""..."3.0" do - it "returns nil" do - Class.new do - (attr_writer :foo, 'bar').should == nil - end + it "returns an array of defined method names as symbols" do + Class.new do + (attr_writer :foo, 'bar').should == [:foo=, :bar=] end end - ruby_version_is "3.0" do - it "returns an array of defined method names as symbols" do - Class.new do - (attr_writer :foo, 'bar').should == [:foo=, :bar=] - end - end - end + it_behaves_like :module_attr_added, :attr_writer end diff --git a/spec/ruby/core/module/autoload_spec.rb b/spec/ruby/core/module/autoload_spec.rb index f17675846b..45d18b8608 100644 --- a/spec/ruby/core/module/autoload_spec.rb +++ b/spec/ruby/core/module/autoload_spec.rb @@ -1,7 +1,6 @@ require_relative '../../spec_helper' require_relative '../../fixtures/code_loading' require_relative 'fixtures/classes' -require 'thread' describe "Module#autoload?" do it "returns the name of the file that will be autoloaded" do @@ -18,16 +17,14 @@ describe "Module#autoload?" do ModuleSpecs::Autoload::Child.autoload?(:AnotherAutoload).should == "another_autoload.rb" end - ruby_version_is "2.7" do - it "returns nil if an ancestor defined that autoload but recursion is disabled" do - ModuleSpecs::Autoload::Parent.autoload :InheritedAutoload, "inherited_autoload.rb" - ModuleSpecs::Autoload::Child.autoload?(:InheritedAutoload, false).should be_nil - end + it "returns nil if an ancestor defined that autoload but recursion is disabled" do + ModuleSpecs::Autoload::Parent.autoload :InheritedAutoload, "inherited_autoload.rb" + ModuleSpecs::Autoload::Child.autoload?(:InheritedAutoload, false).should be_nil + end - it "returns the name of the file that will be loaded if recursion is disabled but the autoload is defined on the class itself" do - ModuleSpecs::Autoload::Child.autoload :ChildAutoload, "child_autoload.rb" - ModuleSpecs::Autoload::Child.autoload?(:ChildAutoload, false).should == "child_autoload.rb" - end + it "returns the name of the file that will be loaded if recursion is disabled but the autoload is defined on the class itself" do + ModuleSpecs::Autoload::Child.autoload :ChildAutoload, "child_autoload.rb" + ModuleSpecs::Autoload::Child.autoload?(:ChildAutoload, false).should == "child_autoload.rb" end end @@ -345,6 +342,29 @@ describe "Module#autoload" do end end + def check_before_during_thread_after(const, &check) + before = check.call + to_autoload_thread, from_autoload_thread = Queue.new, Queue.new + ScratchPad.record -> { + from_autoload_thread.push check.call + to_autoload_thread.pop + } + t = Thread.new { + in_loading_thread = from_autoload_thread.pop + in_other_thread = check.call + to_autoload_thread.push :done + [in_loading_thread, in_other_thread] + } + in_loading_thread, in_other_thread = nil + begin + ModuleSpecs::Autoload.const_get(const) + ensure + in_loading_thread, in_other_thread = t.value + end + after = check.call + [before, in_loading_thread, in_other_thread, after] + end + describe "during the autoload before the constant is assigned" do before :each do @path = fixture(__FILE__, "autoload_during_autoload.rb") @@ -353,58 +373,83 @@ describe "Module#autoload" do raise unless ModuleSpecs::Autoload.autoload?(:DuringAutoload) == @path end - def check_before_during_thread_after(&check) - before = check.call - to_autoload_thread, from_autoload_thread = Queue.new, Queue.new - ScratchPad.record -> { - from_autoload_thread.push check.call - to_autoload_thread.pop - } - t = Thread.new { - in_loading_thread = from_autoload_thread.pop - in_other_thread = check.call - to_autoload_thread.push :done - [in_loading_thread, in_other_thread] - } - in_loading_thread, in_other_thread = nil - begin - ModuleSpecs::Autoload::DuringAutoload - ensure - in_loading_thread, in_other_thread = t.value - end - after = check.call - [before, in_loading_thread, in_other_thread, after] - end - it "returns nil in autoload thread and 'constant' otherwise for defined?" do - results = check_before_during_thread_after { + results = check_before_during_thread_after(:DuringAutoload) { defined?(ModuleSpecs::Autoload::DuringAutoload) } results.should == ['constant', nil, 'constant', 'constant'] end it "keeps the constant in Module#constants" do - results = check_before_during_thread_after { + results = check_before_during_thread_after(:DuringAutoload) { ModuleSpecs::Autoload.constants(false).include?(:DuringAutoload) } results.should == [true, true, true, true] end it "returns false in autoload thread and true otherwise for Module#const_defined?" do - results = check_before_during_thread_after { + results = check_before_during_thread_after(:DuringAutoload) { ModuleSpecs::Autoload.const_defined?(:DuringAutoload, false) } results.should == [true, false, true, true] end it "returns nil in autoload thread and returns the path in other threads for Module#autoload?" do - results = check_before_during_thread_after { + results = check_before_during_thread_after(:DuringAutoload) { ModuleSpecs::Autoload.autoload?(:DuringAutoload) } results.should == [@path, nil, @path, nil] end end + describe "during the autoload after the constant is assigned" do + before :each do + @path = fixture(__FILE__, "autoload_during_autoload_after_define.rb") + ModuleSpecs::Autoload.autoload :DuringAutoloadAfterDefine, @path + @autoload_location = [__FILE__, __LINE__ - 1] + @const_location = [@path, 2] + @remove << :DuringAutoloadAfterDefine + raise unless ModuleSpecs::Autoload.autoload?(:DuringAutoloadAfterDefine) == @path + end + + it "returns 'constant' in both threads" do + results = check_before_during_thread_after(:DuringAutoloadAfterDefine) { + defined?(ModuleSpecs::Autoload::DuringAutoloadAfterDefine) + } + results.should == ['constant', 'constant', 'constant', 'constant'] + end + + it "Module#constants include the autoloaded in both threads" do + results = check_before_during_thread_after(:DuringAutoloadAfterDefine) { + ModuleSpecs::Autoload.constants(false).include?(:DuringAutoloadAfterDefine) + } + results.should == [true, true, true, true] + end + + it "Module#const_defined? returns true in both threads" do + results = check_before_during_thread_after(:DuringAutoloadAfterDefine) { + ModuleSpecs::Autoload.const_defined?(:DuringAutoloadAfterDefine, false) + } + results.should == [true, true, true, true] + end + + it "returns nil in autoload thread and returns the path in other threads for Module#autoload?" do + results = check_before_during_thread_after(:DuringAutoloadAfterDefine) { + ModuleSpecs::Autoload.autoload?(:DuringAutoloadAfterDefine) + } + results.should == [@path, nil, @path, nil] + end + + ruby_bug("#20188", ""..."3.4") do + it "returns the real constant location in autoload thread and returns the autoload location in other threads for Module#const_source_location" do + results = check_before_during_thread_after(:DuringAutoloadAfterDefine) { + ModuleSpecs::Autoload.const_source_location(:DuringAutoloadAfterDefine) + } + results.should == [@autoload_location, @const_location, @autoload_location, @const_location] + end + end + end + it "does not remove the constant from Module#constants if load fails and keeps it as an autoload" do ModuleSpecs::Autoload.autoload :Fail, @non_existent @@ -441,21 +486,42 @@ describe "Module#autoload" do ScratchPad.recorded.should == [:raise, :raise] end - it "does not remove the constant from Module#constants if the loaded file does not define it, but leaves it as 'undefined'" do - path = fixture(__FILE__, "autoload_o.rb") - ScratchPad.record [] - ModuleSpecs::Autoload.autoload :O, path + ruby_version_is "3.1" do + it "removes the constant from Module#constants if the loaded file does not define it" do + path = fixture(__FILE__, "autoload_o.rb") + ScratchPad.record [] + ModuleSpecs::Autoload.autoload :O, path + + ModuleSpecs::Autoload.const_defined?(:O).should == true + ModuleSpecs::Autoload.should have_constant(:O) + ModuleSpecs::Autoload.autoload?(:O).should == path - ModuleSpecs::Autoload.const_defined?(:O).should == true - ModuleSpecs::Autoload.should have_constant(:O) - ModuleSpecs::Autoload.autoload?(:O).should == path + -> { ModuleSpecs::Autoload::O }.should raise_error(NameError) - -> { ModuleSpecs::Autoload::O }.should raise_error(NameError) + ModuleSpecs::Autoload.const_defined?(:O).should == false + ModuleSpecs::Autoload.should_not have_constant(:O) + ModuleSpecs::Autoload.autoload?(:O).should == nil + -> { ModuleSpecs::Autoload.const_get(:O) }.should raise_error(NameError) + end + end + + ruby_version_is ""..."3.1" do + it "does not remove the constant from Module#constants if the loaded file does not define it, but leaves it as 'undefined'" do + path = fixture(__FILE__, "autoload_o.rb") + ScratchPad.record [] + ModuleSpecs::Autoload.autoload :O, path + + ModuleSpecs::Autoload.const_defined?(:O).should == true + ModuleSpecs::Autoload.should have_constant(:O) + ModuleSpecs::Autoload.autoload?(:O).should == path - ModuleSpecs::Autoload.should have_constant(:O) - ModuleSpecs::Autoload.const_defined?(:O).should == false - ModuleSpecs::Autoload.autoload?(:O).should == nil - -> { ModuleSpecs::Autoload.const_get(:O) }.should raise_error(NameError) + -> { ModuleSpecs::Autoload::O }.should raise_error(NameError) + + ModuleSpecs::Autoload.const_defined?(:O).should == false + ModuleSpecs::Autoload.should have_constant(:O) + ModuleSpecs::Autoload.autoload?(:O).should == nil + -> { ModuleSpecs::Autoload.const_get(:O) }.should raise_error(NameError) + end end it "does not try to load the file again if the loaded file did not define the constant" do @@ -493,9 +559,7 @@ describe "Module#autoload" do it "does not load the file when accessing the constants table of the module" do ModuleSpecs::Autoload.autoload :P, @non_existent ModuleSpecs::Autoload.const_defined?(:P).should be_true - ruby_bug "[Bug #15780]", ""..."2.7" do - ModuleSpecs::Autoload.const_defined?("P").should be_true - end + ModuleSpecs::Autoload.const_defined?("P").should be_true end it "loads the file when opening a module that is the autoloaded constant" do @@ -554,31 +618,84 @@ describe "Module#autoload" do # Basically, the parent autoload constant remains in a "undefined" state self.autoload?(:DeclaredInParentDefinedInCurrent).should == nil const_defined?(:DeclaredInParentDefinedInCurrent).should == false - self.should have_constant(:DeclaredInParentDefinedInCurrent) -> { DeclaredInParentDefinedInCurrent }.should raise_error(NameError) ModuleSpecs::Autoload::LexicalScope.send(:remove_const, :DeclaredInParentDefinedInCurrent) end end - it "and fails when finding the undefined autoload constant in the current scope when declared in current and defined in parent" do - @remove << :DeclaredInCurrentDefinedInParent - module ModuleSpecs::Autoload + ruby_version_is "3.2" do + it "warns once in verbose mode if the constant was defined in a parent scope" do ScratchPad.record -> { - DeclaredInCurrentDefinedInParent = :declared_in_current_defined_in_parent + ModuleSpecs::DeclaredInCurrentDefinedInParent = :declared_in_current_defined_in_parent } - class LexicalScope - autoload :DeclaredInCurrentDefinedInParent, fixture(__FILE__, "autoload_callback.rb") - -> { DeclaredInCurrentDefinedInParent }.should raise_error(NameError) - # Basically, the autoload constant remains in a "undefined" state - self.autoload?(:DeclaredInCurrentDefinedInParent).should == nil - const_defined?(:DeclaredInCurrentDefinedInParent).should == false - self.should have_constant(:DeclaredInCurrentDefinedInParent) - -> { const_get(:DeclaredInCurrentDefinedInParent) }.should raise_error(NameError) + module ModuleSpecs + module Autoload + autoload :DeclaredInCurrentDefinedInParent, fixture(__FILE__, "autoload_callback.rb") + self.autoload?(:DeclaredInCurrentDefinedInParent).should == fixture(__FILE__, "autoload_callback.rb") + const_defined?(:DeclaredInCurrentDefinedInParent).should == true + + -> { + DeclaredInCurrentDefinedInParent + }.should complain( + /Expected .*autoload_callback.rb to define ModuleSpecs::Autoload::DeclaredInCurrentDefinedInParent but it didn't/, + verbose: true, + ) + + -> { + DeclaredInCurrentDefinedInParent + }.should_not complain(/.*/, verbose: true) + self.autoload?(:DeclaredInCurrentDefinedInParent).should == nil + const_defined?(:DeclaredInCurrentDefinedInParent).should == false + ModuleSpecs.const_defined?(:DeclaredInCurrentDefinedInParent).should == true + end end + end + end + + ruby_version_is "3.1" do + it "looks up in parent scope after failed autoload" do + @remove << :DeclaredInCurrentDefinedInParent + module ModuleSpecs::Autoload + ScratchPad.record -> { + DeclaredInCurrentDefinedInParent = :declared_in_current_defined_in_parent + } - DeclaredInCurrentDefinedInParent.should == :declared_in_current_defined_in_parent + class LexicalScope + autoload :DeclaredInCurrentDefinedInParent, fixture(__FILE__, "autoload_callback.rb") + -> { DeclaredInCurrentDefinedInParent }.should_not raise_error(NameError) + # Basically, the autoload constant remains in a "undefined" state + self.autoload?(:DeclaredInCurrentDefinedInParent).should == nil + const_defined?(:DeclaredInCurrentDefinedInParent).should == false + -> { const_get(:DeclaredInCurrentDefinedInParent) }.should raise_error(NameError) + end + + DeclaredInCurrentDefinedInParent.should == :declared_in_current_defined_in_parent + end + end + end + + ruby_version_is ""..."3.1" do + it "and fails when finding the undefined autoload constant in the current scope when declared in current and defined in parent" do + @remove << :DeclaredInCurrentDefinedInParent + module ModuleSpecs::Autoload + ScratchPad.record -> { + DeclaredInCurrentDefinedInParent = :declared_in_current_defined_in_parent + } + + class LexicalScope + autoload :DeclaredInCurrentDefinedInParent, fixture(__FILE__, "autoload_callback.rb") + -> { DeclaredInCurrentDefinedInParent }.should raise_error(NameError) + # Basically, the autoload constant remains in a "undefined" state + self.autoload?(:DeclaredInCurrentDefinedInParent).should == nil + const_defined?(:DeclaredInCurrentDefinedInParent).should == false + self.should have_constant(:DeclaredInCurrentDefinedInParent) + -> { const_get(:DeclaredInCurrentDefinedInParent) }.should raise_error(NameError) + end + + DeclaredInCurrentDefinedInParent.should == :declared_in_current_defined_in_parent + end end end diff --git a/spec/ruby/core/module/class_variables_spec.rb b/spec/ruby/core/module/class_variables_spec.rb index fd7aa93aa8..e155f1deac 100644 --- a/spec/ruby/core/module/class_variables_spec.rb +++ b/spec/ruby/core/module/class_variables_spec.rb @@ -23,4 +23,12 @@ describe "Module#class_variables" do c.extend ModuleSpecs::MVars c.class_variables.should_not include(:@@mvar) end + + it "returns the correct class variables when inherit is given" do + ModuleSpecs::SubCVars.class_variables(false).should == [:@@sub] + ModuleSpecs::SubCVars.new.singleton_class.class_variables(false).should == [] + + ModuleSpecs::SubCVars.class_variables(true).should == [:@@sub, :@@cls, :@@meta] + ModuleSpecs::SubCVars.new.singleton_class.class_variables(true).should == [:@@sub, :@@cls, :@@meta] + end end diff --git a/spec/ruby/core/module/const_added_spec.rb b/spec/ruby/core/module/const_added_spec.rb new file mode 100644 index 0000000000..f9edda3a07 --- /dev/null +++ b/spec/ruby/core/module/const_added_spec.rb @@ -0,0 +1,160 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "Module#const_added" do + ruby_version_is "3.2" do + it "is a private instance method" do + Module.should have_private_instance_method(:const_added) + end + + it "returns nil in the default implementation" do + Module.new do + const_added(:TEST).should == nil + end + end + + it "is called when a new constant is assigned on self" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad << name + end + end + + mod.module_eval(<<-RUBY, __FILE__, __LINE__ + 1) + TEST = 1 + RUBY + + ScratchPad.recorded.should == [:TEST] + end + + it "is called when a new constant is assigned on self through const_set" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad << name + end + end + + mod.const_set(:TEST, 1) + + ScratchPad.recorded.should == [:TEST] + end + + it "is called when a new module is defined under self" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad << name + end + end + + mod.module_eval(<<-RUBY, __FILE__, __LINE__ + 1) + module SubModule + end + + module SubModule + end + RUBY + + ScratchPad.recorded.should == [:SubModule] + end + + it "is called when a new class is defined under self" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad << name + end + end + + mod.module_eval(<<-RUBY, __FILE__, __LINE__ + 1) + class SubClass + end + + class SubClass + end + RUBY + + ScratchPad.recorded.should == [:SubClass] + end + + it "is called when an autoload is defined" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad << name + end + end + + mod.autoload :Autoload, "foo" + ScratchPad.recorded.should == [:Autoload] + end + + it "is called with a precise caller location with the line of definition" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + location = caller_locations(1, 1)[0] + ScratchPad << location.lineno + end + end + + line = __LINE__ + mod.module_eval(<<-RUBY, __FILE__, __LINE__ + 1) + TEST = 1 + + module SubModule + end + + class SubClass + end + RUBY + + mod.const_set(:CONST_SET, 1) + + ScratchPad.recorded.should == [line + 2, line + 4, line + 7, line + 11] + end + + it "is called when the constant is already assigned a value" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad.record const_get(name) + end + end + + mod.module_eval(<<-RUBY, __FILE__, __LINE__ + 1) + TEST = 123 + RUBY + + ScratchPad.recorded.should == 123 + end + + it "records re-definition of existing constants" do + ScratchPad.record [] + + mod = Module.new do + def self.const_added(name) + ScratchPad << const_get(name) + end + end + + -> { + mod.module_eval(<<-RUBY, __FILE__, __LINE__ + 1) + TEST = 123 + TEST = 456 + RUBY + }.should complain(/warning: already initialized constant .+::TEST/) + + ScratchPad.recorded.should == [123, 456] + end + end +end diff --git a/spec/ruby/core/module/const_defined_spec.rb b/spec/ruby/core/module/const_defined_spec.rb index 75730395e8..027cf5a245 100644 --- a/spec/ruby/core/module/const_defined_spec.rb +++ b/spec/ruby/core/module/const_defined_spec.rb @@ -17,11 +17,16 @@ describe "Module#const_defined?" do ConstantSpecs::ContainerA::ChildA.const_defined?(:CS_CONST4).should be_true end - it "returns true if the constant is defined in a mixed-in module of the receiver" do + it "returns true if the constant is defined in a mixed-in module of the receiver's parent" do # CS_CONST10 is defined in a module included by ChildA ConstantSpecs::ContainerA::ChildA.const_defined?(:CS_CONST10).should be_true end + it "returns true if the constant is defined in a mixed-in module (with prepends) of the receiver" do + # CS_CONST11 is defined in the module included by ContainerPrepend + ConstantSpecs::ContainerPrepend.const_defined?(:CS_CONST11).should be_true + end + it "returns true if the constant is defined in Object and the receiver is a module" do # CS_CONST1 is defined in Object ConstantSpecs::ModuleA.const_defined?(:CS_CONST1).should be_true @@ -75,10 +80,23 @@ describe "Module#const_defined?" do ConstantSpecs::ClassA.const_defined?(:CS_CONSTX).should == false end - it "calls #to_str to convert the given name to a String" do - name = mock("ClassA") - name.should_receive(:to_str).and_return("ClassA") - ConstantSpecs.const_defined?(name).should == true + describe "converts the given name to a String using #to_str" do + it "calls #to_str to convert the given name to a String" do + name = mock("ClassA") + name.should_receive(:to_str).and_return("ClassA") + ConstantSpecs.const_defined?(name).should == true + end + + it "raises a TypeError if the given name can't be converted to a String" do + -> { ConstantSpecs.const_defined?(nil) }.should raise_error(TypeError) + -> { ConstantSpecs.const_defined?([]) }.should raise_error(TypeError) + end + + it "raises a NoMethodError if the given argument raises a NoMethodError during type coercion to a String" do + name = mock("classA") + name.should_receive(:to_str).and_raise(NoMethodError) + -> { ConstantSpecs.const_defined?(name) }.should raise_error(NoMethodError) + end end it "special cases Object and checks it's included Modules" do diff --git a/spec/ruby/core/module/const_get_spec.rb b/spec/ruby/core/module/const_get_spec.rb index 9f9fafe5bb..0233118f4b 100644 --- a/spec/ruby/core/module/const_get_spec.rb +++ b/spec/ruby/core/module/const_get_spec.rb @@ -100,6 +100,16 @@ describe "Module#const_get" do ConstantSpecs.const_get("::CS_CONST1").should == :const1 end + it "accepts a toplevel scope qualifier when inherit is false" do + ConstantSpecs.const_get("::CS_CONST1", false).should == :const1 + -> { ConstantSpecs.const_get("CS_CONST1", false) }.should raise_error(NameError) + end + + it "returns a constant whose module is defined the toplevel" do + ConstantSpecs.const_get("ConstantSpecsTwo::Foo").should == :cs_two_foo + ConstantSpecsThree.const_get("ConstantSpecsTwo::Foo").should == :cs_three_foo + end + it "accepts a scoped constant name" do ConstantSpecs.const_get("ClassA::CS_CONST10").should == :const10_10 end @@ -140,6 +150,10 @@ describe "Module#const_get" do Object.const_get('CSAutoloadD::InnerModule').name.should == 'CSAutoloadD::InnerModule' end + it "raises a NameError when the nested constant does not exist on the module but exists in Object" do + -> { Object.const_get('ConstantSpecs::CS_CONST1') }.should raise_error(NameError) + end + describe "with statically assigned constants" do it "searches the immediate class or module first" do ConstantSpecs::ClassA.const_get(:CS_CONST10).should == :const10_10 diff --git a/spec/ruby/core/module/const_set_spec.rb b/spec/ruby/core/module/const_set_spec.rb index b537d3f133..5bdfd7b68f 100644 --- a/spec/ruby/core/module/const_set_spec.rb +++ b/spec/ruby/core/module/const_set_spec.rb @@ -20,20 +20,10 @@ describe "Module#const_set" do m.name.should == "ConstantSpecs::CS_CONST1000" end - ruby_version_is ""..."3.0" do - it "does not set the name of a module scoped by an anonymous module" do - a, b = Module.new, Module.new - a.const_set :B, b - b.name.should be_nil - end - end - - ruby_version_is "3.0" do - it "sets the name of a module scoped by an anonymous module" do - a, b = Module.new, Module.new - a.const_set :B, b - b.name.should.end_with? '::B' - end + it "sets the name of a module scoped by an anonymous module" do + a, b = Module.new, Module.new + a.const_set :B, b + b.name.should.end_with? '::B' end it "sets the name of contained modules when assigning a toplevel anonymous module" do @@ -101,7 +91,7 @@ describe "Module#const_set" do mod.const_get(:Foo).should == 1 end - it "does not warn if the previous value was undefined" do + it "does not warn after a failed autoload" do path = fixture(__FILE__, "autoload_o.rb") ScratchPad.record [] mod = Module.new @@ -109,7 +99,6 @@ describe "Module#const_set" do mod.autoload :Foo, path -> { mod::Foo }.should raise_error(NameError) - mod.should have_constant(:Foo) mod.const_defined?(:Foo).should == false mod.autoload?(:Foo).should == nil diff --git a/spec/ruby/core/module/const_source_location_spec.rb b/spec/ruby/core/module/const_source_location_spec.rb index 9e1f2c1c49..c194c9113f 100644 --- a/spec/ruby/core/module/const_source_location_spec.rb +++ b/spec/ruby/core/module/const_source_location_spec.rb @@ -6,214 +6,243 @@ describe "Module#const_source_location" do @constants_fixture_path = File.expand_path('../../fixtures/constants.rb', __dir__) end - ruby_version_is "2.7" do - describe "with dynamically assigned constants" do - it "searches a path in the immediate class or module first" do - ConstantSpecs::ClassA::CSL_CONST301 = :const301_1 - ConstantSpecs::ClassA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] + describe "with dynamically assigned constants" do + it "searches a path in the immediate class or module first" do + ConstantSpecs::ClassA::CSL_CONST301 = :const301_1 + ConstantSpecs::ClassA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] - ConstantSpecs::ModuleA::CSL_CONST301 = :const301_2 - ConstantSpecs::ModuleA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] + ConstantSpecs::ModuleA::CSL_CONST301 = :const301_2 + ConstantSpecs::ModuleA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] - ConstantSpecs::ParentA::CSL_CONST301 = :const301_3 - ConstantSpecs::ParentA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] + ConstantSpecs::ParentA::CSL_CONST301 = :const301_3 + ConstantSpecs::ParentA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] - ConstantSpecs::ContainerA::ChildA::CSL_CONST301 = :const301_5 - ConstantSpecs::ContainerA::ChildA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] - end - - it "searches a path in a module included in the immediate class before the superclass" do - ConstantSpecs::ParentB::CSL_CONST302 = :const302_1 - ConstantSpecs::ModuleF::CSL_CONST302 = :const302_2 - ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST302).should == [__FILE__, __LINE__ - 1] - end - - it "searches a path in the superclass before a module included in the superclass" do - ConstantSpecs::ModuleE::CSL_CONST303 = :const303_1 - ConstantSpecs::ParentB::CSL_CONST303 = :const303_2 - ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST303).should == [__FILE__, __LINE__ - 1] - end - - it "searches a path in a module included in the superclass" do - ConstantSpecs::ModuleA::CSL_CONST304 = :const304_1 - ConstantSpecs::ModuleE::CSL_CONST304 = :const304_2 - ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST304).should == [__FILE__, __LINE__ - 1] - end - - it "searches a path in the superclass chain" do - ConstantSpecs::ModuleA::CSL_CONST305 = :const305 - ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST305).should == [__FILE__, __LINE__ - 1] - end - - it "returns path to a toplevel constant when the receiver is a Class" do - Object::CSL_CONST306 = :const306 - ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST306).should == [__FILE__, __LINE__ - 1] - end - - it "returns path to a toplevel constant when the receiver is a Module" do - Object::CSL_CONST308 = :const308 - ConstantSpecs.const_source_location(:CSL_CONST308).should == [__FILE__, __LINE__ - 1] - ConstantSpecs::ModuleA.const_source_location(:CSL_CONST308).should == [__FILE__, __LINE__ - 2] - end + ConstantSpecs::ContainerA::ChildA::CSL_CONST301 = :const301_5 + ConstantSpecs::ContainerA::ChildA.const_source_location(:CSL_CONST301).should == [__FILE__, __LINE__ - 1] + end - it "returns path to the updated value of a constant" do - ConstantSpecs::ClassB::CSL_CONST309 = :const309_1 - ConstantSpecs::ClassB.const_source_location(:CSL_CONST309).should == [__FILE__, __LINE__ - 1] + it "searches a path in a module included in the immediate class before the superclass" do + ConstantSpecs::ParentB::CSL_CONST302 = :const302_1 + ConstantSpecs::ModuleF::CSL_CONST302 = :const302_2 + ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST302).should == [__FILE__, __LINE__ - 1] + end - -> { - ConstantSpecs::ClassB::CSL_CONST309 = :const309_2 - }.should complain(/already initialized constant/) - ConstantSpecs::ClassB.const_source_location(:CSL_CONST309).should == [__FILE__, __LINE__ - 2] - end + it "searches a path in the superclass before a module included in the superclass" do + ConstantSpecs::ModuleE::CSL_CONST303 = :const303_1 + ConstantSpecs::ParentB::CSL_CONST303 = :const303_2 + ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST303).should == [__FILE__, __LINE__ - 1] end - describe "with statically assigned constants" do - it "searches location path the immediate class or module first" do - ConstantSpecs::ClassA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ClassA::CS_CONST10_LINE] - ConstantSpecs::ModuleA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ModuleA::CS_CONST10_LINE] - ConstantSpecs::ParentA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST10_LINE] - ConstantSpecs::ContainerA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ContainerA::CS_CONST10_LINE] - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ContainerA::ChildA::CS_CONST10_LINE] - end + it "searches a path in a module included in the superclass" do + ConstantSpecs::ModuleA::CSL_CONST304 = :const304_1 + ConstantSpecs::ModuleE::CSL_CONST304 = :const304_2 + ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST304).should == [__FILE__, __LINE__ - 1] + end - it "searches location path a module included in the immediate class before the superclass" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST15).should == [@constants_fixture_path, ConstantSpecs::ModuleC::CS_CONST15_LINE] - end + it "searches a path in the superclass chain" do + ConstantSpecs::ModuleA::CSL_CONST305 = :const305 + ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST305).should == [__FILE__, __LINE__ - 1] + end - it "searches location path the superclass before a module included in the superclass" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST11).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST11_LINE] - end + it "returns path to a toplevel constant when the receiver is a Class" do + Object::CSL_CONST306 = :const306 + ConstantSpecs::ContainerB::ChildB.const_source_location(:CSL_CONST306).should == [__FILE__, __LINE__ - 1] + end - it "searches location path a module included in the superclass" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST12).should == [@constants_fixture_path, ConstantSpecs::ModuleB::CS_CONST12_LINE] - end + it "returns path to a toplevel constant when the receiver is a Module" do + Object::CSL_CONST308 = :const308 + ConstantSpecs.const_source_location(:CSL_CONST308).should == [__FILE__, __LINE__ - 1] + ConstantSpecs::ModuleA.const_source_location(:CSL_CONST308).should == [__FILE__, __LINE__ - 2] + end - it "searches location path the superclass chain" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST13).should == [@constants_fixture_path, ConstantSpecs::ModuleA::CS_CONST13_LINE] - end + it "returns path to the updated value of a constant" do + ConstantSpecs::ClassB::CSL_CONST309 = :const309_1 + ConstantSpecs::ClassB.const_source_location(:CSL_CONST309).should == [__FILE__, __LINE__ - 1] - it "returns location path a toplevel constant when the receiver is a Class" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] - end + -> { + ConstantSpecs::ClassB::CSL_CONST309 = :const309_2 + }.should complain(/already initialized constant/) + ConstantSpecs::ClassB.const_source_location(:CSL_CONST309).should == [__FILE__, __LINE__ - 2] + end + end - it "returns location path a toplevel constant when the receiver is a Module" do - ConstantSpecs.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] - ConstantSpecs::ModuleA.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] - end + describe "with statically assigned constants" do + it "works for the module and class keywords" do + ConstantSpecs.const_source_location(:ModuleB).should == [@constants_fixture_path, ConstantSpecs::ModuleB::LINE] + ConstantSpecs.const_source_location(:ClassA).should == [@constants_fixture_path, ConstantSpecs::ClassA::LINE] end - it "return empty path if constant defined in C code" do - Object.const_source_location(:String).should == [] + it "searches location path the immediate class or module first" do + ConstantSpecs::ClassA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ClassA::CS_CONST10_LINE] + ConstantSpecs::ModuleA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ModuleA::CS_CONST10_LINE] + ConstantSpecs::ParentA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST10_LINE] + ConstantSpecs::ContainerA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ContainerA::CS_CONST10_LINE] + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST10).should == [@constants_fixture_path, ConstantSpecs::ContainerA::ChildA::CS_CONST10_LINE] end - it "accepts a String or Symbol name" do - Object.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] - Object.const_source_location("CS_CONST1").should == [@constants_fixture_path, CS_CONST1_LINE] + it "searches location path a module included in the immediate class before the superclass" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST15).should == [@constants_fixture_path, ConstantSpecs::ModuleC::CS_CONST15_LINE] end - it "returns nil if no constant is defined in the search path" do - ConstantSpecs.const_source_location(:CS_CONSTX).should == nil + it "searches location path the superclass before a module included in the superclass" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST11).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST11_LINE] end - it "raises a NameError if the name does not start with a capital letter" do - -> { ConstantSpecs.const_source_location "name" }.should raise_error(NameError) + it "searches location path a module included in the superclass" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST12).should == [@constants_fixture_path, ConstantSpecs::ModuleB::CS_CONST12_LINE] end - it "raises a NameError if the name starts with a non-alphabetic character" do - -> { ConstantSpecs.const_source_location "__CONSTX__" }.should raise_error(NameError) - -> { ConstantSpecs.const_source_location "@CS_CONST1" }.should raise_error(NameError) - -> { ConstantSpecs.const_source_location "!CS_CONST1" }.should raise_error(NameError) + it "searches location path the superclass chain" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST13).should == [@constants_fixture_path, ConstantSpecs::ModuleA::CS_CONST13_LINE] end - it "raises a NameError if the name contains non-alphabetic characters except '_'" do - Object.const_source_location("CS_CONST1").should == [@constants_fixture_path, CS_CONST1_LINE] - -> { ConstantSpecs.const_source_location "CS_CONST1=" }.should raise_error(NameError) - -> { ConstantSpecs.const_source_location "CS_CONST1?" }.should raise_error(NameError) + it "returns location path a toplevel constant when the receiver is a Class" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] end - it "calls #to_str to convert the given name to a String" do - name = mock("ClassA") - name.should_receive(:to_str).and_return("ClassA") - ConstantSpecs.const_source_location(name).should == [@constants_fixture_path, ConstantSpecs::ClassA::CS_CLASS_A_LINE] + it "returns location path a toplevel constant when the receiver is a Module" do + ConstantSpecs.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] + ConstantSpecs::ModuleA.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] end + end - it "raises a TypeError if conversion to a String by calling #to_str fails" do - name = mock('123') - -> { ConstantSpecs.const_source_location(name) }.should raise_error(TypeError) + it "return empty path if constant defined in C code" do + Object.const_source_location(:String).should == [] + end - name.should_receive(:to_str).and_return(123) - -> { ConstantSpecs.const_source_location(name) }.should raise_error(TypeError) - end + it "accepts a String or Symbol name" do + Object.const_source_location(:CS_CONST1).should == [@constants_fixture_path, CS_CONST1_LINE] + Object.const_source_location("CS_CONST1").should == [@constants_fixture_path, CS_CONST1_LINE] + end - it "does not search the singleton class of a Class or Module" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST14).should == nil - ConstantSpecs.const_source_location(:CS_CONST14).should == nil - end + it "returns nil if no constant is defined in the search path" do + ConstantSpecs.const_source_location(:CS_CONSTX).should == nil + end - it "does not search the containing scope" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST20).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST20_LINE] - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST5) == nil - end + it "raises a NameError if the name does not start with a capital letter" do + -> { ConstantSpecs.const_source_location "name" }.should raise_error(NameError) + end - it "returns nil if the constant is defined in the receiver's superclass and the inherit flag is false" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST4, false).should == nil - end + it "raises a NameError if the name starts with a non-alphabetic character" do + -> { ConstantSpecs.const_source_location "__CONSTX__" }.should raise_error(NameError) + -> { ConstantSpecs.const_source_location "@CS_CONST1" }.should raise_error(NameError) + -> { ConstantSpecs.const_source_location "!CS_CONST1" }.should raise_error(NameError) + end - it "searches into the receiver superclasses if the inherit flag is true" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST4, true).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST4_LINE] - end + it "raises a NameError if the name contains non-alphabetic characters except '_'" do + Object.const_source_location("CS_CONST1").should == [@constants_fixture_path, CS_CONST1_LINE] + -> { ConstantSpecs.const_source_location "CS_CONST1=" }.should raise_error(NameError) + -> { ConstantSpecs.const_source_location "CS_CONST1?" }.should raise_error(NameError) + end - it "returns nil when the receiver is a Module, the constant is defined at toplevel and the inherit flag is false" do - ConstantSpecs::ModuleA.const_source_location(:CS_CONST1, false).should == nil - end + it "calls #to_str to convert the given name to a String" do + name = mock("ClassA") + name.should_receive(:to_str).and_return("ClassA") + ConstantSpecs.const_source_location(name).should == [@constants_fixture_path, ConstantSpecs::ClassA::LINE] + end - it "returns nil when the receiver is a Class, the constant is defined at toplevel and the inherit flag is false" do - ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST1, false).should == nil - end + it "raises a TypeError if conversion to a String by calling #to_str fails" do + name = mock('123') + -> { ConstantSpecs.const_source_location(name) }.should raise_error(TypeError) - it "accepts a toplevel scope qualifier" do - ConstantSpecs.const_source_location("::CS_CONST1").should == [@constants_fixture_path, CS_CONST1_LINE] - end + name.should_receive(:to_str).and_return(123) + -> { ConstantSpecs.const_source_location(name) }.should raise_error(TypeError) + end - it "accepts a scoped constant name" do - ConstantSpecs.const_source_location("ClassA::CS_CONST10").should == [@constants_fixture_path, ConstantSpecs::ClassA::CS_CONST10_LINE] - end + it "does not search the singleton class of a Class or Module" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST14).should == nil + ConstantSpecs.const_source_location(:CS_CONST14).should == nil + end - it "raises a NameError if the name includes two successive scope separators" do - -> { ConstantSpecs.const_source_location("ClassA::::CS_CONST10") }.should raise_error(NameError) - end + it "does not search the containing scope" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST20).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST20_LINE] + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST5) == nil + end - it "raises a NameError if only '::' is passed" do - -> { ConstantSpecs.const_source_location("::") }.should raise_error(NameError) - end + it "returns nil if the constant is defined in the receiver's superclass and the inherit flag is false" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST4, false).should == nil + end + + it "searches into the receiver superclasses if the inherit flag is true" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST4, true).should == [@constants_fixture_path, ConstantSpecs::ParentA::CS_CONST4_LINE] + end - it "raises a NameError if a Symbol has a toplevel scope qualifier" do - -> { ConstantSpecs.const_source_location(:'::CS_CONST1') }.should raise_error(NameError) + it "returns nil when the receiver is a Module, the constant is defined at toplevel and the inherit flag is false" do + ConstantSpecs::ModuleA.const_source_location(:CS_CONST1, false).should == nil + end + + it "returns nil when the receiver is a Class, the constant is defined at toplevel and the inherit flag is false" do + ConstantSpecs::ContainerA::ChildA.const_source_location(:CS_CONST1, false).should == nil + end + + it "accepts a toplevel scope qualifier" do + ConstantSpecs.const_source_location("::CS_CONST1").should == [@constants_fixture_path, CS_CONST1_LINE] + end + + it "accepts a scoped constant name" do + ConstantSpecs.const_source_location("ClassA::CS_CONST10").should == [@constants_fixture_path, ConstantSpecs::ClassA::CS_CONST10_LINE] + end + + it "returns updated location from const_set" do + mod = Module.new + const_line = __LINE__ + 1 + mod.const_set :Foo, 1 + mod.const_source_location(:Foo).should == [__FILE__, const_line] + end + + it "raises a NameError if the name includes two successive scope separators" do + -> { ConstantSpecs.const_source_location("ClassA::::CS_CONST10") }.should raise_error(NameError) + end + + it "raises a NameError if only '::' is passed" do + -> { ConstantSpecs.const_source_location("::") }.should raise_error(NameError) + end + + it "raises a NameError if a Symbol has a toplevel scope qualifier" do + -> { ConstantSpecs.const_source_location(:'::CS_CONST1') }.should raise_error(NameError) + end + + it "raises a NameError if a Symbol is a scoped constant name" do + -> { ConstantSpecs.const_source_location(:'ClassA::CS_CONST10') }.should raise_error(NameError) + end + + it "does search private constants path" do + ConstantSpecs.const_source_location(:CS_PRIVATE).should == [@constants_fixture_path, ConstantSpecs::CS_PRIVATE_LINE] + end + + it "works for eval with a given line" do + c = Class.new do + eval('self::C = 1', nil, "foo", 100) end + c.const_source_location(:C).should == ["foo", 100] + end - it "raises a NameError if a Symbol is a scoped constant name" do - -> { ConstantSpecs.const_source_location(:'ClassA::CS_CONST10') }.should raise_error(NameError) + context 'autoload' do + before :all do + ConstantSpecs.autoload :CSL_CONST1, "#{__dir__}/notexisting.rb" + @line = __LINE__ - 1 end - it "does search private constants path" do - ConstantSpecs.const_source_location(:CS_PRIVATE).should == [@constants_fixture_path, ConstantSpecs::CS_PRIVATE_LINE] + it 'returns the autoload location while not resolved' do + ConstantSpecs.const_source_location('CSL_CONST1').should == [__FILE__, @line] end - context 'autoload' do - before :all do - ConstantSpecs.autoload :CSL_CONST1, "#{__dir__}/notexisting.rb" - @line = __LINE__ - 1 - end + it 'returns where the constant was resolved when resolved' do + file = fixture(__FILE__, 'autoload_location.rb') + ConstantSpecs.autoload :CONST_LOCATION, file + line = ConstantSpecs::CONST_LOCATION + ConstantSpecs.const_source_location('CONST_LOCATION').should == [file, line] + end - it 'returns the autoload location while not resolved' do - ConstantSpecs.const_source_location('CSL_CONST1').should == [__FILE__, @line] - end + ruby_bug("#20188", ""..."3.4") do + it 'returns the real constant location as soon as it is defined' do + file = fixture(__FILE__, 'autoload_const_source_location.rb') + ConstantSpecs.autoload :ConstSource, file + autoload_location = [__FILE__, __LINE__ - 1] - it 'returns where the constant was resolved when resolved' do - file = fixture(__FILE__, 'autoload_location.rb') - ConstantSpecs.autoload :CONST_LOCATION, file - line = ConstantSpecs::CONST_LOCATION - ConstantSpecs.const_source_location('CONST_LOCATION').should == [file, line] + ConstantSpecs.const_source_location(:ConstSource).should == autoload_location + ConstantSpecs::ConstSource::LOCATION.should == ConstantSpecs.const_source_location(:ConstSource) + ConstantSpecs::BEFORE_DEFINE_LOCATION.should == autoload_location end end end diff --git a/spec/ruby/core/module/constants_spec.rb b/spec/ruby/core/module/constants_spec.rb index fe95143872..330da1cc88 100644 --- a/spec/ruby/core/module/constants_spec.rb +++ b/spec/ruby/core/module/constants_spec.rb @@ -74,6 +74,12 @@ describe "Module#constants" do it "returns only public constants" do ModuleSpecs::PrivConstModule.constants.should == [:PUBLIC_CONSTANT] end + + it "returns only constants starting with an uppercase letter" do + # e.g. fatal, IO::generic_readable and IO::generic_writable should not be returned by Module#constants + Object.constants.each { |c| c[0].should == c[0].upcase } + IO.constants.each { |c| c[0].should == c[0].upcase } + end end describe "Module#constants" do diff --git a/spec/ruby/core/module/define_method_spec.rb b/spec/ruby/core/module/define_method_spec.rb index 0cb2ab140c..e04bb87ceb 100644 --- a/spec/ruby/core/module/define_method_spec.rb +++ b/spec/ruby/core/module/define_method_spec.rb @@ -133,6 +133,17 @@ describe "Module#define_method when name is not a special private name" do klass.should have_public_instance_method(:baz) end end + + it "sets the method owner for a dynamically added method with a different original owner" do + mixin_module = Module.new do + def bar; end + end + + foo = Object.new + foo.singleton_class.define_method(:bar, mixin_module.instance_method(:bar)) + + foo.method(:bar).owner.should == foo.singleton_class + end end describe "passed a block" do @@ -219,18 +230,55 @@ describe "Module#define_method" do o.block_test2.should == o end + it "raises TypeError if name cannot converted to String" do + -> { + Class.new { define_method(1001, -> {}) } + }.should raise_error(TypeError, /is not a symbol nor a string/) + + -> { + Class.new { define_method([], -> {}) } + }.should raise_error(TypeError, /is not a symbol nor a string/) + end + + it "converts non-String name to String with #to_str" do + obj = Object.new + def obj.to_str() "foo" end + + new_class = Class.new { define_method(obj, -> { :called }) } + new_class.new.foo.should == :called + end + + it "raises TypeError when #to_str called on non-String name returns non-String value" do + obj = Object.new + def obj.to_str() [] end + + -> { + Class.new { define_method(obj, -> {}) } + }.should raise_error(TypeError, /can't convert Object to String/) + end + it "raises a TypeError when the given method is no Method/Proc" do -> { Class.new { define_method(:test, "self") } - }.should raise_error(TypeError) + }.should raise_error(TypeError, "wrong argument type String (expected Proc/Method/UnboundMethod)") -> { Class.new { define_method(:test, 1234) } - }.should raise_error(TypeError) + }.should raise_error(TypeError, "wrong argument type Integer (expected Proc/Method/UnboundMethod)") -> { Class.new { define_method(:test, nil) } - }.should raise_error(TypeError) + }.should raise_error(TypeError, "wrong argument type NilClass (expected Proc/Method/UnboundMethod)") + end + + it "uses provided Method/Proc even if block is specified" do + new_class = Class.new do + define_method(:test, -> { :method_is_called }) do + :block_is_called + end + end + + new_class.new.test.should == :method_is_called end it "raises an ArgumentError when no block is given" do @@ -350,6 +398,14 @@ describe "Module#define_method" do object2.other_cool_method.should == "data is foo" end + it "accepts a proc from a Symbol" do + symbol_proc = :+.to_proc + klass = Class.new do + define_method :foo, &symbol_proc + end + klass.new.foo(1, 2).should == 3 + end + it "maintains the Proc's scope" do class DefineMethodByProcClass in_scope = true @@ -443,6 +499,33 @@ describe "Module#define_method" do Class.new { define_method :bar, m } }.should raise_error(TypeError, /can't bind singleton method to a different class/) end + + it "defines a new method with public visibility when a Method passed and the class/module of the context isn't equal to the receiver of #define_method" do + c = Class.new do + private def foo + "public" + end + end + + object = c.new + object.singleton_class.define_method(:bar, object.method(:foo)) + + object.bar.should == "public" + end + + it "defines the new method according to the scope visibility when a Method passed and the class/module of the context is equal to the receiver of #define_method" do + c = Class.new do + def foo; end + end + + object = c.new + object.singleton_class.class_eval do + private + define_method(:bar, c.new.method(:foo)) + end + + -> { object.bar }.should raise_error(NoMethodError) + end end describe "Module#define_method" do @@ -641,7 +724,7 @@ describe "Module#define_method" do end end -describe "Method#define_method when passed a Method object" do +describe "Module#define_method when passed a Method object" do before :each do @klass = Class.new do def m(a, b, *c) @@ -666,7 +749,7 @@ describe "Method#define_method when passed a Method object" do end end -describe "Method#define_method when passed an UnboundMethod object" do +describe "Module#define_method when passed an UnboundMethod object" do before :each do @klass = Class.new do def m(a, b, *c) @@ -691,7 +774,7 @@ describe "Method#define_method when passed an UnboundMethod object" do end end -describe "Method#define_method when passed a Proc object" do +describe "Module#define_method when passed a Proc object" do describe "and a method is defined inside" do it "defines the nested method in the default definee where the Proc was created" do prc = nil @@ -715,3 +798,46 @@ describe "Method#define_method when passed a Proc object" do end end end + +describe "Module#define_method when passed a block" do + describe "behaves exactly like a lambda" do + it "for return" do + Class.new do + define_method(:foo) do + return 42 + end + end.new.foo.should == 42 + end + + it "for break" do + Class.new do + define_method(:foo) do + break 42 + end + end.new.foo.should == 42 + end + + it "for next" do + Class.new do + define_method(:foo) do + next 42 + end + end.new.foo.should == 42 + end + + it "for redo" do + Class.new do + result = [] + define_method(:foo) do + if result.empty? + result << :first + redo + else + result << :second + result + end + end + end.new.foo.should == [:first, :second] + end + end +end diff --git a/spec/ruby/core/module/deprecate_constant_spec.rb b/spec/ruby/core/module/deprecate_constant_spec.rb index 7bcced981b..aabef934c4 100644 --- a/spec/ruby/core/module/deprecate_constant_spec.rb +++ b/spec/ruby/core/module/deprecate_constant_spec.rb @@ -9,7 +9,6 @@ describe "Module#deprecate_constant" do @module::PRIVATE = @value @module.private_constant :PRIVATE @module.deprecate_constant :PRIVATE - @pattern = /deprecated/ end describe "when accessing the deprecated module" do @@ -19,7 +18,7 @@ describe "Module#deprecate_constant" do value = nil -> { value = @module::PUBLIC1 - }.should complain(@pattern) + }.should complain(/warning: constant .+::PUBLIC1 is deprecated/) value.should equal(@value) -> { @module::PRIVATE }.should raise_error(NameError) @@ -28,16 +27,28 @@ describe "Module#deprecate_constant" do it "warns with a message" do @module.deprecate_constant :PUBLIC1 - -> { @module::PUBLIC1 }.should complain(@pattern) - -> { @module.const_get :PRIVATE }.should complain(@pattern) + -> { @module::PUBLIC1 }.should complain(/warning: constant .+::PUBLIC1 is deprecated/) + -> { @module.const_get :PRIVATE }.should complain(/warning: constant .+::PRIVATE is deprecated/) + end + + it "does not warn if Warning[:deprecated] is false" do + @module.deprecate_constant :PUBLIC1 + + deprecated = Warning[:deprecated] + begin + Warning[:deprecated] = false + -> { @module::PUBLIC1 }.should_not complain + ensure + Warning[:deprecated] = deprecated + end end end it "accepts multiple symbols and strings as constant names" do @module.deprecate_constant "PUBLIC1", :PUBLIC2 - -> { @module::PUBLIC1 }.should complain(@pattern) - -> { @module::PUBLIC2 }.should complain(@pattern) + -> { @module::PUBLIC1 }.should complain(/warning: constant .+::PUBLIC1 is deprecated/) + -> { @module::PUBLIC2 }.should complain(/warning: constant .+::PUBLIC2 is deprecated/) end it "returns self" do diff --git a/spec/ruby/core/module/extend_object_spec.rb b/spec/ruby/core/module/extend_object_spec.rb index e66b87efef..1fd1abc0b5 100644 --- a/spec/ruby/core/module/extend_object_spec.rb +++ b/spec/ruby/core/module/extend_object_spec.rb @@ -42,20 +42,6 @@ describe "Module#extend_object" do ScratchPad.recorded.should == :extended end - ruby_version_is ''...'2.7' do - it "does not copy own tainted status to the given object" do - other = Object.new - Module.new.taint.send :extend_object, other - other.tainted?.should be_false - end - - it "does not copy own untrusted status to the given object" do - other = Object.new - Module.new.untrust.send :extend_object, other - other.untrusted?.should be_false - end - end - describe "when given a frozen object" do before :each do @receiver = Module.new diff --git a/spec/ruby/core/module/fixtures/autoload_const_source_location.rb b/spec/ruby/core/module/fixtures/autoload_const_source_location.rb new file mode 100644 index 0000000000..ee0e5a689f --- /dev/null +++ b/spec/ruby/core/module/fixtures/autoload_const_source_location.rb @@ -0,0 +1,6 @@ +module ConstantSpecs + BEFORE_DEFINE_LOCATION = const_source_location(:ConstSource) + module ConstSource + LOCATION = Object.const_source_location(name) + end +end diff --git a/spec/ruby/core/module/fixtures/autoload_during_autoload_after_define.rb b/spec/ruby/core/module/fixtures/autoload_during_autoload_after_define.rb new file mode 100644 index 0000000000..a9d886dfd6 --- /dev/null +++ b/spec/ruby/core/module/fixtures/autoload_during_autoload_after_define.rb @@ -0,0 +1,6 @@ +module ModuleSpecs::Autoload + class DuringAutoloadAfterDefine + block = ScratchPad.recorded + ScratchPad.record(block.call) + end +end diff --git a/spec/ruby/core/module/fixtures/classes.rb b/spec/ruby/core/module/fixtures/classes.rb index 40777cdbbd..a434e7b0b8 100644 --- a/spec/ruby/core/module/fixtures/classes.rb +++ b/spec/ruby/core/module/fixtures/classes.rb @@ -42,6 +42,14 @@ module ModuleSpecs class LookupChild < Lookup end + module ModuleWithPrepend + prepend LookupMod + end + + class WithPrependedModule + include ModuleWithPrepend + end + class Parent # For private_class_method spec def self.private_method; end @@ -352,6 +360,10 @@ module ModuleSpecs end end + class SubCVars < CVars + @@sub = :sub + end + module MVars @@mvar = :mvar end @@ -376,6 +388,7 @@ module ModuleSpecs # empty modules module M1; end module M2; end + module M3; end module Autoload def self.use_ex1 @@ -583,6 +596,32 @@ module ModuleSpecs private :foo end EmptyFooMethod = m.instance_method(:foo) + + # for undefined_instance_methods spec + module UndefinedInstanceMethods + module Super + def super_included_method; end + end + + class Parent + def undefed_method; end + undef_method :undefed_method + + def parent_method; end + def another_parent_method; end + end + + class Child < Parent + include Super + + undef_method :parent_method + undef_method :another_parent_method + end + + class Grandchild < Child + undef_method :super_included_method + end + end end class Object diff --git a/spec/ruby/core/module/fixtures/module.rb b/spec/ruby/core/module/fixtures/module.rb index 9050a272ec..34543ca2b4 100644 --- a/spec/ruby/core/module/fixtures/module.rb +++ b/spec/ruby/core/module/fixtures/module.rb @@ -1,4 +1,8 @@ module ModuleSpecs module Anonymous + module Child + end + + SameChild = Child end end diff --git a/spec/ruby/core/module/include_spec.rb b/spec/ruby/core/module/include_spec.rb index 128b9af2bf..c073bc31ca 100644 --- a/spec/ruby/core/module/include_spec.rb +++ b/spec/ruby/core/module/include_spec.rb @@ -104,9 +104,9 @@ describe "Module#include" do class A; include M; end class B < A; include M; end - all = [A,B,M] + all = [A, B, M] - (B.ancestors & all).should == [B, A, M] + (B.ancestors.filter { |a| all.include?(a) }).should == [B, A, M] end end @@ -532,6 +532,27 @@ describe "Module#include" do B.foo.should == 'n' end end + + it "overrides a previous super method call" do + c1 = Class.new do + def foo + [:c1] + end + end + c2 = Class.new(c1) do + def foo + [:c2] + super + end + end + c2.new.foo.should == [:c2, :c1] + m = Module.new do + def foo + [:m1] + end + end + c2.include(m) + c2.new.foo.should == [:c2, :m1] + end end describe "Module#include?" do diff --git a/spec/ruby/core/module/included_modules_spec.rb b/spec/ruby/core/module/included_modules_spec.rb index 40e20953f4..ce94ed1285 100644 --- a/spec/ruby/core/module/included_modules_spec.rb +++ b/spec/ruby/core/module/included_modules_spec.rb @@ -4,9 +4,11 @@ require_relative 'fixtures/classes' describe "Module#included_modules" do it "returns a list of modules included in self" do ModuleSpecs.included_modules.should == [] + ModuleSpecs::Child.included_modules.should include(ModuleSpecs::Super, ModuleSpecs::Basic, Kernel) ModuleSpecs::Parent.included_modules.should include(Kernel) ModuleSpecs::Basic.included_modules.should == [] ModuleSpecs::Super.included_modules.should include(ModuleSpecs::Basic) + ModuleSpecs::WithPrependedModule.included_modules.should include(ModuleSpecs::ModuleWithPrepend) end end diff --git a/spec/ruby/core/module/instance_method_spec.rb b/spec/ruby/core/module/instance_method_spec.rb index b4d6a0d8c8..8d006e647e 100644 --- a/spec/ruby/core/module/instance_method_spec.rb +++ b/spec/ruby/core/module/instance_method_spec.rb @@ -45,20 +45,46 @@ describe "Module#instance_method" do @parent_um.inspect.should =~ /\bModuleSpecs::InstanceMeth\b/ @child_um.inspect.should =~ /\bfoo\b/ @child_um.inspect.should =~ /\bModuleSpecs::InstanceMeth\b/ - @child_um.inspect.should =~ /\bModuleSpecs::InstanceMethChild\b/ + @mod_um.inspect.should =~ /\bbar\b/ @mod_um.inspect.should =~ /\bModuleSpecs::InstanceMethMod\b/ - @mod_um.inspect.should =~ /\bModuleSpecs::InstanceMethChild\b/ + + ruby_version_is ""..."3.2" do + @child_um.inspect.should =~ /\bModuleSpecs::InstanceMethChild\b/ + @mod_um.inspect.should =~ /\bModuleSpecs::InstanceMethChild\b/ + end end - it "raises a TypeError if not passed a symbol" do - -> { Object.instance_method([]) }.should raise_error(TypeError) - -> { Object.instance_method(0) }.should raise_error(TypeError) + it "raises a TypeError if the given name is not a String/Symbol" do + -> { Object.instance_method([]) }.should raise_error(TypeError, /is not a symbol nor a string/) + -> { Object.instance_method(0) }.should raise_error(TypeError, /is not a symbol nor a string/) + -> { Object.instance_method(nil) }.should raise_error(TypeError, /is not a symbol nor a string/) + -> { Object.instance_method(mock('x')) }.should raise_error(TypeError, /is not a symbol nor a string/) end - it "raises a TypeError if the given name is not a string/symbol" do - -> { Object.instance_method(nil) }.should raise_error(TypeError) - -> { Object.instance_method(mock('x')) }.should raise_error(TypeError) + it "accepts String name argument" do + method = ModuleSpecs::InstanceMeth.instance_method(:foo) + method.should be_kind_of(UnboundMethod) + end + + it "accepts Symbol name argument" do + method = ModuleSpecs::InstanceMeth.instance_method("foo") + method.should be_kind_of(UnboundMethod) + end + + it "converts non-String name by calling #to_str method" do + obj = Object.new + def obj.to_str() "foo" end + + method = ModuleSpecs::InstanceMeth.instance_method(obj) + method.should be_kind_of(UnboundMethod) + end + + it "raises TypeError when passed non-String name and #to_str returns non-String value" do + obj = Object.new + def obj.to_str() [] end + + -> { ModuleSpecs::InstanceMeth.instance_method(obj) }.should raise_error(TypeError, /can't convert Object to String/) end it "raises a NameError if the method has been undefined" do diff --git a/spec/ruby/core/module/method_added_spec.rb b/spec/ruby/core/module/method_added_spec.rb index b983c8da76..ec92cddc1e 100644 --- a/spec/ruby/core/module/method_added_spec.rb +++ b/spec/ruby/core/module/method_added_spec.rb @@ -2,6 +2,10 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "Module#method_added" do + before :each do + ScratchPad.record [] + end + it "is a private instance method" do Module.should have_private_instance_method(:method_added) end @@ -13,8 +17,6 @@ describe "Module#method_added" do end it "is called when a new instance method is defined in self" do - ScratchPad.record [] - Module.new do def self.method_added(name) ScratchPad << name @@ -32,8 +34,6 @@ describe "Module#method_added" do it "is not called when a singleton method is added" do # obj.singleton_method_added is called instead - ScratchPad.record [] - klass = Class.new def klass.method_added(name) ScratchPad << name @@ -60,8 +60,71 @@ describe "Module#method_added" do m.should_not have_method(:method_to_undef) end + it "is not called when a method changes visibility" do + Module.new do + def public_method + end + + def private_method + end + + def self.method_added(name) + ScratchPad << name + end + + public :public_method + private :public_method + + private :private_method + public :private_method + end + + ScratchPad.recorded.should == [] + end + + it "is called when using #private in a subclass" do + parent = Class.new do + def foo + end + end + + Class.new(parent) do + def self.method_added(name) + ScratchPad << name + end + + # Create an instance as that might initialize some method lookup caches, which is interesting to test + self.new.foo + + private :foo + public :foo + end + + ScratchPad.recorded.should == [:foo] + end + + it "is not called when a method is copied via module_function, rather #singleton_method_added is called" do + Module.new do + def mod_function + end + + def self.method_added(name) + ScratchPad << [:method_added, name] + end + + def self.singleton_method_added(name) + ScratchPad << [:singleton_method_added, name] + end + + ScratchPad.record [] + + module_function :mod_function + end + + ScratchPad.recorded.should == [[:singleton_method_added, :mod_function]] + end + it "is called with a precise caller location with the line of the 'def'" do - ScratchPad.record [] line = nil Module.new do diff --git a/spec/ruby/core/module/module_function_spec.rb b/spec/ruby/core/module/module_function_spec.rb index 407237d48f..1c3ec5471b 100644 --- a/spec/ruby/core/module/module_function_spec.rb +++ b/spec/ruby/core/module/module_function_spec.rb @@ -38,14 +38,23 @@ describe "Module#module_function with specific method names" do m.respond_to?(:test3).should == false end - it "returns the current module" do - x = nil - m = Module.new do - def test() end - x = module_function :test + ruby_version_is ""..."3.1" do + it "returns self" do + Module.new do + def foo; end + module_function(:foo).should equal(self) + end end + end - x.should == m + ruby_version_is "3.1" do + it "returns argument or arguments if given" do + Module.new do + def foo; end + module_function(:foo).should equal(:foo) + module_function(:foo, :foo).should == [:foo, :foo] + end + end end it "creates an independent copy of the method, not a redirect" do @@ -146,38 +155,92 @@ describe "Module#module_function with specific method names" do m.foo.should == ["m", "super_m"] end + + context "methods created with define_method" do + context "passed a block" do + it "creates duplicates of the given instance methods" do + m = Module.new do + define_method :test1 do; end + module_function :test1 + end + + m.respond_to?(:test1).should == true + end + end + + context "passed a method" do + it "creates duplicates of the given instance methods" do + module_with_method = Module.new do + def test1; end + end + + c = Class.new do + extend module_with_method + end + + m = Module.new do + define_method :test2, c.method(:test1) + module_function :test2 + end + + m.respond_to?(:test2).should == true + end + end + + context "passed an unbound method" do + it "creates duplicates of the given instance methods" do + module_with_method = Module.new do + def test1; end + end + + m = Module.new do + define_method :test2, module_with_method.instance_method(:test1) + module_function :test2 + end + + m.respond_to?(:test2).should == true + end + end + end end describe "Module#module_function as a toggle (no arguments) in a Module body" do it "makes any subsequently defined methods module functions with the normal semantics" do - m = Module.new { + m = Module.new do module_function def test1() end def test2() end - } + end m.respond_to?(:test1).should == true m.respond_to?(:test2).should == true end - it "returns the current module" do - x = nil - m = Module.new { - x = module_function - } + ruby_version_is ""..."3.1" do + it "returns self" do + Module.new do + module_function.should equal(self) + end + end + end - x.should == m + ruby_version_is "3.1" do + it "returns nil" do + Module.new do + module_function.should equal(nil) + end + end end it "stops creating module functions if the body encounters another toggle " \ "like public/protected/private without arguments" do - m = Module.new { + m = Module.new do module_function def test1() end def test2() end public def test3() end - } + end m.respond_to?(:test1).should == true m.respond_to?(:test2).should == true @@ -186,14 +249,14 @@ describe "Module#module_function as a toggle (no arguments) in a Module body" do it "does not stop creating module functions if the body encounters " \ "public/protected/private WITH arguments" do - m = Module.new { + m = Module.new do def foo() end module_function def test1() end def test2() end public :foo def test3() end - } + end m.respond_to?(:test1).should == true m.respond_to?(:test2).should == true @@ -201,69 +264,116 @@ describe "Module#module_function as a toggle (no arguments) in a Module body" do end it "does not affect module_evaled method definitions also if outside the eval itself" do - m = Module.new { + m = Module.new do module_function module_eval { def test1() end } module_eval " def test2() end " - } + end m.respond_to?(:test1).should == false m.respond_to?(:test2).should == false end it "has no effect if inside a module_eval if the definitions are outside of it" do - m = Module.new { + m = Module.new do module_eval { module_function } def test1() end def test2() end - } + end m.respond_to?(:test1).should == false m.respond_to?(:test2).should == false end it "functions normally if both toggle and definitions inside a module_eval" do - m = Module.new { - module_eval { + m = Module.new do + module_eval do module_function def test1() end def test2() end - } - } + end + end m.respond_to?(:test1).should == true m.respond_to?(:test2).should == true end - it "affects evaled method definitions also even when outside the eval itself" do - m = Module.new { + it "affects eval'ed method definitions also even when outside the eval itself" do + m = Module.new do module_function eval "def test1() end" - } + end m.respond_to?(:test1).should == true end it "doesn't affect definitions when inside an eval even if the definitions are outside of it" do - m = Module.new { + m = Module.new do eval "module_function" def test1() end - } + end m.respond_to?(:test1).should == false end it "functions normally if both toggle and definitions inside a eval" do - m = Module.new { + m = Module.new do eval <<-CODE module_function def test1() end def test2() end CODE - } + end m.respond_to?(:test1).should == true m.respond_to?(:test2).should == true end + + context "methods are defined with define_method" do + context "passed a block" do + it "makes any subsequently defined methods module functions with the normal semantics" do + m = Module.new do + module_function + define_method :test1 do; end + end + + m.respond_to?(:test1).should == true + end + end + + context "passed a method" do + it "makes any subsequently defined methods module functions with the normal semantics" do + module_with_method = Module.new do + def test1; end + end + + c = Class.new do + extend module_with_method + end + + m = Module.new do + module_function + define_method :test2, c.method(:test1) + end + + m.respond_to?(:test2).should == true + end + end + + context "passed an unbound method" do + it "makes any subsequently defined methods module functions with the normal semantics" do + module_with_method = Module.new do + def test1; end + end + + m = Module.new do + module_function + define_method :test2, module_with_method.instance_method(:test1) + end + + m.respond_to?(:test2).should == true + end + end + end end diff --git a/spec/ruby/core/module/name_spec.rb b/spec/ruby/core/module/name_spec.rb index ca9106a973..0d1f4e24d5 100644 --- a/spec/ruby/core/module/name_spec.rb +++ b/spec/ruby/core/module/name_spec.rb @@ -6,20 +6,10 @@ describe "Module#name" do Module.new.name.should be_nil end - ruby_version_is ""..."3.0" do - it "is nil when assigned to a constant in an anonymous module" do - m = Module.new - m::N = Module.new - m::N.name.should be_nil - end - end - - ruby_version_is "3.0" do - it "is not nil when assigned to a constant in an anonymous module" do - m = Module.new - m::N = Module.new - m::N.name.should.end_with? '::N' - end + it "is not nil when assigned to a constant in an anonymous module" do + m = Module.new + m::N = Module.new + m::N.name.should.end_with? '::N' end it "is not nil for a nested module created with the module keyword" do @@ -42,6 +32,19 @@ describe "Module#name" do m::N.name.should == "ModuleSpecs::Anonymous::WasAnnon" end + it "may be the repeated in different module objects" do + m = Module.new + n = Module.new + + suppress_warning do + ModuleSpecs::Anonymous::SameName = m + ModuleSpecs::Anonymous::SameName = n + end + + m.name.should == "ModuleSpecs::Anonymous::SameName" + n.name.should == "ModuleSpecs::Anonymous::SameName" + end + it "is set after it is removed from a constant" do module ModuleSpecs module ModuleToRemove @@ -69,12 +72,18 @@ describe "Module#name" do ModuleSpecs::Anonymous.name.should == "ModuleSpecs::Anonymous" end - it "is set when assigning to a constant" do + it "is set when assigning to a constant (constant path matches outer module name)" do m = Module.new ModuleSpecs::Anonymous::A = m m.name.should == "ModuleSpecs::Anonymous::A" end + it "is set when assigning to a constant (constant path does not match outer module name)" do + m = Module.new + ModuleSpecs::Anonymous::SameChild::A = m + m.name.should == "ModuleSpecs::Anonymous::Child::A" + end + it "is not modified when assigning to a new constant after it has been accessed" do m = Module.new ModuleSpecs::Anonymous::B = m @@ -111,34 +120,33 @@ describe "Module#name" do ModuleSpecs::NameEncoding.new.name.encoding.should == Encoding::UTF_8 end - it "is set when the anonymous outer module name is set" do + it "is set when the anonymous outer module name is set (module in one single constant)" do m = Module.new m::N = Module.new ModuleSpecs::Anonymous::E = m m::N.name.should == "ModuleSpecs::Anonymous::E::N" end - ruby_version_is ""..."2.7" do - it "returns a mutable string" do - ModuleSpecs.name.frozen?.should be_false - end - - it "returns a mutable string that when mutated does not modify the original module name" do - ModuleSpecs.name << "foo" - - ModuleSpecs.name.should == "ModuleSpecs" - end + # https://bugs.ruby-lang.org/issues/19681 + it "is set when the anonymous outer module name is set (module in several constants)" do + m = Module.new + m::N = Module.new + m::O = m::N + ModuleSpecs::Anonymous::StoredInMultiplePlaces = m + valid_names = [ + "ModuleSpecs::Anonymous::StoredInMultiplePlaces::N", + "ModuleSpecs::Anonymous::StoredInMultiplePlaces::O" + ] + valid_names.should include(m::N.name) # You get one of the two, but you don't know which one. end - ruby_version_is "2.7" do - it "returns a frozen String" do - ModuleSpecs.name.should.frozen? - end + it "returns a frozen String" do + ModuleSpecs.name.should.frozen? + end - it "always returns the same String for a given Module" do - s1 = ModuleSpecs.name - s2 = ModuleSpecs.name - s1.should equal(s2) - end + it "always returns the same String for a given Module" do + s1 = ModuleSpecs.name + s2 = ModuleSpecs.name + s1.should equal(s2) end end diff --git a/spec/ruby/core/module/prepend_features_spec.rb b/spec/ruby/core/module/prepend_features_spec.rb index 2d1fa713b7..09c15c5c15 100644 --- a/spec/ruby/core/module/prepend_features_spec.rb +++ b/spec/ruby/core/module/prepend_features_spec.rb @@ -28,20 +28,6 @@ describe "Module#prepend_features" do }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "copies own tainted status to the given module" do - other = Module.new - Module.new.taint.send :prepend_features, other - other.tainted?.should be_true - end - - it "copies own untrusted status to the given module" do - other = Module.new - Module.new.untrust.send :prepend_features, other - other.untrusted?.should be_true - end - end - it "clears caches of the given module" do parent = Class.new do def bar; :bar; end diff --git a/spec/ruby/core/module/prepend_spec.rb b/spec/ruby/core/module/prepend_spec.rb index 04cc27d472..c90fa9700e 100644 --- a/spec/ruby/core/module/prepend_spec.rb +++ b/spec/ruby/core/module/prepend_spec.rb @@ -499,34 +499,17 @@ describe "Module#prepend" do c.dup.new.should be_kind_of(m) end - ruby_version_is '0'...'3.0' do - it "keeps the module in the chain when dupping an intermediate module" do - m1 = Module.new { def calc(x) x end } - m2 = Module.new { prepend(m1) } - c1 = Class.new { prepend(m2) } - m2dup = m2.dup - m2dup.ancestors.should == [m2dup,m1,m2] - c2 = Class.new { prepend(m2dup) } - c1.ancestors[0,3].should == [m1,m2,c1] - c1.new.should be_kind_of(m1) - c2.ancestors[0,4].should == [m2dup,m1,m2,c2] - c2.new.should be_kind_of(m1) - end - end - - ruby_version_is '3.0' do - it "uses only new module when dupping the module" do - m1 = Module.new { def calc(x) x end } - m2 = Module.new { prepend(m1) } - c1 = Class.new { prepend(m2) } - m2dup = m2.dup - m2dup.ancestors.should == [m1,m2dup] - c2 = Class.new { prepend(m2dup) } - c1.ancestors[0,3].should == [m1,m2,c1] - c1.new.should be_kind_of(m1) - c2.ancestors[0,3].should == [m1,m2dup,c2] - c2.new.should be_kind_of(m1) - end + it "uses only new module when dupping the module" do + m1 = Module.new { def calc(x) x end } + m2 = Module.new { prepend(m1) } + c1 = Class.new { prepend(m2) } + m2dup = m2.dup + m2dup.ancestors.should == [m1,m2dup] + c2 = Class.new { prepend(m2dup) } + c1.ancestors[0,3].should == [m1,m2,c1] + c1.new.should be_kind_of(m1) + c2.ancestors[0,3].should == [m1,m2dup,c2] + c2.new.should be_kind_of(m1) end it "depends on prepend_features to add the module" do @@ -611,6 +594,18 @@ describe "Module#prepend" do ScratchPad.recorded.should == [[:prepend_features, c], [:prepended, c]] end + it "prepends a module if it is included in a super class" do + module ModuleSpecs::M3 + module M; end + class A; include M; end + class B < A; prepend M; end + + all = [A, B, M] + + (B.ancestors.filter { |a| all.include?(a) }).should == [M, B, A, M] + end + end + it "detects cyclic prepends" do -> { module ModuleSpecs::P @@ -731,6 +726,50 @@ describe "Module#prepend" do ary.should == [3, 2, 1] end + it "does not prepend a second copy if the module already indirectly exists in the hierarchy" do + mod = Module.new do; end + submod = Module.new do; end + klass = Class.new do; end + klass.include(mod) + mod.prepend(submod) + klass.include(mod) + + klass.ancestors.take(4).should == [klass, submod, mod, Object] + end + + # https://bugs.ruby-lang.org/issues/17423 + describe "when module already exists in ancestor chain" do + ruby_version_is ""..."3.1" do + it "does not modify the ancestor chain" do + m = Module.new do; end + a = Module.new do; end + b = Class.new do; end + + b.include(a) + a.prepend(m) + b.ancestors.take(4).should == [b, m, a, Object] + + b.prepend(m) + b.ancestors.take(4).should == [b, m, a, Object] + end + end + + ruby_version_is "3.1" do + it "modifies the ancestor chain" do + m = Module.new do; end + a = Module.new do; end + b = Class.new do; end + + b.include(a) + a.prepend(m) + b.ancestors.take(4).should == [b, m, a, Object] + + b.prepend(m) + b.ancestors.take(5).should == [m, b, m, a, Object] + end + end + end + describe "called on a module" do describe "included into a class" it "does not obscure the module's methods from reflective access" do diff --git a/spec/ruby/core/module/private_class_method_spec.rb b/spec/ruby/core/module/private_class_method_spec.rb index e35b50d986..f899c71a57 100644 --- a/spec/ruby/core/module/private_class_method_spec.rb +++ b/spec/ruby/core/module/private_class_method_spec.rb @@ -78,4 +78,14 @@ describe "Module#private_class_method" do end end.should raise_error(NameError) end + + context "when single argument is passed and is an array" do + it "sets the visibility of the given methods to private" do + c = Class.new do + def self.foo() "foo" end + private_class_method [:foo] + end + -> { c.foo }.should raise_error(NoMethodError) + end + end end diff --git a/spec/ruby/core/module/private_spec.rb b/spec/ruby/core/module/private_spec.rb index e893c24f38..ead806637c 100644 --- a/spec/ruby/core/module/private_spec.rb +++ b/spec/ruby/core/module/private_spec.rb @@ -38,11 +38,25 @@ describe "Module#private" do :module_specs_public_method_on_object_for_kernel_private) end - it "returns self" do - (class << Object.new; self; end).class_eval do - def foo; end - private(:foo).should equal(self) - private.should equal(self) + ruby_version_is ""..."3.1" do + it "returns self" do + (class << Object.new; self; end).class_eval do + def foo; end + private(:foo).should equal(self) + private.should equal(self) + end + end + end + + ruby_version_is "3.1" do + it "returns argument or arguments if given" do + (class << Object.new; self; end).class_eval do + def foo; end + private(:foo).should equal(:foo) + private([:foo, :foo]).should == [:foo, :foo] + private(:foo, :foo).should == [:foo, :foo] + private.should equal(nil) + end end end diff --git a/spec/ruby/core/module/protected_spec.rb b/spec/ruby/core/module/protected_spec.rb index aa04a42fb8..058d49d751 100644 --- a/spec/ruby/core/module/protected_spec.rb +++ b/spec/ruby/core/module/protected_spec.rb @@ -39,11 +39,25 @@ describe "Module#protected" do :module_specs_public_method_on_object_for_kernel_protected) end - it "returns self" do - (class << Object.new; self; end).class_eval do - def foo; end - protected(:foo).should equal(self) - protected.should equal(self) + ruby_version_is ""..."3.1" do + it "returns self" do + (class << Object.new; self; end).class_eval do + def foo; end + protected(:foo).should equal(self) + protected.should equal(self) + end + end + end + + ruby_version_is "3.1" do + it "returns argument or arguments if given" do + (class << Object.new; self; end).class_eval do + def foo; end + protected(:foo).should equal(:foo) + protected([:foo, :foo]).should == [:foo, :foo] + protected(:foo, :foo).should == [:foo, :foo] + protected.should equal(nil) + end end end diff --git a/spec/ruby/core/module/public_class_method_spec.rb b/spec/ruby/core/module/public_class_method_spec.rb index c09cc64863..71b20acda5 100644 --- a/spec/ruby/core/module/public_class_method_spec.rb +++ b/spec/ruby/core/module/public_class_method_spec.rb @@ -77,4 +77,18 @@ describe "Module#public_class_method" do end end.should raise_error(NameError) end + + context "when single argument is passed and is an array" do + it "makes a class method public" do + c = Class.new do + class << self + private + def foo() "foo" end + end + public_class_method [:foo] + end + + c.foo.should == "foo" + end + end end diff --git a/spec/ruby/core/module/public_spec.rb b/spec/ruby/core/module/public_spec.rb index e7059f6aa6..e3b183f228 100644 --- a/spec/ruby/core/module/public_spec.rb +++ b/spec/ruby/core/module/public_spec.rb @@ -27,12 +27,25 @@ describe "Module#public" do :module_specs_private_method_on_object_for_kernel_public) end - it "returns self" do - (class << Object.new; self; end).class_eval do - def foo; end - private :foo - public(:foo).should equal(self) - public.should equal(self) + ruby_version_is ""..."3.1" do + it "returns self" do + (class << Object.new; self; end).class_eval do + def foo; end + public(:foo).should equal(self) + public.should equal(self) + end + end + end + + ruby_version_is "3.1" do + it "returns argument or arguments if given" do + (class << Object.new; self; end).class_eval do + def foo; end + public(:foo).should equal(:foo) + public([:foo, :foo]).should == [:foo, :foo] + public(:foo, :foo).should == [:foo, :foo] + public.should equal(nil) + end end end diff --git a/spec/ruby/core/module/refine_spec.rb b/spec/ruby/core/module/refine_spec.rb index e3b7fde049..11085c325b 100644 --- a/spec/ruby/core/module/refine_spec.rb +++ b/spec/ruby/core/module/refine_spec.rb @@ -71,7 +71,7 @@ describe "Module#refine" do Module.new do refine("foo") {} end - end.should raise_error(TypeError) + end.should raise_error(TypeError, "wrong argument type String (expected Class or Module)") end it "accepts a module as argument" do @@ -243,28 +243,30 @@ describe "Module#refine" do result.should == "foo from singleton class" end - it "looks in the included modules for builtin methods" do - result = ruby_exe(<<-RUBY) - a = Module.new do - def /(other) quo(other) end - end + ruby_version_is ""..."3.2" do + it "looks in the included modules for builtin methods" do + result = ruby_exe(<<-RUBY) + a = Module.new do + def /(other) quo(other) end + end - refinement = Module.new do - refine Integer do - include a + refinement = Module.new do + refine Integer do + include a + end end - end - result = nil - Module.new do - using refinement - result = 1 / 2 - end + result = nil + Module.new do + using refinement + result = 1 / 2 + end - print result.class - RUBY + print result.class + RUBY - result.should == 'Rational' + result.should == 'Rational' + end end it "looks in later included modules of the refined module first" do @@ -298,63 +300,65 @@ describe "Module#refine" do result.should == "foo from IncludeMeLater" end - it "looks in prepended modules from the refinement first" do - refined_class = ModuleSpecs.build_refined_class + ruby_version_is ""..."3.1" do + it "looks in prepended modules from the refinement first" do + refined_class = ModuleSpecs.build_refined_class - refinement = Module.new do - refine refined_class do - include ModuleSpecs::IncludedModule - prepend ModuleSpecs::PrependedModule + refinement = Module.new do + refine refined_class do + include ModuleSpecs::IncludedModule + prepend ModuleSpecs::PrependedModule - def foo; "foo from refinement"; end + def foo; "foo from refinement"; end + end end - end - result = nil - Module.new do - using refinement - result = refined_class.new.foo + result = nil + Module.new do + using refinement + result = refined_class.new.foo + end + + result.should == "foo from prepended module" end - result.should == "foo from prepended module" - end + it "looks in refinement then" do + refined_class = ModuleSpecs.build_refined_class - it "looks in refinement then" do - refined_class = ModuleSpecs.build_refined_class + refinement = Module.new do + refine(refined_class) do + include ModuleSpecs::IncludedModule - refinement = Module.new do - refine(refined_class) do - include ModuleSpecs::IncludedModule + def foo; "foo from refinement"; end + end + end - def foo; "foo from refinement"; end + result = nil + Module.new do + using refinement + result = refined_class.new.foo end - end - result = nil - Module.new do - using refinement - result = refined_class.new.foo + result.should == "foo from refinement" end - result.should == "foo from refinement" - end + it "looks in included modules from the refinement then" do + refined_class = ModuleSpecs.build_refined_class - it "looks in included modules from the refinement then" do - refined_class = ModuleSpecs.build_refined_class + refinement = Module.new do + refine refined_class do + include ModuleSpecs::IncludedModule + end + end - refinement = Module.new do - refine refined_class do - include ModuleSpecs::IncludedModule + result = nil + Module.new do + using refinement + result = refined_class.new.foo end - end - result = nil - Module.new do - using refinement - result = refined_class.new.foo + result.should == "foo from included module" end - - result.should == "foo from included module" end it "looks in the class then" do @@ -514,115 +518,55 @@ describe "Module#refine" do result.should == "hello from refinement" end - ruby_version_is "" ... "2.7" do - it "is not honored by Kernel#method" do - klass = Class.new - refinement = Module.new do - refine klass do - def foo; end - end + it "is honored by Kernel#method" do + klass = Class.new + refinement = Module.new do + refine klass do + def foo; end end - - -> { - Module.new do - using refinement - klass.new.method(:foo) - end - }.should raise_error(NameError, /undefined method `foo'/) end - end - - ruby_version_is "2.7" do - it "is honored by Kernel#method" do - klass = Class.new - refinement = Module.new do - refine klass do - def foo; end - end - end - result = nil - Module.new do - using refinement - result = klass.new.method(:foo).class - end - - result.should == Method + result = nil + Module.new do + using refinement + result = klass.new.method(:foo).class end - end - ruby_version_is "" ... "2.7" do - it "is not honored by Kernel#public_method" do - klass = Class.new - refinement = Module.new do - refine klass do - def foo; end - end - end - - -> { - Module.new do - using refinement - klass.new.public_method(:foo) - end - }.should raise_error(NameError, /undefined method `foo'/) - end + result.should == Method end - ruby_version_is "2.7" do - it "is honored by Kernel#public_method" do - klass = Class.new - refinement = Module.new do - refine klass do - def foo; end - end - end - - result = nil - Module.new do - using refinement - result = klass.new.public_method(:foo).class + it "is honored by Kernel#public_method" do + klass = Class.new + refinement = Module.new do + refine klass do + def foo; end end - - result.should == Method end - end - - ruby_version_is "" ... "2.7" do - it "is not honored by Kernel#instance_method" do - klass = Class.new - refinement = Module.new do - refine klass do - def foo; end - end - end - -> { - Module.new do - using refinement - klass.instance_method(:foo) - end - }.should raise_error(NameError, /undefined method `foo'/) + result = nil + Module.new do + using refinement + result = klass.new.public_method(:foo).class end - end - ruby_version_is "2.7" do - it "is honored by Kernel#instance_method" do - klass = Class.new - refinement = Module.new do - refine klass do - def foo; end - end - end + result.should == Method + end - result = nil - Module.new do - using refinement - result = klass.instance_method(:foo).class + it "is honored by Kernel#instance_method" do + klass = Class.new + refinement = Module.new do + refine klass do + def foo; end end + end - result.should == UnboundMethod + result = nil + Module.new do + using refinement + result = klass.instance_method(:foo).class end + + result.should == UnboundMethod end it "is honored by Kernel#respond_to?" do @@ -662,26 +606,28 @@ describe "Module#refine" do end context "when super is called in a refinement" do - it "looks in the included to refinery module" do - refined_class = ModuleSpecs.build_refined_class + ruby_version_is ""..."3.1" do + it "looks in the included to refinery module" do + refined_class = ModuleSpecs.build_refined_class - refinement = Module.new do - refine refined_class do - include ModuleSpecs::IncludedModule + refinement = Module.new do + refine refined_class do + include ModuleSpecs::IncludedModule - def foo - super + def foo + super + end end end - end - result = nil - Module.new do - using refinement - result = refined_class.new.foo - end + result = nil + Module.new do + using refinement + result = refined_class.new.foo + end - result.should == "foo from included module" + result.should == "foo from included module" + end end it "looks in the refined class" do @@ -704,55 +650,57 @@ describe "Module#refine" do result.should == "foo" end - it "looks in the refined class from included module" do - refined_class = ModuleSpecs.build_refined_class(for_super: true) + ruby_version_is ""..."3.1" do + it "looks in the refined class from included module" do + refined_class = ModuleSpecs.build_refined_class(for_super: true) - a = Module.new do - def foo - [:A] + super + a = Module.new do + def foo + [:A] + super + end end - end - refinement = Module.new do - refine refined_class do - include a + refinement = Module.new do + refine refined_class do + include a + end end - end - result = nil - Module.new do - using refinement + result = nil + Module.new do + using refinement - result = refined_class.new.foo - end + result = refined_class.new.foo + end - result.should == [:A, :C] - end + result.should == [:A, :C] + end - it "looks in the refined ancestors from included module" do - refined_class = ModuleSpecs.build_refined_class(for_super: true) - subclass = Class.new(refined_class) + it "looks in the refined ancestors from included module" do + refined_class = ModuleSpecs.build_refined_class(for_super: true) + subclass = Class.new(refined_class) - a = Module.new do - def foo - [:A] + super + a = Module.new do + def foo + [:A] + super + end end - end - refinement = Module.new do - refine refined_class do - include a + refinement = Module.new do + refine refined_class do + include a + end end - end - result = nil - Module.new do - using refinement + result = nil + Module.new do + using refinement - result = subclass.new.foo - end + result = subclass.new.foo + end - result.should == [:A, :C] + result.should == [:A, :C] + end end # super in a method of a refinement invokes the method in the refined @@ -816,175 +764,177 @@ describe "Module#refine" do end end - it "does't have access to active refinements for C from included module" do - refined_class = ModuleSpecs.build_refined_class + ruby_version_is ""..."3.1" do + it "does't have access to active refinements for C from included module" do + refined_class = ModuleSpecs.build_refined_class - a = Module.new do - def foo - super + bar + a = Module.new do + def foo + super + bar + end end - end - refinement = Module.new do - refine refined_class do - include a + refinement = Module.new do + refine refined_class do + include a - def bar - "bar is not seen from A methods" + def bar + "bar is not seen from A methods" + end end end - end - Module.new do - using refinement - -> { - refined_class.new.foo - }.should raise_error(NameError) { |e| e.name.should == :bar } + Module.new do + using refinement + -> { + refined_class.new.foo + }.should raise_error(NameError) { |e| e.name.should == :bar } + end end - end - it "does't have access to other active refinements from included module" do - refined_class = ModuleSpecs.build_refined_class + it "does't have access to other active refinements from included module" do + refined_class = ModuleSpecs.build_refined_class - refinement_integer = Module.new do - refine Integer do - def bar - "bar is not seen from A methods" + refinement_integer = Module.new do + refine Integer do + def bar + "bar is not seen from A methods" + end end end - end - a = Module.new do - def foo - super + 1.bar + a = Module.new do + def foo + super + 1.bar + end end - end - refinement = Module.new do - refine refined_class do - include a + refinement = Module.new do + refine refined_class do + include a + end end - end - Module.new do - using refinement - using refinement_integer - -> { - refined_class.new.foo - }.should raise_error(NameError) { |e| e.name.should == :bar } + Module.new do + using refinement + using refinement_integer + -> { + refined_class.new.foo + }.should raise_error(NameError) { |e| e.name.should == :bar } + end end - end - # https://bugs.ruby-lang.org/issues/16977 - it "looks in the another active refinement if super called from included modules" do - refined_class = ModuleSpecs.build_refined_class(for_super: true) + # https://bugs.ruby-lang.org/issues/16977 + it "looks in the another active refinement if super called from included modules" do + refined_class = ModuleSpecs.build_refined_class(for_super: true) - a = Module.new do - def foo - [:A] + super + a = Module.new do + def foo + [:A] + super + end end - end - b = Module.new do - def foo - [:B] + super + b = Module.new do + def foo + [:B] + super + end end - end - refinement_a = Module.new do - refine refined_class do - include a + refinement_a = Module.new do + refine refined_class do + include a + end end - end - refinement_b = Module.new do - refine refined_class do - include b + refinement_b = Module.new do + refine refined_class do + include b + end end - end - result = nil - Module.new do - using refinement_a - using refinement_b - result = refined_class.new.foo + result = nil + Module.new do + using refinement_a + using refinement_b + result = refined_class.new.foo + end + + result.should == [:B, :A, :C] end - result.should == [:B, :A, :C] - end + it "looks in the current active refinement from included modules" do + refined_class = ModuleSpecs.build_refined_class(for_super: true) - it "looks in the current active refinement from included modules" do - refined_class = ModuleSpecs.build_refined_class(for_super: true) + a = Module.new do + def foo + [:A] + super + end + end - a = Module.new do - def foo - [:A] + super + b = Module.new do + def foo + [:B] + super + end end - end - b = Module.new do - def foo - [:B] + super + refinement = Module.new do + refine refined_class do + def foo + [:LAST] + super + end + end end - end - refinement = Module.new do - refine refined_class do - def foo - [:LAST] + super + refinement_a_b = Module.new do + refine refined_class do + include a + include b end end - end - refinement_a_b = Module.new do - refine refined_class do - include a - include b + result = nil + Module.new do + using refinement + using refinement_a_b + result = refined_class.new.foo end - end - result = nil - Module.new do - using refinement - using refinement_a_b - result = refined_class.new.foo + result.should == [:B, :A, :LAST, :C] end - result.should == [:B, :A, :LAST, :C] - end + it "looks in the lexical scope refinements before other active refinements" do + refined_class = ModuleSpecs.build_refined_class(for_super: true) - it "looks in the lexical scope refinements before other active refinements" do - refined_class = ModuleSpecs.build_refined_class(for_super: true) + refinement_local = Module.new do + refine refined_class do + def foo + [:LOCAL] + super + end + end + end + + a = Module.new do + using refinement_local - refinement_local = Module.new do - refine refined_class do def foo - [:LOCAL] + super + [:A] + super end end - end - a = Module.new do - using refinement_local - - def foo - [:A] + super + refinement = Module.new do + refine refined_class do + include a + end end - end - refinement = Module.new do - refine refined_class do - include a + result = nil + Module.new do + using refinement + result = refined_class.new.foo end - end - result = nil - Module.new do - using refinement - result = refined_class.new.foo + result.should == [:A, :LOCAL, :C] end - - result.should == [:A, :LOCAL, :C] end end diff --git a/spec/ruby/core/module/refinements_spec.rb b/spec/ruby/core/module/refinements_spec.rb new file mode 100644 index 0000000000..5648fcbd6f --- /dev/null +++ b/spec/ruby/core/module/refinements_spec.rb @@ -0,0 +1,45 @@ +require_relative '../../spec_helper' + +describe "Module#refinements" do + ruby_version_is "3.2" do + it "returns refinements defined in a module" do + ScratchPad.record [] + + m = Module.new do + refine String do + ScratchPad << self + end + + refine Array do + ScratchPad << self + end + end + + m.refinements.sort_by(&:object_id).should == ScratchPad.recorded.sort_by(&:object_id) + end + + it "does not return refinements defined in the included module" do + ScratchPad.record [] + + m1 = Module.new do + refine Integer do + nil + end + end + + m2 = Module.new do + include m1 + + refine String do + ScratchPad << self + end + end + + m2.refinements.should == ScratchPad.recorded + end + + it "returns an empty array if no refinements defined in a module" do + Module.new.refinements.should == [] + end + end +end diff --git a/spec/ruby/core/module/ruby2_keywords_spec.rb b/spec/ruby/core/module/ruby2_keywords_spec.rb index 34c45cb1bc..aca419f522 100644 --- a/spec/ruby/core/module/ruby2_keywords_spec.rb +++ b/spec/ruby/core/module/ruby2_keywords_spec.rb @@ -1,112 +1,297 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is "2.7" do - describe "Module#ruby2_keywords" do - it "marks the final hash argument as keyword hash" do - obj = Object.new +describe "Module#ruby2_keywords" do + class << self + ruby2_keywords def mark(*args) + args + end + end - obj.singleton_class.class_exec do - def foo(*a) a.last end - ruby2_keywords :foo - end + it "marks the final hash argument as keyword hash" do + last = mark(1, 2, a: "a").last + Hash.ruby2_keywords_hash?(last).should == true + end - last = obj.foo(1, 2, a: "a") - Hash.ruby2_keywords_hash?(last).should == true + it "makes a copy of the hash and only marks the copy as keyword hash" do + obj = Object.new + obj.singleton_class.class_exec do + def regular(*args) + args.last + end end - ruby_version_is "2.7" ... "3.0" do - it "fixes delegation warnings when calling a method accepting keywords" do - obj = Object.new + h = {a: 1} - obj.singleton_class.class_exec do - def foo(*a) bar(*a) end - def bar(*a, **b) end - end + last = mark(**h).last + Hash.ruby2_keywords_hash?(last).should == true + Hash.ruby2_keywords_hash?(h).should == false - -> { obj.foo(1, 2, {a: "a"}) }.should complain(/Using the last argument as keyword parameters is deprecated/) - - obj.singleton_class.class_exec do - ruby2_keywords :foo - end + last2 = mark(**last).last # last is already marked + Hash.ruby2_keywords_hash?(last2).should == true + Hash.ruby2_keywords_hash?(last).should == true + last2.should_not.equal?(last) + Hash.ruby2_keywords_hash?(h).should == false + end - -> { obj.foo(1, 2, {a: "a"}) }.should_not complain + it "makes a copy and unmark the Hash when calling a method taking (arg)" do + obj = Object.new + obj.singleton_class.class_exec do + def single(arg) + arg end end - it "returns nil" do - obj = Object.new + h = { a: 1 } + args = mark(**h) + marked = args.last + Hash.ruby2_keywords_hash?(marked).should == true - obj.singleton_class.class_exec do - def foo(*a) end + after_usage = obj.single(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should_not.equal?(marked) + Hash.ruby2_keywords_hash?(after_usage).should == false + Hash.ruby2_keywords_hash?(marked).should == true + end - ruby2_keywords(:foo).should == nil + it "makes a copy and unmark the Hash when calling a method taking (**kw)" do + obj = Object.new + obj.singleton_class.class_exec do + def kwargs(**kw) + kw end end - it "raises NameError when passed not existing method name" do - obj = Object.new + h = { a: 1 } + args = mark(**h) + marked = args.last + Hash.ruby2_keywords_hash?(marked).should == true - -> { - obj.singleton_class.class_exec do - ruby2_keywords :not_existing - end - }.should raise_error(NameError, /undefined method `not_existing'/) - end + after_usage = obj.kwargs(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should_not.equal?(marked) + Hash.ruby2_keywords_hash?(after_usage).should == false + Hash.ruby2_keywords_hash?(marked).should == true + end - it "acceps String as well" do + ruby_version_is "3.2" do + it "makes a copy and unmark the Hash when calling a method taking (*args)" do obj = Object.new - obj.singleton_class.class_exec do - def foo(*a) a.last end - ruby2_keywords "foo" + def splat(*args) + args.last + end + + def splat1(arg, *args) + args.last + end + + def proc_call(*args) + -> *a { a.last }.call(*args) + end end - last = obj.foo(1, 2, a: "a") - Hash.ruby2_keywords_hash?(last).should == true + h = { a: 1 } + args = mark(**h) + marked = args.last + Hash.ruby2_keywords_hash?(marked).should == true + + after_usage = obj.splat(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should_not.equal?(marked) + Hash.ruby2_keywords_hash?(after_usage).should == false + Hash.ruby2_keywords_hash?(marked).should == true + + args = mark(1, **h) + marked = args.last + after_usage = obj.splat1(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should_not.equal?(marked) + Hash.ruby2_keywords_hash?(after_usage).should == false + Hash.ruby2_keywords_hash?(marked).should == true + + args = mark(**h) + marked = args.last + after_usage = obj.proc_call(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should_not.equal?(marked) + Hash.ruby2_keywords_hash?(after_usage).should == false + Hash.ruby2_keywords_hash?(marked).should == true + + args = mark(**h) + marked = args.last + after_usage = obj.send(:splat, *args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should_not.equal?(marked) + Hash.ruby2_keywords_hash?(after_usage).should == false + Hash.ruby2_keywords_hash?(marked).should == true end + end - it "raises TypeError when passed not Symbol or String" do + ruby_version_is ""..."3.2" do + # https://bugs.ruby-lang.org/issues/18625 + it "does NOT copy the Hash when calling a method taking (*args)" do obj = Object.new + obj.singleton_class.class_exec do + def splat(*args) + args.last + end - -> { - obj.singleton_class.class_exec do - ruby2_keywords Object.new + def splat1(arg, *args) + args.last end - }.should raise_error(TypeError, /is not a symbol nor a string/) + + def proc_call(*args) + -> *a { a.last }.call(*args) + end + end + + h = { a: 1 } + args = mark(**h) + marked = args.last + Hash.ruby2_keywords_hash?(marked).should == true + + after_usage = obj.splat(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should.equal?(marked) # https://bugs.ruby-lang.org/issues/18625 + Hash.ruby2_keywords_hash?(after_usage).should == true # https://bugs.ruby-lang.org/issues/18625 + Hash.ruby2_keywords_hash?(marked).should == true + + args = mark(1, **h) + marked = args.last + after_usage = obj.splat1(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should.equal?(marked) # https://bugs.ruby-lang.org/issues/18625 + Hash.ruby2_keywords_hash?(after_usage).should == true # https://bugs.ruby-lang.org/issues/18625 + Hash.ruby2_keywords_hash?(marked).should == true + + args = mark(**h) + marked = args.last + after_usage = obj.proc_call(*args) + after_usage.should == h + after_usage.should_not.equal?(h) + after_usage.should.equal?(marked) # https://bugs.ruby-lang.org/issues/18625 + Hash.ruby2_keywords_hash?(after_usage).should == true # https://bugs.ruby-lang.org/issues/18625 + Hash.ruby2_keywords_hash?(marked).should == true + + args = mark(**h) + marked = args.last + after_usage = obj.send(:splat, *args) + after_usage.should == h + after_usage.should_not.equal?(h) + send_copies = RUBY_ENGINE == "ruby" # inconsistent with Proc#call above for CRuby + after_usage.equal?(marked).should == !send_copies + Hash.ruby2_keywords_hash?(after_usage).should == !send_copies + Hash.ruby2_keywords_hash?(marked).should == true end + end - it "prints warning when a method does not accept argument splat" do - obj = Object.new - def obj.foo(a, b, c) end + it "applies to the underlying method and applies across aliasing" do + obj = Object.new - -> { - obj.singleton_class.class_exec do - ruby2_keywords :foo - end - }.should complain(/Skipping set of ruby2_keywords flag for/) + obj.singleton_class.class_exec do + def foo(*a) a.last end + alias_method :bar, :foo + ruby2_keywords :foo + + def baz(*a) a.last end + ruby2_keywords :baz + alias_method :bob, :baz end - it "prints warning when a method accepts keywords" do - obj = Object.new - def obj.foo(a:, b:) end + last = obj.foo(1, 2, a: "a") + Hash.ruby2_keywords_hash?(last).should == true - -> { - obj.singleton_class.class_exec do - ruby2_keywords :foo - end - }.should complain(/Skipping set of ruby2_keywords flag for/) + last = obj.bar(1, 2, a: "a") + Hash.ruby2_keywords_hash?(last).should == true + + last = obj.baz(1, 2, a: "a") + Hash.ruby2_keywords_hash?(last).should == true + + last = obj.bob(1, 2, a: "a") + Hash.ruby2_keywords_hash?(last).should == true + end + + it "returns nil" do + obj = Object.new + + obj.singleton_class.class_exec do + def foo(*a) end + + ruby2_keywords(:foo).should == nil end + end - it "prints warning when a method accepts keyword splat" do - obj = Object.new - def obj.foo(**a) end + it "raises NameError when passed not existing method name" do + obj = Object.new - -> { - obj.singleton_class.class_exec do - ruby2_keywords :foo - end - }.should complain(/Skipping set of ruby2_keywords flag for/) + -> { + obj.singleton_class.class_exec do + ruby2_keywords :not_existing + end + }.should raise_error(NameError, /undefined method [`']not_existing'/) + end + + it "accepts String as well" do + obj = Object.new + + obj.singleton_class.class_exec do + def foo(*a) a.last end + ruby2_keywords "foo" end + + last = obj.foo(1, 2, a: "a") + Hash.ruby2_keywords_hash?(last).should == true + end + + it "raises TypeError when passed not Symbol or String" do + obj = Object.new + + -> { + obj.singleton_class.class_exec do + ruby2_keywords Object.new + end + }.should raise_error(TypeError, /is not a symbol nor a string/) + end + + it "prints warning when a method does not accept argument splat" do + obj = Object.new + def obj.foo(a, b, c) end + + -> { + obj.singleton_class.class_exec do + ruby2_keywords :foo + end + }.should complain(/Skipping set of ruby2_keywords flag for/) + end + + it "prints warning when a method accepts keywords" do + obj = Object.new + def obj.foo(a:, b:) end + + -> { + obj.singleton_class.class_exec do + ruby2_keywords :foo + end + }.should complain(/Skipping set of ruby2_keywords flag for/) + end + + it "prints warning when a method accepts keyword splat" do + obj = Object.new + def obj.foo(**a) end + + -> { + obj.singleton_class.class_exec do + ruby2_keywords :foo + end + }.should complain(/Skipping set of ruby2_keywords flag for/) end end diff --git a/spec/ruby/core/module/set_temporary_name_spec.rb b/spec/ruby/core/module/set_temporary_name_spec.rb new file mode 100644 index 0000000000..f5886a3398 --- /dev/null +++ b/spec/ruby/core/module/set_temporary_name_spec.rb @@ -0,0 +1,68 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.3" do + describe "Module#set_temporary_name" do + it "can assign a temporary name" do + m = Module.new + m.name.should be_nil + + m.set_temporary_name("fake_name") + m.name.should == "fake_name" + + m.set_temporary_name(nil) + m.name.should be_nil + end + + it "can assign a temporary name which is not a valid constant path" do + m = Module.new + m.set_temporary_name("a::B") + m.name.should == "a::B" + + m.set_temporary_name("Template['foo.rb']") + m.name.should == "Template['foo.rb']" + end + + it "can't assign empty string as name" do + m = Module.new + -> { m.set_temporary_name("") }.should raise_error(ArgumentError, "empty class/module name") + end + + it "can't assign a constant name as a temporary name" do + m = Module.new + -> { m.set_temporary_name("Object") }.should raise_error(ArgumentError, "the temporary name must not be a constant path to avoid confusion") + end + + it "can't assign a constant path as a temporary name" do + m = Module.new + -> { m.set_temporary_name("A::B") }.should raise_error(ArgumentError, "the temporary name must not be a constant path to avoid confusion") + -> { m.set_temporary_name("::A") }.should raise_error(ArgumentError, "the temporary name must not be a constant path to avoid confusion") + -> { m.set_temporary_name("::A::B") }.should raise_error(ArgumentError, "the temporary name must not be a constant path to avoid confusion") + end + + it "can't assign name to permanent module" do + -> { Object.set_temporary_name("fake_name") }.should raise_error(RuntimeError, "can't change permanent name") + end + + it "can assign a temporary name to a nested module" do + m = Module.new + module m::N; end + m::N.name.should =~ /\A#<Module:0x\h+>::N\z/ + + m::N.set_temporary_name("fake_name") + m::N.name.should == "fake_name" + + m::N.set_temporary_name(nil) + m::N.name.should be_nil + end + + it "can update the name when assigned to a constant" do + m = Module.new + m::N = Module.new + m::N.name.should =~ /\A#<Module:0x\h+>::N\z/ + m::N.set_temporary_name(nil) + + m::M = m::N + m::M.name.should =~ /\A#<Module:0x\h+>::M\z/m + end + end +end diff --git a/spec/ruby/core/module/shared/attr_added.rb b/spec/ruby/core/module/shared/attr_added.rb new file mode 100644 index 0000000000..ce832cdcff --- /dev/null +++ b/spec/ruby/core/module/shared/attr_added.rb @@ -0,0 +1,34 @@ +describe :module_attr_added, shared: true do + it "calls method_added for normal classes" do + ScratchPad.record [] + + cls = Class.new do + class << self + def method_added(name) + ScratchPad.recorded << name + end + end + end + + cls.send(@method, :foo) + + ScratchPad.recorded.each {|name| name.to_s.should =~ /foo[=]?/} + end + + it "calls singleton_method_added for singleton classes" do + ScratchPad.record [] + cls = Class.new do + class << self + def singleton_method_added(name) + # called for this def so ignore it + return if name == :singleton_method_added + ScratchPad.recorded << name + end + end + end + + cls.singleton_class.send(@method, :foo) + + ScratchPad.recorded.each {|name| name.to_s.should =~ /foo[=]?/} + end +end diff --git a/spec/ruby/core/module/shared/class_eval.rb b/spec/ruby/core/module/shared/class_eval.rb index 224078ae54..b1d5cb3814 100644 --- a/spec/ruby/core/module/shared/class_eval.rb +++ b/spec/ruby/core/module/shared/class_eval.rb @@ -52,43 +52,58 @@ describe :module_class_eval, shared: true do ModuleSpecs.send(@method, "[__FILE__, __LINE__]", "test", 102).should == ["test", 102] end + ruby_version_is "3.3" do + it "uses the caller location as default filename" do + ModuleSpecs.send(@method, "[__FILE__, __LINE__]").should == ["(eval at #{__FILE__}:#{__LINE__})", 1] + end + end + it "converts a non-string filename to a string using to_str" do (file = mock(__FILE__)).should_receive(:to_str).and_return(__FILE__) ModuleSpecs.send(@method, "1+1", file) + + (file = mock(__FILE__)).should_receive(:to_str).and_return(__FILE__) + ModuleSpecs.send(@method, "1+1", file, 15) end it "raises a TypeError when the given filename can't be converted to string using to_str" do (file = mock('123')).should_receive(:to_str).and_return(123) - -> { ModuleSpecs.send(@method, "1+1", file) }.should raise_error(TypeError) + -> { ModuleSpecs.send(@method, "1+1", file) }.should raise_error(TypeError, /can't convert MockObject to String/) end it "converts non string eval-string to string using to_str" do (o = mock('1 + 1')).should_receive(:to_str).and_return("1 + 1") ModuleSpecs.send(@method, o).should == 2 + + (o = mock('1 + 1')).should_receive(:to_str).and_return("1 + 1") + ModuleSpecs.send(@method, o, "file.rb").should == 2 + + (o = mock('1 + 1')).should_receive(:to_str).and_return("1 + 1") + ModuleSpecs.send(@method, o, "file.rb", 15).should == 2 end it "raises a TypeError when the given eval-string can't be converted to string using to_str" do o = mock('x') - -> { ModuleSpecs.send(@method, o) }.should raise_error(TypeError) + -> { ModuleSpecs.send(@method, o) }.should raise_error(TypeError, "no implicit conversion of MockObject into String") (o = mock('123')).should_receive(:to_str).and_return(123) - -> { ModuleSpecs.send(@method, o) }.should raise_error(TypeError) + -> { ModuleSpecs.send(@method, o) }.should raise_error(TypeError, /can't convert MockObject to String/) end it "raises an ArgumentError when no arguments and no block are given" do - -> { ModuleSpecs.send(@method) }.should raise_error(ArgumentError) + -> { ModuleSpecs.send(@method) }.should raise_error(ArgumentError, "wrong number of arguments (given 0, expected 1..3)") end it "raises an ArgumentError when more than 3 arguments are given" do -> { ModuleSpecs.send(@method, "1 + 1", "some file", 0, "bogus") - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, "wrong number of arguments (given 4, expected 1..3)") end it "raises an ArgumentError when a block and normal arguments are given" do -> { ModuleSpecs.send(@method, "1 + 1") { 1 + 1 } - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, "wrong number of arguments (given 1, expected 0)") end # This case was found because Rubinius was caching the compiled diff --git a/spec/ruby/core/module/shared/set_visibility.rb b/spec/ruby/core/module/shared/set_visibility.rb index 9f31e230ca..a1586dd2bd 100644 --- a/spec/ruby/core/module/shared/set_visibility.rb +++ b/spec/ruby/core/module/shared/set_visibility.rb @@ -22,21 +22,19 @@ describe :set_visibility, shared: true do end end - ruby_version_is "3.0" do - describe "array as a single argument" do - it "sets visibility of given method names" do - visibility = @method - old_visibility = [:protected, :private].find {|vis| vis != visibility } - - mod = Module.new { - send old_visibility - def test1() end - def test2() end - send visibility, [:test1, :test2] - } - mod.should send(:"have_#{visibility}_instance_method", :test1, false) - mod.should send(:"have_#{visibility}_instance_method", :test2, false) - end + describe "array as a single argument" do + it "sets visibility of given method names" do + visibility = @method + old_visibility = [:protected, :private].find {|vis| vis != visibility } + + mod = Module.new { + send old_visibility + def test1() end + def test2() end + send visibility, [:test1, :test2] + } + mod.should send(:"have_#{visibility}_instance_method", :test1, false) + mod.should send(:"have_#{visibility}_instance_method", :test2, false) end end diff --git a/spec/ruby/core/module/undef_method_spec.rb b/spec/ruby/core/module/undef_method_spec.rb index c2ad200536..d4efcd51cb 100644 --- a/spec/ruby/core/module/undef_method_spec.rb +++ b/spec/ruby/core/module/undef_method_spec.rb @@ -50,7 +50,7 @@ describe "Module#undef_method" do end it "raises a NameError when passed a missing name for a module" do - -> { @module.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method `not_exist' for module `#{@module}'/) { |e| + -> { @module.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method [`']not_exist' for module [`']#{@module}'/) { |e| # a NameError and not a NoMethodError e.class.should == NameError } @@ -58,7 +58,7 @@ describe "Module#undef_method" do it "raises a NameError when passed a missing name for a class" do klass = Class.new - -> { klass.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method `not_exist' for class `#{klass}'/) { |e| + -> { klass.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method [`']not_exist' for class [`']#{klass}'/) { |e| # a NameError and not a NoMethodError e.class.should == NameError } @@ -69,8 +69,8 @@ describe "Module#undef_method" do obj = klass.new sclass = obj.singleton_class - -> { sclass.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method `not_exist' for class `#{sclass}'/) { |e| - e.message.should include('`#<Class:#<#<Class:') + -> { sclass.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method [`']not_exist' for class [`']#{sclass}'/) { |e| + e.message.should =~ /[`']#<Class:#<#<Class:/ # a NameError and not a NoMethodError e.class.should == NameError @@ -79,7 +79,7 @@ describe "Module#undef_method" do it "raises a NameError when passed a missing name for a metaclass" do klass = String.singleton_class - -> { klass.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method `not_exist' for class `String'/) { |e| + -> { klass.send :undef_method, :not_exist }.should raise_error(NameError, /undefined method [`']not_exist' for class [`']String'/) { |e| # a NameError and not a NoMethodError e.class.should == NameError } diff --git a/spec/ruby/core/module/undefined_instance_methods_spec.rb b/spec/ruby/core/module/undefined_instance_methods_spec.rb new file mode 100644 index 0000000000..3be860d053 --- /dev/null +++ b/spec/ruby/core/module/undefined_instance_methods_spec.rb @@ -0,0 +1,26 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "Module#undefined_instance_methods" do + ruby_version_is "3.2" do + it "returns methods undefined in the class" do + methods = ModuleSpecs::UndefinedInstanceMethods::Parent.undefined_instance_methods + methods.should == [:undefed_method] + end + + it "returns inherited methods undefined in the class" do + methods = ModuleSpecs::UndefinedInstanceMethods::Child.undefined_instance_methods + methods.should include(:parent_method, :another_parent_method) + end + + it "returns methods from an included module that are undefined in the class" do + methods = ModuleSpecs::UndefinedInstanceMethods::Grandchild.undefined_instance_methods + methods.should include(:super_included_method) + end + + it "does not returns ancestors undefined methods" do + methods = ModuleSpecs::UndefinedInstanceMethods::Grandchild.undefined_instance_methods + methods.should_not include(:parent_method, :another_parent_method) + end + end +end diff --git a/spec/ruby/core/module/used_refinements_spec.rb b/spec/ruby/core/module/used_refinements_spec.rb new file mode 100644 index 0000000000..c16cab0e3c --- /dev/null +++ b/spec/ruby/core/module/used_refinements_spec.rb @@ -0,0 +1,87 @@ +require_relative '../../spec_helper' + +describe "Module.used_refinements" do + ruby_version_is "3.2" do + it "returns list of all refinements imported in the current scope" do + refinement_int = nil + refinement_str = nil + ScratchPad.record [] + + m1 = Module.new do + refine Integer do + refinement_int = self + end + end + + m2 = Module.new do + refine String do + refinement_str = self + end + end + + Module.new do + using m1 + using m2 + + Module.used_refinements.each { |r| ScratchPad << r } + end + + ScratchPad.recorded.sort_by(&:object_id).should == [refinement_int, refinement_str].sort_by(&:object_id) + end + + it "returns empty array if does not have any refinements imported" do + used_refinements = nil + + Module.new do + used_refinements = Module.used_refinements + end + + used_refinements.should == [] + end + + it "ignores refinements imported in a module that is included into the current one" do + used_refinements = nil + + m1 = Module.new do + refine Integer do + nil + end + end + + m2 = Module.new do + using m1 + end + + Module.new do + include m2 + + used_refinements = Module.used_refinements + end + + used_refinements.should == [] + end + + it "returns refinements even not defined directly in a module refinements are imported from" do + used_refinements = nil + ScratchPad.record [] + + m1 = Module.new do + refine Integer do + ScratchPad << self + end + end + + m2 = Module.new do + include m1 + end + + Module.new do + using m2 + + used_refinements = Module.used_refinements + end + + used_refinements.should == ScratchPad.recorded + end + end +end diff --git a/spec/ruby/core/module/using_spec.rb b/spec/ruby/core/module/using_spec.rb index 4781b99bb7..a908363c96 100644 --- a/spec/ruby/core/module/using_spec.rb +++ b/spec/ruby/core/module/using_spec.rb @@ -316,7 +316,7 @@ describe "Module#using" do using refinement def initialize - @a = "1703" + @a = +"1703" @a.instance_eval do def abc diff --git a/spec/ruby/core/mutex/lock_spec.rb b/spec/ruby/core/mutex/lock_spec.rb index 7a39817b11..e9d33f5fd9 100644 --- a/spec/ruby/core/mutex/lock_spec.rb +++ b/spec/ruby/core/mutex/lock_spec.rb @@ -1,10 +1,6 @@ require_relative '../../spec_helper' describe "Mutex#lock" do - before :each do - ScratchPad.clear - end - it "returns self" do m = Mutex.new m.lock.should == m diff --git a/spec/ruby/core/mutex/owned_spec.rb b/spec/ruby/core/mutex/owned_spec.rb index 1f843cd576..7bfc7d8f83 100644 --- a/spec/ruby/core/mutex/owned_spec.rb +++ b/spec/ruby/core/mutex/owned_spec.rb @@ -41,15 +41,13 @@ describe "Mutex#owned?" do end end - ruby_version_is "3.0" do - it "is held per Fiber" do - m = Mutex.new - m.lock - - Fiber.new do - m.locked?.should == true - m.owned?.should == false - end.resume - end + it "is held per Fiber" do + m = Mutex.new + m.lock + + Fiber.new do + m.locked?.should == true + m.owned?.should == false + end.resume end end diff --git a/spec/ruby/core/nil/match_spec.rb b/spec/ruby/core/nil/match_spec.rb index 2e2b5d1c1b..bc1c591793 100644 --- a/spec/ruby/core/nil/match_spec.rb +++ b/spec/ruby/core/nil/match_spec.rb @@ -2,7 +2,7 @@ require_relative '../../spec_helper' describe "NilClass#=~" do it "returns nil matching any object" do - o = Object.new + o = nil suppress_warning do (o =~ /Object/).should be_nil diff --git a/spec/ruby/core/nil/singleton_method_spec.rb b/spec/ruby/core/nil/singleton_method_spec.rb new file mode 100644 index 0000000000..8d898b1cc9 --- /dev/null +++ b/spec/ruby/core/nil/singleton_method_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' + +describe "NilClass#singleton_method" do + ruby_version_is '3.3' do + it "raises regardless of whether NilClass defines the method" do + -> { nil.singleton_method(:foo) }.should raise_error(NameError) + begin + def (nil).foo; end + -> { nil.singleton_method(:foo) }.should raise_error(NameError) + ensure + NilClass.send(:remove_method, :foo) + end + end + end +end diff --git a/spec/ruby/core/nil/to_s_spec.rb b/spec/ruby/core/nil/to_s_spec.rb index 283d26477a..fa0b929677 100644 --- a/spec/ruby/core/nil/to_s_spec.rb +++ b/spec/ruby/core/nil/to_s_spec.rb @@ -5,13 +5,11 @@ describe "NilClass#to_s" do nil.to_s.should == "" end - ruby_version_is "2.7" do - it "returns a frozen string" do - nil.to_s.should.frozen? - end + it "returns a frozen string" do + nil.to_s.should.frozen? + end - it "always returns the same string" do - nil.to_s.should equal(nil.to_s) - end + it "always returns the same string" do + nil.to_s.should equal(nil.to_s) end end diff --git a/spec/ruby/core/numeric/clone_spec.rb b/spec/ruby/core/numeric/clone_spec.rb index e3bf0a9e7c..423cec85dd 100644 --- a/spec/ruby/core/numeric/clone_spec.rb +++ b/spec/ruby/core/numeric/clone_spec.rb @@ -14,7 +14,7 @@ describe "Numeric#clone" do 1.clone.frozen?.should == true end - it "accepts optonal keyword argument :freeze" do + it "accepts optional keyword argument :freeze" do value = 1 value.clone(freeze: true).should equal(value) end @@ -22,4 +22,9 @@ describe "Numeric#clone" do it "raises ArgumentError if passed freeze: false" do -> { 1.clone(freeze: false) }.should raise_error(ArgumentError, /can't unfreeze/) end + + it "does not change frozen status if passed freeze: nil" do + value = 1 + value.clone(freeze: nil).should equal(value) + end end diff --git a/spec/ruby/core/numeric/fdiv_spec.rb b/spec/ruby/core/numeric/fdiv_spec.rb index 907e5d343c..e97fa77f79 100644 --- a/spec/ruby/core/numeric/fdiv_spec.rb +++ b/spec/ruby/core/numeric/fdiv_spec.rb @@ -1,5 +1,4 @@ require_relative '../../spec_helper' -require_relative 'shared/quo' describe "Numeric#fdiv" do it "coerces self with #to_f" do diff --git a/spec/ruby/core/numeric/magnitude_spec.rb b/spec/ruby/core/numeric/magnitude_spec.rb index 7a3290b036..1371dff21f 100644 --- a/spec/ruby/core/numeric/magnitude_spec.rb +++ b/spec/ruby/core/numeric/magnitude_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/abs' describe "Numeric#magnitude" do diff --git a/spec/ruby/core/numeric/quo_spec.rb b/spec/ruby/core/numeric/quo_spec.rb index 5c952b11a9..6e3ce7a374 100644 --- a/spec/ruby/core/numeric/quo_spec.rb +++ b/spec/ruby/core/numeric/quo_spec.rb @@ -1,6 +1,5 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -require_relative 'shared/quo' describe "Numeric#quo" do it "returns the result of self divided by the given Integer as a Rational" do @@ -20,7 +19,7 @@ describe "Numeric#quo" do -> { 10.quo(0) }.should raise_error(ZeroDivisionError) -> { -10.quo(0) }.should raise_error(ZeroDivisionError) -> { bignum_value.quo(0) }.should raise_error(ZeroDivisionError) - -> { -bignum_value.quo(0) }.should raise_error(ZeroDivisionError) + -> { (-bignum_value).quo(0) }.should raise_error(ZeroDivisionError) end it "calls #to_r to convert the object to a Rational" do @@ -52,4 +51,13 @@ describe "Numeric#quo" do obj.quo(19).should == 1.quo(20) end + + it "raises a ZeroDivisionError if the given argument is zero and not a Float" do + -> { 1.quo(0) }.should raise_error(ZeroDivisionError) + end + + it "returns infinity if the given argument is zero and is a Float" do + (1.quo(0.0)).to_s.should == 'Infinity' + (-1.quo(0.0)).to_s.should == '-Infinity' + end end diff --git a/spec/ruby/core/numeric/remainder_spec.rb b/spec/ruby/core/numeric/remainder_spec.rb index 1e2f5f3a96..674fa22d8e 100644 --- a/spec/ruby/core/numeric/remainder_spec.rb +++ b/spec/ruby/core/numeric/remainder_spec.rb @@ -6,6 +6,9 @@ describe "Numeric#remainder" do @obj = NumericSpecs::Subclass.new @result = mock("Numeric#% result") @other = mock("Passed Object") + ruby_version_is "3.3" do + @other.should_receive(:coerce).with(@obj).and_return([@obj, @other]) + end end it "returns the result of calling self#% with other if self is 0" do diff --git a/spec/ruby/core/numeric/shared/quo.rb b/spec/ruby/core/numeric/shared/quo.rb deleted file mode 100644 index 2392636fe7..0000000000 --- a/spec/ruby/core/numeric/shared/quo.rb +++ /dev/null @@ -1,7 +0,0 @@ -describe :numeric_quo_18, shared: true do - it "returns the result of calling self#/ with other" do - obj = mock_numeric('numeric') - obj.should_receive(:/).with(19).and_return(:result) - obj.send(@method, 19).should == :result - end -end diff --git a/spec/ruby/core/numeric/shared/step.rb b/spec/ruby/core/numeric/shared/step.rb index a4fe74f9db..977ec6de02 100644 --- a/spec/ruby/core/numeric/shared/step.rb +++ b/spec/ruby/core/numeric/shared/step.rb @@ -5,7 +5,7 @@ require_relative '../fixtures/classes' # To be able to do it, the @step ivar must contain a Proc that transforms # the step call arguments passed as positional arguments to the style of # arguments pretended to test. -describe :numeric_step, :shared => true do +describe :numeric_step, shared: true do before :each do ScratchPad.record [] @prc = -> x { ScratchPad << x } @@ -256,15 +256,8 @@ describe :numeric_step, :shared => true do end describe "when no block is given" do - step_enum_class = Enumerator step_enum_class = Enumerator::ArithmeticSequence - ruby_version_is ""..."3.0" do - it "returns an #{step_enum_class} when step is 0" do - @step.call(1, 2, 0).should be_an_instance_of(step_enum_class) - end - end - it "returns an #{step_enum_class} when not passed a block and self > stop" do @step.call(1, 0, 2).should be_an_instance_of(step_enum_class) end diff --git a/spec/ruby/core/numeric/step_spec.rb b/spec/ruby/core/numeric/step_spec.rb index 03af8b0e4d..1705fb1b4e 100644 --- a/spec/ruby/core/numeric/step_spec.rb +++ b/spec/ruby/core/numeric/step_spec.rb @@ -21,33 +21,10 @@ describe "Numeric#step" do it_behaves_like :numeric_step, :step describe "when no block is given" do - step_enum_class = Enumerator step_enum_class = Enumerator::ArithmeticSequence - ruby_version_is ""..."3.0" do - it "returns an #{step_enum_class} when step is 0" do - 1.step(5, 0).should be_an_instance_of(step_enum_class) - end - - it "returns an #{step_enum_class} when step is 0.0" do - 1.step(2, 0.0).should be_an_instance_of(step_enum_class) - end - end - describe "returned #{step_enum_class}" do describe "size" do - ruby_version_is ""..."3.0" do - it "is infinity when step is 0" do - enum = 1.step(5, 0) - enum.size.should == Float::INFINITY - end - - it "is infinity when step is 0.0" do - enum = 1.step(2, 0.0) - enum.size.should == Float::INFINITY - end - end - it "defaults to an infinite size" do enum = 1.step enum.size.should == Float::INFINITY @@ -61,26 +38,9 @@ describe "Numeric#step" do end end end - end describe 'with keyword arguments' do - ruby_version_is ""..."3.0" do - it "doesn't raise an error when step is 0" do - -> { 1.step(to: 5, by: 0) { break } }.should_not raise_error - end - - it "doesn't raise an error when step is 0.0" do - -> { 1.step(to: 2, by: 0.0) { break } }.should_not raise_error - end - - it "should loop over self when step is 0 or 0.0" do - 1.step(to: 2, by: 0.0).take(5).should eql [1.0, 1.0, 1.0, 1.0, 1.0] - 1.step(to: 2, by: 0).take(5).should eql [1, 1, 1, 1, 1] - 1.1.step(to: 2, by: 0).take(5).should eql [1.1, 1.1, 1.1, 1.1, 1.1] - end - end - describe "when no block is given" do describe "returned Enumerator" do describe "size" do @@ -88,16 +48,6 @@ describe "Numeric#step" do 1.step(by: 42).size.should == infinity_value end - ruby_version_is ""..."3.0" do - it "should return infinity_value when step is 0" do - 1.step(to: 5, by: 0).size.should == infinity_value - end - - it "should return infinity_value when step is 0.0" do - 1.step(to: 2, by: 0.0).size.should == infinity_value - end - end - it "should return infinity_value when ascending towards a limit of Float::INFINITY" do 1.step(to: Float::INFINITY, by: 42).size.should == infinity_value end @@ -130,24 +80,12 @@ describe "Numeric#step" do end describe 'with mixed arguments' do - ruby_version_is ""..."3.0" do - it "doesn't raise an error when step is 0" do - -> { 1.step(5, by: 0) { break } }.should_not raise_error - end - - it "doesn't raise an error when step is 0.0" do - -> { 1.step(2, by: 0.0) { break } }.should_not raise_error - end + it " raises an ArgumentError when step is 0" do + -> { 1.step(5, by: 0) { break } }.should raise_error(ArgumentError) end - ruby_version_is "3.0" do - it " raises an ArgumentError when step is 0" do - -> { 1.step(5, by: 0) { break } }.should raise_error(ArgumentError) - end - - it "raises an ArgumentError when step is 0.0" do - -> { 1.step(2, by: 0.0) { break } }.should raise_error(ArgumentError) - end + it "raises an ArgumentError when step is 0.0" do + -> { 1.step(2, by: 0.0) { break } }.should raise_error(ArgumentError) end it "raises a ArgumentError when limit and to are defined" do @@ -158,26 +96,9 @@ describe "Numeric#step" do -> { 1.step(5, 1, by: 5) { break } }.should raise_error(ArgumentError) end - ruby_version_is ""..."3.0" do - it "should loop over self when step is 0 or 0.0" do - 1.step(2, by: 0.0).take(5).should eql [1.0, 1.0, 1.0, 1.0, 1.0] - 1.step(2, by: 0).take(5).should eql [1, 1, 1, 1, 1] - 1.1.step(2, by: 0).take(5).should eql [1.1, 1.1, 1.1, 1.1, 1.1] - end - end - describe "when no block is given" do describe "returned Enumerator" do describe "size" do - ruby_version_is ""..."3.0" do - it "should return infinity_value when step is 0" do - 1.step(5, by: 0).size.should == infinity_value - end - - it "should return infinity_value when step is 0.0" do - 1.step(2, by: 0.0).size.should == infinity_value - end - end end end end diff --git a/spec/ruby/core/objectspace/define_finalizer_spec.rb b/spec/ruby/core/objectspace/define_finalizer_spec.rb index 281785b0a4..effecc41d0 100644 --- a/spec/ruby/core/objectspace/define_finalizer_spec.rb +++ b/spec/ruby/core/objectspace/define_finalizer_spec.rb @@ -52,7 +52,7 @@ describe "ObjectSpace.define_finalizer" do Proc.new { puts "finalizer run" } end handler = scoped - obj = "Test" + obj = +"Test" ObjectSpace.define_finalizer(obj, handler) exit 0 RUBY @@ -60,60 +60,58 @@ describe "ObjectSpace.define_finalizer" do ruby_exe(code, :args => "2>&1").should include("finalizer run\n") end - ruby_version_is "3.0" do - it "warns if the finalizer has the object as the receiver" do - code = <<-RUBY - class CapturesSelf - def initialize - ObjectSpace.define_finalizer(self, proc { - puts "finalizer run" - }) - end + it "warns if the finalizer has the object as the receiver" do + code = <<-RUBY + class CapturesSelf + def initialize + ObjectSpace.define_finalizer(self, proc { + puts "finalizer run" + }) end - CapturesSelf.new - exit 0 - RUBY + end + CapturesSelf.new + exit 0 + RUBY - ruby_exe(code, :args => "2>&1").should include("warning: finalizer references object to be finalized\n") - end + ruby_exe(code, :args => "2>&1").should include("warning: finalizer references object to be finalized\n") + end - it "warns if the finalizer is a method bound to the receiver" do - code = <<-RUBY - class CapturesSelf - def initialize - ObjectSpace.define_finalizer(self, method(:finalize)) - end - def finalize(id) - puts "finalizer run" - end + it "warns if the finalizer is a method bound to the receiver" do + code = <<-RUBY + class CapturesSelf + def initialize + ObjectSpace.define_finalizer(self, method(:finalize)) end - CapturesSelf.new - exit 0 - RUBY + def finalize(id) + puts "finalizer run" + end + end + CapturesSelf.new + exit 0 + RUBY - ruby_exe(code, :args => "2>&1").should include("warning: finalizer references object to be finalized\n") - end + ruby_exe(code, :args => "2>&1").should include("warning: finalizer references object to be finalized\n") + end - it "warns if the finalizer was a block in the receiver" do - code = <<-RUBY - class CapturesSelf - def initialize - ObjectSpace.define_finalizer(self) do - puts "finalizer run" - end + it "warns if the finalizer was a block in the receiver" do + code = <<-RUBY + class CapturesSelf + def initialize + ObjectSpace.define_finalizer(self) do + puts "finalizer run" end end - CapturesSelf.new - exit 0 - RUBY + end + CapturesSelf.new + exit 0 + RUBY - ruby_exe(code, :args => "2>&1").should include("warning: finalizer references object to be finalized\n") - end + ruby_exe(code, :args => "2>&1").should include("warning: finalizer references object to be finalized\n") end it "calls a finalizer at exit even if it is self-referencing" do code = <<-RUBY - obj = "Test" + obj = +"Test" handler = Proc.new { puts "finalizer run" } ObjectSpace.define_finalizer(obj, handler) exit 0 @@ -143,9 +141,9 @@ describe "ObjectSpace.define_finalizer" do it "calls a finalizer defined in a finalizer running at exit" do code = <<-RUBY - obj = "Test" + obj = +"Test" handler = Proc.new do - obj2 = "Test" + obj2 = +"Test" handler2 = Proc.new { puts "finalizer 2 run" } ObjectSpace.define_finalizer(obj2, handler2) exit 0 @@ -169,4 +167,26 @@ describe "ObjectSpace.define_finalizer" do ruby_exe(code).lines.sort.should == ["finalized1\n", "finalized2\n"] end + + ruby_version_is "3.1" do + describe "when $VERBOSE is not nil" do + it "warns if an exception is raised in finalizer" do + code = <<-RUBY + ObjectSpace.define_finalizer(Object.new) { raise "finalizing" } + RUBY + + ruby_exe(code, args: "2>&1").should include("warning: Exception in finalizer", "finalizing") + end + end + + describe "when $VERBOSE is nil" do + it "does not warn even if an exception is raised in finalizer" do + code = <<-RUBY + ObjectSpace.define_finalizer(Object.new) { raise "finalizing" } + RUBY + + ruby_exe(code, args: "2>&1", options: "-W0").should == "" + end + end + end end diff --git a/spec/ruby/core/objectspace/garbage_collect_spec.rb b/spec/ruby/core/objectspace/garbage_collect_spec.rb index 1aec3ea072..521eaa8785 100644 --- a/spec/ruby/core/objectspace/garbage_collect_spec.rb +++ b/spec/ruby/core/objectspace/garbage_collect_spec.rb @@ -6,8 +6,8 @@ describe "ObjectSpace.garbage_collect" do -> { ObjectSpace.garbage_collect }.should_not raise_error end - it "doesn't accept any arguments" do - -> { ObjectSpace.garbage_collect(1) }.should raise_error(ArgumentError) + it "accepts keyword arguments" do + ObjectSpace.garbage_collect(full_mark: true, immediate_sweep: true).should == nil end it "ignores the supplied block" do diff --git a/spec/ruby/core/objectspace/weakkeymap/delete_spec.rb b/spec/ruby/core/objectspace/weakkeymap/delete_spec.rb new file mode 100644 index 0000000000..6e534b8ea8 --- /dev/null +++ b/spec/ruby/core/objectspace/weakkeymap/delete_spec.rb @@ -0,0 +1,40 @@ +require_relative '../../../spec_helper' + +ruby_version_is '3.3' do + describe "ObjectSpace::WeakKeyMap#delete" do + it "removes the entry and returns the deleted value" do + m = ObjectSpace::WeakKeyMap.new + key = Object.new + value = Object.new + m[key] = value + + m.delete(key).should == value + m.key?(key).should == false + end + + it "uses equality semantic" do + m = ObjectSpace::WeakKeyMap.new + key = "foo".upcase + value = Object.new + m[key] = value + + m.delete("foo".upcase).should == value + m.key?(key).should == false + end + + it "calls supplied block if the key is not found" do + key = Object.new + m = ObjectSpace::WeakKeyMap.new + return_value = m.delete(key) do |yielded_key| + yielded_key.should == key + 5 + end + return_value.should == 5 + end + + it "returns nil if the key is not found when no block is given" do + m = ObjectSpace::WeakMap.new + m.delete(Object.new).should == nil + end + end +end diff --git a/spec/ruby/core/objectspace/weakkeymap/element_reference_spec.rb b/spec/ruby/core/objectspace/weakkeymap/element_reference_spec.rb new file mode 100644 index 0000000000..862480cd02 --- /dev/null +++ b/spec/ruby/core/objectspace/weakkeymap/element_reference_spec.rb @@ -0,0 +1,26 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.3" do + describe "ObjectSpace::WeakKeyMap#[]" do + it "is faithful to the map's content" do + map = ObjectSpace::WeakKeyMap.new + key1, key2 = %w[a b].map(&:upcase) + ref1, ref2 = %w[x y] + map[key1] = ref1 + map[key1].should == ref1 + map[key1] = ref1 + map[key1].should == ref1 + map[key2] = ref2 + map[key1].should == ref1 + map[key2].should == ref2 + end + + it "matches using equality semantics" do + map = ObjectSpace::WeakKeyMap.new + key1, key2 = %w[a a].map(&:upcase) + ref = "x" + map[key1] = ref + map[key2].should == ref + end + end +end diff --git a/spec/ruby/core/objectspace/weakkeymap/element_set_spec.rb b/spec/ruby/core/objectspace/weakkeymap/element_set_spec.rb new file mode 100644 index 0000000000..c427e01ca5 --- /dev/null +++ b/spec/ruby/core/objectspace/weakkeymap/element_set_spec.rb @@ -0,0 +1,71 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.3" do + describe "ObjectSpace::WeakKeyMap#[]=" do + def should_accept(map, key, value) + (map[key] = value).should == value + map.should.key?(key) + map[key].should == value + end + + def should_not_accept(map, key, value) + -> { map[key] = value }.should raise_error(ArgumentError) + end + + it "is correct" do + map = ObjectSpace::WeakKeyMap.new + key1, key2 = %w[a b].map(&:upcase) + ref1, ref2 = %w[x y] + should_accept(map, key1, ref1) + should_accept(map, key1, ref1) + should_accept(map, key2, ref2) + map[key1].should == ref1 + end + + it "requires the keys to implement #hash" do + map = ObjectSpace::WeakKeyMap.new + -> { map[BasicObject.new] = 1 }.should raise_error(NoMethodError, /undefined method [`']hash' for an instance of BasicObject/) + end + + it "accepts frozen keys or values" do + map = ObjectSpace::WeakKeyMap.new + x = Object.new + should_accept(map, x, true) + should_accept(map, x, false) + should_accept(map, x, 42) + should_accept(map, x, :foo) + + y = Object.new.freeze + should_accept(map, x, y) + should_accept(map, y, x) + end + + it "rejects symbols as keys" do + map = ObjectSpace::WeakKeyMap.new + should_not_accept(map, :foo, true) + should_not_accept(map, rand.to_s.to_sym, true) + end + + it "rejects integers as keys" do + map = ObjectSpace::WeakKeyMap.new + should_not_accept(map, 42, true) + should_not_accept(map, 2 ** 68, true) + end + + it "rejects floats as keys" do + map = ObjectSpace::WeakKeyMap.new + should_not_accept(map, 4.2, true) + end + + it "rejects booleans as keys" do + map = ObjectSpace::WeakKeyMap.new + should_not_accept(map, true, true) + should_not_accept(map, false, true) + end + + it "rejects nil as keys" do + map = ObjectSpace::WeakKeyMap.new + should_not_accept(map, nil, true) + end + end +end diff --git a/spec/ruby/core/objectspace/weakkeymap/getkey_spec.rb b/spec/ruby/core/objectspace/weakkeymap/getkey_spec.rb new file mode 100644 index 0000000000..3af0186f27 --- /dev/null +++ b/spec/ruby/core/objectspace/weakkeymap/getkey_spec.rb @@ -0,0 +1,14 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.3" do + describe "ObjectSpace::WeakKeyMap#getkey" do + it "returns the existing equal key" do + map = ObjectSpace::WeakKeyMap.new + key1, key2 = %w[a a].map(&:upcase) + + map[key1] = true + map.getkey(key2).should equal(key1) + map.getkey("X").should == nil + end + end +end diff --git a/spec/ruby/core/objectspace/weakkeymap/inspect_spec.rb b/spec/ruby/core/objectspace/weakkeymap/inspect_spec.rb new file mode 100644 index 0000000000..557fbc8733 --- /dev/null +++ b/spec/ruby/core/objectspace/weakkeymap/inspect_spec.rb @@ -0,0 +1,17 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.3" do + describe "ObjectSpace::WeakKeyMap#inspect" do + it "only displays size in output" do + map = ObjectSpace::WeakKeyMap.new + key1, key2, key3 = "foo", "bar", "bar" + map.inspect.should =~ /\A\#<ObjectSpace::WeakKeyMap:0x\h+ size=0>\z/ + map[key1] = 1 + map.inspect.should =~ /\A\#<ObjectSpace::WeakKeyMap:0x\h+ size=1>\z/ + map[key2] = 2 + map.inspect.should =~ /\A\#<ObjectSpace::WeakKeyMap:0x\h+ size=2>\z/ + map[key3] = 3 + map.inspect.should =~ /\A\#<ObjectSpace::WeakKeyMap:0x\h+ size=2>\z/ + end + end +end diff --git a/spec/ruby/core/objectspace/weakkeymap/key_spec.rb b/spec/ruby/core/objectspace/weakkeymap/key_spec.rb new file mode 100644 index 0000000000..2af9c2b8e7 --- /dev/null +++ b/spec/ruby/core/objectspace/weakkeymap/key_spec.rb @@ -0,0 +1,33 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.3" do + describe "ObjectSpace::WeakKeyMap#key?" do + it "recognizes keys in use" do + map = ObjectSpace::WeakKeyMap.new + key1, key2 = %w[a b].map(&:upcase) + ref1, ref2 = %w[x y] + + map[key1] = ref1 + map.key?(key1).should == true + map[key1] = ref1 + map.key?(key1).should == true + map[key2] = ref2 + map.key?(key2).should == true + end + + it "matches using equality semantics" do + map = ObjectSpace::WeakKeyMap.new + key1, key2 = %w[a a].map(&:upcase) + ref = "x" + map[key1] = ref + map.key?(key2).should == true + end + + it "reports true if the pair exists and the value is nil" do + map = ObjectSpace::WeakKeyMap.new + key = Object.new + map[key] = nil + map.key?(key).should == true + end + end +end diff --git a/spec/ruby/core/objectspace/weakmap/delete_spec.rb b/spec/ruby/core/objectspace/weakmap/delete_spec.rb new file mode 100644 index 0000000000..302de264fb --- /dev/null +++ b/spec/ruby/core/objectspace/weakmap/delete_spec.rb @@ -0,0 +1,30 @@ +require_relative '../../../spec_helper' + +ruby_version_is '3.3' do + describe "ObjectSpace::WeakMap#delete" do + it "removes the entry and returns the deleted value" do + m = ObjectSpace::WeakMap.new + key = Object.new + value = Object.new + m[key] = value + + m.delete(key).should == value + m.key?(key).should == false + end + + it "calls supplied block if the key is not found" do + key = Object.new + m = ObjectSpace::WeakMap.new + return_value = m.delete(key) do |yielded_key| + yielded_key.should == key + 5 + end + return_value.should == 5 + end + + it "returns nil if the key is not found when no block is given" do + m = ObjectSpace::WeakMap.new + m.delete(Object.new).should == nil + end + end +end diff --git a/spec/ruby/core/objectspace/weakmap/element_set_spec.rb b/spec/ruby/core/objectspace/weakmap/element_set_spec.rb index 2b53650148..8588877158 100644 --- a/spec/ruby/core/objectspace/weakmap/element_set_spec.rb +++ b/spec/ruby/core/objectspace/weakmap/element_set_spec.rb @@ -17,45 +17,22 @@ describe "ObjectSpace::WeakMap#[]=" do map[key1].should == ref1 end - ruby_version_is ""..."2.7" do - it "does not accept primitive or frozen keys or values" do - map = ObjectSpace::WeakMap.new - x = Object.new - -> { map[true] = x }.should raise_error(ArgumentError) - -> { map[false] = x }.should raise_error(ArgumentError) - -> { map[nil] = x }.should raise_error(ArgumentError) - -> { map[42] = x }.should raise_error(ArgumentError) - -> { map[:foo] = x }.should raise_error(ArgumentError) - -> { map[x] = true }.should raise_error(ArgumentError) - -> { map[x] = false }.should raise_error(ArgumentError) - -> { map[x] = nil }.should raise_error(ArgumentError) - -> { map[x] = 42 }.should raise_error(ArgumentError) - -> { map[x] = :foo }.should raise_error(ArgumentError) - - y = Object.new.freeze - -> { map[x] = y}.should raise_error(FrozenError) - -> { map[y] = x}.should raise_error(FrozenError) - end - end - - ruby_version_is "2.7" do - it "accepts primitive or frozen keys or values" do - map = ObjectSpace::WeakMap.new - x = Object.new - should_accept(map, true, x) - should_accept(map, false, x) - should_accept(map, nil, x) - should_accept(map, 42, x) - should_accept(map, :foo, x) + it "accepts primitive or frozen keys or values" do + map = ObjectSpace::WeakMap.new + x = Object.new + should_accept(map, true, x) + should_accept(map, false, x) + should_accept(map, nil, x) + should_accept(map, 42, x) + should_accept(map, :foo, x) - should_accept(map, x, true) - should_accept(map, x, false) - should_accept(map, x, 42) - should_accept(map, x, :foo) + should_accept(map, x, true) + should_accept(map, x, false) + should_accept(map, x, 42) + should_accept(map, x, :foo) - y = Object.new.freeze - should_accept(map, x, y) - should_accept(map, y, x) - end + y = Object.new.freeze + should_accept(map, x, y) + should_accept(map, y, x) end end diff --git a/spec/ruby/core/objectspace/weakmap/shared/include.rb b/spec/ruby/core/objectspace/weakmap/shared/include.rb index f9c174b6d1..1770eeac8b 100644 --- a/spec/ruby/core/objectspace/weakmap/shared/include.rb +++ b/spec/ruby/core/objectspace/weakmap/shared/include.rb @@ -20,15 +20,11 @@ describe :weakmap_include?, shared: true do map.send(@method, key2).should == false end - ruby_version_is "2.7" do - ruby_bug "#16826", "2.7.0"..."2.7.2" do - it "reports true if the pair exists and the value is nil" do - map = ObjectSpace::WeakMap.new - key = Object.new - map[key] = nil - map.size.should == 1 - map.send(@method, key).should == true - end - end + it "reports true if the pair exists and the value is nil" do + map = ObjectSpace::WeakMap.new + key = Object.new + map[key] = nil + map.size.should == 1 + map.send(@method, key).should == true end end diff --git a/spec/ruby/core/proc/arity_spec.rb b/spec/ruby/core/proc/arity_spec.rb index f7cb5ad0f8..5c7728cb30 100644 --- a/spec/ruby/core/proc/arity_spec.rb +++ b/spec/ruby/core/proc/arity_spec.rb @@ -268,6 +268,14 @@ describe "Proc#arity" do @a.arity.should == 3 @b.arity.should == 3 end + + # implicit rest + evaluate <<-ruby do + @a = lambda { |a, | } + ruby + + @a.arity.should == 1 + end end context "returns negative values" do @@ -530,6 +538,14 @@ describe "Proc#arity" do @a.arity.should == 1 @b.arity.should == 5 end + + # implicit rest + evaluate <<-ruby do + @a = proc { |a, | } + ruby + + @a.arity.should == 1 + end end context "returns negative values" do diff --git a/spec/ruby/core/proc/block_pass_spec.rb b/spec/ruby/core/proc/block_pass_spec.rb index 99255139d4..411c0bf3db 100644 --- a/spec/ruby/core/proc/block_pass_spec.rb +++ b/spec/ruby/core/proc/block_pass_spec.rb @@ -19,25 +19,3 @@ describe "Proc as a block pass argument" do p.should == p2 end end - -ruby_version_is ""..."2.7" do - describe "Proc as an implicit block pass argument" do - def revivify - Proc.new - end - - it "remains the same object if re-vivified by the target method" do - p = Proc.new {} - p2 = revivify(&p) - p.should equal p2 - p.should == p2 - end - - it "remains the same object if reconstructed with Proc.new" do - p = Proc.new {} - p2 = Proc.new(&p) - p.should equal p2 - p.should == p2 - end - end -end diff --git a/spec/ruby/core/proc/clone_spec.rb b/spec/ruby/core/proc/clone_spec.rb index a1a1292654..7eca9c561e 100644 --- a/spec/ruby/core/proc/clone_spec.rb +++ b/spec/ruby/core/proc/clone_spec.rb @@ -3,4 +3,13 @@ require_relative 'shared/dup' describe "Proc#clone" do it_behaves_like :proc_dup, :clone + + ruby_bug "cloning a frozen proc is broken on Ruby 3.3", "3.3"..."3.4" do + it "preserves frozen status" do + proc = Proc.new { } + proc.freeze + proc.frozen?.should == true + proc.clone.frozen?.should == true + end + end end diff --git a/spec/ruby/core/proc/compose_spec.rb b/spec/ruby/core/proc/compose_spec.rb index 803a32af7b..9e9b57e06f 100644 --- a/spec/ruby/core/proc/compose_spec.rb +++ b/spec/ruby/core/proc/compose_spec.rb @@ -37,34 +37,22 @@ describe "Proc#<<" do (f << g).should_not.lambda? end - ruby_version_is(''...'3.0') do - it "is a Proc when other is lambda" do - f = proc { |x| x * x } - g = -> x { x + x } - - (f << g).is_a?(Proc).should == true - (f << g).should_not.lambda? - end - - it "is a lambda when self is lambda" do - f = -> x { x * x } - g = proc { |x| x + x } - - (f << g).is_a?(Proc).should == true - (f << g).should.lambda? - end - end + it "is a lambda when parameter is lambda" do + f = -> x { x * x } + g = proc { |x| x + x } + lambda_proc = -> x { x } + + # lambda << proc + (f << g).is_a?(Proc).should == true + (f << g).should_not.lambda? - ruby_version_is('3.0') do - it "is a lambda when parameter is lambda" do - f = -> x { x * x } - g = proc { |x| x + x } - lambda_proc = -> x { x } + # lambda << lambda + (f << lambda_proc).is_a?(Proc).should == true + (f << lambda_proc).should.lambda? - (f << g).is_a?(Proc).should == true - (f << g).should_not.lambda? - (f << lambda_proc).should.lambda? - end + # proc << lambda + (g << f).is_a?(Proc).should == true + (g << f).should.lambda? end it "may accept multiple arguments" do diff --git a/spec/ruby/core/proc/dup_spec.rb b/spec/ruby/core/proc/dup_spec.rb index 6da2f3080c..dd19b3c1e9 100644 --- a/spec/ruby/core/proc/dup_spec.rb +++ b/spec/ruby/core/proc/dup_spec.rb @@ -3,4 +3,11 @@ require_relative 'shared/dup' describe "Proc#dup" do it_behaves_like :proc_dup, :dup + + it "resets frozen status" do + proc = Proc.new { } + proc.freeze + proc.frozen?.should == true + proc.dup.frozen?.should == false + end end diff --git a/spec/ruby/core/proc/eql_spec.rb b/spec/ruby/core/proc/eql_spec.rb index 5f38af72d9..ad8f6749fc 100644 --- a/spec/ruby/core/proc/eql_spec.rb +++ b/spec/ruby/core/proc/eql_spec.rb @@ -2,11 +2,5 @@ require_relative '../../spec_helper' require_relative 'shared/equal' describe "Proc#eql?" do - ruby_version_is "0"..."3.0" do - it_behaves_like :proc_equal_undefined, :eql? - end - - ruby_version_is "3.0" do - it_behaves_like :proc_equal, :eql? - end + it_behaves_like :proc_equal, :eql? end diff --git a/spec/ruby/core/proc/equal_value_spec.rb b/spec/ruby/core/proc/equal_value_spec.rb index 4c336331d7..ec7f274732 100644 --- a/spec/ruby/core/proc/equal_value_spec.rb +++ b/spec/ruby/core/proc/equal_value_spec.rb @@ -2,11 +2,5 @@ require_relative '../../spec_helper' require_relative 'shared/equal' describe "Proc#==" do - ruby_version_is "0"..."3.0" do - it_behaves_like :proc_equal_undefined, :== - end - - ruby_version_is "3.0" do - it_behaves_like :proc_equal, :== - end + it_behaves_like :proc_equal, :== end diff --git a/spec/ruby/core/proc/fixtures/proc_aref.rb b/spec/ruby/core/proc/fixtures/proc_aref.rb index a305667797..8ee355b14c 100644 --- a/spec/ruby/core/proc/fixtures/proc_aref.rb +++ b/spec/ruby/core/proc/fixtures/proc_aref.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false module ProcArefSpecs def self.aref proc {|a| a }["sometext"] diff --git a/spec/ruby/core/proc/lambda_spec.rb b/spec/ruby/core/proc/lambda_spec.rb index b2d3f50350..5c3c38fc2a 100644 --- a/spec/ruby/core/proc/lambda_spec.rb +++ b/spec/ruby/core/proc/lambda_spec.rb @@ -14,9 +14,11 @@ describe "Proc#lambda?" do Proc.new {}.lambda?.should be_false end - it "is preserved when passing a Proc with & to the lambda keyword" do - suppress_warning {lambda(&->{})}.lambda?.should be_true - suppress_warning {lambda(&proc{})}.lambda?.should be_false + ruby_version_is ""..."3.3" do + it "is preserved when passing a Proc with & to the lambda keyword" do + suppress_warning {lambda(&->{})}.lambda?.should be_true + suppress_warning {lambda(&proc{})}.lambda?.should be_false + end end it "is preserved when passing a Proc with & to the proc keyword" do diff --git a/spec/ruby/core/proc/new_spec.rb b/spec/ruby/core/proc/new_spec.rb index 6d5eb67a4b..b2b7387756 100644 --- a/spec/ruby/core/proc/new_spec.rb +++ b/spec/ruby/core/proc/new_spec.rb @@ -94,20 +94,6 @@ describe "Proc.new with an associated block" do obj.first.should == :a obj.second.should == 2 end - - ruby_version_is ""..."2.7" do - it "returns a new Proc instance from the block passed to the containing method" do - prc = ProcSpecs.new_proc_in_method { "hello" } - prc.should be_an_instance_of(Proc) - prc.call.should == "hello" - end - - it "returns a new Proc instance from the block passed to the containing method" do - prc = ProcSpecs.new_proc_subclass_in_method { "hello" } - prc.should be_an_instance_of(ProcSpecs::ProcSubclass) - prc.call.should == "hello" - end - end end describe "Proc.new with a block argument" do @@ -180,59 +166,13 @@ describe "Proc.new without a block" do -> { ProcSpecs.new_proc_subclass_in_method }.should raise_error(ArgumentError) end - ruby_version_is ""..."2.7" do - it "uses the implicit block from an enclosing method" do - def some_method - Proc.new - end - - prc = some_method { "hello" } - - prc.call.should == "hello" - end - - it "uses the implicit block from an enclosing method when called inside a block" do - def some_method - proc do |&block| - Proc.new - end.call { "failing" } - end - prc = some_method { "hello" } - - prc.call.should == "hello" - end - end - - ruby_version_is "2.7"..."3.0" do - it "can be created if invoked from within a method with a block" do - -> { ProcSpecs.new_proc_in_method { "hello" } }.should complain(/Capturing the given block using Proc.new is deprecated/) - end - - it "can be created if invoked on a subclass from within a method with a block" do - -> { ProcSpecs.new_proc_subclass_in_method { "hello" } }.should complain(/Capturing the given block using Proc.new is deprecated/) - end - - - it "can be create when called with no block" do - def some_method - Proc.new - end - - -> { - some_method { "hello" } - }.should complain(/Capturing the given block using Proc.new is deprecated/) + it "raises an ArgumentError when passed no block" do + def some_method + Proc.new end - end - ruby_version_is "3.0" do - it "raises an ArgumentError when passed no block" do - def some_method - Proc.new - end - - -> { ProcSpecs.new_proc_in_method { "hello" } }.should raise_error(ArgumentError, 'tried to create Proc object without a block') - -> { ProcSpecs.new_proc_subclass_in_method { "hello" } }.should raise_error(ArgumentError, 'tried to create Proc object without a block') - -> { some_method { "hello" } }.should raise_error(ArgumentError, 'tried to create Proc object without a block') - end + -> { ProcSpecs.new_proc_in_method { "hello" } }.should raise_error(ArgumentError, 'tried to create Proc object without a block') + -> { ProcSpecs.new_proc_subclass_in_method { "hello" } }.should raise_error(ArgumentError, 'tried to create Proc object without a block') + -> { some_method { "hello" } }.should raise_error(ArgumentError, 'tried to create Proc object without a block') end end diff --git a/spec/ruby/core/proc/parameters_spec.rb b/spec/ruby/core/proc/parameters_spec.rb index 5fb5cf418d..972596d2ea 100644 --- a/spec/ruby/core/proc/parameters_spec.rb +++ b/spec/ruby/core/proc/parameters_spec.rb @@ -20,6 +20,31 @@ describe "Proc#parameters" do proc {|x| }.parameters.first.first.should == :opt end + ruby_version_is "3.2" do + it "sets the first element of each sub-Array to :req for required argument if lambda keyword used" do + proc {|x| }.parameters(lambda: true).first.first.should == :req + proc {|y,*x| }.parameters(lambda: true).first.first.should == :req + end + + it "regards named parameters in procs as required if lambda keyword used" do + proc {|x| }.parameters(lambda: true).first.first.should == :req + end + + it "regards named parameters in lambda as optional if lambda: false keyword used" do + -> x { }.parameters(lambda: false).first.first.should == :opt + end + + it "regards named parameters in procs and lambdas as required if lambda keyword is truthy" do + proc {|x| }.parameters(lambda: 123).first.first.should == :req + -> x { }.parameters(lambda: 123).first.first.should == :req + end + + it "ignores the lambda keyword if it is nil" do + proc {|x|}.parameters(lambda: nil).first.first.should == :opt + -> x { }.parameters(lambda: nil).first.first.should == :req + end + end + it "regards optional keyword parameters in procs as optional" do proc {|x: :y| }.parameters.first.first.should == :key end @@ -76,12 +101,39 @@ describe "Proc#parameters" do proc {|&block| }.parameters.first.last.should == :block end - it "ignores unnamed rest args" do + it "ignores unnamed rest arguments" do -> x {}.parameters.should == [[:req, :x]] end - it "adds nameless rest arg for \"star\" argument" do - -> x, * {}.parameters.should == [[:req, :x], [:rest]] + it "ignores implicit rest arguments" do + proc { |x, | }.parameters.should == [[:opt, :x]] + -> x { }.parameters.should == [[:req, :x]] + end + + ruby_version_is '3.2' do + it "adds rest arg with name * for \"star\" argument" do + -> * {}.parameters.should == [[:rest, :*]] + end + + it "adds keyrest arg with ** as a name for \"double star\" argument" do + -> ** {}.parameters.should == [[:keyrest, :**]] + end + end + + ruby_version_is ''...'3.2' do + it "adds nameless rest arg for \"star\" argument" do + -> * {}.parameters.should == [[:rest]] + end + + it "adds nameless keyrest arg for \"double star\" argument" do + -> ** {}.parameters.should == [[:keyrest]] + end + end + + ruby_version_is '3.1' do + it "adds block arg with name & for anonymous block argument" do + eval('-> & {}.parameters').should == [[:block, :&]] + end end it "does not add locals as block options with a block and splat" do @@ -92,4 +144,34 @@ describe "Proc#parameters" do local_is_not_parameter = {} end.parameters.should == [[:rest, :args], [:block, :blk]] end + + it "returns all parameters defined with the name _ as _" do + proc = proc {|_, _, _ = 1, *_, _:, _: 2, **_, &_| } + proc.parameters.should == [ + [:opt, :_], + [:opt, :_], + [:opt, :_], + [:rest, :_], + [:keyreq, :_], + [:key, :_], + [:keyrest, :_], + [:block, :_] + ] + + lambda = -> _, _, _ = 1, *_, _:, _: 2, **_, &_ {} + lambda.parameters.should == [ + [:req, :_], + [:req, :_], + [:opt, :_], + [:rest, :_], + [:keyreq, :_], + [:key, :_], + [:keyrest, :_], + [:block, :_] + ] + end + + it "returns :nokey for **nil parameter" do + proc { |**nil| }.parameters.should == [[:nokey]] + end end diff --git a/spec/ruby/core/proc/ruby2_keywords_spec.rb b/spec/ruby/core/proc/ruby2_keywords_spec.rb index 4f6bc151b6..ab67302231 100644 --- a/spec/ruby/core/proc/ruby2_keywords_spec.rb +++ b/spec/ruby/core/proc/ruby2_keywords_spec.rb @@ -1,64 +1,56 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Proc#ruby2_keywords" do - it "marks the final hash argument as keyword hash" do - f = -> *a { a.last } - f.ruby2_keywords - - last = f.call(1, 2, a: "a") - Hash.ruby2_keywords_hash?(last).should == true - end +describe "Proc#ruby2_keywords" do + it "marks the final hash argument as keyword hash" do + f = -> *a { a.last } + f.ruby2_keywords - ruby_version_is "2.7" ... "3.0" do - it "fixes delegation warnings when calling a method accepting keywords" do - obj = Object.new - def obj.foo(*a, **b) end + last = f.call(1, 2, a: "a") + Hash.ruby2_keywords_hash?(last).should == true + end - f = -> *a { obj.foo(*a) } + it "applies to the underlying method and applies across duplication" do + f1 = -> *a { a.last } + f1.ruby2_keywords + f2 = f1.dup - -> { f.call(1, 2, {a: "a"}) }.should complain(/Using the last argument as keyword parameters is deprecated/) - f.ruby2_keywords - -> { f.call(1, 2, {a: "a"}) }.should_not complain - end + Hash.ruby2_keywords_hash?(f1.call(1, 2, a: "a")).should == true + Hash.ruby2_keywords_hash?(f2.call(1, 2, a: "a")).should == true - it "fixes delegation warnings when calling a proc accepting keywords" do - g = -> *a, **b { } - f = -> *a { g.call(*a) } + f3 = -> *a { a.last } + f4 = f3.dup + f3.ruby2_keywords - -> { f.call(1, 2, {a: "a"}) }.should complain(/Using the last argument as keyword parameters is deprecated/) - f.ruby2_keywords - -> { f.call(1, 2, {a: "a"}) }.should_not complain - end - end + Hash.ruby2_keywords_hash?(f3.call(1, 2, a: "a")).should == true + Hash.ruby2_keywords_hash?(f4.call(1, 2, a: "a")).should == true + end - it "returns self" do - f = -> *a { } - f.ruby2_keywords.should equal f - end + it "returns self" do + f = -> *a { } + f.ruby2_keywords.should equal f + end - it "prints warning when a proc does not accept argument splat" do - f = -> a, b, c { } + it "prints warning when a proc does not accept argument splat" do + f = -> a, b, c { } - -> { - f.ruby2_keywords - }.should complain(/Skipping set of ruby2_keywords flag for/) - end + -> { + f.ruby2_keywords + }.should complain(/Skipping set of ruby2_keywords flag for/) + end - it "prints warning when a proc accepts keywords" do - f = -> a:, b: { } + it "prints warning when a proc accepts keywords" do + f = -> a:, b: { } - -> { - f.ruby2_keywords - }.should complain(/Skipping set of ruby2_keywords flag for/) - end + -> { + f.ruby2_keywords + }.should complain(/Skipping set of ruby2_keywords flag for/) + end - it "prints warning when a proc accepts keyword splat" do - f = -> **a { } + it "prints warning when a proc accepts keyword splat" do + f = -> **a { } - -> { - f.ruby2_keywords - }.should complain(/Skipping set of ruby2_keywords flag for/) - end + -> { + f.ruby2_keywords + }.should complain(/Skipping set of ruby2_keywords flag for/) end end diff --git a/spec/ruby/core/proc/shared/compose.rb b/spec/ruby/core/proc/shared/compose.rb index e3ae7f76b8..3d3f3b310d 100644 --- a/spec/ruby/core/proc/shared/compose.rb +++ b/spec/ruby/core/proc/shared/compose.rb @@ -1,47 +1,22 @@ describe :proc_compose, shared: true do - ruby_version_is ""..."2.7" do - it "raises NoMethodError when called if passed not callable object" do - not_callable = Object.new - composed = @object.call.send(@method, not_callable) + it "raises TypeError if passed not callable object" do + lhs = @object.call + not_callable = Object.new - -> { - composed.call('a') - }.should raise_error(NoMethodError, /undefined method `call' for/) + -> { + lhs.send(@method, not_callable) + }.should raise_error(TypeError, "callable object is expected") - end - - it "when called does not try to coerce argument with #to_proc" do - succ = Object.new - def succ.to_proc(s); s.succ; end - - composed = @object.call.send(@method, succ) - - -> { - composed.call('a') - }.should raise_error(NoMethodError, /undefined method `call' for/) - end end - ruby_version_is "2.7" do # https://bugs.ruby-lang.org/issues/15428 - it "raises TypeError if passed not callable object" do - lhs = @object.call - not_callable = Object.new - - -> { - lhs.send(@method, not_callable) - }.should raise_error(TypeError, "callable object is expected") - - end - - it "does not try to coerce argument with #to_proc" do - lhs = @object.call + it "does not try to coerce argument with #to_proc" do + lhs = @object.call - succ = Object.new - def succ.to_proc(s); s.succ; end + succ = Object.new + def succ.to_proc(s); s.succ; end - -> { - lhs.send(@method, succ) - }.should raise_error(TypeError, "callable object is expected") - end + -> { + lhs.send(@method, succ) + }.should raise_error(TypeError, "callable object is expected") end end diff --git a/spec/ruby/core/proc/shared/dup.rb b/spec/ruby/core/proc/shared/dup.rb index eda1d6929d..c419a4078a 100644 --- a/spec/ruby/core/proc/shared/dup.rb +++ b/spec/ruby/core/proc/shared/dup.rb @@ -7,4 +7,35 @@ describe :proc_dup, shared: true do a.call.should == b.call end + + ruby_version_is "3.2" do + it "returns an instance of subclass" do + cl = Class.new(Proc) + + cl.new{}.send(@method).class.should == cl + end + end + + ruby_version_is "3.4" do + it "copies instance variables" do + proc = -> { "hello" } + proc.instance_variable_set(:@ivar, 1) + cl = proc.send(@method) + cl.instance_variables.should == [:@ivar] + end + + it "copies the finalizer" do + code = <<-RUBY + obj = Proc.new { } + + ObjectSpace.define_finalizer(obj, Proc.new { STDOUT.write "finalized\n" }) + + obj.clone + + exit 0 + RUBY + + ruby_exe(code).lines.sort.should == ["finalized\n", "finalized\n"] + end + end end diff --git a/spec/ruby/core/proc/shared/equal.rb b/spec/ruby/core/proc/shared/equal.rb index 0c0020ca7f..d0503fb064 100644 --- a/spec/ruby/core/proc/shared/equal.rb +++ b/spec/ruby/core/proc/shared/equal.rb @@ -81,20 +81,3 @@ describe :proc_equal, shared: true do p.send(@method, p2).should be_false end end - -describe :proc_equal_undefined, shared: true do - it "is not defined" do - Proc.should_not have_instance_method(@method, false) - end - - it "returns false if other is a dup of the original" do - p = proc { :foo } - p.send(@method, p.dup).should be_false - - p = Proc.new { :foo } - p.send(@method, p.dup).should be_false - - p = -> { :foo } - p.send(@method, p.dup).should be_false - end -end diff --git a/spec/ruby/core/proc/shared/to_s.rb b/spec/ruby/core/proc/shared/to_s.rb index 7f167a3d9d..a52688a89f 100644 --- a/spec/ruby/core/proc/shared/to_s.rb +++ b/spec/ruby/core/proc/shared/to_s.rb @@ -1,9 +1,7 @@ describe :proc_to_s, shared: true do - sep = ruby_version_is("2.7") ? " " : "@" - describe "for a proc created with Proc.new" do it "returns a description including file and line number" do - Proc.new { "hello" }.send(@method).should =~ /^#<Proc:([^ ]*?)#{sep}#{Regexp.escape __FILE__}:#{__LINE__ }>$/ + Proc.new { "hello" }.send(@method).should =~ /^#<Proc:([^ ]*?) #{Regexp.escape __FILE__}:#{__LINE__ }>$/ end it "has a binary encoding" do @@ -13,7 +11,7 @@ describe :proc_to_s, shared: true do describe "for a proc created with lambda" do it "returns a description including '(lambda)' and including file and line number" do - -> { "hello" }.send(@method).should =~ /^#<Proc:([^ ]*?)#{sep}#{Regexp.escape __FILE__}:#{__LINE__ } \(lambda\)>$/ + -> { "hello" }.send(@method).should =~ /^#<Proc:([^ ]*?) #{Regexp.escape __FILE__}:#{__LINE__ } \(lambda\)>$/ end it "has a binary encoding" do @@ -23,7 +21,7 @@ describe :proc_to_s, shared: true do describe "for a proc created with proc" do it "returns a description including file and line number" do - proc { "hello" }.send(@method).should =~ /^#<Proc:([^ ]*?)#{sep}#{Regexp.escape __FILE__}:#{__LINE__ }>$/ + proc { "hello" }.send(@method).should =~ /^#<Proc:([^ ]*?) #{Regexp.escape __FILE__}:#{__LINE__ }>$/ end it "has a binary encoding" do @@ -33,13 +31,13 @@ describe :proc_to_s, shared: true do describe "for a proc created with UnboundMethod#to_proc" do it "returns a description including '(lambda)' and optionally including file and line number" do - def hello; end - s = method("hello").to_proc.send(@method) - if s.include? __FILE__ - s.should =~ /^#<Proc:([^ ]*?)#{sep}#{Regexp.escape __FILE__}:#{__LINE__ - 3} \(lambda\)>$/ - else - s.should =~ /^#<Proc:([^ ]*?) \(lambda\)>$/ - end + def hello; end + s = method("hello").to_proc.send(@method) + if s.include? __FILE__ + s.should =~ /^#<Proc:([^ ]*?) #{Regexp.escape __FILE__}:#{__LINE__ - 3} \(lambda\)>$/ + else + s.should =~ /^#<Proc:([^ ]*?) \(lambda\)>$/ + end end it "has a binary encoding" do diff --git a/spec/ruby/core/proc/source_location_spec.rb b/spec/ruby/core/proc/source_location_spec.rb index f268499b82..a8b99287d5 100644 --- a/spec/ruby/core/proc/source_location_spec.rb +++ b/spec/ruby/core/proc/source_location_spec.rb @@ -19,19 +19,19 @@ describe "Proc#source_location" do it "sets the first value to the path of the file in which the proc was defined" do file = @proc.source_location.first file.should be_an_instance_of(String) - file.should == File.realpath('../fixtures/source_location.rb', __FILE__) + file.should == File.realpath('fixtures/source_location.rb', __dir__) file = @proc_new.source_location.first file.should be_an_instance_of(String) - file.should == File.realpath('../fixtures/source_location.rb', __FILE__) + file.should == File.realpath('fixtures/source_location.rb', __dir__) file = @lambda.source_location.first file.should be_an_instance_of(String) - file.should == File.realpath('../fixtures/source_location.rb', __FILE__) + file.should == File.realpath('fixtures/source_location.rb', __dir__) file = @method.source_location.first file.should be_an_instance_of(String) - file.should == File.realpath('../fixtures/source_location.rb', __FILE__) + file.should == File.realpath('fixtures/source_location.rb', __dir__) end it "sets the last value to an Integer representing the line on which the proc was defined" do @@ -83,4 +83,9 @@ describe "Proc#source_location" do proc.source_location.should == nil end + + it "works for eval with a given line" do + proc = eval('-> {}', nil, "foo", 100) + proc.source_location.should == ["foo", 100] + end end diff --git a/spec/ruby/core/process/_fork_spec.rb b/spec/ruby/core/process/_fork_spec.rb new file mode 100644 index 0000000000..6f711ad2dd --- /dev/null +++ b/spec/ruby/core/process/_fork_spec.rb @@ -0,0 +1,24 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + describe "Process._fork" do + it "for #respond_to? returns the same as Process.respond_to?(:fork)" do + Process.respond_to?(:_fork).should == Process.respond_to?(:fork) + end + + guard_not -> { Process.respond_to?(:fork) } do + it "raises a NotImplementedError when called" do + -> { Process._fork }.should raise_error(NotImplementedError) + end + end + + guard -> { Process.respond_to?(:fork) } do + it "is called by Process#fork" do + Process.should_receive(:_fork).once.and_return(42) + + pid = Process.fork {} + pid.should equal(42) + end + end + end +end diff --git a/spec/ruby/core/process/argv0_spec.rb b/spec/ruby/core/process/argv0_spec.rb new file mode 100644 index 0000000000..f5aba719e9 --- /dev/null +++ b/spec/ruby/core/process/argv0_spec.rb @@ -0,0 +1,25 @@ +require_relative '../../spec_helper' + +describe "Process.argv0" do + it "returns a String" do + Process.argv0.should be_kind_of(String) + end + + it "is the path given as the main script and the same as __FILE__" do + script = "fixtures/argv0.rb" + + Dir.chdir(__dir__) do + ruby_exe(script).should == "#{script}\n#{script}\nOK" + end + end + + ruby_bug "#19597", ""..."3.3" do + it "returns a frozen object" do + Process.argv0.should.frozen? + end + end + + it "returns every time the same object" do + Process.argv0.should.equal?(Process.argv0) + end +end diff --git a/spec/ruby/core/process/clock_gettime_spec.rb b/spec/ruby/core/process/clock_gettime_spec.rb index 59e1406e02..6c1a52f21e 100644 --- a/spec/ruby/core/process/clock_gettime_spec.rb +++ b/spec/ruby/core/process/clock_gettime_spec.rb @@ -52,7 +52,7 @@ describe "Process.clock_gettime" do end # These specs need macOS 10.12+ / darwin 16+ - guard_not -> { platform_is_not(:darwin) or RUBY_PLATFORM[/darwin\d+/].to_i >= 16 } do + guard -> { platform_is_not(:darwin) or kernel_version_is '16' } do platform_is :linux, :openbsd, :darwin do it "CLOCK_PROCESS_CPUTIME_ID" do Process.clock_gettime(Process::CLOCK_PROCESS_CPUTIME_ID).should be_an_instance_of(Float) @@ -65,20 +65,6 @@ describe "Process.clock_gettime" do end end - platform_is :freebsd, :openbsd do - it "CLOCK_VIRTUAL" do - Process.clock_gettime(Process::CLOCK_VIRTUAL).should be_an_instance_of(Float) - end - - it "CLOCK_PROF" do - Process.clock_gettime(Process::CLOCK_PROF).should be_an_instance_of(Float) - end - - it "CLOCK_UPTIME" do - Process.clock_gettime(Process::CLOCK_UPTIME).should be_an_instance_of(Float) - end - end - platform_is :linux, :darwin do it "CLOCK_MONOTONIC_RAW" do Process.clock_gettime(Process::CLOCK_MONOTONIC_RAW).should be_an_instance_of(Float) @@ -95,42 +81,71 @@ describe "Process.clock_gettime" do Process.clock_gettime(Process::CLOCK_UPTIME_RAW_APPROX).should be_an_instance_of(Float) end end + end - platform_is :freebsd do - it "CLOCK_REALTIME_FAST and CLOCK_REALTIME_PRECISE" do - Process.clock_gettime(Process::CLOCK_REALTIME_FAST).should be_an_instance_of(Float) - Process.clock_gettime(Process::CLOCK_REALTIME_PRECISE).should be_an_instance_of(Float) - end + platform_is :freebsd do + it "CLOCK_VIRTUAL" do + Process.clock_gettime(Process::CLOCK_VIRTUAL).should be_an_instance_of(Float) + end - it "CLOCK_MONOTONIC_FAST and CLOCK_MONOTONIC_PRECISE" do - Process.clock_gettime(Process::CLOCK_MONOTONIC_FAST).should be_an_instance_of(Float) - Process.clock_gettime(Process::CLOCK_MONOTONIC_PRECISE).should be_an_instance_of(Float) - end + it "CLOCK_PROF" do + Process.clock_gettime(Process::CLOCK_PROF).should be_an_instance_of(Float) + end + end - it "CLOCK_UPTIME_FAST and CLOCK_UPTIME_PRECISE" do - Process.clock_gettime(Process::CLOCK_UPTIME_FAST).should be_an_instance_of(Float) - Process.clock_gettime(Process::CLOCK_UPTIME_PRECISE).should be_an_instance_of(Float) - end + platform_is :freebsd, :openbsd do + it "CLOCK_UPTIME" do + Process.clock_gettime(Process::CLOCK_UPTIME).should be_an_instance_of(Float) + end + end - it "CLOCK_SECOND" do - Process.clock_gettime(Process::CLOCK_SECOND).should be_an_instance_of(Float) - end + platform_is :freebsd do + it "CLOCK_REALTIME_FAST and CLOCK_REALTIME_PRECISE" do + Process.clock_gettime(Process::CLOCK_REALTIME_FAST).should be_an_instance_of(Float) + Process.clock_gettime(Process::CLOCK_REALTIME_PRECISE).should be_an_instance_of(Float) end - platform_is :linux do - it "CLOCK_REALTIME_COARSE and CLOCK_REALTIME_ALARM" do - Process.clock_gettime(Process::CLOCK_REALTIME_COARSE).should be_an_instance_of(Float) - Process.clock_gettime(Process::CLOCK_REALTIME_ALARM).should be_an_instance_of(Float) - end + it "CLOCK_MONOTONIC_FAST and CLOCK_MONOTONIC_PRECISE" do + Process.clock_gettime(Process::CLOCK_MONOTONIC_FAST).should be_an_instance_of(Float) + Process.clock_gettime(Process::CLOCK_MONOTONIC_PRECISE).should be_an_instance_of(Float) + end - it "CLOCK_MONOTONIC_COARSE" do - Process.clock_gettime(Process::CLOCK_MONOTONIC_COARSE).should be_an_instance_of(Float) - end + it "CLOCK_UPTIME_FAST and CLOCK_UPTIME_PRECISE" do + Process.clock_gettime(Process::CLOCK_UPTIME_FAST).should be_an_instance_of(Float) + Process.clock_gettime(Process::CLOCK_UPTIME_PRECISE).should be_an_instance_of(Float) + end - it "CLOCK_BOOTTIME and CLOCK_BOOTTIME_ALARM" do - Process.clock_gettime(Process::CLOCK_BOOTTIME).should be_an_instance_of(Float) - Process.clock_gettime(Process::CLOCK_BOOTTIME_ALARM).should be_an_instance_of(Float) - end + it "CLOCK_SECOND" do + Process.clock_gettime(Process::CLOCK_SECOND).should be_an_instance_of(Float) + end + end + + guard -> { platform_is :linux and kernel_version_is '2.6.32' } do + it "CLOCK_REALTIME_COARSE" do + Process.clock_gettime(Process::CLOCK_REALTIME_COARSE).should be_an_instance_of(Float) + end + + it "CLOCK_MONOTONIC_COARSE" do + Process.clock_gettime(Process::CLOCK_MONOTONIC_COARSE).should be_an_instance_of(Float) + end + end + + guard -> { platform_is :linux and kernel_version_is '2.6.39' } do + it "CLOCK_BOOTTIME" do + skip "No Process::CLOCK_BOOTTIME" unless defined?(Process::CLOCK_BOOTTIME) + Process.clock_gettime(Process::CLOCK_BOOTTIME).should be_an_instance_of(Float) + end + end + + guard -> { platform_is "x86_64-linux" and kernel_version_is '3.0' } do + it "CLOCK_REALTIME_ALARM" do + skip "No Process::CLOCK_REALTIME_ALARM" unless defined?(Process::CLOCK_REALTIME_ALARM) + Process.clock_gettime(Process::CLOCK_REALTIME_ALARM).should be_an_instance_of(Float) + end + + it "CLOCK_BOOTTIME_ALARM" do + skip "No Process::CLOCK_BOOTTIME_ALARM" unless defined?(Process::CLOCK_BOOTTIME_ALARM) + Process.clock_gettime(Process::CLOCK_BOOTTIME_ALARM).should be_an_instance_of(Float) end end end diff --git a/spec/ruby/core/process/constants_spec.rb b/spec/ruby/core/process/constants_spec.rb index b61f5ab64e..616c54b8e1 100644 --- a/spec/ruby/core/process/constants_spec.rb +++ b/spec/ruby/core/process/constants_spec.rb @@ -1,3 +1,4 @@ +require_relative '../../spec_helper' describe "Process::Constants" do platform_is :darwin, :netbsd, :freebsd do @@ -55,12 +56,18 @@ describe "Process::Constants" do end platform_is :netbsd, :freebsd do - it "Process::RLIMIT_SBSIZE" do + it "has the correct constant values on NetBSD and FreeBSD" do Process::RLIMIT_SBSIZE.should == 9 # FIXME: what's it equal? Process::RLIMIT_AS.should == 10 end end + platform_is :freebsd do + it "has the correct constant values on FreeBSD" do + Process::RLIMIT_NPTS.should == 11 + end + end + platform_is :windows do it "does not define RLIMIT constants" do %i[ diff --git a/spec/ruby/core/process/detach_spec.rb b/spec/ruby/core/process/detach_spec.rb index 1c27ed9c2c..f13bda1f5d 100644 --- a/spec/ruby/core/process/detach_spec.rb +++ b/spec/ruby/core/process/detach_spec.rb @@ -42,5 +42,40 @@ describe "Process.detach" do thr.pid.should == pid end + + it "tolerates not existing child process pid" do + # Use a value that is close to the INT_MAX (pid usually is signed int). + # It should (at least) be greater than allowed pid limit value that depends on OS. + pid_not_existing = 2.pow(30) + + # Check that there is no a child process with this hardcoded pid. + # Command `kill 0 pid`: + # - returns "1" if a process exists and + # - raises Errno::ESRCH otherwise + -> { Process.kill(0, pid_not_existing) }.should raise_error(Errno::ESRCH) + + thr = Process.detach(pid_not_existing) + thr.join + + thr.should be_kind_of(Thread) + end + + it "calls #to_int to implicitly convert non-Integer pid to Integer" do + pid = MockObject.new('mock-enumerable') + pid.should_receive(:to_int).and_return(100500) + + Process.detach(pid).join + end + + it "raises TypeError when pid argument does not have #to_int method" do + -> { Process.detach(Object.new) }.should raise_error(TypeError, "no implicit conversion of Object into Integer") + end + + it "raises TypeError when #to_int returns non-Integer value" do + pid = MockObject.new('mock-enumerable') + pid.should_receive(:to_int).and_return(:symbol) + + -> { Process.detach(pid) }.should raise_error(TypeError, "can't convert MockObject to Integer (MockObject#to_int gives Symbol)") + end end end diff --git a/spec/ruby/core/process/egid_spec.rb b/spec/ruby/core/process/egid_spec.rb index 24dda43804..a67b623d5c 100644 --- a/spec/ruby/core/process/egid_spec.rb +++ b/spec/ruby/core/process/egid_spec.rb @@ -15,5 +15,44 @@ describe "Process.egid" do end describe "Process.egid=" do - it "needs to be reviewed for spec completeness" + + platform_is_not :windows do + it "raises TypeError if not passed an Integer or String" do + -> { Process.egid = Object.new }.should raise_error(TypeError) + end + + it "sets the effective group id to its own gid if given the username corresponding to its own gid" do + raise unless Process.gid == Process.egid + + require "etc" + group = Etc.getgrgid(Process.gid).name + + Process.egid = group + Process.egid.should == Process.gid + end + + as_user do + it "raises Errno::ERPERM if run by a non superuser trying to set the root group id" do + -> { Process.egid = 0 }.should raise_error(Errno::EPERM) + end + + platform_is :linux do + it "raises Errno::ERPERM if run by a non superuser trying to set the group id from group name" do + -> { Process.egid = "root" }.should raise_error(Errno::EPERM) + end + end + end + + as_superuser do + context "when ran by a superuser" do + it "sets the effective group id for the current process if run by a superuser" do + code = <<-RUBY + Process.egid = 1 + puts Process.egid + RUBY + ruby_exe(code).should == "1\n" + end + end + end + end end diff --git a/spec/ruby/core/process/euid_spec.rb b/spec/ruby/core/process/euid_spec.rb index a2f1bbf42e..c1ec4171d0 100644 --- a/spec/ruby/core/process/euid_spec.rb +++ b/spec/ruby/core/process/euid_spec.rb @@ -21,9 +21,19 @@ describe "Process.euid=" do -> { Process.euid = Object.new }.should raise_error(TypeError) end + it "sets the effective user id to its own uid if given the username corresponding to its own uid" do + raise unless Process.uid == Process.euid + + require "etc" + user = Etc.getpwuid(Process.uid).name + + Process.euid = user + Process.euid.should == Process.uid + end + as_user do it "raises Errno::ERPERM if run by a non superuser trying to set the superuser id" do - -> { (Process.euid = 0)}.should raise_error(Errno::EPERM) + -> { Process.euid = 0 }.should raise_error(Errno::EPERM) end it "raises Errno::ERPERM if run by a non superuser trying to set the superuser id from username" do diff --git a/spec/ruby/core/process/exec_spec.rb b/spec/ruby/core/process/exec_spec.rb index deb8913b6b..0f371b39c8 100644 --- a/spec/ruby/core/process/exec_spec.rb +++ b/spec/ruby/core/process/exec_spec.rb @@ -30,20 +30,20 @@ describe "Process.exec" do end it "raises Errno::EACCES when passed a directory" do - -> { Process.exec File.dirname(__FILE__) }.should raise_error(Errno::EACCES) + -> { Process.exec __dir__ }.should raise_error(Errno::EACCES) end it "runs the specified command, replacing current process" do - ruby_exe('Process.exec "echo hello"; puts "fail"', escape: true).should == "hello\n" + ruby_exe('Process.exec "echo hello"; puts "fail"').should == "hello\n" end it "sets the current directory when given the :chdir option" do tmpdir = tmp("")[0..-2] platform_is_not :windows do - ruby_exe("Process.exec(\"pwd\", chdir: #{tmpdir.inspect})", escape: true).should == "#{tmpdir}\n" + ruby_exe("Process.exec(\"pwd\", chdir: #{tmpdir.inspect})").should == "#{tmpdir}\n" end platform_is :windows do - ruby_exe("Process.exec(\"cd\", chdir: #{tmpdir.inspect})", escape: true).tr('\\', '/').should == "#{tmpdir}\n" + ruby_exe("Process.exec(\"cd\", chdir: #{tmpdir.inspect})").tr('\\', '/').should == "#{tmpdir}\n" end end @@ -73,13 +73,13 @@ describe "Process.exec" do platform_is_not :windows do it "subjects the specified command to shell expansion" do result = Dir.chdir(@dir) do - ruby_exe('Process.exec "echo *"', escape: true) + ruby_exe('Process.exec "echo *"') end result.chomp.should == @name end it "creates an argument array with shell parsing semantics for whitespace" do - ruby_exe('Process.exec "echo a b c d"', escape: true).should == "a b c d\n" + ruby_exe('Process.exec "echo a b c d"').should == "a b c d\n" end end @@ -87,13 +87,13 @@ describe "Process.exec" do # There is no shell expansion on Windows it "does not subject the specified command to shell expansion on Windows" do result = Dir.chdir(@dir) do - ruby_exe('Process.exec "echo *"', escape: true) + ruby_exe('Process.exec "echo *"') end result.should == "*\n" end it "does not create an argument array with shell parsing semantics for whitespace on Windows" do - ruby_exe('Process.exec "echo a b c d"', escape: true).should == "a b c d\n" + ruby_exe('Process.exec "echo a b c d"').should == "a b c d\n" end end @@ -105,7 +105,7 @@ describe "Process.exec" do platform_is :windows do cmd = '"cmd.exe", "/C", "echo", "*"' end - ruby_exe("Process.exec #{cmd}", escape: true).should == "*\n" + ruby_exe("Process.exec #{cmd}").should == "*\n" end end @@ -124,29 +124,29 @@ describe "Process.exec" do end it "sets environment variables in the child environment" do - ruby_exe('Process.exec({"FOO" => "BAR"}, "echo ' + var + '")', escape: true).should == "BAR\n" + ruby_exe('Process.exec({"FOO" => "BAR"}, "echo ' + var + '")').should == "BAR\n" end it "unsets environment variables whose value is nil" do platform_is_not :windows do - ruby_exe('Process.exec({"FOO" => nil}, "echo ' + var + '")', escape: true).should == "\n" + ruby_exe('Process.exec({"FOO" => nil}, "echo ' + var + '")').should == "\n" end platform_is :windows do # On Windows, echo-ing a non-existent env var is treated as echo-ing any other string of text - ruby_exe('Process.exec({"FOO" => nil}, "echo ' + var + '")', escape: true).should == var + "\n" + ruby_exe('Process.exec({"FOO" => nil}, "echo ' + var + '")').should == var + "\n" end end it "coerces environment argument using to_hash" do - ruby_exe('o = Object.new; def o.to_hash; {"FOO" => "BAR"}; end; Process.exec(o, "echo ' + var + '")', escape: true).should == "BAR\n" + ruby_exe('o = Object.new; def o.to_hash; {"FOO" => "BAR"}; end; Process.exec(o, "echo ' + var + '")').should == "BAR\n" end it "unsets other environment variables when given a true :unsetenv_others option" do platform_is_not :windows do - ruby_exe('Process.exec("echo ' + var + '", unsetenv_others: true)', escape: true).should == "\n" + ruby_exe('Process.exec("echo ' + var + '", unsetenv_others: true)').should == "\n" end platform_is :windows do - ruby_exe('Process.exec("' + ENV['COMSPEC'].gsub('\\', '\\\\\\') + ' /C echo ' + var + '", unsetenv_others: true)', escape: true).should == var + "\n" + ruby_exe('Process.exec("' + ENV['COMSPEC'].gsub('\\', '\\\\\\') + ' /C echo ' + var + '", unsetenv_others: true)').should == var + "\n" end end end @@ -154,19 +154,19 @@ describe "Process.exec" do describe "with a command array" do it "uses the first element as the command name and the second as the argv[0] value" do platform_is_not :windows do - ruby_exe('Process.exec(["/bin/sh", "argv_zero"], "-c", "echo $0")', escape: true).should == "argv_zero\n" + ruby_exe('Process.exec(["/bin/sh", "argv_zero"], "-c", "echo $0")').should == "argv_zero\n" end platform_is :windows do - ruby_exe('Process.exec(["cmd.exe", "/C"], "/C", "echo", "argv_zero")', escape: true).should == "argv_zero\n" + ruby_exe('Process.exec(["cmd.exe", "/C"], "/C", "echo", "argv_zero")').should == "argv_zero\n" end end it "coerces the argument using to_ary" do platform_is_not :windows do - ruby_exe('o = Object.new; def o.to_ary; ["/bin/sh", "argv_zero"]; end; Process.exec(o, "-c", "echo $0")', escape: true).should == "argv_zero\n" + ruby_exe('o = Object.new; def o.to_ary; ["/bin/sh", "argv_zero"]; end; Process.exec(o, "-c", "echo $0")').should == "argv_zero\n" end platform_is :windows do - ruby_exe('o = Object.new; def o.to_ary; ["cmd.exe", "/C"]; end; Process.exec(o, "/C", "echo", "argv_zero")', escape: true).should == "argv_zero\n" + ruby_exe('o = Object.new; def o.to_ary; ["cmd.exe", "/C"]; end; Process.exec(o, "/C", "echo", "argv_zero")').should == "argv_zero\n" end end @@ -200,7 +200,7 @@ describe "Process.exec" do end EOC - ruby_exe(cmd, escape: true) + ruby_exe(cmd) child_fd = IO.read(@child_fd_file).to_i child_fd.to_i.should > STDERR.fileno @@ -216,7 +216,7 @@ describe "Process.exec" do Process.exec("#{ruby_cmd(map_fd_fixture)} \#{f.fileno}", f.fileno => f.fileno) EOC - output = ruby_exe(cmd, escape: true) + output = ruby_exe(cmd) child_fd, close_on_exec = output.split child_fd.to_i.should > STDERR.fileno @@ -232,7 +232,7 @@ describe "Process.exec" do puts(f.close_on_exec?) EOC - output = ruby_exe(cmd, escape: true) + output = ruby_exe(cmd) output.split.should == ['true', 'false'] end end diff --git a/spec/ruby/core/process/exit_spec.rb b/spec/ruby/core/process/exit_spec.rb index 70d79d789d..4f7dc94407 100644 --- a/spec/ruby/core/process/exit_spec.rb +++ b/spec/ruby/core/process/exit_spec.rb @@ -6,5 +6,5 @@ describe "Process.exit" do end describe "Process.exit!" do - it_behaves_like :process_exit!, :exit!, Process + it_behaves_like :process_exit!, :exit!, "Process" end diff --git a/spec/ruby/core/process/fixtures/argv0.rb b/spec/ruby/core/process/fixtures/argv0.rb new file mode 100644 index 0000000000..847a3e903e --- /dev/null +++ b/spec/ruby/core/process/fixtures/argv0.rb @@ -0,0 +1,6 @@ +puts Process.argv0 +puts __FILE__ + +if Process.argv0 == __FILE__ + print "OK" +end diff --git a/spec/ruby/core/process/fixtures/kill.rb b/spec/ruby/core/process/fixtures/kill.rb index 0b88f8ee1f..b922a043f1 100644 --- a/spec/ruby/core/process/fixtures/kill.rb +++ b/spec/ruby/core/process/fixtures/kill.rb @@ -1,5 +1,3 @@ -require 'thread' - pid_file = ARGV.shift scenario = ARGV.shift diff --git a/spec/ruby/core/process/spawn_spec.rb b/spec/ruby/core/process/spawn_spec.rb index 56e02ff38a..283a7f033d 100644 --- a/spec/ruby/core/process/spawn_spec.rb +++ b/spec/ruby/core/process/spawn_spec.rb @@ -212,6 +212,26 @@ describe "Process.spawn" do end.should output_to_fd("nil\n") end + platform_is_not :windows do + it "uses the passed env['PATH'] to search the executable" do + dir = tmp("spawn_path_dir") + mkdir_p dir + begin + exe = 'process-spawn-executable-in-path' + path = "#{dir}/#{exe}" + File.write(path, "#!/bin/sh\necho $1") + File.chmod(0755, path) + + env = { "PATH" => "#{dir}#{File::PATH_SEPARATOR}#{ENV['PATH']}" } + Process.wait Process.spawn(env, exe, 'OK', out: @name) + $?.should.success? + File.read(@name).should == "OK\n" + ensure + rm_r dir + end + end + end + it "calls #to_hash to convert the environment" do o = mock("to_hash") o.should_receive(:to_hash).and_return({"FOO" => "BAR"}) @@ -329,7 +349,7 @@ describe "Process.spawn" do pgid = Process.getpgid(Process.pid) # The process group is not available on all platforms. # See "man proc" - /proc/[pid]/stat - (5) pgrp - # In Travis arm64 environment, the value is 0. + # In Travis aarch64 environment, the value is 0. # # $ cat /proc/[pid]/stat # 19179 (ruby) S 19160 0 0 ... @@ -457,6 +477,16 @@ describe "Process.spawn" do # redirection + it 'redirects to the wrapped IO using wrapped_io.to_io if out: wrapped_io' do + File.open(@name, 'w') do |file| + -> do + wrapped_io = mock('wrapped IO') + wrapped_io.should_receive(:to_io).and_return(file) + Process.wait Process.spawn('echo Hello World', out: wrapped_io) + end.should output_to_fd("Hello World\n", file) + end + end + it "redirects STDOUT to the given file descriptor if out: Integer" do File.open(@name, 'w') do |file| -> do @@ -547,6 +577,24 @@ describe "Process.spawn" do end end + platform_is_not :windows do + it "redirects non-default file descriptor to itself" do + File.open(@name, 'w') do |file| + -> do + Process.wait Process.spawn( + ruby_cmd("f = IO.new(#{file.fileno}, 'w'); f.print(:bang); f.flush"), file.fileno => file.fileno) + end.should output_to_fd("bang", file) + end + end + end + + it "redirects default file descriptor to itself" do + -> do + Process.wait Process.spawn( + ruby_cmd("f = IO.new(#{STDOUT.fileno}, 'w'); f.print(:bang); f.flush"), STDOUT.fileno => STDOUT.fileno) + end.should output_to_fd("bang", STDOUT) + end + # :close_others platform_is_not :windows do @@ -666,7 +714,7 @@ describe "Process.spawn" do end it "raises an Errno::EACCES or Errno::EISDIR when passed a directory" do - -> { Process.spawn File.dirname(__FILE__) }.should raise_error(SystemCallError) { |e| + -> { Process.spawn __dir__ }.should raise_error(SystemCallError) { |e| [Errno::EACCES, Errno::EISDIR].should include(e.class) } end diff --git a/spec/ruby/core/process/status/equal_value_spec.rb b/spec/ruby/core/process/status/equal_value_spec.rb index d85bb22214..d8a2be26b8 100644 --- a/spec/ruby/core/process/status/equal_value_spec.rb +++ b/spec/ruby/core/process/status/equal_value_spec.rb @@ -8,7 +8,7 @@ describe "Process::Status#==" do end it "returns true when compared to the integer status of a terminated child" do - ruby_exe("Process.kill(:KILL, $$); exit(29)", exit_status: platform_is(:windows) ? 0 : nil) + ruby_exe("Process.kill(:KILL, $$); exit(29)", exit_status: platform_is(:windows) ? 0 : :SIGKILL) $?.to_i.should == $? $?.should == $?.to_i end diff --git a/spec/ruby/core/process/status/exited_spec.rb b/spec/ruby/core/process/status/exited_spec.rb index 059cd5b1aa..a61292b146 100644 --- a/spec/ruby/core/process/status/exited_spec.rb +++ b/spec/ruby/core/process/status/exited_spec.rb @@ -14,7 +14,7 @@ describe "Process::Status#exited?" do describe "for a terminated child" do before :each do - ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : nil) + ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : :SIGKILL) end platform_is_not :windows do diff --git a/spec/ruby/core/process/status/exitstatus_spec.rb b/spec/ruby/core/process/status/exitstatus_spec.rb index 3087bd619e..5c86c2b3c8 100644 --- a/spec/ruby/core/process/status/exitstatus_spec.rb +++ b/spec/ruby/core/process/status/exitstatus_spec.rb @@ -11,7 +11,7 @@ describe "Process::Status#exitstatus" do describe "for a child that raised SignalException" do before :each do - ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : nil) + ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : :SIGKILL) end platform_is_not :windows do diff --git a/spec/ruby/core/process/status/signaled_spec.rb b/spec/ruby/core/process/status/signaled_spec.rb index 389092a533..c0de7b8006 100644 --- a/spec/ruby/core/process/status/signaled_spec.rb +++ b/spec/ruby/core/process/status/signaled_spec.rb @@ -13,7 +13,7 @@ describe "Process::Status#signaled?" do describe "for a terminated child" do before :each do - ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : nil) + ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : :SIGKILL) end platform_is_not :windows do diff --git a/spec/ruby/core/process/status/success_spec.rb b/spec/ruby/core/process/status/success_spec.rb index c531121f08..3589cc611f 100644 --- a/spec/ruby/core/process/status/success_spec.rb +++ b/spec/ruby/core/process/status/success_spec.rb @@ -23,7 +23,7 @@ describe "Process::Status#success?" do describe "for a child that was terminated" do before :each do - ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : nil) + ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : :SIGKILL) end platform_is_not :windows do diff --git a/spec/ruby/core/process/status/termsig_spec.rb b/spec/ruby/core/process/status/termsig_spec.rb index 1c87a6f455..9a22dbea71 100644 --- a/spec/ruby/core/process/status/termsig_spec.rb +++ b/spec/ruby/core/process/status/termsig_spec.rb @@ -6,14 +6,14 @@ describe "Process::Status#termsig" do ruby_exe("exit(0)") end - it "returns true" do + it "returns nil" do $?.termsig.should be_nil end end describe "for a child that raised SignalException" do before :each do - ruby_exe("raise SignalException, 'SIGTERM'", exit_status: nil) + ruby_exe("raise SignalException, 'SIGTERM'", exit_status: :SIGTERM) end platform_is_not :windows do @@ -25,7 +25,7 @@ describe "Process::Status#termsig" do describe "for a child that was sent a signal" do before :each do - ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : nil) + ruby_exe("Process.kill(:KILL, $$); exit(42)", exit_status: platform_is(:windows) ? 0 : :SIGKILL) end platform_is_not :windows do diff --git a/spec/ruby/core/process/status/to_i_spec.rb b/spec/ruby/core/process/status/to_i_spec.rb index 7cde9b915b..39f8e2d84c 100644 --- a/spec/ruby/core/process/status/to_i_spec.rb +++ b/spec/ruby/core/process/status/to_i_spec.rb @@ -7,7 +7,7 @@ describe "Process::Status#to_i" do end it "returns an integer when the child is signaled" do - ruby_exe('raise SignalException, "TERM"', exit_status: platform_is(:windows) ? 3 : nil) + ruby_exe('raise SignalException, "TERM"', exit_status: platform_is(:windows) ? 3 : :SIGTERM) $?.to_i.should be_an_instance_of(Integer) end end diff --git a/spec/ruby/core/process/status/wait_spec.rb b/spec/ruby/core/process/status/wait_spec.rb index b9d80e31f4..57d56209a9 100644 --- a/spec/ruby/core/process/status/wait_spec.rb +++ b/spec/ruby/core/process/status/wait_spec.rb @@ -1,102 +1,100 @@ require_relative '../../../spec_helper' require_relative '../fixtures/common' -ruby_version_is "3.0" do - describe "Process::Status.wait" do - ProcessSpecs.use_system_ruby(self) - - before :all do - begin - leaked = Process.waitall - # Ruby-space should not see PIDs used by mjit - raise "subprocesses leaked before wait specs: #{leaked}" unless leaked.empty? - rescue NotImplementedError - end +describe "Process::Status.wait" do + ProcessSpecs.use_system_ruby(self) + + before :all do + begin + leaked = Process.waitall + # Ruby-space should not see PIDs used by rjit + raise "subprocesses leaked before wait specs: #{leaked}" unless leaked.empty? + rescue NotImplementedError end + end + + it "returns a status with pid -1 if there are no child processes" do + Process::Status.wait.pid.should == -1 + end - it "returns a status with pid -1 if there are no child processes" do - Process::Status.wait.pid.should == -1 + platform_is_not :windows do + it "returns a status with its child pid" do + pid = Process.spawn(ruby_cmd('exit')) + status = Process::Status.wait + status.should be_an_instance_of(Process::Status) + status.pid.should == pid end - platform_is_not :windows do - it "returns a status with its child pid" do - pid = Process.spawn(ruby_cmd('exit')) - status = Process::Status.wait - status.should be_an_instance_of(Process::Status) - status.pid.should == pid - end + it "should not set $? to the Process::Status" do + pid = Process.spawn(ruby_cmd('exit')) + status = Process::Status.wait + $?.should_not equal(status) + end - it "should not set $? to the Process::Status" do - pid = Process.spawn(ruby_cmd('exit')) - status = Process::Status.wait - $?.should_not equal(status) - end + it "should not change the value of $?" do + pid = Process.spawn(ruby_cmd('exit')) + Process.wait + status = $? + Process::Status.wait + status.should equal($?) + end - it "should not change the value of $?" do - pid = Process.spawn(ruby_cmd('exit')) - Process.wait - status = $? - Process::Status.wait - status.should equal($?) - end + it "waits for any child process if no pid is given" do + pid = Process.spawn(ruby_cmd('exit')) + Process::Status.wait.pid.should == pid + -> { Process.kill(0, pid) }.should raise_error(Errno::ESRCH) + end - it "waits for any child process if no pid is given" do - pid = Process.spawn(ruby_cmd('exit')) - Process::Status.wait.pid.should == pid - -> { Process.kill(0, pid) }.should raise_error(Errno::ESRCH) - end + it "waits for a specific child if a pid is given" do + pid1 = Process.spawn(ruby_cmd('exit')) + pid2 = Process.spawn(ruby_cmd('exit')) + Process::Status.wait(pid2).pid.should == pid2 + Process::Status.wait(pid1).pid.should == pid1 + -> { Process.kill(0, pid1) }.should raise_error(Errno::ESRCH) + -> { Process.kill(0, pid2) }.should raise_error(Errno::ESRCH) + end - it "waits for a specific child if a pid is given" do - pid1 = Process.spawn(ruby_cmd('exit')) - pid2 = Process.spawn(ruby_cmd('exit')) - Process::Status.wait(pid2).pid.should == pid2 - Process::Status.wait(pid1).pid.should == pid1 - -> { Process.kill(0, pid1) }.should raise_error(Errno::ESRCH) - -> { Process.kill(0, pid2) }.should raise_error(Errno::ESRCH) - end + it "coerces the pid to an Integer" do + pid1 = Process.spawn(ruby_cmd('exit')) + Process::Status.wait(mock_int(pid1)).pid.should == pid1 + -> { Process.kill(0, pid1) }.should raise_error(Errno::ESRCH) + end - it "coerces the pid to an Integer" do - pid1 = Process.spawn(ruby_cmd('exit')) - Process::Status.wait(mock_int(pid1)).pid.should == pid1 - -> { Process.kill(0, pid1) }.should raise_error(Errno::ESRCH) - end + # This spec is probably system-dependent. + it "waits for a child whose process group ID is that of the calling process" do + pid1 = Process.spawn(ruby_cmd('exit'), pgroup: true) + pid2 = Process.spawn(ruby_cmd('exit')) - # This spec is probably system-dependent. - it "waits for a child whose process group ID is that of the calling process" do - pid1 = Process.spawn(ruby_cmd('exit'), pgroup: true) - pid2 = Process.spawn(ruby_cmd('exit')) + Process::Status.wait(0).pid.should == pid2 + Process::Status.wait.pid.should == pid1 + end - Process::Status.wait(0).pid.should == pid2 - Process::Status.wait.pid.should == pid1 + # This spec is probably system-dependent. + it "doesn't block if no child is available when WNOHANG is used" do + read, write = IO.pipe + pid = Process.fork do + read.close + Signal.trap("TERM") { Process.exit! } + write << 1 + write.close + sleep end - # This spec is probably system-dependent. - it "doesn't block if no child is available when WNOHANG is used" do - read, write = IO.pipe - pid = Process.fork do - read.close - Signal.trap("TERM") { Process.exit! } - write << 1 - write.close - sleep - end + Process::Status.wait(pid, Process::WNOHANG).should be_nil - Process::Status.wait(pid, Process::WNOHANG).should be_nil + # wait for the child to setup its TERM handler + write.close + read.read(1) + read.close - # wait for the child to setup its TERM handler - write.close - read.read(1) - read.close - - Process.kill("TERM", pid) - Process::Status.wait.pid.should == pid - end + Process.kill("TERM", pid) + Process::Status.wait.pid.should == pid + end - it "always accepts flags=0" do - pid = Process.spawn(ruby_cmd('exit')) - Process::Status.wait(-1, 0).pid.should == pid - -> { Process.kill(0, pid) }.should raise_error(Errno::ESRCH) - end + it "always accepts flags=0" do + pid = Process.spawn(ruby_cmd('exit')) + Process::Status.wait(-1, 0).pid.should == pid + -> { Process.kill(0, pid) }.should raise_error(Errno::ESRCH) end end end diff --git a/spec/ruby/core/process/times_spec.rb b/spec/ruby/core/process/times_spec.rb index b47189a7e7..d3bff2cda9 100644 --- a/spec/ruby/core/process/times_spec.rb +++ b/spec/ruby/core/process/times_spec.rb @@ -5,31 +5,15 @@ describe "Process.times" do Process.times.should be_kind_of(Process::Tms) end - it "returns current cpu times" do - t = Process.times - user = t.utime + # TODO: Intel C Compiler does not work this example + # http://rubyci.s3.amazonaws.com/icc-x64/ruby-master/log/20221013T030005Z.fail.html.gz + unless RbConfig::CONFIG['CC']&.include?("icx") + it "returns current cpu times" do + t = Process.times + user = t.utime - 1 until Process.times.utime > user - Process.times.utime.should > user - end - - platform_is_not :windows do - it "uses getrusage when available to improve precision beyond milliseconds" do - max = 10_000 - has_getrusage = max.times.find do - time = Process.clock_gettime(:GETRUSAGE_BASED_CLOCK_PROCESS_CPUTIME_ID) - ('%.6f' % time).end_with?('000') - end - unless has_getrusage - skip "getrusage is not supported on this environment" - end - - found = (max * 100).times.find do - time = Process.times.utime - ('%.6f' % time).end_with?('000') - end - - found.should_not == nil + 1 until Process.times.utime > user + Process.times.utime.should > user end end end diff --git a/spec/ruby/core/process/wait2_spec.rb b/spec/ruby/core/process/wait2_spec.rb index 6eb7fc6d06..8ba429dc96 100644 --- a/spec/ruby/core/process/wait2_spec.rb +++ b/spec/ruby/core/process/wait2_spec.rb @@ -4,14 +4,14 @@ describe "Process.wait2" do before :all do # HACK: this kludge is temporarily necessary because some # misbehaving spec somewhere else does not clear processes - # Note: background processes are unavoidable with MJIT, + # Note: background processes are unavoidable with RJIT, # but we shouldn't reap them from Ruby-space begin Process.wait(-1, Process::WNOHANG) $stderr.puts "Leaked process before wait2 specs! Waiting for it" leaked = Process.waitall $stderr.puts "leaked before wait2 specs: #{leaked}" unless leaked.empty? - # Ruby-space should not see PIDs used by mjit + # Ruby-space should not see PIDs used by rjit leaked.should be_empty rescue Errno::ECHILD # No child processes rescue NotImplementedError @@ -33,4 +33,13 @@ describe "Process.wait2" do -> { Process.wait2 }.should raise_error(Errno::ECHILD) -> { Process.wait2 }.should raise_error(StandardError) end + + it "returns nil if the child process is still running when given the WNOHANG flag" do + IO.popen(ruby_cmd('STDIN.getbyte'), "w") do |io| + pid, status = Process.wait2(io.pid, Process::WNOHANG) + pid.should be_nil + status.should be_nil + io.write('a') + end + end end diff --git a/spec/ruby/core/process/wait_spec.rb b/spec/ruby/core/process/wait_spec.rb index 44c95d6304..385acc9928 100644 --- a/spec/ruby/core/process/wait_spec.rb +++ b/spec/ruby/core/process/wait_spec.rb @@ -7,7 +7,7 @@ describe "Process.wait" do before :all do begin leaked = Process.waitall - # Ruby-space should not see PIDs used by mjit + # Ruby-space should not see PIDs used by rjit raise "subprocesses leaked before wait specs: #{leaked}" unless leaked.empty? rescue NotImplementedError end diff --git a/spec/ruby/core/process/waitpid_spec.rb b/spec/ruby/core/process/waitpid_spec.rb index f7cf1a45a8..a02147b663 100644 --- a/spec/ruby/core/process/waitpid_spec.rb +++ b/spec/ruby/core/process/waitpid_spec.rb @@ -2,7 +2,8 @@ require_relative '../../spec_helper' describe "Process.waitpid" do it "returns nil when the process has not yet completed and WNOHANG is specified" do - pid = spawn("sleep 5") + cmd = platform_is(:windows) ? "timeout" : "sleep" + pid = spawn("#{cmd} 5") begin Process.waitpid(pid, Process::WNOHANG).should == nil Process.kill("KILL", pid) diff --git a/spec/ruby/core/process/warmup_spec.rb b/spec/ruby/core/process/warmup_spec.rb new file mode 100644 index 0000000000..b562d52d22 --- /dev/null +++ b/spec/ruby/core/process/warmup_spec.rb @@ -0,0 +1,11 @@ +require_relative '../../spec_helper' + +describe "Process.warmup" do + ruby_version_is "3.3" do + # The behavior is entirely implementation specific. + # Other implementations are free to just make it a noop + it "is implemented" do + Process.warmup.should == true + end + end +end diff --git a/spec/ruby/core/queue/deq_spec.rb b/spec/ruby/core/queue/deq_spec.rb index 9510978eac..f84d4220ea 100644 --- a/spec/ruby/core/queue/deq_spec.rb +++ b/spec/ruby/core/queue/deq_spec.rb @@ -1,6 +1,13 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/deque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "Queue#deq" do it_behaves_like :queue_deq, :deq, -> { Queue.new } end + +describe "Queue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = Queue.new; q.push(1); q.deq(timeout: v) } + end +end diff --git a/spec/ruby/core/queue/initialize_spec.rb b/spec/ruby/core/queue/initialize_spec.rb index 83c7e595fe..c6c1ae63c5 100644 --- a/spec/ruby/core/queue/initialize_spec.rb +++ b/spec/ruby/core/queue/initialize_spec.rb @@ -7,6 +7,10 @@ describe "Queue#initialize" do q.should.empty? end + it "is a private method" do + Queue.private_instance_methods.include?(:initialize).should == true + end + ruby_version_is '3.1' do it "adds all elements of the passed Enumerable to self" do q = Queue.new([1, 2, 3]) @@ -18,21 +22,41 @@ describe "Queue#initialize" do q.should.empty? end - it "uses #to_a on the provided Enumerable" do - enumerable = MockObject.new('mock-enumerable') - enumerable.should_receive(:to_a).and_return([1, 2, 3]) - q = Queue.new(enumerable) - q.size.should == 3 - q.should_not.empty? - q.pop.should == 1 - q.pop.should == 2 - q.pop.should == 3 - q.should.empty? + describe "converts the given argument to an Array using #to_a" do + it "uses #to_a on the provided Enumerable" do + enumerable = MockObject.new('mock-enumerable') + enumerable.should_receive(:to_a).and_return([1, 2, 3]) + q = Queue.new(enumerable) + q.size.should == 3 + q.should_not.empty? + q.pop.should == 1 + q.pop.should == 2 + q.pop.should == 3 + q.should.empty? + end + + it "raises a TypeError if the given argument can't be converted to an Array" do + -> { Queue.new(42) }.should raise_error(TypeError) + -> { Queue.new(:abc) }.should raise_error(TypeError) + end + + it "raises a NoMethodError if the given argument raises a NoMethodError during type coercion to an Array" do + enumerable = MockObject.new('mock-enumerable') + enumerable.should_receive(:to_a).and_raise(NoMethodError) + -> { Queue.new(enumerable) }.should raise_error(NoMethodError) + end end - it "raises if the provided Enumerable does not respond to #to_a" do + it "raises TypeError if the provided Enumerable does not respond to #to_a" do enumerable = MockObject.new('mock-enumerable') -> { Queue.new(enumerable) }.should raise_error(TypeError, "can't convert MockObject into Array") end + + it "raises TypeError if #to_a does not return Array" do + enumerable = MockObject.new('mock-enumerable') + enumerable.should_receive(:to_a).and_return("string") + + -> { Queue.new(enumerable) }.should raise_error(TypeError, "can't convert MockObject to Array (MockObject#to_a gives String)") + end end end diff --git a/spec/ruby/core/queue/pop_spec.rb b/spec/ruby/core/queue/pop_spec.rb index 1ce9231685..d344740834 100644 --- a/spec/ruby/core/queue/pop_spec.rb +++ b/spec/ruby/core/queue/pop_spec.rb @@ -1,6 +1,13 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/deque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "Queue#pop" do it_behaves_like :queue_deq, :pop, -> { Queue.new } end + +describe "Queue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = Queue.new; q.push(1); q.pop(timeout: v) } + end +end diff --git a/spec/ruby/core/queue/shift_spec.rb b/spec/ruby/core/queue/shift_spec.rb index f84058e1df..64165e0b61 100644 --- a/spec/ruby/core/queue/shift_spec.rb +++ b/spec/ruby/core/queue/shift_spec.rb @@ -1,6 +1,13 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/deque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "Queue#shift" do it_behaves_like :queue_deq, :shift, -> { Queue.new } end + +describe "Queue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = Queue.new; q.push(1); q.shift(timeout: v) } + end +end diff --git a/spec/ruby/core/random/bytes_spec.rb b/spec/ruby/core/random/bytes_spec.rb index 06e84d03bd..b42dc61234 100644 --- a/spec/ruby/core/random/bytes_spec.rb +++ b/spec/ruby/core/random/bytes_spec.rb @@ -9,7 +9,6 @@ describe "Random#bytes" do Random.new(33).bytes(2).should == Random.new(33).bytes(2) end - # Should double check this is official spec it "returns the same numeric output for a given seed across all implementations and platforms" do rnd = Random.new(33) rnd.bytes(2).should == "\x14\\" @@ -18,7 +17,7 @@ describe "Random#bytes" do end it "returns the same numeric output for a given huge seed across all implementations and platforms" do - rnd = Random.new(bignum_value ** 4) + rnd = Random.new(2 ** (63 * 4)) rnd.bytes(2).should == "_\x91" rnd.bytes(1000) # skip some rnd.bytes(2).should == "\x17\x12" diff --git a/spec/ruby/core/random/default_spec.rb b/spec/ruby/core/random/default_spec.rb index a709eddd53..01d7430df8 100644 --- a/spec/ruby/core/random/default_spec.rb +++ b/spec/ruby/core/random/default_spec.rb @@ -1,22 +1,19 @@ require_relative '../../spec_helper' describe "Random::DEFAULT" do - - it "returns a random number generator" do - suppress_warning do - Random::DEFAULT.should respond_to(:rand) - end - end - - ruby_version_is ''...'3.0' do - it "returns a Random instance" do + ruby_version_is ''...'3.2' do + it "returns a random number generator" do suppress_warning do - Random::DEFAULT.should be_an_instance_of(Random) + Random::DEFAULT.should respond_to(:rand) end end - end - ruby_version_is '3.0' do + it "changes seed on reboot" do + seed1 = ruby_exe('p Random::DEFAULT.seed', options: '--disable-gems') + seed2 = ruby_exe('p Random::DEFAULT.seed', options: '--disable-gems') + seed1.should != seed2 + end + it "refers to the Random class" do suppress_warning do Random::DEFAULT.should.equal?(Random) @@ -30,9 +27,9 @@ describe "Random::DEFAULT" do end end - it "changes seed on reboot" do - seed1 = ruby_exe('p Random::DEFAULT.seed', options: '--disable-gems') - seed2 = ruby_exe('p Random::DEFAULT.seed', options: '--disable-gems') - seed1.should != seed2 + ruby_version_is '3.2' do + it "is no longer defined" do + Random.should_not.const_defined?(:DEFAULT) + end end end diff --git a/spec/ruby/core/random/new_spec.rb b/spec/ruby/core/random/new_spec.rb index 4280b5b9c3..90e2a9d6f2 100644 --- a/spec/ruby/core/random/new_spec.rb +++ b/spec/ruby/core/random/new_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" describe "Random.new" do it "returns a new instance of Random" do Random.new.should be_an_instance_of(Random) diff --git a/spec/ruby/core/random/rand_spec.rb b/spec/ruby/core/random/rand_spec.rb index 6ea7eece5f..9244177ab5 100644 --- a/spec/ruby/core/random/rand_spec.rb +++ b/spec/ruby/core/random/rand_spec.rb @@ -205,6 +205,11 @@ describe "Random#rand with Range" do Random.new(42).rand(0..1.0).should be_kind_of(Float) end + it "returns a float within a given float range" do + Random.new(42).rand(0.0...100.0).should == 37.454011884736246 + Random.new(42).rand(-100.0...0.0).should == -62.545988115263754 + end + it "raises an ArgumentError when the startpoint lacks #+ and #- methods" do -> do Random.new.rand(Object.new..67) diff --git a/spec/ruby/core/random/raw_seed_spec.rb b/spec/ruby/core/random/raw_seed_spec.rb deleted file mode 100644 index 0e40ed0796..0000000000 --- a/spec/ruby/core/random/raw_seed_spec.rb +++ /dev/null @@ -1,6 +0,0 @@ -require_relative '../../spec_helper' -require_relative 'shared/urandom' - -describe "Random.urandom" do - it_behaves_like :random_urandom, :urandom -end diff --git a/spec/ruby/core/random/shared/urandom.rb b/spec/ruby/core/random/shared/urandom.rb deleted file mode 100644 index 159716075c..0000000000 --- a/spec/ruby/core/random/shared/urandom.rb +++ /dev/null @@ -1,23 +0,0 @@ -describe :random_urandom, shared: true do - it "returns a String" do - Random.send(@method, 1).should be_an_instance_of(String) - end - - it "returns a String of the length given as argument" do - Random.send(@method, 15).length.should == 15 - end - - it "raises an ArgumentError on a negative size" do - -> { - Random.send(@method, -1) - }.should raise_error(ArgumentError) - end - - it "returns a binary String" do - Random.send(@method, 15).encoding.should == Encoding::BINARY - end - - it "returns a random binary String" do - Random.send(@method, 12).should_not == Random.send(@method, 12) - end -end diff --git a/spec/ruby/core/random/urandom_spec.rb b/spec/ruby/core/random/urandom_spec.rb new file mode 100644 index 0000000000..6f180e54ac --- /dev/null +++ b/spec/ruby/core/random/urandom_spec.rb @@ -0,0 +1,25 @@ +require_relative '../../spec_helper' + +describe "Random.urandom" do + it "returns a String" do + Random.urandom(1).should be_an_instance_of(String) + end + + it "returns a String of the length given as argument" do + Random.urandom(15).length.should == 15 + end + + it "raises an ArgumentError on a negative size" do + -> { + Random.urandom(-1) + }.should raise_error(ArgumentError) + end + + it "returns a binary String" do + Random.urandom(15).encoding.should == Encoding::BINARY + end + + it "returns a random binary String" do + Random.urandom(12).should_not == Random.urandom(12) + end +end diff --git a/spec/ruby/core/range/bsearch_spec.rb b/spec/ruby/core/range/bsearch_spec.rb index 438c7ce314..5254ab756c 100644 --- a/spec/ruby/core/range/bsearch_spec.rb +++ b/spec/ruby/core/range/bsearch_spec.rb @@ -9,22 +9,30 @@ describe "Range#bsearch" do it_behaves_like :enumeratorized_with_unknown_size, :bsearch, (1..3) it "raises a TypeError if the block returns an Object" do - -> { (0..1).bsearch { Object.new } }.should raise_error(TypeError) + -> { (0..1).bsearch { Object.new } }.should raise_error(TypeError, "wrong argument type Object (must be numeric, true, false or nil)") end - it "raises a TypeError if the block returns a String" do - -> { (0..1).bsearch { "1" } }.should raise_error(TypeError) + it "raises a TypeError if the block returns a String and boundaries are Integer values" do + -> { (0..1).bsearch { "1" } }.should raise_error(TypeError, "wrong argument type String (must be numeric, true, false or nil)") + end + + it "raises a TypeError if the block returns a String and boundaries are Float values" do + -> { (0.0..1.0).bsearch { "1" } }.should raise_error(TypeError, "wrong argument type String (must be numeric, true, false or nil)") end it "raises a TypeError if the Range has Object values" do value = mock("range bsearch") r = Range.new value, value - -> { r.bsearch { true } }.should raise_error(TypeError) + -> { r.bsearch { true } }.should raise_error(TypeError, "can't do binary search for MockObject") end it "raises a TypeError if the Range has String values" do - -> { ("a".."e").bsearch { true } }.should raise_error(TypeError) + -> { ("a".."e").bsearch { true } }.should raise_error(TypeError, "can't do binary search for String") + end + + it "raises TypeError when non-Numeric begin/end and block not passed" do + -> { ("a".."e").bsearch }.should raise_error(TypeError, "can't do binary search for String") end context "with Integer values" do @@ -94,6 +102,10 @@ describe "Range#bsearch" do (4..2).bsearch { 0 }.should == nil (4..2).bsearch { -1 }.should == nil end + + it "returns enumerator when block not passed" do + (0...3).bsearch.kind_of?(Enumerator).should == true + end end context "with Float values" do @@ -156,7 +168,6 @@ describe "Range#bsearch" do it "returns nil if the block returns greater than zero for every element" do (0.3..3.0).bsearch { |x| x <=> -1 }.should be_nil - end it "returns nil if the block never returns zero" do @@ -213,6 +224,10 @@ describe "Range#bsearch" do (0...inf).bsearch { |x| x >= Float::MAX ? 0 : 1 }.should == Float::MAX end end + + it "returns enumerator when block not passed" do + (0.1...2.3).bsearch.kind_of?(Enumerator).should == true + end end context "with endless ranges and Integer values" do @@ -250,6 +265,10 @@ describe "Range#bsearch" do [1, 2, 3].should include(result) end end + + it "returns enumerator when block not passed" do + eval("(-2..)").bsearch.kind_of?(Enumerator).should == true + end end context "with endless ranges and Float values" do @@ -327,112 +346,121 @@ describe "Range#bsearch" do eval("(0.0...)").bsearch { 0 }.should != inf end end + + it "returns enumerator when block not passed" do + eval("(0.1..)").bsearch.kind_of?(Enumerator).should == true + end end + context "with beginless ranges and Integer values" do + context "with a block returning true or false" do + it "returns the smallest element for which block returns true" do + (..10).bsearch { |x| x >= 2 }.should == 2 + (...-1).bsearch { |x| x >= -10 }.should == -10 + end + end - ruby_version_is "2.7" do - context "with beginless ranges and Integer values" do - context "with a block returning true or false" do - it "returns the smallest element for which block returns true" do - eval("(..10)").bsearch { |x| x >= 2 }.should == 2 - eval("(...-1)").bsearch { |x| x >= -10 }.should == -10 - end + context "with a block returning negative, zero, positive numbers" do + it "returns nil if the block returns greater than zero for every element" do + (..0).bsearch { |x| 1 }.should be_nil end - context "with a block returning negative, zero, positive numbers" do - it "returns nil if the block returns greater than zero for every element" do - eval("(..0)").bsearch { |x| 1 }.should be_nil - end + it "returns nil if the block never returns zero" do + (..0).bsearch { |x| x > 5 ? -1 : 1 }.should be_nil + end - it "returns nil if the block never returns zero" do - eval("(..0)").bsearch { |x| x > 5 ? -1 : 1 }.should be_nil - end + it "accepts Float::INFINITY from the block" do + (..0).bsearch { |x| Float::INFINITY }.should be_nil + end - it "accepts Float::INFINITY from the block" do - eval("(..0)").bsearch { |x| Float::INFINITY }.should be_nil - end + it "returns an element at an index for which block returns 0.0" do + result = (..10).bsearch { |x| x < 2 ? 1.0 : x > 2 ? -1.0 : 0.0 } + result.should == 2 + end - it "returns an element at an index for which block returns 0.0" do - result = eval("(..10)").bsearch { |x| x < 2 ? 1.0 : x > 2 ? -1.0 : 0.0 } - result.should == 2 - end + it "returns an element at an index for which block returns 0" do + result = (...10).bsearch { |x| x < 1 ? 1 : x > 3 ? -1 : 0 } + [1, 2, 3].should include(result) + end + end + + it "returns enumerator when block not passed" do + (..10).bsearch.kind_of?(Enumerator).should == true + end + end - it "returns an element at an index for which block returns 0" do - result = eval("(...10)").bsearch { |x| x < 1 ? 1 : x > 3 ? -1 : 0 } - [1, 2, 3].should include(result) - end + context "with beginless ranges and Float values" do + context "with a block returning true or false" do + it "returns nil if the block returns true for every element" do + (..-0.1).bsearch { |x| x > 0.0 }.should be_nil + (...-0.1).bsearch { |x| x > 0.0 }.should be_nil + end + + it "returns nil if the block returns nil for every element" do + (..-0.1).bsearch { |x| nil }.should be_nil + (...-0.1).bsearch { |x| nil }.should be_nil + end + + it "returns the smallest element for which block returns true" do + (..10).bsearch { |x| x >= 2 }.should == 2 + (..10).bsearch { |x| x >= 1 }.should == 1 + end + + it "works with infinity bounds" do + inf = Float::INFINITY + (..inf).bsearch { |x| true }.should == -inf + (...inf).bsearch { |x| true }.should == -inf + (..-inf).bsearch { |x| true }.should == -inf + (...-inf).bsearch { |x| true }.should == nil end end - context "with beginless ranges and Float values" do - context "with a block returning true or false" do - it "returns nil if the block returns true for every element" do - eval("(..-0.1)").bsearch { |x| x > 0.0 }.should be_nil - eval("(...-0.1)").bsearch { |x| x > 0.0 }.should be_nil - end - - it "returns nil if the block returns nil for every element" do - eval("(..-0.1)").bsearch { |x| nil }.should be_nil - eval("(...-0.1)").bsearch { |x| nil }.should be_nil - end - - it "returns the smallest element for which block returns true" do - eval("(..10)").bsearch { |x| x >= 2 }.should == 2 - eval("(..10)").bsearch { |x| x >= 1 }.should == 1 - end - - it "works with infinity bounds" do - inf = Float::INFINITY - eval("(..inf)").bsearch { |x| true }.should == -inf - eval("(...inf)").bsearch { |x| true }.should == -inf - eval("(..-inf)").bsearch { |x| true }.should == -inf - eval("(...-inf)").bsearch { |x| true }.should == nil - end - end - - context "with a block returning negative, zero, positive numbers" do - it "returns nil if the block returns less than zero for every element" do - eval("(..5.0)").bsearch { |x| -1 }.should be_nil - eval("(...5.0)").bsearch { |x| -1 }.should be_nil - end - - it "returns nil if the block returns greater than zero for every element" do - eval("(..1.1)").bsearch { |x| 1 }.should be_nil - eval("(...1.1)").bsearch { |x| 1 }.should be_nil - end - - it "returns nil if the block never returns zero" do - eval("(..6.3)").bsearch { |x| x < 2 ? 1 : -1 }.should be_nil - end - - it "accepts (+/-)Float::INFINITY from the block" do - eval("(..5.0)").bsearch { |x| Float::INFINITY }.should be_nil - eval("(..7.0)").bsearch { |x| -Float::INFINITY }.should be_nil - end - - it "returns an element at an index for which block returns 0.0" do - result = eval("(..8.0)").bsearch { |x| x < 2 ? 1.0 : x > 2 ? -1.0 : 0.0 } - result.should == 2 - end - - it "returns an element at an index for which block returns 0" do - result = eval("(..8.0)").bsearch { |x| x < 1 ? 1 : x > 3 ? -1 : 0 } - result.should >= 1 - result.should <= 3 - end - - it "works with infinity bounds" do - inf = Float::INFINITY - eval("(..-inf)").bsearch { |x| 1 }.should == nil - eval("(...-inf)").bsearch { |x| 1 }.should == nil - eval("(..inf)").bsearch { |x| x == inf ? 0 : 1 }.should == inf - eval("(...inf)").bsearch { |x| x == inf ? 0 : 1 }.should == nil - eval("(..-inf)").bsearch { |x| x == -inf ? 0 : -1 }.should == -inf - eval("(...-inf)").bsearch { |x| x == -inf ? 0 : -1 }.should == nil - eval("(..inf)").bsearch { |x| 3 - x }.should == 3 - eval("(...inf)").bsearch { |x| 3 - x }.should == 3 - end + context "with a block returning negative, zero, positive numbers" do + it "returns nil if the block returns less than zero for every element" do + (..5.0).bsearch { |x| -1 }.should be_nil + (...5.0).bsearch { |x| -1 }.should be_nil + end + + it "returns nil if the block returns greater than zero for every element" do + (..1.1).bsearch { |x| 1 }.should be_nil + (...1.1).bsearch { |x| 1 }.should be_nil + end + + it "returns nil if the block never returns zero" do + (..6.3).bsearch { |x| x < 2 ? 1 : -1 }.should be_nil + end + + it "accepts (+/-)Float::INFINITY from the block" do + (..5.0).bsearch { |x| Float::INFINITY }.should be_nil + (..7.0).bsearch { |x| -Float::INFINITY }.should be_nil end + + it "returns an element at an index for which block returns 0.0" do + result = (..8.0).bsearch { |x| x < 2 ? 1.0 : x > 2 ? -1.0 : 0.0 } + result.should == 2 + end + + it "returns an element at an index for which block returns 0" do + result = (..8.0).bsearch { |x| x < 1 ? 1 : x > 3 ? -1 : 0 } + result.should >= 1 + result.should <= 3 + end + + it "works with infinity bounds" do + inf = Float::INFINITY + (..-inf).bsearch { |x| 1 }.should == nil + (...-inf).bsearch { |x| 1 }.should == nil + (..inf).bsearch { |x| x == inf ? 0 : 1 }.should == inf + (...inf).bsearch { |x| x == inf ? 0 : 1 }.should == nil + (..-inf).bsearch { |x| x == -inf ? 0 : -1 }.should == -inf + (...-inf).bsearch { |x| x == -inf ? 0 : -1 }.should == nil + (..inf).bsearch { |x| 3 - x }.should == 3 + (...inf).bsearch { |x| 3 - x }.should == 3 + end + end + + it "returns enumerator when block not passed" do + (..-0.1).bsearch.kind_of?(Enumerator).should == true end end end diff --git a/spec/ruby/core/range/case_compare_spec.rb b/spec/ruby/core/range/case_compare_spec.rb index e795026230..65878aaabe 100644 --- a/spec/ruby/core/range/case_compare_spec.rb +++ b/spec/ruby/core/range/case_compare_spec.rb @@ -8,8 +8,12 @@ describe "Range#===" do (range === RangeSpecs::WithoutSucc.new(2)).should == true end - ruby_version_is "2.7" do - it_behaves_like :range_cover_and_include, :=== - it_behaves_like :range_cover, :=== + it_behaves_like :range_cover_and_include, :=== + it_behaves_like :range_cover, :=== + + ruby_bug "#19533", "3.2"..."3.3" do + it "returns true on any value if begin and end are both nil" do + (nil..nil).should === 1 + end end end diff --git a/spec/ruby/core/range/clone_spec.rb b/spec/ruby/core/range/clone_spec.rb new file mode 100644 index 0000000000..cf6ce74da0 --- /dev/null +++ b/spec/ruby/core/range/clone_spec.rb @@ -0,0 +1,26 @@ +require_relative '../../spec_helper' + +describe "Range#clone" do + it "duplicates the range" do + original = (1..3) + copy = original.clone + copy.begin.should == 1 + copy.end.should == 3 + copy.should_not.exclude_end? + copy.should_not.equal? original + + original = ("a"..."z") + copy = original.clone + copy.begin.should == "a" + copy.end.should == "z" + copy.should.exclude_end? + copy.should_not.equal? original + end + + it "maintains the frozen state" do + (1..2).clone.frozen?.should == (1..2).frozen? + (1..).clone.frozen?.should == (1..).frozen? + Range.new(1, 2).clone.frozen?.should == Range.new(1, 2).frozen? + Class.new(Range).new(1, 2).clone.frozen?.should == Class.new(Range).new(1, 2).frozen? + end +end diff --git a/spec/ruby/core/range/count_spec.rb b/spec/ruby/core/range/count_spec.rb index f6f60fa054..24d4a9caf3 100644 --- a/spec/ruby/core/range/count_spec.rb +++ b/spec/ruby/core/range/count_spec.rb @@ -1,14 +1,12 @@ require_relative '../../spec_helper' describe "Range#count" do - ruby_version_is "2.7" do - it "returns Infinity for beginless ranges without arguments or blocks" do - inf = Float::INFINITY - eval("('a'...)").count.should == inf - eval("(7..)").count.should == inf - eval("(...'a')").count.should == inf - eval("(...nil)").count.should == inf - eval("(..10.0)").count.should == inf - end + it "returns Infinity for beginless ranges without arguments or blocks" do + inf = Float::INFINITY + eval("('a'...)").count.should == inf + eval("(7..)").count.should == inf + (...'a').count.should == inf + (...nil).count.should == inf + (..10.0).count.should == inf end end diff --git a/spec/ruby/core/range/cover_spec.rb b/spec/ruby/core/range/cover_spec.rb index fa881607e9..eb7cddc967 100644 --- a/spec/ruby/core/range/cover_spec.rb +++ b/spec/ruby/core/range/cover_spec.rb @@ -7,4 +7,8 @@ describe "Range#cover?" do it_behaves_like :range_cover_and_include, :cover? it_behaves_like :range_cover, :cover? it_behaves_like :range_cover_subrange, :cover? + + it "covers U+9995 in the range U+0999..U+9999" do + ("\u{999}".."\u{9999}").cover?("\u{9995}").should be_true + end end diff --git a/spec/ruby/core/range/dup_spec.rb b/spec/ruby/core/range/dup_spec.rb index 6c9d0c954a..fab3c3f1b2 100644 --- a/spec/ruby/core/range/dup_spec.rb +++ b/spec/ruby/core/range/dup_spec.rb @@ -2,14 +2,22 @@ require_relative '../../spec_helper' describe "Range#dup" do it "duplicates the range" do - copy = (1..3).dup + original = (1..3) + copy = original.dup copy.begin.should == 1 copy.end.should == 3 copy.should_not.exclude_end? + copy.should_not.equal?(original) copy = ("a"..."z").dup copy.begin.should == "a" copy.end.should == "z" copy.should.exclude_end? end + + it "creates an unfrozen range" do + (1..2).dup.should_not.frozen? + (1..).dup.should_not.frozen? + Range.new(1, 2).dup.should_not.frozen? + end end diff --git a/spec/ruby/core/range/each_spec.rb b/spec/ruby/core/range/each_spec.rb index bd4bbb82e5..ecae17c881 100644 --- a/spec/ruby/core/range/each_spec.rb +++ b/spec/ruby/core/range/each_spec.rb @@ -58,10 +58,8 @@ describe "Range#each" do a.should == ["A", "B", "C", "D"] end - ruby_version_is "2.7" do - it "raises a TypeError beginless ranges" do - -> { eval("(..2)").each { |x| x } }.should raise_error(TypeError) - end + it "raises a TypeError beginless ranges" do + -> { (..2).each { |x| x } }.should raise_error(TypeError) end it "raises a TypeError if the first element does not respond to #succ" do @@ -84,9 +82,27 @@ describe "Range#each" do enum.to_a.should == [1, 2, 3] end - it "raises a TypeError if the first element is a Time object" do - t = Time.now - -> { (t..t+1).each { |i| i } }.should raise_error(TypeError) + ruby_version_is "3.1" do + it "supports Time objects that respond to #succ" do + t = Time.utc(1970) + def t.succ; self + 1 end + t_succ = t.succ + def t_succ.succ; self + 1; end + + (t..t_succ).to_a.should == [Time.utc(1970), Time.utc(1970, nil, nil, nil, nil, 1)] + (t...t_succ).to_a.should == [Time.utc(1970)] + end + end + + ruby_version_is ""..."3.1" do + it "raises a TypeError if the first element is a Time object even if it responds to #succ" do + t = Time.utc(1970) + def t.succ; self + 1 end + t_succ = t.succ + def t_succ.succ; self + 1; end + + -> { (t..t_succ).each { |i| i } }.should raise_error(TypeError) + end end it "passes each Symbol element by using #succ" do diff --git a/spec/ruby/core/range/equal_value_spec.rb b/spec/ruby/core/range/equal_value_spec.rb index 0aaebfb59a..83dcf5cec8 100644 --- a/spec/ruby/core/range/equal_value_spec.rb +++ b/spec/ruby/core/range/equal_value_spec.rb @@ -12,9 +12,7 @@ describe "Range#==" do eval("(1.0..)").should == eval("(1.0..)") end - ruby_version_is "2.7" do - it "returns true if the endpoints are == for beginless ranges" do - eval("(...10)").should == eval("(...10)") - end + it "returns true if the endpoints are == for beginless ranges" do + (...10).should == (...10) end end diff --git a/spec/ruby/core/range/first_spec.rb b/spec/ruby/core/range/first_spec.rb index c5c90800ac..2af935f439 100644 --- a/spec/ruby/core/range/first_spec.rb +++ b/spec/ruby/core/range/first_spec.rb @@ -47,9 +47,7 @@ describe "Range#first" do -> { (2..3).first("1") }.should raise_error(TypeError) end - ruby_version_is "2.7" do - it "raises a RangeError when called on an beginless range" do - -> { eval("(..1)").first }.should raise_error(RangeError) - end + it "raises a RangeError when called on an beginless range" do + -> { (..1).first }.should raise_error(RangeError) end end diff --git a/spec/ruby/core/range/frozen_spec.rb b/spec/ruby/core/range/frozen_spec.rb new file mode 100644 index 0000000000..8dab5e5339 --- /dev/null +++ b/spec/ruby/core/range/frozen_spec.rb @@ -0,0 +1,25 @@ +require_relative '../../spec_helper' + +# There is no Range#frozen? method but this feels like the best place for these specs +describe "Range#frozen?" do + it "is true for literal ranges" do + (1..2).should.frozen? + (1..).should.frozen? + (..1).should.frozen? + end + + it "is true for Range.new" do + Range.new(1, 2).should.frozen? + Range.new(1, nil).should.frozen? + Range.new(nil, 1).should.frozen? + end + + it "is false for instances of a subclass of Range" do + sub_range = Class.new(Range).new(1, 2) + sub_range.should_not.frozen? + end + + it "is false for Range.allocate" do + Range.allocate.should_not.frozen? + end +end diff --git a/spec/ruby/core/range/include_spec.rb b/spec/ruby/core/range/include_spec.rb index b2c7a54545..277de205d1 100644 --- a/spec/ruby/core/range/include_spec.rb +++ b/spec/ruby/core/range/include_spec.rb @@ -7,4 +7,8 @@ require_relative 'shared/cover' describe "Range#include?" do it_behaves_like :range_cover_and_include, :include? it_behaves_like :range_include, :include? + + it "does not include U+9995 in the range U+0999..U+9999" do + ("\u{999}".."\u{9999}").include?("\u{9995}").should be_false + end end diff --git a/spec/ruby/core/range/initialize_spec.rb b/spec/ruby/core/range/initialize_spec.rb index 8a6ca65daa..c653caf0c6 100644 --- a/spec/ruby/core/range/initialize_spec.rb +++ b/spec/ruby/core/range/initialize_spec.rb @@ -27,18 +27,9 @@ describe "Range#initialize" do -> { @range.send(:initialize, 1, 3, 5, 7, 9) }.should raise_error(ArgumentError) end - ruby_version_is ""..."3.0" do - it "raises a NameError if called on an already initialized Range" do - -> { (0..1).send(:initialize, 1, 3) }.should raise_error(NameError) - -> { (0..1).send(:initialize, 1, 3, true) }.should raise_error(NameError) - end - end - - ruby_version_is "3.0" do - it "raises a FrozenError if called on an already initialized Range" do - -> { (0..1).send(:initialize, 1, 3) }.should raise_error(FrozenError) - -> { (0..1).send(:initialize, 1, 3, true) }.should raise_error(FrozenError) - end + it "raises a FrozenError if called on an already initialized Range" do + -> { (0..1).send(:initialize, 1, 3) }.should raise_error(FrozenError) + -> { (0..1).send(:initialize, 1, 3, true) }.should raise_error(FrozenError) end it "raises an ArgumentError if arguments don't respond to <=>" do diff --git a/spec/ruby/core/range/inspect_spec.rb b/spec/ruby/core/range/inspect_spec.rb index f49882e6ce..072de123b7 100644 --- a/spec/ruby/core/range/inspect_spec.rb +++ b/spec/ruby/core/range/inspect_spec.rb @@ -17,29 +17,13 @@ describe "Range#inspect" do eval("(0.1...)").inspect.should == "0.1..." end - ruby_version_is '2.7' do - it "works for beginless ranges" do - eval("(..1)").inspect.should == "..1" - eval("(...0.1)").inspect.should == "...0.1" - end - - it "works for nil ... nil ranges" do - eval("(..nil)").inspect.should == "nil..nil" - eval("(nil...)").inspect.should == "nil...nil" - end + it "works for beginless ranges" do + (..1).inspect.should == "..1" + (...0.1).inspect.should == "...0.1" end - ruby_version_is ''...'2.7' do - it "returns a tainted string if either end is tainted" do - (("a".taint)..."c").inspect.tainted?.should be_true - ("a"...("c".taint)).inspect.tainted?.should be_true - ("a"..."c").taint.inspect.tainted?.should be_true - end - - it "returns a untrusted string if either end is untrusted" do - (("a".untrust)..."c").inspect.untrusted?.should be_true - ("a"...("c".untrust)).inspect.untrusted?.should be_true - ("a"..."c").untrust.inspect.untrusted?.should be_true - end + it "works for nil ... nil ranges" do + (..nil).inspect.should == "nil..nil" + eval("(nil...)").inspect.should == "nil...nil" end end diff --git a/spec/ruby/core/range/last_spec.rb b/spec/ruby/core/range/last_spec.rb index d7ef776b42..6698686dd5 100644 --- a/spec/ruby/core/range/last_spec.rb +++ b/spec/ruby/core/range/last_spec.rb @@ -8,6 +8,12 @@ describe "Range#last" do (1..5).last(3).should == [3, 4, 5] end + ruby_bug '#18994', '2.7'...'3.2' do + it "returns the specified number if elements for single element inclusive range" do + (1..1).last(1).should == [1] + end + end + it "returns an empty array for an empty Range" do (0...0).last(2).should == [] end diff --git a/spec/ruby/core/range/max_spec.rb b/spec/ruby/core/range/max_spec.rb index a970144d66..a3bbc31e7d 100644 --- a/spec/ruby/core/range/max_spec.rb +++ b/spec/ruby/core/range/max_spec.rb @@ -50,17 +50,15 @@ describe "Range#max" do -> { eval("(1..)").max }.should raise_error(RangeError) end - ruby_version_is "3.0" do - it "returns the end point for beginless ranges" do - eval("(..1)").max.should == 1 - eval("(..1.0)").max.should == 1.0 - end + it "returns the end point for beginless ranges" do + (..1).max.should == 1 + (..1.0).max.should == 1.0 + end - it "raises for an exclusive beginless range" do - -> { - eval("(...1)").max - }.should raise_error(TypeError, 'cannot exclude end value with non Integer begin value') - end + it "raises for an exclusive beginless range" do + -> { + (...1).max + }.should raise_error(TypeError, 'cannot exclude end value with non Integer begin value') end end @@ -97,9 +95,7 @@ describe "Range#max given a block" do (5...5).max {|x,y| x <=> y}.should be_nil end - ruby_version_is "2.7" do - it "raises RangeError when called with custom comparison method on an beginless range" do - -> { eval("(..1)").max {|a, b| a} }.should raise_error(RangeError) - end + it "raises RangeError when called with custom comparison method on an beginless range" do + -> { (..1).max {|a, b| a} }.should raise_error(RangeError) end end diff --git a/spec/ruby/core/range/min_spec.rb b/spec/ruby/core/range/min_spec.rb index 6e56cc733b..89310ee589 100644 --- a/spec/ruby/core/range/min_spec.rb +++ b/spec/ruby/core/range/min_spec.rb @@ -44,10 +44,8 @@ describe "Range#min" do eval("(1.0...)").min.should == 1.0 end - ruby_version_is "2.7" do - it "raises RangeError when called on an beginless range" do - -> { eval("(..1)").min }.should raise_error(RangeError) - end + it "raises RangeError when called on an beginless range" do + -> { (..1).min }.should raise_error(RangeError) end end diff --git a/spec/ruby/core/range/minmax_spec.rb b/spec/ruby/core/range/minmax_spec.rb index 1db9bfce38..6651ae3726 100644 --- a/spec/ruby/core/range/minmax_spec.rb +++ b/spec/ruby/core/range/minmax_spec.rb @@ -1,6 +1,5 @@ require_relative '../../spec_helper' -# These specs use Range.new instead of the literal notation for beginless Ranges so they parse fine on Ruby < 2.7 describe 'Range#minmax' do before(:each) do @x = mock('x') @@ -13,37 +12,26 @@ describe 'Range#minmax' do end describe 'on an inclusive range' do - ruby_version_is ''...'2.7' do - it 'should try to iterate endlessly on an endless range' do - @x.should_receive(:succ).once.and_return(@y) - range = (@x..) - - -> { range.minmax }.should raise_error(NoMethodError, /^undefined method `succ' for/) - end - end - - ruby_version_is '2.7' do - it 'should raise RangeError on an endless range without iterating the range' do - @x.should_not_receive(:succ) - - range = (@x..) + it 'should raise RangeError on an endless range without iterating the range' do + @x.should_not_receive(:succ) - -> { range.minmax }.should raise_error(RangeError, 'cannot get the maximum of endless range') - end + range = (@x..) - it 'raises RangeError or ArgumentError on a beginless range' do - range = Range.new(nil, @x) + -> { range.minmax }.should raise_error(RangeError, 'cannot get the maximum of endless range') + end - -> { range.minmax }.should raise_error(StandardError) { |e| - if RangeError === e - # error from #min - -> { raise e }.should raise_error(RangeError, 'cannot get the minimum of beginless range') - else - # error from #max - -> { raise e }.should raise_error(ArgumentError, 'comparison of NilClass with MockObject failed') - end - } - end + it 'raises RangeError or ArgumentError on a beginless range' do + range = (..@x) + + -> { range.minmax }.should raise_error(StandardError) { |e| + if RangeError === e + # error from #min + -> { raise e }.should raise_error(RangeError, 'cannot get the minimum of beginless range') + else + # error from #max + -> { raise e }.should raise_error(ArgumentError, 'comparison of NilClass with MockObject failed') + end + } end it 'should return beginning of range if beginning and end are equal without iterating the range' do @@ -58,34 +46,22 @@ describe 'Range#minmax' do (@y..@x).minmax.should == [nil, nil] end - ruby_version_is ''...'2.7' do - it 'should return the minimum and maximum values for a non-numeric range by iterating the range' do - @x.should_receive(:succ).once.and_return(@y) - - (@x..@y).minmax.should == [@x, @y] - end - end - - ruby_version_is '2.7' do - it 'should return the minimum and maximum values for a non-numeric range without iterating the range' do - @x.should_not_receive(:succ) + it 'should return the minimum and maximum values for a non-numeric range without iterating the range' do + @x.should_not_receive(:succ) - (@x..@y).minmax.should == [@x, @y] - end + (@x..@y).minmax.should == [@x, @y] end it 'should return the minimum and maximum values for a numeric range' do (1..3).minmax.should == [1, 3] end - ruby_version_is '2.7' do - it 'should return the minimum and maximum values for a numeric range without iterating the range' do - # We cannot set expectations on integers, - # so we "prevent" iteration by picking a value that would iterate until the spec times out. - range_end = Float::INFINITY + it 'should return the minimum and maximum values for a numeric range without iterating the range' do + # We cannot set expectations on integers, + # so we "prevent" iteration by picking a value that would iterate until the spec times out. + range_end = Float::INFINITY - (1..range_end).minmax.should == [1, range_end] - end + (1..range_end).minmax.should == [1, range_end] end it 'should return the minimum and maximum values according to the provided block by iterating the range' do @@ -96,69 +72,53 @@ describe 'Range#minmax' do end describe 'on an exclusive range' do - ruby_version_is ''...'2.7' do - # Endless ranges introduced in 2.6 - it 'should try to iterate endlessly on an endless range' do - @x.should_receive(:succ).once.and_return(@y) - range = (@x...) + it 'should raise RangeError on an endless range' do + @x.should_not_receive(:succ) + range = (@x...) - -> { range.minmax }.should raise_error(NoMethodError, /^undefined method `succ' for/) - end + -> { range.minmax }.should raise_error(RangeError, 'cannot get the maximum of endless range') end - ruby_version_is '2.7' do - it 'should raise RangeError on an endless range' do - @x.should_not_receive(:succ) - range = (@x...) - - -> { range.minmax }.should raise_error(RangeError, 'cannot get the maximum of endless range') - end - - it 'should raise RangeError on a beginless range' do - range = Range.new(nil, @x, true) + it 'should raise RangeError on a beginless range' do + range = (...@x) - -> { range.minmax }.should raise_error(RangeError, - /cannot get the maximum of beginless range with custom comparison method|cannot get the minimum of beginless range/) - end + -> { range.minmax }.should raise_error(RangeError, + /cannot get the maximum of beginless range with custom comparison method|cannot get the minimum of beginless range/) end - ruby_bug "#17014", "2.7.0"..."3.0" do - it 'should return nil pair if beginning and end are equal without iterating the range' do - @x.should_not_receive(:succ) + it 'should return nil pair if beginning and end are equal without iterating the range' do + @x.should_not_receive(:succ) - (@x...@x).minmax.should == [nil, nil] - end + (@x...@x).minmax.should == [nil, nil] + end - it 'should return nil pair if beginning is greater than end without iterating the range' do - @y.should_not_receive(:succ) + it 'should return nil pair if beginning is greater than end without iterating the range' do + @y.should_not_receive(:succ) - (@y...@x).minmax.should == [nil, nil] - end + (@y...@x).minmax.should == [nil, nil] + end - it 'should return the minimum and maximum values for a non-numeric range by iterating the range' do - @x.should_receive(:succ).once.and_return(@y) + it 'should return the minimum and maximum values for a non-numeric range by iterating the range' do + @x.should_receive(:succ).once.and_return(@y) - (@x...@y).minmax.should == [@x, @x] - end + (@x...@y).minmax.should == [@x, @x] end it 'should return the minimum and maximum values for a numeric range' do (1...3).minmax.should == [1, 2] end - ruby_version_is '2.7' do - it 'should return the minimum and maximum values for a numeric range without iterating the range' do - # We cannot set expectations on integers, - # so we "prevent" iteration by picking a value that would iterate until the spec times out. - range_end = bignum_value + it 'should return the minimum and maximum values for a numeric range without iterating the range' do + # We cannot set expectations on integers, + # so we "prevent" iteration by picking a value that would iterate until the spec times out. + range_end = bignum_value - (1...range_end).minmax.should == [1, range_end - 1] - end + (1...range_end).minmax.should == [1, range_end - 1] + end - it 'raises TypeError if the end value is not an integer' do - range = (0...Float::INFINITY) - -> { range.minmax }.should raise_error(TypeError, 'cannot exclude non Integer end value') - end + it 'raises TypeError if the end value is not an integer' do + range = (0...Float::INFINITY) + -> { range.minmax }.should raise_error(TypeError, 'cannot exclude non Integer end value') end it 'should return the minimum and maximum values according to the provided block by iterating the range' do diff --git a/spec/ruby/core/range/new_spec.rb b/spec/ruby/core/range/new_spec.rb index a4de4963e7..3cab887799 100644 --- a/spec/ruby/core/range/new_spec.rb +++ b/spec/ruby/core/range/new_spec.rb @@ -42,24 +42,16 @@ describe "Range.new" do end describe "beginless/endless range" do - ruby_version_is ""..."2.7" do - it "does not allow range without left boundary" do - -> { Range.new(nil, 1) }.should raise_error(ArgumentError, /bad value for range/) - end + it "allows beginless left boundary" do + range = Range.new(nil, 1) + range.begin.should == nil end - ruby_version_is "2.7" do - it "allows beginless left boundary" do - range = Range.new(nil, 1) - range.begin.should == nil - end - - it "distinguishes ranges with included and excluded right boundary" do - range_exclude = Range.new(nil, 1, true) - range_include = Range.new(nil, 1, false) + it "distinguishes ranges with included and excluded right boundary" do + range_exclude = Range.new(nil, 1, true) + range_include = Range.new(nil, 1, false) - range_exclude.should_not == range_include - end + range_exclude.should_not == range_include end it "allows endless right boundary" do @@ -73,5 +65,13 @@ describe "Range.new" do range_exclude.should_not == range_include end + + it "creates a frozen range if the class is Range.class" do + Range.new(1, 2).should.frozen? + end + + it "does not create a frozen range if the class is not Range.class" do + Class.new(Range).new(1, 2).should_not.frozen? + end end end diff --git a/spec/ruby/core/range/shared/cover.rb b/spec/ruby/core/range/shared/cover.rb index f3c7d22668..0b41a26455 100644 --- a/spec/ruby/core/range/shared/cover.rb +++ b/spec/ruby/core/range/shared/cover.rb @@ -151,45 +151,43 @@ describe :range_cover_subrange, shared: true do end end - ruby_version_is "2.7" do - it "allows self to be a beginless range" do - eval("(...10)").send(@method, (3..7)).should be_true - eval("(...10)").send(@method, (3..15)).should be_false + it "allows self to be a beginless range" do + (...10).send(@method, (3..7)).should be_true + (...10).send(@method, (3..15)).should be_false - eval("(..7.9)").send(@method, (2.5..6.5)).should be_true - eval("(..7.9)").send(@method, (2.5..8.5)).should be_false + (..7.9).send(@method, (2.5..6.5)).should be_true + (..7.9).send(@method, (2.5..8.5)).should be_false - eval("(..'i')").send(@method, ('d'..'f')).should be_true - eval("(..'i')").send(@method, ('d'..'z')).should be_false - end + (..'i').send(@method, ('d'..'f')).should be_true + (..'i').send(@method, ('d'..'z')).should be_false + end - it "allows self to be a endless range" do - eval("(0...)").send(@method, (3..7)).should be_true - eval("(5...)").send(@method, (3..15)).should be_false + it "allows self to be a endless range" do + eval("(0...)").send(@method, (3..7)).should be_true + eval("(5...)").send(@method, (3..15)).should be_false - eval("(1.1..)").send(@method, (2.5..6.5)).should be_true - eval("(3.3..)").send(@method, (2.5..8.5)).should be_false + eval("(1.1..)").send(@method, (2.5..6.5)).should be_true + eval("(3.3..)").send(@method, (2.5..8.5)).should be_false - eval("('a'..)").send(@method, ('d'..'f')).should be_true - eval("('p'..)").send(@method, ('d'..'z')).should be_false - end + eval("('a'..)").send(@method, ('d'..'f')).should be_true + eval("('p'..)").send(@method, ('d'..'z')).should be_false + end - it "accepts beginless range argument" do - eval("(..10)").send(@method, eval("(...10)")).should be_true - (0..10).send(@method, eval("(...10)")).should be_false + it "accepts beginless range argument" do + (..10).send(@method, (...10)).should be_true + (0..10).send(@method, (...10)).should be_false - (1.1..7.9).send(@method, eval("(...10.5)")).should be_false + (1.1..7.9).send(@method, (...10.5)).should be_false - ('c'..'i').send(@method, eval("(..'i')")).should be_false - end + ('c'..'i').send(@method, (..'i')).should be_false + end - it "accepts endless range argument" do - eval("(0..)").send(@method, eval("(0...)")).should be_true - (0..10).send(@method, eval("(0...)")).should be_false + it "accepts endless range argument" do + eval("(0..)").send(@method, eval("(0...)")).should be_true + (0..10).send(@method, eval("(0...)")).should be_false - (1.1..7.9).send(@method, eval("(0.8...)")).should be_false + (1.1..7.9).send(@method, eval("(0.8...)")).should be_false - ('c'..'i').send(@method, eval("('a'..)")).should be_false - end + ('c'..'i').send(@method, eval("('a'..)")).should be_false end end diff --git a/spec/ruby/core/range/shared/cover_and_include.rb b/spec/ruby/core/range/shared/cover_and_include.rb index e978e39af5..f36a2cef8b 100644 --- a/spec/ruby/core/range/shared/cover_and_include.rb +++ b/spec/ruby/core/range/shared/cover_and_include.rb @@ -24,11 +24,9 @@ describe :range_cover_and_include, shared: true do eval("(0.5...)").send(@method, 2.4).should == true end - ruby_version_is "2.7" do - it "returns true if other is an element of self for beginless ranges" do - eval("(..10)").send(@method, 2.4).should == true - eval("(...10.5)").send(@method, 2.4).should == true - end + it "returns true if other is an element of self for beginless ranges" do + (..10).send(@method, 2.4).should == true + (...10.5).send(@method, 2.4).should == true end it "compares values using <=>" do @@ -59,7 +57,6 @@ describe :range_cover_and_include, shared: true do it "returns true if argument is less than the last value of the range and greater than the first value" do (20..30).send(@method, 28).should be_true ('e'..'h').send(@method, 'g').should be_true - ("\u{999}".."\u{9999}").send @method, "\u{9995}" end it "returns true if argument is sole element in the range" do diff --git a/spec/ruby/core/range/size_spec.rb b/spec/ruby/core/range/size_spec.rb index 0019c5ff00..a1fe3ce17d 100644 --- a/spec/ruby/core/range/size_spec.rb +++ b/spec/ruby/core/range/size_spec.rb @@ -4,42 +4,93 @@ describe "Range#size" do it "returns the number of elements in the range" do (1..16).size.should == 16 (1...16).size.should == 15 - - (1.0..16.0).size.should == 16 - (1.0...16.0).size.should == 15 - (1.0..15.9).size.should == 15 - (1.1..16.0).size.should == 15 - (1.1..15.9).size.should == 15 end it "returns 0 if last is less than first" do (16..0).size.should == 0 - (16.0..0.0).size.should == 0 - (Float::INFINITY..0).size.should == 0 end it 'returns Float::INFINITY for increasing, infinite ranges' do (0..Float::INFINITY).size.should == Float::INFINITY - (-Float::INFINITY..0).size.should == Float::INFINITY - (-Float::INFINITY..Float::INFINITY).size.should == Float::INFINITY end it 'returns Float::INFINITY for endless ranges if the start is numeric' do eval("(1..)").size.should == Float::INFINITY - eval("(0.5...)").size.should == Float::INFINITY end it 'returns nil for endless ranges if the start is not numeric' do eval("('z'..)").size.should == nil - eval("([]...)").size.should == nil end - ruby_version_is "2.7" do + ruby_version_is ""..."3.2" do it 'returns Float::INFINITY for all beginless ranges' do - eval("(..1)").size.should == Float::INFINITY - eval("(...0.5)").size.should == Float::INFINITY - eval("(..nil)").size.should == Float::INFINITY - eval("(...'o')").size.should == Float::INFINITY + (..1).size.should == Float::INFINITY + (...0.5).size.should == Float::INFINITY + (..nil).size.should == Float::INFINITY + (...'o').size.should == Float::INFINITY + end + end + + ruby_version_is "3.2"..."3.4" do + it 'returns Float::INFINITY for all beginless ranges if the end is numeric' do + (..1).size.should == Float::INFINITY + (...0.5).size.should == Float::INFINITY + end + + it 'returns nil for all beginless ranges if the end is not numeric' do + (...'o').size.should == nil + end + + it 'returns nil if the start and the end is both nil' do + (nil..nil).size.should == nil + end + end + + ruby_version_is ""..."3.4" do + it "returns the number of elements in the range" do + (1.0..16.0).size.should == 16 + (1.0...16.0).size.should == 15 + (1.0..15.9).size.should == 15 + (1.1..16.0).size.should == 15 + (1.1..15.9).size.should == 15 + end + + it "returns 0 if last is less than first" do + (16.0..0.0).size.should == 0 + (Float::INFINITY..0).size.should == 0 + end + + it 'returns Float::INFINITY for increasing, infinite ranges' do + (-Float::INFINITY..0).size.should == Float::INFINITY + (-Float::INFINITY..Float::INFINITY).size.should == Float::INFINITY + end + + it 'returns Float::INFINITY for endless ranges if the start is numeric' do + eval("(0.5...)").size.should == Float::INFINITY + end + + it 'returns nil for endless ranges if the start is not numeric' do + eval("([]...)").size.should == nil + end + end + + ruby_version_is "3.4" do + it 'raises TypeError if a range is not iterable' do + -> { (1.0..16.0).size }.should raise_error(TypeError, /can't iterate from/) + -> { (1.0...16.0).size }.should raise_error(TypeError, /can't iterate from/) + -> { (1.0..15.9).size }.should raise_error(TypeError, /can't iterate from/) + -> { (1.1..16.0).size }.should raise_error(TypeError, /can't iterate from/) + -> { (1.1..15.9).size }.should raise_error(TypeError, /can't iterate from/) + -> { (16.0..0.0).size }.should raise_error(TypeError, /can't iterate from/) + -> { (Float::INFINITY..0).size }.should raise_error(TypeError, /can't iterate from/) + -> { (-Float::INFINITY..0).size }.should raise_error(TypeError, /can't iterate from/) + -> { (-Float::INFINITY..Float::INFINITY).size }.should raise_error(TypeError, /can't iterate from/) + -> { (..1).size }.should raise_error(TypeError, /can't iterate from/) + -> { (...0.5).size }.should raise_error(TypeError, /can't iterate from/) + -> { (..nil).size }.should raise_error(TypeError, /can't iterate from/) + -> { (...'o').size }.should raise_error(TypeError, /can't iterate from/) + -> { eval("(0.5...)").size }.should raise_error(TypeError, /can't iterate from/) + -> { eval("([]...)").size }.should raise_error(TypeError, /can't iterate from/) end end diff --git a/spec/ruby/core/range/step_spec.rb b/spec/ruby/core/range/step_spec.rb index 624fa71f5f..64ea3de4ed 100644 --- a/spec/ruby/core/range/step_spec.rb +++ b/spec/ruby/core/range/step_spec.rb @@ -377,48 +377,21 @@ describe "Range#step" do end describe "when no block is given" do - ruby_version_is "3.0" do - it "raises an ArgumentError if step is 0" do - -> { (-1..1).step(0) }.should raise_error(ArgumentError) - end + it "raises an ArgumentError if step is 0" do + -> { (-1..1).step(0) }.should raise_error(ArgumentError) end describe "returned Enumerator" do describe "size" do - ruby_version_is ""..."3.0" do - it "raises a TypeError if step does not respond to #to_int" do - obj = mock("Range#step non-integer") - enum = (1..2).step(obj) - -> { enum.size }.should raise_error(TypeError) - end - - it "raises a TypeError if #to_int does not return an Integer" do - obj = mock("Range#step non-integer") - obj.should_receive(:to_int).and_return("1") - enum = (1..2).step(obj) - - -> { enum.size }.should raise_error(TypeError) - end - end - - ruby_version_is "3.0" do - it "raises a TypeError if step does not respond to #to_int" do - obj = mock("Range#step non-integer") - -> { (1..2).step(obj) }.should raise_error(TypeError) - end - - it "raises a TypeError if #to_int does not return an Integer" do - obj = mock("Range#step non-integer") - obj.should_receive(:to_int).and_return("1") - -> { (1..2).step(obj) }.should raise_error(TypeError) - end + it "raises a TypeError if step does not respond to #to_int" do + obj = mock("Range#step non-integer") + -> { (1..2).step(obj) }.should raise_error(TypeError) end - ruby_version_is ""..."3.0" do - it "returns Float::INFINITY for zero step" do - (-1..1).step(0).size.should == Float::INFINITY - (-1..1).step(0.0).size.should == Float::INFINITY - end + it "raises a TypeError if #to_int does not return an Integer" do + obj = mock("Range#step non-integer") + obj.should_receive(:to_int).and_return("1") + -> { (1..2).step(obj) }.should raise_error(TypeError) end it "returns the ceil of range size divided by the number of steps" do @@ -474,16 +447,45 @@ describe "Range#step" do end end + # We use .take below to ensure the enumerator works + # because that's an Enumerable method and so it uses the Enumerator behavior + # not just a method overridden in Enumerator::ArithmeticSequence. describe "type" do context "when both begin and end are numerics" do it "returns an instance of Enumerator::ArithmeticSequence" do (1..10).step.class.should == Enumerator::ArithmeticSequence + (1..10).step(3).take(4).should == [1, 4, 7, 10] + end + end + + context "when begin is not defined and end is numeric" do + it "returns an instance of Enumerator::ArithmeticSequence" do + (..10).step.class.should == Enumerator::ArithmeticSequence + end + end + + context "when range is endless" do + it "returns an instance of Enumerator::ArithmeticSequence when begin is numeric" do + (1..).step.class.should == Enumerator::ArithmeticSequence + (1..).step(2).take(3).should == [1, 3, 5] + end + + it "returns an instance of Enumerator when begin is not numeric" do + ("a"..).step.class.should == Enumerator + ("a"..).step(2).take(3).should == %w[a c e] + end + end + + context "when range is beginless and endless" do + it "returns an instance of Enumerator" do + Range.new(nil, nil).step.class.should == Enumerator end end context "when begin and end are not numerics" do it "returns an instance of Enumerator" do ("a".."z").step.class.should == Enumerator + ("a".."z").step(3).take(4).should == %w[a d g j] end end end diff --git a/spec/ruby/core/range/to_a_spec.rb b/spec/ruby/core/range/to_a_spec.rb index 52ebc02941..b1d3de32db 100644 --- a/spec/ruby/core/range/to_a_spec.rb +++ b/spec/ruby/core/range/to_a_spec.rb @@ -33,9 +33,7 @@ describe "Range#to_a" do -> { eval("(1..)").to_a }.should raise_error(RangeError) end - ruby_version_is "2.7" do - it "throws an exception for beginless ranges" do - -> { eval("(..1)").to_a }.should raise_error(TypeError) - end + it "throws an exception for beginless ranges" do + -> { (..1).to_a }.should raise_error(TypeError) end end diff --git a/spec/ruby/core/range/to_s_spec.rb b/spec/ruby/core/range/to_s_spec.rb index 581c2e7d90..460c330912 100644 --- a/spec/ruby/core/range/to_s_spec.rb +++ b/spec/ruby/core/range/to_s_spec.rb @@ -16,24 +16,8 @@ describe "Range#to_s" do eval("(1.0...)").to_s.should == "1.0..." end - ruby_version_is "2.7" do - it "can show beginless ranges" do - eval("(..1)").to_s.should == "..1" - eval("(...1.0)").to_s.should == "...1.0" - end - end - - ruby_version_is ''...'2.7' do - it "returns a tainted string if either end is tainted" do - (("a".taint)..."c").to_s.tainted?.should be_true - ("a"...("c".taint)).to_s.tainted?.should be_true - ("a"..."c").taint.to_s.tainted?.should be_true - end - - it "returns a untrusted string if either end is untrusted" do - (("a".untrust)..."c").to_s.untrusted?.should be_true - ("a"...("c".untrust)).to_s.untrusted?.should be_true - ("a"..."c").untrust.to_s.untrusted?.should be_true - end + it "can show beginless ranges" do + (..1).to_s.should == "..1" + (...1.0).to_s.should == "...1.0" end end diff --git a/spec/ruby/core/rational/abs_spec.rb b/spec/ruby/core/rational/abs_spec.rb index aed7713058..7272ad2422 100644 --- a/spec/ruby/core/rational/abs_spec.rb +++ b/spec/ruby/core/rational/abs_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/abs' describe "Rational#abs" do diff --git a/spec/ruby/core/rational/ceil_spec.rb b/spec/ruby/core/rational/ceil_spec.rb index 5b0ca4a9d6..e736351604 100644 --- a/spec/ruby/core/rational/ceil_spec.rb +++ b/spec/ruby/core/rational/ceil_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/ceil' describe "Rational#ceil" do diff --git a/spec/ruby/core/rational/coerce_spec.rb b/spec/ruby/core/rational/coerce_spec.rb deleted file mode 100644 index 3f78f0bcd6..0000000000 --- a/spec/ruby/core/rational/coerce_spec.rb +++ /dev/null @@ -1,5 +0,0 @@ -require_relative '../../shared/rational/coerce' - -describe "Rational#coerce" do - it_behaves_like :rational_coerce, :coerce -end diff --git a/spec/ruby/core/rational/comparison_spec.rb b/spec/ruby/core/rational/comparison_spec.rb index 9d8e7fd7ee..877069fb8f 100644 --- a/spec/ruby/core/rational/comparison_spec.rb +++ b/spec/ruby/core/rational/comparison_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/comparison' describe "Rational#<=> when passed a Rational object" do diff --git a/spec/ruby/core/rational/denominator_spec.rb b/spec/ruby/core/rational/denominator_spec.rb index 6214b40587..c2f49b4190 100644 --- a/spec/ruby/core/rational/denominator_spec.rb +++ b/spec/ruby/core/rational/denominator_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/denominator' describe "Rational#denominator" do diff --git a/spec/ruby/core/rational/div_spec.rb b/spec/ruby/core/rational/div_spec.rb index 1cd8606b90..bee7d01a67 100644 --- a/spec/ruby/core/rational/div_spec.rb +++ b/spec/ruby/core/rational/div_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/div' describe "Rational#div" do diff --git a/spec/ruby/core/rational/divide_spec.rb b/spec/ruby/core/rational/divide_spec.rb index d8e3a44dc2..14e8c4c195 100644 --- a/spec/ruby/core/rational/divide_spec.rb +++ b/spec/ruby/core/rational/divide_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/divide' require_relative '../../shared/rational/arithmetic_exception_in_coerce' diff --git a/spec/ruby/core/rational/divmod_spec.rb b/spec/ruby/core/rational/divmod_spec.rb index 6be1f8bd73..7ffdde74f4 100644 --- a/spec/ruby/core/rational/divmod_spec.rb +++ b/spec/ruby/core/rational/divmod_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/divmod' describe "Rational#divmod when passed a Rational" do diff --git a/spec/ruby/core/rational/equal_value_spec.rb b/spec/ruby/core/rational/equal_value_spec.rb index 8e7acb1354..c6f7f4c6a2 100644 --- a/spec/ruby/core/rational/equal_value_spec.rb +++ b/spec/ruby/core/rational/equal_value_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/equal_value' describe "Rational#==" do diff --git a/spec/ruby/core/rational/exponent_spec.rb b/spec/ruby/core/rational/exponent_spec.rb index 622cf22782..7e35b4ebc1 100644 --- a/spec/ruby/core/rational/exponent_spec.rb +++ b/spec/ruby/core/rational/exponent_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/exponent' describe "Rational#**" do diff --git a/spec/ruby/core/rational/fdiv_spec.rb b/spec/ruby/core/rational/fdiv_spec.rb index bfb321abaa..b75f39abd5 100644 --- a/spec/ruby/core/rational/fdiv_spec.rb +++ b/spec/ruby/core/rational/fdiv_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/fdiv' describe "Rational#fdiv" do diff --git a/spec/ruby/core/rational/floor_spec.rb b/spec/ruby/core/rational/floor_spec.rb index 752a2d8815..70db0499d0 100644 --- a/spec/ruby/core/rational/floor_spec.rb +++ b/spec/ruby/core/rational/floor_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/floor' describe "Rational#floor" do diff --git a/spec/ruby/core/rational/hash_spec.rb b/spec/ruby/core/rational/hash_spec.rb index 84cd31518a..7e8d30049b 100644 --- a/spec/ruby/core/rational/hash_spec.rb +++ b/spec/ruby/core/rational/hash_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/hash' describe "Rational#hash" do diff --git a/spec/ruby/core/rational/inspect_spec.rb b/spec/ruby/core/rational/inspect_spec.rb index ef337ef0ce..2cbf6cadc1 100644 --- a/spec/ruby/core/rational/inspect_spec.rb +++ b/spec/ruby/core/rational/inspect_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/inspect' describe "Rational#inspect" do diff --git a/spec/ruby/core/rational/integer_spec.rb b/spec/ruby/core/rational/integer_spec.rb index 0f9a3bdead..be7476a9dd 100644 --- a/spec/ruby/core/rational/integer_spec.rb +++ b/spec/ruby/core/rational/integer_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" describe "Rational#integer?" do # Guard against the Mathn library guard -> { !defined?(Math.rsqrt) } do diff --git a/spec/ruby/core/rational/magnitude_spec.rb b/spec/ruby/core/rational/magnitude_spec.rb index 878fc8f879..27d9af6a81 100644 --- a/spec/ruby/core/rational/magnitude_spec.rb +++ b/spec/ruby/core/rational/magnitude_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/abs' describe "Rational#abs" do diff --git a/spec/ruby/core/rational/minus_spec.rb b/spec/ruby/core/rational/minus_spec.rb index 9e0f81556b..a61b62ebe6 100644 --- a/spec/ruby/core/rational/minus_spec.rb +++ b/spec/ruby/core/rational/minus_spec.rb @@ -1,7 +1,51 @@ -require_relative '../../shared/rational/minus' +require_relative '../../spec_helper' require_relative '../../shared/rational/arithmetic_exception_in_coerce' describe "Rational#-" do - it_behaves_like :rational_minus, :- it_behaves_like :rational_arithmetic_exception_in_coerce, :- + + it "calls #coerce on the passed argument with self" do + rational = Rational(3, 4) + obj = mock("Object") + obj.should_receive(:coerce).with(rational).and_return([1, 2]) + + rational - obj + end + + it "calls #- on the coerced Rational with the coerced Object" do + rational = Rational(3, 4) + + coerced_rational = mock("Coerced Rational") + coerced_rational.should_receive(:-).and_return(:result) + + coerced_obj = mock("Coerced Object") + + obj = mock("Object") + obj.should_receive(:coerce).and_return([coerced_rational, coerced_obj]) + + (rational - obj).should == :result + end +end + +describe "Rational#- passed a Rational" do + it "returns the result of subtracting other from self as a Rational" do + (Rational(3, 4) - Rational(0, 1)).should eql(Rational(3, 4)) + (Rational(3, 4) - Rational(1, 4)).should eql(Rational(1, 2)) + + (Rational(3, 4) - Rational(2, 1)).should eql(Rational(-5, 4)) + end +end + +describe "Rational#- passed a Float" do + it "returns the result of subtracting other from self as a Float" do + (Rational(3, 4) - 0.2).should eql(0.55) + (Rational(3, 4) - 2.5).should eql(-1.75) + end +end + +describe "Rational#- passed an Integer" do + it "returns the result of subtracting other from self as a Rational" do + (Rational(3, 4) - 1).should eql(Rational(-1, 4)) + (Rational(3, 4) - 2).should eql(Rational(-5, 4)) + end end diff --git a/spec/ruby/core/rational/modulo_spec.rb b/spec/ruby/core/rational/modulo_spec.rb index c43f7788e3..7a60c176ac 100644 --- a/spec/ruby/core/rational/modulo_spec.rb +++ b/spec/ruby/core/rational/modulo_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/modulo' describe "Rational#%" do diff --git a/spec/ruby/core/rational/multiply_spec.rb b/spec/ruby/core/rational/multiply_spec.rb index ea644074e9..7413376bb1 100644 --- a/spec/ruby/core/rational/multiply_spec.rb +++ b/spec/ruby/core/rational/multiply_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/multiply' require_relative '../../shared/rational/arithmetic_exception_in_coerce' diff --git a/spec/ruby/core/rational/numerator_spec.rb b/spec/ruby/core/rational/numerator_spec.rb index 85b2ed9e86..6f9a9c0e3b 100644 --- a/spec/ruby/core/rational/numerator_spec.rb +++ b/spec/ruby/core/rational/numerator_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/numerator' describe "Rational#numerator" do diff --git a/spec/ruby/core/rational/plus_spec.rb b/spec/ruby/core/rational/plus_spec.rb index e7ef3a8f92..67c0ff63d2 100644 --- a/spec/ruby/core/rational/plus_spec.rb +++ b/spec/ruby/core/rational/plus_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/plus' require_relative '../../shared/rational/arithmetic_exception_in_coerce' diff --git a/spec/ruby/core/rational/quo_spec.rb b/spec/ruby/core/rational/quo_spec.rb index 119aca1955..181f091f7c 100644 --- a/spec/ruby/core/rational/quo_spec.rb +++ b/spec/ruby/core/rational/quo_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/divide' describe "Rational#quo" do diff --git a/spec/ruby/core/rational/rational_spec.rb b/spec/ruby/core/rational/rational_spec.rb index 704e49354e..482deab38d 100644 --- a/spec/ruby/core/rational/rational_spec.rb +++ b/spec/ruby/core/rational/rational_spec.rb @@ -4,4 +4,8 @@ describe "Rational" do it "includes Comparable" do Rational.include?(Comparable).should == true end + + it "does not respond to new" do + -> { Rational.new(1) }.should raise_error(NoMethodError) + end end diff --git a/spec/ruby/core/rational/remainder_spec.rb b/spec/ruby/core/rational/remainder_spec.rb index 0f9442f6f5..1c0035e5f4 100644 --- a/spec/ruby/core/rational/remainder_spec.rb +++ b/spec/ruby/core/rational/remainder_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/remainder' describe "Rational#remainder" do diff --git a/spec/ruby/core/rational/to_f_spec.rb b/spec/ruby/core/rational/to_f_spec.rb index 15bf1e88dc..a9cd1be3b5 100644 --- a/spec/ruby/core/rational/to_f_spec.rb +++ b/spec/ruby/core/rational/to_f_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/to_f' describe "Rational#to_f" do diff --git a/spec/ruby/core/rational/to_i_spec.rb b/spec/ruby/core/rational/to_i_spec.rb index 3deb3664e1..22cf02b4da 100644 --- a/spec/ruby/core/rational/to_i_spec.rb +++ b/spec/ruby/core/rational/to_i_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/to_i' describe "Rational#to_i" do diff --git a/spec/ruby/core/rational/to_r_spec.rb b/spec/ruby/core/rational/to_r_spec.rb index cc704c965e..03f204daf1 100644 --- a/spec/ruby/core/rational/to_r_spec.rb +++ b/spec/ruby/core/rational/to_r_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/to_r' describe "Rational#to_r" do diff --git a/spec/ruby/core/rational/to_s_spec.rb b/spec/ruby/core/rational/to_s_spec.rb index c5c419787c..5d90c7d80b 100644 --- a/spec/ruby/core/rational/to_s_spec.rb +++ b/spec/ruby/core/rational/to_s_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/to_s' describe "Rational#to_s" do diff --git a/spec/ruby/core/rational/truncate_spec.rb b/spec/ruby/core/rational/truncate_spec.rb index 4e72339752..47a7cdf17c 100644 --- a/spec/ruby/core/rational/truncate_spec.rb +++ b/spec/ruby/core/rational/truncate_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative '../../shared/rational/truncate' describe "Rational#truncate" do diff --git a/spec/ruby/core/rational/zero_spec.rb b/spec/ruby/core/rational/zero_spec.rb index e6dd751922..af7fb391ac 100644 --- a/spec/ruby/core/rational/zero_spec.rb +++ b/spec/ruby/core/rational/zero_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" describe "Rational#zero?" do it "returns true if the numerator is 0" do Rational(0,26).zero?.should be_true diff --git a/spec/ruby/core/refinement/append_features_spec.rb b/spec/ruby/core/refinement/append_features_spec.rb new file mode 100644 index 0000000000..fb84f245bd --- /dev/null +++ b/spec/ruby/core/refinement/append_features_spec.rb @@ -0,0 +1,21 @@ +require_relative '../../spec_helper' + +describe "Refinement#append_features" do + ruby_version_is "3.2" do + it "is not defined" do + Refinement.should_not have_private_instance_method(:append_features) + end + + it "is not called by Module#include" do + c = Class.new + Module.new do + refine c do + called = false + define_method(:append_features){called = true} + proc{c.include(self)}.should raise_error(TypeError) + called.should == false + end + end + end + end +end diff --git a/spec/ruby/core/refinement/extend_object_spec.rb b/spec/ruby/core/refinement/extend_object_spec.rb new file mode 100644 index 0000000000..6c2a0af4f3 --- /dev/null +++ b/spec/ruby/core/refinement/extend_object_spec.rb @@ -0,0 +1,23 @@ +require_relative '../../spec_helper' + +describe "Refinement#extend_object" do + ruby_version_is "3.2" do + it "is not defined" do + Refinement.should_not have_private_instance_method(:extend_object) + end + + it "is not called by Object#extend" do + c = Class.new + Module.new do + refine c do + called = false + define_method(:extend_object) { called = true } + -> { + c.extend(self) + }.should raise_error(TypeError) + called.should == false + end + end + end + end +end diff --git a/spec/ruby/core/refinement/fixtures/classes.rb b/spec/ruby/core/refinement/fixtures/classes.rb new file mode 100644 index 0000000000..94324db47c --- /dev/null +++ b/spec/ruby/core/refinement/fixtures/classes.rb @@ -0,0 +1,10 @@ +module RefinementSpec + + module ModuleWithAncestors + include Module.new do + def indent(level) + " " * level + self + end + end + end +end diff --git a/spec/ruby/core/refinement/import_methods_spec.rb b/spec/ruby/core/refinement/import_methods_spec.rb new file mode 100644 index 0000000000..614c54dff8 --- /dev/null +++ b/spec/ruby/core/refinement/import_methods_spec.rb @@ -0,0 +1,269 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "Refinement#import_methods" do + ruby_version_is "3.1" do + context "when methods are defined in Ruby code" do + it "imports methods" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + end + + Module.new do + refine String do + import_methods str_utils + "foo".indent(3).should == " foo" + end + end + end + + it "throws an exception when argument is not a module" do + Module.new do + refine String do + -> { + import_methods Integer + }.should raise_error(TypeError, "wrong argument type Class (expected Module)") + end + end + end + + it "imports methods from multiple modules" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + end + + str_utils_fancy = Module.new do + def indent_star(level) + "*" * level + self + end + end + + Module.new do + refine String do + import_methods str_utils, str_utils_fancy + "foo".indent(3).should == " foo" + "foo".indent_star(3).should == "***foo" + end + end + end + + it "imports a method defined in the last module if method with same name is defined in multiple modules" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + end + + str_utils_fancy = Module.new do + def indent(level) + "*" * level + self + end + end + + Module.new do + refine String do + import_methods str_utils, str_utils_fancy + "foo".indent(3).should == "***foo" + end + end + end + + it "still imports methods of modules listed before a module that contains method not defined in Ruby" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + end + + string_refined = Module.new do + refine String do + -> { + import_methods str_utils, Kernel + }.should raise_error(ArgumentError) + end + end + + Module.new do + using string_refined + "foo".indent(3).should == " foo" + end + end + end + + it "warns if a module includes/prepends some other module" do + module1 = Module.new do + end + + module2 = Module.new do + include module1 + end + + Module.new do + refine String do + -> { + import_methods module2 + }.should complain(/warning: #<Module:\w*> has ancestors, but Refinement#import_methods doesn't import their methods/) + end + end + + Module.new do + refine String do + -> { + import_methods RefinementSpec::ModuleWithAncestors + }.should complain(/warning: RefinementSpec::ModuleWithAncestors has ancestors, but Refinement#import_methods doesn't import their methods/) + end + end + end + + it "doesn't import methods from included/prepended modules" do + Module.new do + refine String do + suppress_warning { import_methods RefinementSpec::ModuleWithAncestors } + end + + using self + -> { + "foo".indent(3) + }.should raise_error(NoMethodError, /undefined method [`']indent' for ("foo":String|an instance of String)/) + end + end + + it "doesn't import any methods if one of the arguments is not a module" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + end + + string_refined = Module.new do + refine String do + -> { + import_methods str_utils, Integer + }.should raise_error(TypeError) + end + end + + Module.new do + using string_refined + -> { + "foo".indent(3) + }.should raise_error(NoMethodError) + end + end + + it "imports methods from multiple modules so that methods see other's module's methods" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + end + + str_utils_normal = Module.new do + def indent_normal(level) + self.indent(level) + end + end + + Module.new do + refine String do + import_methods str_utils, str_utils_normal + end + + using self + "foo".indent_normal(3).should == " foo" + end + end + + it "imports methods from module so that methods can see each other" do + str_utils = Module.new do + def indent(level) + " " * level + self + end + + def indent_with_dot(level) + self.indent(level) + "." + end + end + + Module.new do + refine String do + import_methods str_utils + end + + using self + "foo".indent_with_dot(3).should == " foo." + end + end + + it "doesn't import module's class methods" do + str_utils = Module.new do + def self.indent(level) + " " * level + self + end + end + + Module.new do + refine String do + import_methods str_utils + end + + using self + -> { + String.indent(3) + }.should raise_error(NoMethodError, /undefined method [`']indent' for (String:Class|class String)/) + end + end + + it "imports module methods with super" do + class_to_refine = Class.new do + def foo(number) + 2 * number + end + end + + extension = Module.new do + def foo(number) + super * 2 + end + end + + refinement = Module.new do + refine class_to_refine do + import_methods extension + end + end + + Module.new do + using refinement + class_to_refine.new.foo(2).should == 8 + end + end + + context "when methods are not defined in Ruby code" do + it "raises ArgumentError" do + Module.new do + refine String do + -> { + import_methods Kernel + }.should raise_error(ArgumentError) + end + end + end + + it "raises ArgumentError when importing methods from C extension" do + require 'zlib' + Module.new do + refine String do + -> { + import_methods Zlib + }.should raise_error(ArgumentError, /Can't import method which is not defined with Ruby code: Zlib#*/) + end + end + end + end + end +end diff --git a/spec/ruby/core/refinement/include_spec.rb b/spec/ruby/core/refinement/include_spec.rb new file mode 100644 index 0000000000..25a53f0ec7 --- /dev/null +++ b/spec/ruby/core/refinement/include_spec.rb @@ -0,0 +1,27 @@ +require_relative '../../spec_helper' + +describe "Refinement#include" do + ruby_version_is "3.1"..."3.2" do + it "warns about deprecation" do + Module.new do + refine String do + -> { + include Module.new + }.should complain(/warning: Refinement#include is deprecated and will be removed in Ruby 3.2/) + end + end + end + end + + ruby_version_is "3.2" do + it "raises a TypeError" do + Module.new do + refine String do + -> { + include Module.new + }.should raise_error(TypeError, "Refinement#include has been removed") + end + end + end + end +end diff --git a/spec/ruby/core/refinement/prepend_features_spec.rb b/spec/ruby/core/refinement/prepend_features_spec.rb new file mode 100644 index 0000000000..9fdea199a2 --- /dev/null +++ b/spec/ruby/core/refinement/prepend_features_spec.rb @@ -0,0 +1,21 @@ +require_relative '../../spec_helper' + +describe "Refinement#prepend_features" do + ruby_version_is "3.2" do + it "is not defined" do + Refinement.should_not have_private_instance_method(:prepend_features) + end + + it "is not called by Module#prepend" do + c = Class.new + Module.new do + refine c do + called = false + define_method(:prepend_features){called = true} + proc{c.prepend(self)}.should raise_error(TypeError) + called.should == false + end + end + end + end +end diff --git a/spec/ruby/core/refinement/prepend_spec.rb b/spec/ruby/core/refinement/prepend_spec.rb new file mode 100644 index 0000000000..27b70d392a --- /dev/null +++ b/spec/ruby/core/refinement/prepend_spec.rb @@ -0,0 +1,27 @@ +require_relative '../../spec_helper' + +describe "Refinement#prepend" do + ruby_version_is "3.1"..."3.2" do + it "warns about deprecation" do + Module.new do + refine String do + -> { + prepend Module.new + }.should complain(/warning: Refinement#prepend is deprecated and will be removed in Ruby 3.2/) + end + end + end + end + + ruby_version_is "3.2" do + it "raises a TypeError" do + Module.new do + refine String do + -> { + prepend Module.new + }.should raise_error(TypeError, "Refinement#prepend has been removed") + end + end + end + end +end diff --git a/spec/ruby/core/refinement/refined_class_spec.rb b/spec/ruby/core/refinement/refined_class_spec.rb new file mode 100644 index 0000000000..00b65d0895 --- /dev/null +++ b/spec/ruby/core/refinement/refined_class_spec.rb @@ -0,0 +1,17 @@ +require_relative '../../spec_helper' + +describe "Refinement#refined_class" do + ruby_version_is "3.2"..."3.3" do + it "returns the class refined by the receiver" do + refinement_int = nil + + Module.new do + refine Integer do + refinement_int = self + end + end + + refinement_int.refined_class.should == Integer + end + end +end diff --git a/spec/ruby/core/regexp/compile_spec.rb b/spec/ruby/core/regexp/compile_spec.rb index 329cb4f753..c41399cfbb 100644 --- a/spec/ruby/core/regexp/compile_spec.rb +++ b/spec/ruby/core/regexp/compile_spec.rb @@ -13,3 +13,7 @@ end describe "Regexp.compile given a Regexp" do it_behaves_like :regexp_new_regexp, :compile end + +describe "Regexp.new given a non-String/Regexp" do + it_behaves_like :regexp_new_non_string_or_regexp, :compile +end diff --git a/spec/ruby/core/regexp/initialize_spec.rb b/spec/ruby/core/regexp/initialize_spec.rb index 772a233e82..dd57292242 100644 --- a/spec/ruby/core/regexp/initialize_spec.rb +++ b/spec/ruby/core/regexp/initialize_spec.rb @@ -2,19 +2,11 @@ require_relative '../../spec_helper' describe "Regexp#initialize" do it "is a private method" do - Regexp.should have_private_method(:initialize) + Regexp.should have_private_instance_method(:initialize) end - ruby_version_is ""..."3.0" do - it "raises a SecurityError on a Regexp literal" do - -> { //.send(:initialize, "") }.should raise_error(SecurityError) - end - end - - ruby_version_is "3.0" do - it "raises a FrozenError on a Regexp literal" do - -> { //.send(:initialize, "") }.should raise_error(FrozenError) - end + it "raises a FrozenError on a Regexp literal" do + -> { //.send(:initialize, "") }.should raise_error(FrozenError) end it "raises a TypeError on an initialized non-literal Regexp" do diff --git a/spec/ruby/core/regexp/linear_time_spec.rb b/spec/ruby/core/regexp/linear_time_spec.rb new file mode 100644 index 0000000000..4dc436264f --- /dev/null +++ b/spec/ruby/core/regexp/linear_time_spec.rb @@ -0,0 +1,25 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "Regexp.linear_time?" do + it "returns true if matching can be done in linear time" do + Regexp.linear_time?(/a/).should == true + Regexp.linear_time?('a').should == true + end + + it "return false if matching can't be done in linear time" do + Regexp.linear_time?(/(a)\1/).should == false + Regexp.linear_time?("(a)\\1").should == false + end + + it "accepts flags for string argument" do + Regexp.linear_time?('a', Regexp::IGNORECASE).should == true + end + + it "warns about flags being ignored for regexp arguments" do + -> { + Regexp.linear_time?(/a/, Regexp::IGNORECASE) + }.should complain(/warning: flags ignored/) + end + end +end diff --git a/spec/ruby/core/regexp/new_spec.rb b/spec/ruby/core/regexp/new_spec.rb index ce662b7a4f..65f612df55 100644 --- a/spec/ruby/core/regexp/new_spec.rb +++ b/spec/ruby/core/regexp/new_spec.rb @@ -11,17 +11,9 @@ end describe "Regexp.new given a Regexp" do it_behaves_like :regexp_new_regexp, :new - it_behaves_like :regexp_new_string_binary, :compile + it_behaves_like :regexp_new_string_binary, :new end -describe "Regexp.new given an Integer" do - it "raises a TypeError" do - -> { Regexp.new(1) }.should raise_error(TypeError) - end -end - -describe "Regexp.new given a Float" do - it "raises a TypeError" do - -> { Regexp.new(1.0) }.should raise_error(TypeError) - end +describe "Regexp.new given a non-String/Regexp" do + it_behaves_like :regexp_new_non_string_or_regexp, :new end diff --git a/spec/ruby/core/regexp/shared/new.rb b/spec/ruby/core/regexp/shared/new.rb index 9cbf89cd8b..7c3fabf612 100644 --- a/spec/ruby/core/regexp/shared/new.rb +++ b/spec/ruby/core/regexp/shared/new.rb @@ -24,6 +24,32 @@ describe :regexp_new, shared: true do end end +describe :regexp_new_non_string_or_regexp, shared: true do + it "calls #to_str method for non-String/Regexp argument" do + obj = Object.new + def obj.to_str() "a" end + + Regexp.send(@method, obj).should == /a/ + end + + it "raises TypeError if there is no #to_str method for non-String/Regexp argument" do + obj = Object.new + -> { Regexp.send(@method, obj) }.should raise_error(TypeError, "no implicit conversion of Object into String") + + -> { Regexp.send(@method, 1) }.should raise_error(TypeError, "no implicit conversion of Integer into String") + -> { Regexp.send(@method, 1.0) }.should raise_error(TypeError, "no implicit conversion of Float into String") + -> { Regexp.send(@method, :symbol) }.should raise_error(TypeError, "no implicit conversion of Symbol into String") + -> { Regexp.send(@method, []) }.should raise_error(TypeError, "no implicit conversion of Array into String") + end + + it "raises TypeError if #to_str returns non-String value" do + obj = Object.new + def obj.to_str() [] end + + -> { Regexp.send(@method, obj) }.should raise_error(TypeError, /can't convert Object to String/) + end +end + describe :regexp_new_string, shared: true do it "uses the String argument as an unescaped literal to construct a Regexp object" do Regexp.send(@method, "^hi{2,3}fo.o$").should == /^hi{2,3}fo.o$/ @@ -58,6 +84,15 @@ describe :regexp_new_string, shared: true do end end + it "sets options from second argument if it is true" do + r = Regexp.send(@method, 'Hi', true) + (r.options & Regexp::IGNORECASE).should_not == 0 + (r.options & Regexp::MULTILINE).should == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should == 0 + end + end + it "sets options from second argument if it is one of the Integer option constants" do r = Regexp.send(@method, 'Hi', Regexp::IGNORECASE) (r.options & Regexp::IGNORECASE).should_not == 0 @@ -88,57 +123,140 @@ describe :regexp_new_string, shared: true do (r.options & Regexp::EXTENDED).should_not == 0 end - it "treats any non-Integer, non-nil, non-false second argument as IGNORECASE" do - r = Regexp.send(@method, 'Hi', Object.new) - (r.options & Regexp::IGNORECASE).should_not == 0 - (r.options & Regexp::MULTILINE).should == 0 - not_supported_on :opal do - (r.options & Regexp::EXTENDED).should == 0 + ruby_version_is ""..."3.2" do + it "does not try to convert the second argument to Integer with #to_int method call" do + ScratchPad.clear + obj = Object.new + def obj.to_int() ScratchPad.record(:called) end + + Regexp.send(@method, "Hi", obj) + + ScratchPad.recorded.should == nil end end - it "ignores the third argument if it is 'e' or 'euc' (case-insensitive)" do - -> { - Regexp.send(@method, 'Hi', nil, 'e').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'euc').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'E').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'EUC').encoding.should == Encoding::US_ASCII - }.should complain(/encoding option is ignored/) - end + ruby_version_is "3.2" do + it "does not try to convert the second argument to Integer with #to_int method call" do + ScratchPad.clear + obj = Object.new + def obj.to_int() ScratchPad.record(:called) end - it "ignores the third argument if it is 's' or 'sjis' (case-insensitive)" do - -> { - Regexp.send(@method, 'Hi', nil, 's').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'sjis').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'S').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'SJIS').encoding.should == Encoding::US_ASCII - }.should complain(/encoding option is ignored/) + -> { + Regexp.send(@method, "Hi", obj) + }.should complain(/expected true or false as ignorecase/, {verbose: true}) + + ScratchPad.recorded.should == nil + end end - it "ignores the third argument if it is 'u' or 'utf8' (case-insensitive)" do - -> { - Regexp.send(@method, 'Hi', nil, 'u').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'utf8').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'U').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'UTF8').encoding.should == Encoding::US_ASCII - }.should complain(/encoding option is ignored/) + ruby_version_is ""..."3.2" do + it "treats any non-Integer, non-nil, non-false second argument as IGNORECASE" do + r = Regexp.send(@method, 'Hi', Object.new) + (r.options & Regexp::IGNORECASE).should_not == 0 + (r.options & Regexp::MULTILINE).should == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should == 0 + end + end end - it "uses US_ASCII encoding if third argument is 'n' or 'none' (case insensitive) and only ascii characters" do - Regexp.send(@method, 'Hi', nil, 'n').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'none').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'N').encoding.should == Encoding::US_ASCII - Regexp.send(@method, 'Hi', nil, 'NONE').encoding.should == Encoding::US_ASCII + ruby_version_is "3.2" do + it "warns any non-Integer, non-nil, non-false second argument" do + r = nil + -> { + r = Regexp.send(@method, 'Hi', Object.new) + }.should complain(/expected true or false as ignorecase/, {verbose: true}) + (r.options & Regexp::IGNORECASE).should_not == 0 + (r.options & Regexp::MULTILINE).should == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should == 0 + end + end + + it "accepts a String of supported flags as the second argument" do + r = Regexp.send(@method, 'Hi', 'i') + (r.options & Regexp::IGNORECASE).should_not == 0 + (r.options & Regexp::MULTILINE).should == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should == 0 + end + + r = Regexp.send(@method, 'Hi', 'imx') + (r.options & Regexp::IGNORECASE).should_not == 0 + (r.options & Regexp::MULTILINE).should_not == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should_not == 0 + end + + r = Regexp.send(@method, 'Hi', 'mimi') + (r.options & Regexp::IGNORECASE).should_not == 0 + (r.options & Regexp::MULTILINE).should_not == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should == 0 + end + + r = Regexp.send(@method, 'Hi', '') + (r.options & Regexp::IGNORECASE).should == 0 + (r.options & Regexp::MULTILINE).should == 0 + not_supported_on :opal do + (r.options & Regexp::EXTENDED).should == 0 + end + end + + it "raises an Argument error if the second argument contains unsupported chars" do + -> { Regexp.send(@method, 'Hi', 'e') }.should raise_error(ArgumentError, "unknown regexp option: e") + -> { Regexp.send(@method, 'Hi', 'n') }.should raise_error(ArgumentError, "unknown regexp option: n") + -> { Regexp.send(@method, 'Hi', 's') }.should raise_error(ArgumentError, "unknown regexp option: s") + -> { Regexp.send(@method, 'Hi', 'u') }.should raise_error(ArgumentError, "unknown regexp option: u") + -> { Regexp.send(@method, 'Hi', 'j') }.should raise_error(ArgumentError, "unknown regexp option: j") + -> { Regexp.send(@method, 'Hi', 'mjx') }.should raise_error(ArgumentError, /unknown regexp option: mjx\b/) + end end - it "uses ASCII_8BIT encoding if third argument is 'n' or 'none' (case insensitive) and non-ascii characters" do - a = "(?:[\x8E\xA1-\xFE])" - str = "\A(?:#{a}|x*)\z" + ruby_version_is ""..."3.2" do + it "ignores the third argument if it is 'e' or 'euc' (case-insensitive)" do + -> { + Regexp.send(@method, 'Hi', nil, 'e').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'euc').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'E').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'EUC').encoding.should == Encoding::US_ASCII + }.should complain(/encoding option is ignored/) + end + + it "ignores the third argument if it is 's' or 'sjis' (case-insensitive)" do + -> { + Regexp.send(@method, 'Hi', nil, 's').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'sjis').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'S').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'SJIS').encoding.should == Encoding::US_ASCII + }.should complain(/encoding option is ignored/) + end - Regexp.send(@method, str, nil, 'N').encoding.should == Encoding::BINARY - Regexp.send(@method, str, nil, 'n').encoding.should == Encoding::BINARY - Regexp.send(@method, str, nil, 'none').encoding.should == Encoding::BINARY - Regexp.send(@method, str, nil, 'NONE').encoding.should == Encoding::BINARY + it "ignores the third argument if it is 'u' or 'utf8' (case-insensitive)" do + -> { + Regexp.send(@method, 'Hi', nil, 'u').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'utf8').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'U').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'UTF8').encoding.should == Encoding::US_ASCII + }.should complain(/encoding option is ignored/) + end + + it "uses US_ASCII encoding if third argument is 'n' or 'none' (case insensitive) and only ascii characters" do + Regexp.send(@method, 'Hi', nil, 'n').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'none').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'N').encoding.should == Encoding::US_ASCII + Regexp.send(@method, 'Hi', nil, 'NONE').encoding.should == Encoding::US_ASCII + end + + it "uses ASCII_8BIT encoding if third argument is 'n' or 'none' (case insensitive) and non-ascii characters" do + a = "(?:[\x8E\xA1-\xFE])" + str = "\A(?:#{a}|x*)\z" + + Regexp.send(@method, str, nil, 'N').encoding.should == Encoding::BINARY + Regexp.send(@method, str, nil, 'n').encoding.should == Encoding::BINARY + Regexp.send(@method, str, nil, 'none').encoding.should == Encoding::BINARY + Regexp.send(@method, str, nil, 'NONE').encoding.should == Encoding::BINARY + end end describe "with escaped characters" do @@ -330,6 +448,10 @@ describe :regexp_new_string, shared: true do Regexp.send(@method, "\056\x42\u3042\x52\076").should == /#{"\x2e\x42\u3042\x52\x3e"}/ end + it "accepts a multiple byte character which need not be escaped" do + Regexp.send(@method, "\§").should == /#{"§"}/ + end + it "raises a RegexpError if less than four digits are given for \\uHHHH" do -> { Regexp.send(@method, "\\" + "u304") }.should raise_error(RegexpError) end @@ -367,12 +489,12 @@ describe :regexp_new_string, shared: true do end it "returns a Regexp with the input String's encoding" do - str = "\x82\xa0".force_encoding(Encoding::Shift_JIS) + str = "\x82\xa0".dup.force_encoding(Encoding::Shift_JIS) Regexp.send(@method, str).encoding.should == Encoding::Shift_JIS end it "returns a Regexp with source String having the input String's encoding" do - str = "\x82\xa0".force_encoding(Encoding::Shift_JIS) + str = "\x82\xa0".dup.force_encoding(Encoding::Shift_JIS) Regexp.send(@method, str).source.encoding.should == Encoding::Shift_JIS end end @@ -498,8 +620,10 @@ describe :regexp_new_regexp, shared: true do Regexp.send(@method, /Hi/n).encoding.should == Encoding::US_ASCII end - it "sets the encoding to source String's encoding if the Regexp literal has the 'n' option and the source String is not ASCII only" do - Regexp.send(@method, Regexp.new("\\xff", nil, 'n')).encoding.should == Encoding::BINARY + ruby_version_is ''...'3.2' do + it "sets the encoding to source String's encoding if the Regexp literal has the 'n' option and the source String is not ASCII only" do + Regexp.send(@method, Regexp.new("\\xff", nil, 'n')).encoding.should == Encoding::BINARY + end end end end diff --git a/spec/ruby/core/regexp/shared/quote.rb b/spec/ruby/core/regexp/shared/quote.rb index a55adb5bf2..b5ecc35f04 100644 --- a/spec/ruby/core/regexp/shared/quote.rb +++ b/spec/ruby/core/regexp/shared/quote.rb @@ -12,19 +12,29 @@ describe :regexp_quote, shared: true do Regexp.send(@method, :symbol).should == 'symbol' end + it "works with substrings" do + str = ".+[]()"[1...-1] + Regexp.send(@method, str).should == '\+\[\]\(' + end + + it "works for broken strings" do + Regexp.send(@method, "a.\x85b.".dup.force_encoding("US-ASCII")).should =="a\\.\x85b\\.".dup.force_encoding("US-ASCII") + Regexp.send(@method, "a.\x80".dup.force_encoding("UTF-8")).should == "a\\.\x80".dup.force_encoding("UTF-8") + end + it "sets the encoding of the result to US-ASCII if there are only US-ASCII characters present in the input String" do - str = "abc".force_encoding("euc-jp") + str = "abc".dup.force_encoding("euc-jp") Regexp.send(@method, str).encoding.should == Encoding::US_ASCII end it "sets the encoding of the result to the encoding of the String if any non-US-ASCII characters are present in an input String with valid encoding" do - str = "ã‚ã‚ŠãŒã¨ã†".force_encoding("utf-8") + str = "ã‚ã‚ŠãŒã¨ã†".dup.force_encoding("utf-8") str.valid_encoding?.should be_true Regexp.send(@method, str).encoding.should == Encoding::UTF_8 end it "sets the encoding of the result to BINARY if any non-US-ASCII characters are present in an input String with invalid encoding" do - str = "\xff".force_encoding "us-ascii" + str = "\xff".dup.force_encoding "us-ascii" str.valid_encoding?.should be_false Regexp.send(@method, "\xff").encoding.should == Encoding::BINARY end diff --git a/spec/ruby/core/regexp/source_spec.rb b/spec/ruby/core/regexp/source_spec.rb index 709fee49b3..5f253da9ea 100644 --- a/spec/ruby/core/regexp/source_spec.rb +++ b/spec/ruby/core/regexp/source_spec.rb @@ -9,8 +9,26 @@ describe "Regexp#source" do /x(.)xz/.source.should == "x(.)xz" end - it "will remove escape characters" do - /foo\/bar/.source.should == "foo/bar" + it "keeps escape sequences as is" do + /\x20\+/.source.should == '\x20\+' + end + + describe "escaping" do + it "keeps escaping of metacharacter" do + /\$/.source.should == "\\$" + end + + it "keeps escaping of metacharacter used as a terminator" do + %r+\++.source.should == "\\+" + end + + it "removes escaping of non-metacharacter used as a terminator" do + %r@\@@.source.should == "@" + end + + it "keeps escaping of non-metacharacter not used as a terminator" do + /\@/.source.should == "\\@" + end end not_supported_on :opal do diff --git a/spec/ruby/core/regexp/timeout_spec.rb b/spec/ruby/core/regexp/timeout_spec.rb new file mode 100644 index 0000000000..6fce261814 --- /dev/null +++ b/spec/ruby/core/regexp/timeout_spec.rb @@ -0,0 +1,35 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "Regexp.timeout" do + after :each do + Regexp.timeout = nil + end + + it "returns global timeout" do + Regexp.timeout = 3 + Regexp.timeout.should == 3 + end + + it "raises Regexp::TimeoutError after global timeout elapsed" do + Regexp.timeout = 0.001 + Regexp.timeout.should == 0.001 + + -> { + # A typical ReDoS case + /^(a*)*$/ =~ "a" * 1000000 + "x" + }.should raise_error(Regexp::TimeoutError, "regexp match timeout") + end + + it "raises Regexp::TimeoutError after timeout keyword value elapsed" do + Regexp.timeout = 3 # This should be ignored + Regexp.timeout.should == 3 + + re = Regexp.new("^a*b?a*$", timeout: 0.001) + + -> { + re =~ "a" * 1000000 + "x" + }.should raise_error(Regexp::TimeoutError, "regexp match timeout") + end + end +end diff --git a/spec/ruby/core/regexp/try_convert_spec.rb b/spec/ruby/core/regexp/try_convert_spec.rb index be567e2130..e775dbe971 100644 --- a/spec/ruby/core/regexp/try_convert_spec.rb +++ b/spec/ruby/core/regexp/try_convert_spec.rb @@ -18,4 +18,10 @@ describe "Regexp.try_convert" do rex.should_receive(:to_regexp).and_return(/(p(a)t[e]rn)/) Regexp.try_convert(rex).should == /(p(a)t[e]rn)/ end + + it "raises a TypeError if the object does not return an Regexp from #to_regexp" do + obj = mock("regexp") + obj.should_receive(:to_regexp).and_return("string") + -> { Regexp.try_convert(obj) }.should raise_error(TypeError, "can't convert MockObject to Regexp (MockObject#to_regexp gives String)") + end end diff --git a/spec/ruby/core/regexp/union_spec.rb b/spec/ruby/core/regexp/union_spec.rb index 8076836471..ea5a5053f7 100644 --- a/spec/ruby/core/regexp/union_spec.rb +++ b/spec/ruby/core/regexp/union_spec.rb @@ -43,6 +43,27 @@ describe "Regexp.union" do Regexp.union("\u00A9".encode("ISO-8859-1"), "a".encode("UTF-8")).encoding.should == Encoding::ISO_8859_1 end + it "returns ASCII-8BIT if the regexp encodings are ASCII-8BIT and at least one has non-ASCII characters" do + us_ascii_implicit, us_ascii_explicit, binary = /abc/, /[\x00-\x7f]/n, /[\x80-\xBF]/n + us_ascii_implicit.encoding.should == Encoding::US_ASCII + us_ascii_explicit.encoding.should == Encoding::US_ASCII + binary.encoding.should == Encoding::BINARY + + Regexp.union(us_ascii_implicit, us_ascii_explicit, binary).encoding.should == Encoding::BINARY + Regexp.union(us_ascii_implicit, binary, us_ascii_explicit).encoding.should == Encoding::BINARY + Regexp.union(us_ascii_explicit, us_ascii_implicit, binary).encoding.should == Encoding::BINARY + Regexp.union(us_ascii_explicit, binary, us_ascii_implicit).encoding.should == Encoding::BINARY + Regexp.union(binary, us_ascii_implicit, us_ascii_explicit).encoding.should == Encoding::BINARY + Regexp.union(binary, us_ascii_explicit, us_ascii_implicit).encoding.should == Encoding::BINARY + end + + it "return US-ASCII if all patterns are ASCII-only" do + Regexp.union(/abc/e, /def/e).encoding.should == Encoding::US_ASCII + Regexp.union(/abc/n, /def/n).encoding.should == Encoding::US_ASCII + Regexp.union(/abc/s, /def/s).encoding.should == Encoding::US_ASCII + Regexp.union(/abc/u, /def/u).encoding.should == Encoding::US_ASCII + end + it "returns a Regexp with UTF-8 if one part is UTF-8" do Regexp.union(/probl[éeè]me/i, /help/i).encoding.should == Encoding::UTF_8 end @@ -54,83 +75,83 @@ describe "Regexp.union" do it "raises ArgumentError if the arguments include conflicting ASCII-incompatible Strings" do -> { Regexp.union("a".encode("UTF-16LE"), "b".encode("UTF-16BE")) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-16LE and UTF-16BE') end it "raises ArgumentError if the arguments include conflicting ASCII-incompatible Regexps" do -> { Regexp.union(Regexp.new("a".encode("UTF-16LE")), Regexp.new("b".encode("UTF-16BE"))) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-16LE and UTF-16BE') end it "raises ArgumentError if the arguments include conflicting fixed encoding Regexps" do -> { Regexp.union(Regexp.new("a".encode("UTF-8"), Regexp::FIXEDENCODING), Regexp.new("b".encode("US-ASCII"), Regexp::FIXEDENCODING)) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-8 and US-ASCII') end it "raises ArgumentError if the arguments include a fixed encoding Regexp and a String containing non-ASCII-compatible characters in a different encoding" do -> { Regexp.union(Regexp.new("a".encode("UTF-8"), Regexp::FIXEDENCODING), "\u00A9".encode("ISO-8859-1")) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-8 and ISO-8859-1') end it "raises ArgumentError if the arguments include a String containing non-ASCII-compatible characters and a fixed encoding Regexp in a different encoding" do -> { Regexp.union("\u00A9".encode("ISO-8859-1"), Regexp.new("a".encode("UTF-8"), Regexp::FIXEDENCODING)) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: ISO-8859-1 and UTF-8') end it "raises ArgumentError if the arguments include an ASCII-incompatible String and an ASCII-only String" do -> { Regexp.union("a".encode("UTF-16LE"), "b".encode("UTF-8")) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, /ASCII incompatible encoding: UTF-16LE|incompatible encodings: UTF-16LE and US-ASCII/) end it "raises ArgumentError if the arguments include an ASCII-incompatible Regexp and an ASCII-only String" do -> { Regexp.union(Regexp.new("a".encode("UTF-16LE")), "b".encode("UTF-8")) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, /ASCII incompatible encoding: UTF-16LE|incompatible encodings: UTF-16LE and US-ASCII/) end it "raises ArgumentError if the arguments include an ASCII-incompatible String and an ASCII-only Regexp" do -> { Regexp.union("a".encode("UTF-16LE"), Regexp.new("b".encode("UTF-8"))) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, /ASCII incompatible encoding: UTF-16LE|incompatible encodings: UTF-16LE and US-ASCII/) end it "raises ArgumentError if the arguments include an ASCII-incompatible Regexp and an ASCII-only Regexp" do -> { Regexp.union(Regexp.new("a".encode("UTF-16LE")), Regexp.new("b".encode("UTF-8"))) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, /ASCII incompatible encoding: UTF-16LE|incompatible encodings: UTF-16LE and US-ASCII/) end it "raises ArgumentError if the arguments include an ASCII-incompatible String and a String containing non-ASCII-compatible characters in a different encoding" do -> { Regexp.union("a".encode("UTF-16LE"), "\u00A9".encode("ISO-8859-1")) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-16LE and ISO-8859-1') end it "raises ArgumentError if the arguments include an ASCII-incompatible Regexp and a String containing non-ASCII-compatible characters in a different encoding" do -> { Regexp.union(Regexp.new("a".encode("UTF-16LE")), "\u00A9".encode("ISO-8859-1")) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-16LE and ISO-8859-1') end it "raises ArgumentError if the arguments include an ASCII-incompatible String and a Regexp containing non-ASCII-compatible characters in a different encoding" do -> { Regexp.union("a".encode("UTF-16LE"), Regexp.new("\u00A9".encode("ISO-8859-1"))) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-16LE and ISO-8859-1') end it "raises ArgumentError if the arguments include an ASCII-incompatible Regexp and a Regexp containing non-ASCII-compatible characters in a different encoding" do -> { Regexp.union(Regexp.new("a".encode("UTF-16LE")), Regexp.new("\u00A9".encode("ISO-8859-1"))) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, 'incompatible encodings: UTF-16LE and ISO-8859-1') end it "uses to_str to convert arguments (if not Regexp)" do @@ -154,6 +175,8 @@ describe "Regexp.union" do not_supported_on :opal do Regexp.union([/dogs/, /cats/i]).should == /(?-mix:dogs)|(?i-mx:cats)/ end - ->{Regexp.union(["skiing", "sledding"], [/dogs/, /cats/i])}.should raise_error(TypeError) + -> { + Regexp.union(["skiing", "sledding"], [/dogs/, /cats/i]) + }.should raise_error(TypeError, 'no implicit conversion of Array into String') end end diff --git a/spec/ruby/core/signal/signame_spec.rb b/spec/ruby/core/signal/signame_spec.rb index b66de9fc85..adfe895d97 100644 --- a/spec/ruby/core/signal/signame_spec.rb +++ b/spec/ruby/core/signal/signame_spec.rb @@ -9,10 +9,22 @@ describe "Signal.signame" do Signal.signame(-1).should == nil end + it "calls #to_int on an object to convert to an Integer" do + obj = mock('signal') + obj.should_receive(:to_int).and_return(0) + Signal.signame(obj).should == "EXIT" + end + it "raises a TypeError when the passed argument can't be coerced to Integer" do -> { Signal.signame("hello") }.should raise_error(TypeError) end + it "raises a TypeError when the passed argument responds to #to_int but does not return an Integer" do + obj = mock('signal') + obj.should_receive(:to_int).and_return('not an int') + -> { Signal.signame(obj) }.should raise_error(TypeError) + end + platform_is_not :windows do it "the original should take precedence over alias when looked up by number" do Signal.signame(Signal.list["ABRT"]).should == "ABRT" diff --git a/spec/ruby/core/signal/trap_spec.rb b/spec/ruby/core/signal/trap_spec.rb index 3c78922694..6d654a99be 100644 --- a/spec/ruby/core/signal/trap_spec.rb +++ b/spec/ruby/core/signal/trap_spec.rb @@ -221,6 +221,37 @@ describe "Signal.trap" do Signal.trap(:HUP, @saved_trap).should equal(@proc) end + it "calls #to_str on an object to convert to a String" do + obj = mock("signal") + obj.should_receive(:to_str).exactly(2).times.and_return("HUP") + Signal.trap obj, @proc + Signal.trap(obj, @saved_trap).should equal(@proc) + end + + it "accepts Integer values" do + hup = Signal.list["HUP"] + Signal.trap hup, @proc + Signal.trap(hup, @saved_trap).should equal(@proc) + end + + it "does not call #to_int on an object to convert to an Integer" do + obj = mock("signal") + obj.should_not_receive(:to_int) + -> { Signal.trap obj, @proc }.should raise_error(ArgumentError, /bad signal type/) + end + + it "raises ArgumentError when passed unknown signal" do + -> { Signal.trap(300) { } }.should raise_error(ArgumentError, "invalid signal number (300)") + -> { Signal.trap("USR10") { } }.should raise_error(ArgumentError, /\Aunsupported signal [`']SIGUSR10'\z/) + -> { Signal.trap("SIGUSR10") { } }.should raise_error(ArgumentError, /\Aunsupported signal [`']SIGUSR10'\z/) + end + + it "raises ArgumentError when passed signal is not Integer, String or Symbol" do + -> { Signal.trap(nil) { } }.should raise_error(ArgumentError, "bad signal type NilClass") + -> { Signal.trap(100.0) { } }.should raise_error(ArgumentError, "bad signal type Float") + -> { Signal.trap(Rational(100)) { } }.should raise_error(ArgumentError, "bad signal type Rational") + end + # See man 2 signal %w[KILL STOP].each do |signal| it "raises ArgumentError or Errno::EINVAL for SIG#{signal}" do @@ -233,6 +264,14 @@ describe "Signal.trap" do end end + %w[SEGV BUS ILL FPE VTALRM].each do |signal| + it "raises ArgumentError for SIG#{signal} which is reserved by Ruby" do + -> { + Signal.trap(signal, -> {}) + }.should raise_error(ArgumentError, "can't trap reserved signal: SIG#{signal}") + end + end + it "allows to register a handler for all known signals, except reserved signals for which it raises ArgumentError" do out = ruby_exe(fixture(__FILE__, "trap_all.rb"), args: "2>&1") out.should == "OK\n" @@ -254,12 +293,10 @@ describe "Signal.trap" do r.close loop { w.write("a"*1024) } RUBY - out = ruby_exe(code, exit_status: nil) + out = ruby_exe(code, exit_status: :SIGPIPE) status = $? out.should == "nil\n" status.should.signaled? - status.termsig.should be_kind_of(Integer) - Signal.signame(status.termsig).should == "PIPE" end end diff --git a/spec/ruby/core/sizedqueue/append_spec.rb b/spec/ruby/core/sizedqueue/append_spec.rb index ca79068930..6fffe2f272 100644 --- a/spec/ruby/core/sizedqueue/append_spec.rb +++ b/spec/ruby/core/sizedqueue/append_spec.rb @@ -1,6 +1,7 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/enque' require_relative '../../shared/sizedqueue/enque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "SizedQueue#<<" do it_behaves_like :queue_enq, :<<, -> { SizedQueue.new(10) } @@ -9,3 +10,9 @@ end describe "SizedQueue#<<" do it_behaves_like :sizedqueue_enq, :<<, -> n { SizedQueue.new(n) } end + +describe "SizedQueue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = SizedQueue.new(1); q.send(:<<, 1, timeout: v) } + end +end diff --git a/spec/ruby/core/sizedqueue/deq_spec.rb b/spec/ruby/core/sizedqueue/deq_spec.rb index 5e1bd9f746..985d654bb3 100644 --- a/spec/ruby/core/sizedqueue/deq_spec.rb +++ b/spec/ruby/core/sizedqueue/deq_spec.rb @@ -1,6 +1,13 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/deque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "SizedQueue#deq" do it_behaves_like :queue_deq, :deq, -> { SizedQueue.new(10) } end + +describe "SizedQueue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = SizedQueue.new(10); q.push(1); q.deq(timeout: v) } + end +end diff --git a/spec/ruby/core/sizedqueue/enq_spec.rb b/spec/ruby/core/sizedqueue/enq_spec.rb index 3821afac95..619373e46b 100644 --- a/spec/ruby/core/sizedqueue/enq_spec.rb +++ b/spec/ruby/core/sizedqueue/enq_spec.rb @@ -1,6 +1,7 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/enque' require_relative '../../shared/sizedqueue/enque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "SizedQueue#enq" do it_behaves_like :queue_enq, :enq, -> { SizedQueue.new(10) } @@ -9,3 +10,9 @@ end describe "SizedQueue#enq" do it_behaves_like :sizedqueue_enq, :enq, -> n { SizedQueue.new(n) } end + +describe "SizedQueue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = SizedQueue.new(1); q.enq(1, timeout: v) } + end +end diff --git a/spec/ruby/core/sizedqueue/pop_spec.rb b/spec/ruby/core/sizedqueue/pop_spec.rb index a0cf6f509c..5e7cfea8fb 100644 --- a/spec/ruby/core/sizedqueue/pop_spec.rb +++ b/spec/ruby/core/sizedqueue/pop_spec.rb @@ -1,6 +1,13 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/deque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "SizedQueue#pop" do it_behaves_like :queue_deq, :pop, -> { SizedQueue.new(10) } end + +describe "SizedQueue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = SizedQueue.new(10); q.push(1); q.pop(timeout: v) } + end +end diff --git a/spec/ruby/core/sizedqueue/push_spec.rb b/spec/ruby/core/sizedqueue/push_spec.rb index bba9be9e3f..ce61e89b53 100644 --- a/spec/ruby/core/sizedqueue/push_spec.rb +++ b/spec/ruby/core/sizedqueue/push_spec.rb @@ -1,6 +1,7 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/enque' require_relative '../../shared/sizedqueue/enque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "SizedQueue#push" do it_behaves_like :queue_enq, :push, -> { SizedQueue.new(10) } @@ -9,3 +10,9 @@ end describe "SizedQueue#push" do it_behaves_like :sizedqueue_enq, :push, -> n { SizedQueue.new(n) } end + +describe "SizedQueue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = SizedQueue.new(1); q.push(1, timeout: v) } + end +end diff --git a/spec/ruby/core/sizedqueue/shift_spec.rb b/spec/ruby/core/sizedqueue/shift_spec.rb index 5138e68258..3220801f3a 100644 --- a/spec/ruby/core/sizedqueue/shift_spec.rb +++ b/spec/ruby/core/sizedqueue/shift_spec.rb @@ -1,6 +1,13 @@ require_relative '../../spec_helper' require_relative '../../shared/queue/deque' +require_relative '../../shared/types/rb_num2dbl_fails' describe "SizedQueue#shift" do it_behaves_like :queue_deq, :shift, -> { SizedQueue.new(10) } end + +describe "SizedQueue operations with timeout" do + ruby_version_is "3.2" do + it_behaves_like :rb_num2dbl_fails, nil, -> v { q = SizedQueue.new(10); q.push(1); q.shift(timeout: v) } + end +end diff --git a/spec/ruby/core/string/allocate_spec.rb b/spec/ruby/core/string/allocate_spec.rb index 5b36b4fd05..30d5f60594 100644 --- a/spec/ruby/core/string/allocate_spec.rb +++ b/spec/ruby/core/string/allocate_spec.rb @@ -14,6 +14,6 @@ describe "String.allocate" do end it "returns a binary String" do - String.new.encoding.should == Encoding::BINARY + String.allocate.encoding.should == Encoding::BINARY end end diff --git a/spec/ruby/core/string/append_spec.rb b/spec/ruby/core/string/append_spec.rb index 1e1667f617..8497ce8262 100644 --- a/spec/ruby/core/string/append_spec.rb +++ b/spec/ruby/core/string/append_spec.rb @@ -5,4 +5,10 @@ require_relative 'shared/concat' describe "String#<<" do it_behaves_like :string_concat, :<< it_behaves_like :string_concat_encoding, :<< + it_behaves_like :string_concat_type_coercion, :<< + + it "raises an ArgumentError when given the incorrect number of arguments" do + -> { "hello".send(:<<) }.should raise_error(ArgumentError) + -> { "hello".send(:<<, "one", "two") }.should raise_error(ArgumentError) + end end diff --git a/spec/ruby/core/string/ascii_only_spec.rb b/spec/ruby/core/string/ascii_only_spec.rb index c7e02fd874..88a0559cfd 100644 --- a/spec/ruby/core/string/ascii_only_spec.rb +++ b/spec/ruby/core/string/ascii_only_spec.rb @@ -7,12 +7,12 @@ describe "String#ascii_only?" do it "returns true if the encoding is UTF-8" do [ ["hello", true], ["hello".encode('UTF-8'), true], - ["hello".force_encoding('UTF-8'), true], + ["hello".dup.force_encoding('UTF-8'), true], ].should be_computed_by(:ascii_only?) end it "returns true if the encoding is US-ASCII" do - "hello".force_encoding(Encoding::US_ASCII).ascii_only?.should be_true + "hello".dup.force_encoding(Encoding::US_ASCII).ascii_only?.should be_true "hello".encode(Encoding::US_ASCII).ascii_only?.should be_true end @@ -34,13 +34,13 @@ describe "String#ascii_only?" do [ ["\u{6666}", false], ["hello, \u{6666}", false], ["\u{6666}".encode('UTF-8'), false], - ["\u{6666}".force_encoding('UTF-8'), false], + ["\u{6666}".dup.force_encoding('UTF-8'), false], ].should be_computed_by(:ascii_only?) end it "returns false if the encoding is US-ASCII" do - [ ["\u{6666}".force_encoding(Encoding::US_ASCII), false], - ["hello, \u{6666}".force_encoding(Encoding::US_ASCII), false], + [ ["\u{6666}".dup.force_encoding(Encoding::US_ASCII), false], + ["hello, \u{6666}".dup.force_encoding(Encoding::US_ASCII), false], ].should be_computed_by(:ascii_only?) end end @@ -51,17 +51,16 @@ describe "String#ascii_only?" do end it "returns false for the empty String with a non-ASCII-compatible encoding" do - "".force_encoding('UTF-16LE').ascii_only?.should be_false + "".dup.force_encoding('UTF-16LE').ascii_only?.should be_false "".encode('UTF-16BE').ascii_only?.should be_false end it "returns false for a non-empty String with non-ASCII-compatible encoding" do - "\x78\x00".force_encoding("UTF-16LE").ascii_only?.should be_false + "\x78\x00".dup.force_encoding("UTF-16LE").ascii_only?.should be_false end it "returns false when interpolating non ascii strings" do - base = "EU currency is" - base.force_encoding(Encoding::US_ASCII) + base = "EU currency is".dup.force_encoding(Encoding::US_ASCII) euro = "\u20AC" interp = "#{base} #{euro}" euro.ascii_only?.should be_false @@ -70,14 +69,14 @@ describe "String#ascii_only?" do end it "returns false after appending non ASCII characters to an empty String" do - ("" << "λ").ascii_only?.should be_false + ("".dup << "λ").ascii_only?.should be_false end it "returns false when concatenating an ASCII and non-ASCII String" do - "".concat("λ").ascii_only?.should be_false + "".dup.concat("λ").ascii_only?.should be_false end it "returns false when replacing an ASCII String with a non-ASCII String" do - "".replace("λ").ascii_only?.should be_false + "".dup.replace("λ").ascii_only?.should be_false end end diff --git a/spec/ruby/core/string/b_spec.rb b/spec/ruby/core/string/b_spec.rb index b2e3d326ba..4b1fafff11 100644 --- a/spec/ruby/core/string/b_spec.rb +++ b/spec/ruby/core/string/b_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' describe "String#b" do @@ -12,13 +13,4 @@ describe "String#b" do str.b.should_not equal(str) str.should == "ã“ã‚“ã¡ã«ã¯" end - - ruby_version_is ''...'2.7' do - it "copies own tainted/untrusted status to the returning value" do - utf_8 = "ã“ã‚“ã¡ã«ã¯".taint.untrust - ret = utf_8.b - ret.tainted?.should be_true - ret.untrusted?.should be_true - end - end end diff --git a/spec/ruby/core/string/byteindex_spec.rb b/spec/ruby/core/string/byteindex_spec.rb new file mode 100644 index 0000000000..47c7be1029 --- /dev/null +++ b/spec/ruby/core/string/byteindex_spec.rb @@ -0,0 +1,304 @@ +# -*- encoding: utf-8 -*- +require_relative '../../spec_helper' +require_relative 'fixtures/classes' +require_relative 'shared/byte_index_common.rb' + +describe "String#byteindex" do + ruby_version_is "3.2" do + it "calls #to_str to convert the first argument" do + char = mock("string index char") + char.should_receive(:to_str).and_return("b") + "abc".byteindex(char).should == 1 + end + + it "calls #to_int to convert the second argument" do + offset = mock("string index offset") + offset.should_receive(:to_int).and_return(1) + "abc".byteindex("c", offset).should == 2 + end + + it "does not raise IndexError when byte offset is correct or on string boundary" do + "ã‚".byteindex("").should == 0 + "ã‚".byteindex("", 0).should == 0 + "ã‚".byteindex("", 3).should == 3 + end + + it_behaves_like :byte_index_common, :byteindex + end +end + +describe "String#byteindex with String" do + ruby_version_is "3.2" do + it "behaves the same as String#byteindex(char) for one-character strings" do + "blablabla hello cruel world...!".split("").uniq.each do |str| + chr = str[0] + str.byteindex(str).should == str.byteindex(chr) + + 0.upto(str.size + 1) do |start| + str.byteindex(str, start).should == str.byteindex(chr, start) + end + + (-str.size - 1).upto(-1) do |start| + str.byteindex(str, start).should == str.byteindex(chr, start) + end + end + end + + it "returns the byteindex of the first occurrence of the given substring" do + "blablabla".byteindex("").should == 0 + "blablabla".byteindex("b").should == 0 + "blablabla".byteindex("bla").should == 0 + "blablabla".byteindex("blabla").should == 0 + "blablabla".byteindex("blablabla").should == 0 + + "blablabla".byteindex("l").should == 1 + "blablabla".byteindex("la").should == 1 + "blablabla".byteindex("labla").should == 1 + "blablabla".byteindex("lablabla").should == 1 + + "blablabla".byteindex("a").should == 2 + "blablabla".byteindex("abla").should == 2 + "blablabla".byteindex("ablabla").should == 2 + end + + it "treats the offset as a byteindex" do + "aaaaa".byteindex("a", 0).should == 0 + "aaaaa".byteindex("a", 2).should == 2 + "aaaaa".byteindex("a", 4).should == 4 + end + + it "ignores string subclasses" do + "blablabla".byteindex(StringSpecs::MyString.new("bla")).should == 0 + StringSpecs::MyString.new("blablabla").byteindex("bla").should == 0 + StringSpecs::MyString.new("blablabla").byteindex(StringSpecs::MyString.new("bla")).should == 0 + end + + it "starts the search at the given offset" do + "blablabla".byteindex("bl", 0).should == 0 + "blablabla".byteindex("bl", 1).should == 3 + "blablabla".byteindex("bl", 2).should == 3 + "blablabla".byteindex("bl", 3).should == 3 + + "blablabla".byteindex("bla", 0).should == 0 + "blablabla".byteindex("bla", 1).should == 3 + "blablabla".byteindex("bla", 2).should == 3 + "blablabla".byteindex("bla", 3).should == 3 + + "blablabla".byteindex("blab", 0).should == 0 + "blablabla".byteindex("blab", 1).should == 3 + "blablabla".byteindex("blab", 2).should == 3 + "blablabla".byteindex("blab", 3).should == 3 + + "blablabla".byteindex("la", 1).should == 1 + "blablabla".byteindex("la", 2).should == 4 + "blablabla".byteindex("la", 3).should == 4 + "blablabla".byteindex("la", 4).should == 4 + + "blablabla".byteindex("lab", 1).should == 1 + "blablabla".byteindex("lab", 2).should == 4 + "blablabla".byteindex("lab", 3).should == 4 + "blablabla".byteindex("lab", 4).should == 4 + + "blablabla".byteindex("ab", 2).should == 2 + "blablabla".byteindex("ab", 3).should == 5 + "blablabla".byteindex("ab", 4).should == 5 + "blablabla".byteindex("ab", 5).should == 5 + + "blablabla".byteindex("", 0).should == 0 + "blablabla".byteindex("", 1).should == 1 + "blablabla".byteindex("", 2).should == 2 + "blablabla".byteindex("", 7).should == 7 + "blablabla".byteindex("", 8).should == 8 + "blablabla".byteindex("", 9).should == 9 + end + + it "starts the search at offset + self.length if offset is negative" do + str = "blablabla" + + ["bl", "bla", "blab", "la", "lab", "ab", ""].each do |needle| + (-str.length .. -1).each do |offset| + str.byteindex(needle, offset).should == + str.byteindex(needle, offset + str.length) + end + end + end + + it "returns nil if the substring isn't found" do + "blablabla".byteindex("B").should == nil + "blablabla".byteindex("z").should == nil + "blablabla".byteindex("BLA").should == nil + "blablabla".byteindex("blablablabla").should == nil + "blablabla".byteindex("", 10).should == nil + + "hello".byteindex("he", 1).should == nil + "hello".byteindex("he", 2).should == nil + "I’ve got a multibyte character.\n".byteindex("\n\n").should == nil + end + + it "returns the character byteindex of a multibyte character" do + "ã‚ã‚ŠãŒã¨ã†".byteindex("ãŒ").should == 6 + end + + it "returns the character byteindex after offset" do + "ã‚ã‚Œã‚ã‚Œ".byteindex("ã‚", 3).should == 6 + "ã‚ã‚ŠãŒã¨ã†ã‚ã‚ŠãŒã¨ã†".byteindex("ãŒ", 9).should == 21 + end + + it "returns the character byteindex after a partial first match" do + "</</h".byteindex("</h").should == 2 + end + + it "raises an Encoding::CompatibilityError if the encodings are incompatible" do + char = "ã‚Œ".encode Encoding::EUC_JP + -> do + "ã‚ã‚Œ".byteindex(char) + end.should raise_error(Encoding::CompatibilityError) + end + + it "handles a substring in a superset encoding" do + 'abc'.dup.force_encoding(Encoding::US_ASCII).byteindex('é').should == nil + end + + it "handles a substring in a subset encoding" do + 'été'.byteindex('t'.dup.force_encoding(Encoding::US_ASCII)).should == 2 + end + end +end + +describe "String#byteindex with Regexp" do + ruby_version_is "3.2" do + it "behaves the same as String#byteindex(string) for escaped string regexps" do + ["blablabla", "hello cruel world...!"].each do |str| + ["", "b", "bla", "lab", "o c", "d."].each do |needle| + regexp = Regexp.new(Regexp.escape(needle)) + str.byteindex(regexp).should == str.byteindex(needle) + + 0.upto(str.size + 1) do |start| + str.byteindex(regexp, start).should == str.byteindex(needle, start) + end + + (-str.size - 1).upto(-1) do |start| + str.byteindex(regexp, start).should == str.byteindex(needle, start) + end + end + end + end + + it "returns the byteindex of the first match of regexp" do + "blablabla".byteindex(/bla/).should == 0 + "blablabla".byteindex(/BLA/i).should == 0 + + "blablabla".byteindex(/.{0}/).should == 0 + "blablabla".byteindex(/.{6}/).should == 0 + "blablabla".byteindex(/.{9}/).should == 0 + + "blablabla".byteindex(/.*/).should == 0 + "blablabla".byteindex(/.+/).should == 0 + + "blablabla".byteindex(/lab|b/).should == 0 + + not_supported_on :opal do + "blablabla".byteindex(/\A/).should == 0 + "blablabla".byteindex(/\Z/).should == 9 + "blablabla".byteindex(/\z/).should == 9 + "blablabla\n".byteindex(/\Z/).should == 9 + "blablabla\n".byteindex(/\z/).should == 10 + end + + "blablabla".byteindex(/^/).should == 0 + "\nblablabla".byteindex(/^/).should == 0 + "b\nablabla".byteindex(/$/).should == 1 + "bl\nablabla".byteindex(/$/).should == 2 + + "blablabla".byteindex(/.l./).should == 0 + end + + it "starts the search at the given offset" do + "blablabla".byteindex(/.{0}/, 5).should == 5 + "blablabla".byteindex(/.{1}/, 5).should == 5 + "blablabla".byteindex(/.{2}/, 5).should == 5 + "blablabla".byteindex(/.{3}/, 5).should == 5 + "blablabla".byteindex(/.{4}/, 5).should == 5 + + "blablabla".byteindex(/.{0}/, 3).should == 3 + "blablabla".byteindex(/.{1}/, 3).should == 3 + "blablabla".byteindex(/.{2}/, 3).should == 3 + "blablabla".byteindex(/.{5}/, 3).should == 3 + "blablabla".byteindex(/.{6}/, 3).should == 3 + + "blablabla".byteindex(/.l./, 0).should == 0 + "blablabla".byteindex(/.l./, 1).should == 3 + "blablabla".byteindex(/.l./, 2).should == 3 + "blablabla".byteindex(/.l./, 3).should == 3 + + "xblaxbla".byteindex(/x./, 0).should == 0 + "xblaxbla".byteindex(/x./, 1).should == 4 + "xblaxbla".byteindex(/x./, 2).should == 4 + + not_supported_on :opal do + "blablabla\n".byteindex(/\Z/, 9).should == 9 + end + end + + it "starts the search at offset + self.length if offset is negative" do + str = "blablabla" + + ["bl", "bla", "blab", "la", "lab", "ab", ""].each do |needle| + (-str.length .. -1).each do |offset| + str.byteindex(needle, offset).should == + str.byteindex(needle, offset + str.length) + end + end + end + + it "returns nil if the substring isn't found" do + "blablabla".byteindex(/BLA/).should == nil + + "blablabla".byteindex(/.{10}/).should == nil + "blaxbla".byteindex(/.x/, 3).should == nil + "blaxbla".byteindex(/..x/, 2).should == nil + end + + it "returns nil if the Regexp matches the empty string and the offset is out of range" do + "ruby".byteindex(//, 12).should be_nil + end + + it "supports \\G which matches at the given start offset" do + "helloYOU.".byteindex(/\GYOU/, 5).should == 5 + "helloYOU.".byteindex(/\GYOU/).should == nil + + re = /\G.+YOU/ + # The # marks where \G will match. + [ + ["#hi!YOUall.", 0], + ["h#i!YOUall.", 1], + ["hi#!YOUall.", 2], + ["hi!#YOUall.", nil] + ].each do |spec| + + start = spec[0].byteindex("#") + str = spec[0].delete("#") + + str.byteindex(re, start).should == spec[1] + end + end + + it "converts start_offset to an integer via to_int" do + obj = mock('1') + obj.should_receive(:to_int).and_return(1) + "RWOARW".byteindex(/R./, obj).should == 4 + end + + it "returns the character byteindex of a multibyte character" do + "ã‚ã‚ŠãŒã¨ã†".byteindex(/ãŒ/).should == 6 + end + + it "returns the character byteindex after offset" do + "ã‚ã‚Œã‚ã‚Œ".byteindex(/ã‚/, 3).should == 6 + end + + it "treats the offset as a byteindex" do + "ã‚ã‚Œã‚ã‚ã‚Œ".byteindex(/ã‚/, 6).should == 6 + end + end +end diff --git a/spec/ruby/core/string/byterindex_spec.rb b/spec/ruby/core/string/byterindex_spec.rb new file mode 100644 index 0000000000..150f709b90 --- /dev/null +++ b/spec/ruby/core/string/byterindex_spec.rb @@ -0,0 +1,359 @@ +# -*- encoding: utf-8 -*- +require_relative '../../spec_helper' +require_relative 'fixtures/classes' +require_relative 'shared/byte_index_common.rb' + +describe "String#byterindex with object" do + ruby_version_is "3.2" do + it "tries to convert obj to a string via to_str" do + obj = mock('lo') + def obj.to_str() "lo" end + "hello".byterindex(obj).should == "hello".byterindex("lo") + + obj = mock('o') + def obj.respond_to?(arg, *) true end + def obj.method_missing(*args) "o" end + "hello".byterindex(obj).should == "hello".byterindex("o") + end + + it "calls #to_int to convert the second argument" do + offset = mock("string index offset") + offset.should_receive(:to_int).and_return(3) + "abc".byterindex("c", offset).should == 2 + end + + it "does not raise IndexError when byte offset is correct or on string boundary" do + "ã‚".byterindex("", 0).should == 0 + "ã‚".byterindex("", 3).should == 3 + "ã‚".byterindex("").should == 3 + end + + it_behaves_like :byte_index_common, :byterindex + end +end + +describe "String#byterindex with String" do + ruby_version_is "3.2" do + it "behaves the same as String#byterindex(char) for one-character strings" do + "blablabla hello cruel world...!".split("").uniq.each do |str| + chr = str[0] + str.byterindex(str).should == str.byterindex(chr) + + 0.upto(str.size + 1) do |start| + str.byterindex(str, start).should == str.byterindex(chr, start) + end + + (-str.size - 1).upto(-1) do |start| + str.byterindex(str, start).should == str.byterindex(chr, start) + end + end + end + + it "behaves the same as String#byterindex(?char) for one-character strings" do + "blablabla hello cruel world...!".split("").uniq.each do |str| + chr = str[0] =~ / / ? str[0] : eval("?#{str[0]}") + str.byterindex(str).should == str.byterindex(chr) + + 0.upto(str.size + 1) do |start| + str.byterindex(str, start).should == str.byterindex(chr, start) + end + + (-str.size - 1).upto(-1) do |start| + str.byterindex(str, start).should == str.byterindex(chr, start) + end + end + end + + it "returns the index of the last occurrence of the given substring" do + "blablabla".byterindex("").should == 9 + "blablabla".byterindex("a").should == 8 + "blablabla".byterindex("la").should == 7 + "blablabla".byterindex("bla").should == 6 + "blablabla".byterindex("abla").should == 5 + "blablabla".byterindex("labla").should == 4 + "blablabla".byterindex("blabla").should == 3 + "blablabla".byterindex("ablabla").should == 2 + "blablabla".byterindex("lablabla").should == 1 + "blablabla".byterindex("blablabla").should == 0 + + "blablabla".byterindex("l").should == 7 + "blablabla".byterindex("bl").should == 6 + "blablabla".byterindex("abl").should == 5 + "blablabla".byterindex("labl").should == 4 + "blablabla".byterindex("blabl").should == 3 + "blablabla".byterindex("ablabl").should == 2 + "blablabla".byterindex("lablabl").should == 1 + "blablabla".byterindex("blablabl").should == 0 + + "blablabla".byterindex("b").should == 6 + "blablabla".byterindex("ab").should == 5 + "blablabla".byterindex("lab").should == 4 + "blablabla".byterindex("blab").should == 3 + "blablabla".byterindex("ablab").should == 2 + "blablabla".byterindex("lablab").should == 1 + "blablabla".byterindex("blablab").should == 0 + end + + it "ignores string subclasses" do + "blablabla".byterindex(StringSpecs::MyString.new("bla")).should == 6 + StringSpecs::MyString.new("blablabla").byterindex("bla").should == 6 + StringSpecs::MyString.new("blablabla").byterindex(StringSpecs::MyString.new("bla")).should == 6 + end + + it "starts the search at the given offset" do + "blablabla".byterindex("bl", 0).should == 0 + "blablabla".byterindex("bl", 1).should == 0 + "blablabla".byterindex("bl", 2).should == 0 + "blablabla".byterindex("bl", 3).should == 3 + + "blablabla".byterindex("bla", 0).should == 0 + "blablabla".byterindex("bla", 1).should == 0 + "blablabla".byterindex("bla", 2).should == 0 + "blablabla".byterindex("bla", 3).should == 3 + + "blablabla".byterindex("blab", 0).should == 0 + "blablabla".byterindex("blab", 1).should == 0 + "blablabla".byterindex("blab", 2).should == 0 + "blablabla".byterindex("blab", 3).should == 3 + "blablabla".byterindex("blab", 6).should == 3 + "blablablax".byterindex("blab", 6).should == 3 + + "blablabla".byterindex("la", 1).should == 1 + "blablabla".byterindex("la", 2).should == 1 + "blablabla".byterindex("la", 3).should == 1 + "blablabla".byterindex("la", 4).should == 4 + + "blablabla".byterindex("lab", 1).should == 1 + "blablabla".byterindex("lab", 2).should == 1 + "blablabla".byterindex("lab", 3).should == 1 + "blablabla".byterindex("lab", 4).should == 4 + + "blablabla".byterindex("ab", 2).should == 2 + "blablabla".byterindex("ab", 3).should == 2 + "blablabla".byterindex("ab", 4).should == 2 + "blablabla".byterindex("ab", 5).should == 5 + + "blablabla".byterindex("", 0).should == 0 + "blablabla".byterindex("", 1).should == 1 + "blablabla".byterindex("", 2).should == 2 + "blablabla".byterindex("", 7).should == 7 + "blablabla".byterindex("", 8).should == 8 + "blablabla".byterindex("", 9).should == 9 + "blablabla".byterindex("", 10).should == 9 + end + + it "starts the search at offset + self.length if offset is negative" do + str = "blablabla" + + ["bl", "bla", "blab", "la", "lab", "ab", ""].each do |needle| + (-str.length .. -1).each do |offset| + str.byterindex(needle, offset).should == + str.byterindex(needle, offset + str.length) + end + end + end + + it "returns nil if the substring isn't found" do + "blablabla".byterindex("B").should == nil + "blablabla".byterindex("z").should == nil + "blablabla".byterindex("BLA").should == nil + "blablabla".byterindex("blablablabla").should == nil + + "hello".byterindex("lo", 0).should == nil + "hello".byterindex("lo", 1).should == nil + "hello".byterindex("lo", 2).should == nil + + "hello".byterindex("llo", 0).should == nil + "hello".byterindex("llo", 1).should == nil + + "hello".byterindex("el", 0).should == nil + "hello".byterindex("ello", 0).should == nil + + "hello".byterindex("", -6).should == nil + "hello".byterindex("", -7).should == nil + + "hello".byterindex("h", -6).should == nil + end + + it "tries to convert start_offset to an integer via to_int" do + obj = mock('5') + def obj.to_int() 5 end + "str".byterindex("st", obj).should == 0 + + obj = mock('5') + def obj.respond_to?(arg, *) true end + def obj.method_missing(*args) 5 end + "str".byterindex("st", obj).should == 0 + end + + it "raises a TypeError when given offset is nil" do + -> { "str".byterindex("st", nil) }.should raise_error(TypeError) + end + + it "handles a substring in a superset encoding" do + 'abc'.dup.force_encoding(Encoding::US_ASCII).byterindex('é').should == nil + end + + it "handles a substring in a subset encoding" do + 'été'.byterindex('t'.dup.force_encoding(Encoding::US_ASCII)).should == 2 + end + end +end + +describe "String#byterindex with Regexp" do + ruby_version_is "3.2" do + it "behaves the same as String#byterindex(string) for escaped string regexps" do + ["blablabla", "hello cruel world...!"].each do |str| + ["", "b", "bla", "lab", "o c", "d."].each do |needle| + regexp = Regexp.new(Regexp.escape(needle)) + str.byterindex(regexp).should == str.byterindex(needle) + + 0.upto(str.size + 1) do |start| + str.byterindex(regexp, start).should == str.byterindex(needle, start) + end + + (-str.size - 1).upto(-1) do |start| + str.byterindex(regexp, start).should == str.byterindex(needle, start) + end + end + end + end + + it "returns the index of the first match from the end of string of regexp" do + "blablabla".byterindex(/bla/).should == 6 + "blablabla".byterindex(/BLA/i).should == 6 + + "blablabla".byterindex(/.{0}/).should == 9 + "blablabla".byterindex(/.{1}/).should == 8 + "blablabla".byterindex(/.{2}/).should == 7 + "blablabla".byterindex(/.{6}/).should == 3 + "blablabla".byterindex(/.{9}/).should == 0 + + "blablabla".byterindex(/.*/).should == 9 + "blablabla".byterindex(/.+/).should == 8 + + "blablabla".byterindex(/bla|a/).should == 8 + + not_supported_on :opal do + "blablabla".byterindex(/\A/).should == 0 + "blablabla".byterindex(/\Z/).should == 9 + "blablabla".byterindex(/\z/).should == 9 + "blablabla\n".byterindex(/\Z/).should == 10 + "blablabla\n".byterindex(/\z/).should == 10 + end + + "blablabla".byterindex(/^/).should == 0 + not_supported_on :opal do + "\nblablabla".byterindex(/^/).should == 1 + "b\nlablabla".byterindex(/^/).should == 2 + end + "blablabla".byterindex(/$/).should == 9 + + "blablabla".byterindex(/.l./).should == 6 + end + + it "starts the search at the given offset" do + "blablabla".byterindex(/.{0}/, 5).should == 5 + "blablabla".byterindex(/.{1}/, 5).should == 5 + "blablabla".byterindex(/.{2}/, 5).should == 5 + "blablabla".byterindex(/.{3}/, 5).should == 5 + "blablabla".byterindex(/.{4}/, 5).should == 5 + + "blablabla".byterindex(/.{0}/, 3).should == 3 + "blablabla".byterindex(/.{1}/, 3).should == 3 + "blablabla".byterindex(/.{2}/, 3).should == 3 + "blablabla".byterindex(/.{5}/, 3).should == 3 + "blablabla".byterindex(/.{6}/, 3).should == 3 + + "blablabla".byterindex(/.l./, 0).should == 0 + "blablabla".byterindex(/.l./, 1).should == 0 + "blablabla".byterindex(/.l./, 2).should == 0 + "blablabla".byterindex(/.l./, 3).should == 3 + + "blablablax".byterindex(/.x/, 10).should == 8 + "blablablax".byterindex(/.x/, 9).should == 8 + "blablablax".byterindex(/.x/, 8).should == 8 + + "blablablax".byterindex(/..x/, 10).should == 7 + "blablablax".byterindex(/..x/, 9).should == 7 + "blablablax".byterindex(/..x/, 8).should == 7 + "blablablax".byterindex(/..x/, 7).should == 7 + + not_supported_on :opal do + "blablabla\n".byterindex(/\Z/, 9).should == 9 + end + end + + it "starts the search at offset + self.length if offset is negative" do + str = "blablabla" + + ["bl", "bla", "blab", "la", "lab", "ab", ""].each do |needle| + (-str.length .. -1).each do |offset| + str.byterindex(needle, offset).should == + str.byterindex(needle, offset + str.length) + end + end + end + + it "returns nil if the substring isn't found" do + "blablabla".byterindex(/BLA/).should == nil + "blablabla".byterindex(/.{10}/).should == nil + "blablablax".byterindex(/.x/, 7).should == nil + "blablablax".byterindex(/..x/, 6).should == nil + + not_supported_on :opal do + "blablabla".byterindex(/\Z/, 5).should == nil + "blablabla".byterindex(/\z/, 5).should == nil + "blablabla\n".byterindex(/\z/, 9).should == nil + end + end + + not_supported_on :opal do + it "supports \\G which matches at the given start offset" do + "helloYOU.".byterindex(/YOU\G/, 8).should == 5 + "helloYOU.".byterindex(/YOU\G/).should == nil + + idx = "helloYOUall!".index("YOU") + re = /YOU.+\G.+/ + # The # marks where \G will match. + [ + ["helloYOU#all.", nil], + ["helloYOUa#ll.", idx], + ["helloYOUal#l.", idx], + ["helloYOUall#.", idx], + ["helloYOUall.#", nil] + ].each do |i| + start = i[0].index("#") + str = i[0].delete("#") + + str.byterindex(re, start).should == i[1] + end + end + end + + it "tries to convert start_offset to an integer" do + obj = mock('5') + def obj.to_int() 5 end + "str".byterindex(/../, obj).should == 1 + + obj = mock('5') + def obj.respond_to?(arg, *) true end + def obj.method_missing(*args); 5; end + "str".byterindex(/../, obj).should == 1 + end + + it "raises a TypeError when given offset is nil" do + -> { "str".byterindex(/../, nil) }.should raise_error(TypeError) + end + + it "returns the reverse byte index of a multibyte character" do + "ã‚ã‚ŠãŒã‚ŠãŒã¨ã†".byterindex("ãŒ").should == 12 + "ã‚ã‚ŠãŒã‚ŠãŒã¨ã†".byterindex(/ãŒ/).should == 12 + end + + it "returns the character index before the finish" do + "ã‚ã‚ŠãŒã‚ŠãŒã¨ã†".byterindex("ãŒ", 9).should == 6 + "ã‚ã‚ŠãŒã‚ŠãŒã¨ã†".byterindex(/ãŒ/, 9).should == 6 + end + end +end diff --git a/spec/ruby/core/string/bytes_spec.rb b/spec/ruby/core/string/bytes_spec.rb index 859b346550..02151eebbc 100644 --- a/spec/ruby/core/string/bytes_spec.rb +++ b/spec/ruby/core/string/bytes_spec.rb @@ -50,6 +50,6 @@ describe "String#bytes" do end it "is unaffected by #force_encoding" do - @utf8.force_encoding('ASCII').bytes.to_a.should == @utf8.bytes.to_a + @utf8.dup.force_encoding('ASCII').bytes.to_a.should == @utf8.bytes.to_a end end diff --git a/spec/ruby/core/string/bytesize_spec.rb b/spec/ruby/core/string/bytesize_spec.rb index b8b07cfbec..2bbefc0820 100644 --- a/spec/ruby/core/string/bytesize_spec.rb +++ b/spec/ruby/core/string/bytesize_spec.rb @@ -2,7 +2,7 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -describe "#String#bytesize" do +describe "String#bytesize" do it "returns the length of self in bytes" do "hello".bytesize.should == 5 " ".bytesize.should == 1 @@ -13,21 +13,21 @@ describe "#String#bytesize" do end it "works with pseudo-ASCII strings containing single UTF-8 characters" do - "\u{6666}".force_encoding('ASCII').bytesize.should == 3 + "\u{6666}".dup.force_encoding('ASCII').bytesize.should == 3 end it "works with strings containing UTF-8 characters" do - "c \u{6666}".force_encoding('UTF-8').bytesize.should == 5 + "c \u{6666}".dup.force_encoding('UTF-8').bytesize.should == 5 "c \u{6666}".bytesize.should == 5 end it "works with pseudo-ASCII strings containing UTF-8 characters" do - "c \u{6666}".force_encoding('ASCII').bytesize.should == 5 + "c \u{6666}".dup.force_encoding('ASCII').bytesize.should == 5 end it "returns 0 for the empty string" do "".bytesize.should == 0 - "".force_encoding('ASCII').bytesize.should == 0 - "".force_encoding('UTF-8').bytesize.should == 0 + "".dup.force_encoding('ASCII').bytesize.should == 0 + "".dup.force_encoding('UTF-8').bytesize.should == 0 end end diff --git a/spec/ruby/core/string/byteslice_spec.rb b/spec/ruby/core/string/byteslice_spec.rb index a49da040eb..5b1027f4a5 100644 --- a/spec/ruby/core/string/byteslice_spec.rb +++ b/spec/ruby/core/string/byteslice_spec.rb @@ -19,9 +19,15 @@ end describe "String#byteslice on on non ASCII strings" do it "returns byteslice of unicode strings" do - "\u3042".byteslice(1).should == "\x81".force_encoding("UTF-8") - "\u3042".byteslice(1, 2).should == "\x81\x82".force_encoding("UTF-8") - "\u3042".byteslice(1..2).should == "\x81\x82".force_encoding("UTF-8") - "\u3042".byteslice(-1).should == "\x82".force_encoding("UTF-8") + "\u3042".byteslice(1).should == "\x81".dup.force_encoding("UTF-8") + "\u3042".byteslice(1, 2).should == "\x81\x82".dup.force_encoding("UTF-8") + "\u3042".byteslice(1..2).should == "\x81\x82".dup.force_encoding("UTF-8") + "\u3042".byteslice(-1).should == "\x82".dup.force_encoding("UTF-8") + end + + it "returns a String in the same encoding as self" do + "ruby".encode("UTF-8").slice(0).encoding.should == Encoding::UTF_8 + "ruby".encode("US-ASCII").slice(0).encoding.should == Encoding::US_ASCII + "ruby".encode("Windows-1251").slice(0).encoding.should == Encoding::Windows_1251 end end diff --git a/spec/ruby/core/string/bytesplice_spec.rb b/spec/ruby/core/string/bytesplice_spec.rb new file mode 100644 index 0000000000..967edcba29 --- /dev/null +++ b/spec/ruby/core/string/bytesplice_spec.rb @@ -0,0 +1,134 @@ +# -*- encoding: utf-8 -*- +# frozen_string_literal: false +require_relative '../../spec_helper' + +describe "String#bytesplice" do + ruby_version_is "3.2" do + it "raises IndexError when index is less than -bytesize" do + -> { "hello".bytesplice(-6, 0, "xxx") }.should raise_error(IndexError, "index -6 out of string") + end + + it "raises IndexError when index is greater than bytesize" do + -> { "hello".bytesplice(6, 0, "xxx") }.should raise_error(IndexError, "index 6 out of string") + end + + it "raises IndexError for negative length" do + -> { "abc".bytesplice(0, -2, "") }.should raise_error(IndexError, "negative length -2") + end + + it "replaces with integer indices" do + "hello".bytesplice(-5, 0, "xxx").should == "xxxhello" + "hello".bytesplice(0, 0, "xxx").should == "xxxhello" + "hello".bytesplice(0, 1, "xxx").should == "xxxello" + "hello".bytesplice(0, 5, "xxx").should == "xxx" + "hello".bytesplice(0, 6, "xxx").should == "xxx" + end + + it "raises RangeError when range left boundary is less than -bytesize" do + -> { "hello".bytesplice(-6...-6, "xxx") }.should raise_error(RangeError, "-6...-6 out of range") + end + + it "replaces with ranges" do + "hello".bytesplice(-5...-5, "xxx").should == "xxxhello" + "hello".bytesplice(0...0, "xxx").should == "xxxhello" + "hello".bytesplice(0..0, "xxx").should == "xxxello" + "hello".bytesplice(0...1, "xxx").should == "xxxello" + "hello".bytesplice(0..1, "xxx").should == "xxxllo" + "hello".bytesplice(0..-1, "xxx").should == "xxx" + "hello".bytesplice(0...5, "xxx").should == "xxx" + "hello".bytesplice(0...6, "xxx").should == "xxx" + end + + it "raises TypeError when integer index is provided without length argument" do + -> { "hello".bytesplice(0, "xxx") }.should raise_error(TypeError, "wrong argument type Integer (expected Range)") + end + + it "replaces on an empty string" do + "".bytesplice(0, 0, "").should == "" + "".bytesplice(0, 0, "xxx").should == "xxx" + end + + it "mutates self" do + s = "hello" + s.bytesplice(2, 1, "xxx").should.equal?(s) + end + + it "raises when string is frozen" do + s = "hello".freeze + -> { s.bytesplice(2, 1, "xxx") }.should raise_error(FrozenError, "can't modify frozen String: \"hello\"") + end + end +end + +describe "String#bytesplice with multibyte characters" do + ruby_version_is "3.2" do + it "raises IndexError when index is out of byte size boundary" do + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(-16, 0, "xxx") }.should raise_error(IndexError, "index -16 out of string") + end + + it "raises IndexError when index is not on a codepoint boundary" do + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(1, 0, "xxx") }.should raise_error(IndexError, "offset 1 does not land on character boundary") + end + + it "raises IndexError when length is not matching the codepoint boundary" do + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(0, 1, "xxx") }.should raise_error(IndexError, "offset 1 does not land on character boundary") + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(0, 2, "xxx") }.should raise_error(IndexError, "offset 2 does not land on character boundary") + end + + it "replaces with integer indices" do + "ã“ã‚“ã«ã¡ã¯".bytesplice(-15, 0, "xxx").should == "xxxã“ã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0, 0, "xxx").should == "xxxã“ã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0, 3, "xxx").should == "xxxã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(3, 3, "ã¯ã¯").should == "ã“ã¯ã¯ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(15, 0, "xxx").should == "ã“ã‚“ã«ã¡ã¯xxx" + end + + it "replaces with range" do + "ã“ã‚“ã«ã¡ã¯".bytesplice(-15...-16, "xxx").should == "xxxã“ã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0...0, "xxx").should == "xxxã“ã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0..2, "xxx").should == "xxxã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0...3, "xxx").should == "xxxã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0..5, "xxx").should == "xxxã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0..-1, "xxx").should == "xxx" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0...15, "xxx").should == "xxx" + "ã“ã‚“ã«ã¡ã¯".bytesplice(0...18, "xxx").should == "xxx" + end + + it "treats negative length for range as 0" do + "ã“ã‚“ã«ã¡ã¯".bytesplice(0...-100, "xxx").should == "xxxã“ã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(3...-100, "xxx").should == "ã“xxxã‚“ã«ã¡ã¯" + "ã“ã‚“ã«ã¡ã¯".bytesplice(-15...-100, "xxx").should == "xxxã“ã‚“ã«ã¡ã¯" + end + + it "raises when ranges not match codepoint boundaries" do + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(0..0, "x") }.should raise_error(IndexError, "offset 1 does not land on character boundary") + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(0..1, "x") }.should raise_error(IndexError, "offset 2 does not land on character boundary") + # Begin is incorrect + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(-4..-1, "x") }.should raise_error(IndexError, "offset 11 does not land on character boundary") + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(-5..-1, "x") }.should raise_error(IndexError, "offset 10 does not land on character boundary") + # End is incorrect + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(-3..-2, "x") }.should raise_error(IndexError, "offset 14 does not land on character boundary") + -> { "ã“ã‚“ã«ã¡ã¯".bytesplice(-3..-3, "x") }.should raise_error(IndexError, "offset 13 does not land on character boundary") + end + + it "deals with a different encoded argument" do + s = "ã“ã‚“ã«ã¡ã¯" + s.encoding.should == Encoding::UTF_8 + sub = "xxxxxx" + sub.force_encoding(Encoding::US_ASCII) + + result = s.bytesplice(0, 3, sub) + result.should == "xxxxxxã‚“ã«ã¡ã¯" + result.encoding.should == Encoding::UTF_8 + + s = "xxxxxx" + s.force_encoding(Encoding::US_ASCII) + sub = "ã“ã‚“ã«ã¡ã¯" + sub.encoding.should == Encoding::UTF_8 + + result = s.bytesplice(0, 3, sub) + result.should == "ã“ã‚“ã«ã¡ã¯xxx" + result.encoding.should == Encoding::UTF_8 + end + end +end diff --git a/spec/ruby/core/string/capitalize_spec.rb b/spec/ruby/core/string/capitalize_spec.rb index 21df18a5ae..5e59b656c5 100644 --- a/spec/ruby/core/string/capitalize_spec.rb +++ b/spec/ruby/core/string/capitalize_spec.rb @@ -10,13 +10,7 @@ describe "String#capitalize" do "hello".capitalize.should == "Hello" "HELLO".capitalize.should == "Hello" "123ABC".capitalize.should == "123abc" - end - - ruby_version_is ''...'2.7' do - it "taints resulting string when self is tainted" do - "".taint.capitalize.should.tainted? - "hello".taint.capitalize.should.tainted? - end + "abcdef"[1...-1].capitalize.should == "Bcde" end describe "full Unicode case mapping" do @@ -42,6 +36,10 @@ describe "String#capitalize" do it "does not capitalize non-ASCII characters" do "ßet".capitalize(:ascii).should == "ßet" end + + it "handles non-ASCII substrings properly" do + "garçon"[1...-1].capitalize(:ascii).should == "Arço" + end end describe "full Unicode case mapping adapted for Turkic languages" do @@ -80,24 +78,19 @@ describe "String#capitalize" do -> { "abc".capitalize(:invalid_option) }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("hello").capitalize.should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("Hello").capitalize.should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("hello").capitalize.should be_an_instance_of(String) + StringSpecs::MyString.new("Hello").capitalize.should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("hello").capitalize.should be_an_instance_of(String) - StringSpecs::MyString.new("Hello").capitalize.should be_an_instance_of(String) - end + it "returns a String in the same encoding as self" do + "h".encode("US-ASCII").capitalize.encoding.should == Encoding::US_ASCII end end describe "String#capitalize!" do it "capitalizes self in place" do - a = "hello" + a = +"hello" a.capitalize!.should equal(a) a.should == "Hello" end @@ -110,13 +103,13 @@ describe "String#capitalize!" do describe "full Unicode case mapping" do it "modifies self in place for all of Unicode with no option" do - a = "äöÜ" + a = +"äöÜ" a.capitalize! a.should == "Äöü" end it "only capitalizes the first resulting character when upcasing a character produces a multi-character sequence" do - a = "ß" + a = +"ß" a.capitalize! a.should == "Ss" end @@ -128,7 +121,7 @@ describe "String#capitalize!" do end it "updates string metadata" do - capitalized = "ßeT" + capitalized = +"ßeT" capitalized.capitalize! capitalized.should == "Sset" @@ -140,7 +133,7 @@ describe "String#capitalize!" do describe "modifies self in place for ASCII-only case mapping" do it "does not capitalize non-ASCII characters" do - a = "ßet" + a = +"ßet" a.capitalize!(:ascii) a.should == "ßet" end @@ -154,13 +147,13 @@ describe "String#capitalize!" do describe "modifies self in place for full Unicode case mapping adapted for Turkic languages" do it "capitalizes ASCII characters according to Turkic semantics" do - a = "iSa" + a = +"iSa" a.capitalize!(:turkic) a.should == "Ä°sa" end it "allows Lithuanian as an extra option" do - a = "iSa" + a = +"iSa" a.capitalize!(:turkic, :lithuanian) a.should == "Ä°sa" end @@ -172,13 +165,13 @@ describe "String#capitalize!" do describe "modifies self in place for full Unicode case mapping adapted for Lithuanian" do it "currently works the same as full Unicode case mapping" do - a = "iß" + a = +"iß" a.capitalize!(:lithuanian) a.should == "Iß" end it "allows Turkic as an extra option (and applies Turkic semantics)" do - a = "iß" + a = +"iß" a.capitalize!(:lithuanian, :turkic) a.should == "İß" end @@ -197,12 +190,12 @@ describe "String#capitalize!" do end it "returns nil when no changes are made" do - a = "Hello" + a = +"Hello" a.capitalize!.should == nil a.should == "Hello" - "".capitalize!.should == nil - "H".capitalize!.should == nil + (+"").capitalize!.should == nil + (+"H").capitalize!.should == nil end it "raises a FrozenError when self is frozen" do diff --git a/spec/ruby/core/string/casecmp_spec.rb b/spec/ruby/core/string/casecmp_spec.rb index 986fbc8718..81ebea557c 100644 --- a/spec/ruby/core/string/casecmp_spec.rb +++ b/spec/ruby/core/string/casecmp_spec.rb @@ -117,6 +117,11 @@ describe "String#casecmp independent of case" do "B".casecmp(a).should == 1 end end + + it "returns 0 for empty strings in different encodings" do + ''.b.casecmp('').should == 0 + ''.b.casecmp(''.encode("UTF-32LE")).should == 0 + end end describe 'String#casecmp? independent of case' do @@ -191,4 +196,9 @@ describe 'String#casecmp? independent of case' do it "returns nil if other can't be converted to a string" do "abc".casecmp?(mock('abc')).should be_nil end + + it "returns true for empty strings in different encodings" do + ''.b.should.casecmp?('') + ''.b.should.casecmp?(''.encode("UTF-32LE")) + end end diff --git a/spec/ruby/core/string/center_spec.rb b/spec/ruby/core/string/center_spec.rb index b66015172c..1667b59327 100644 --- a/spec/ruby/core/string/center_spec.rb +++ b/spec/ruby/core/string/center_spec.rb @@ -47,16 +47,6 @@ describe "String#center with length, padding" do "radiology".center(8, '-').should == "radiology" end - ruby_version_is ''...'2.7' do - it "taints result when self or padstr is tainted" do - "x".taint.center(4).should.tainted? - "x".taint.center(0).should.tainted? - "".taint.center(0).should.tainted? - "x".taint.center(4, "*").should.tainted? - "x".center(4, "*".taint).should.tainted? - end - end - it "calls #to_int to convert length to an integer" do "_".center(3.8, "^").should == "^_^" @@ -91,39 +81,18 @@ describe "String#center with length, padding" do -> { "hello".center(0, "") }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on subclasses" do - StringSpecs::MyString.new("").center(10).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").center(10).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(StringSpecs::MyString) - - "".center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - "foo".center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - end - end + it "returns String instances when called on subclasses" do + StringSpecs::MyString.new("").center(10).should be_an_instance_of(String) + StringSpecs::MyString.new("foo").center(10).should be_an_instance_of(String) + StringSpecs::MyString.new("foo").center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - ruby_version_is '3.0' do - it "returns String instances when called on subclasses" do - StringSpecs::MyString.new("").center(10).should be_an_instance_of(String) - StringSpecs::MyString.new("foo").center(10).should be_an_instance_of(String) - StringSpecs::MyString.new("foo").center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - - "".center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - "foo".center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - end - end - - ruby_version_is ''...'2.7' do - it "when padding is tainted and self is untainted returns a tainted string if and only if length is longer than self" do - "hello".center(4, 'X'.taint).tainted?.should be_false - "hello".center(5, 'X'.taint).tainted?.should be_false - "hello".center(6, 'X'.taint).tainted?.should be_true - end + "".center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) + "foo".center(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) end describe "with width" do it "returns a String in the same encoding as the original" do - str = "abc".force_encoding Encoding::IBM437 + str = "abc".dup.force_encoding Encoding::IBM437 result = str.center 6 result.should == " abc " result.encoding.should equal(Encoding::IBM437) @@ -132,7 +101,7 @@ describe "String#center with length, padding" do describe "with width, pattern" do it "returns a String in the compatible encoding" do - str = "abc".force_encoding Encoding::IBM437 + str = "abc".dup.force_encoding Encoding::IBM437 result = str.center 6, "ã‚" result.should == "ã‚abcã‚ã‚" result.encoding.should equal(Encoding::UTF_8) diff --git a/spec/ruby/core/string/chars_spec.rb b/spec/ruby/core/string/chars_spec.rb index e4f26bc0cc..ee85430574 100644 --- a/spec/ruby/core/string/chars_spec.rb +++ b/spec/ruby/core/string/chars_spec.rb @@ -1,5 +1,5 @@ +require_relative "../../spec_helper" require_relative 'shared/chars' -require_relative 'shared/each_char_without_block' describe "String#chars" do it_behaves_like :string_chars, :chars @@ -7,4 +7,10 @@ describe "String#chars" do it "returns an array when no block given" do "hello".chars.should == ['h', 'e', 'l', 'l', 'o'] end + + it "returns Strings in the same encoding as self" do + "hello".encode("US-ASCII").chars.each do |c| + c.encoding.should == Encoding::US_ASCII + end + end end diff --git a/spec/ruby/core/string/chilled_string_spec.rb b/spec/ruby/core/string/chilled_string_spec.rb new file mode 100644 index 0000000000..8de4fc421b --- /dev/null +++ b/spec/ruby/core/string/chilled_string_spec.rb @@ -0,0 +1,69 @@ +require_relative '../../spec_helper' + +describe "chilled String" do + guard -> { ruby_version_is "3.4" and !"test".equal?("test") } do + describe "#frozen?" do + it "returns true" do + "chilled".frozen?.should == true + end + end + + describe "#-@" do + it "returns a different instance" do + input = "chilled" + interned = (-input) + interned.frozen?.should == true + interned.object_id.should_not == input.object_id + end + end + + describe "#+@" do + it "returns a different instance" do + input = "chilled" + duped = (+input) + duped.frozen?.should == false + duped.object_id.should_not == input.object_id + end + end + + describe "#clone" do + it "preserves chilled status" do + input = "chilled".clone + -> { + input << "-mutated" + }.should complain(/literal string will be frozen in the future/) + input.should == "chilled-mutated" + end + end + + describe "mutation" do + it "emits a warning" do + input = "chilled" + -> { + input << "-mutated" + }.should complain(/literal string will be frozen in the future/) + input.should == "chilled-mutated" + end + + it "emits a warning on singleton_class creaation" do + -> { + "chilled".singleton_class + }.should complain(/literal string will be frozen in the future/) + end + + it "emits a warning on instance variable assignment" do + -> { + "chilled".instance_variable_set(:@ivar, 42) + }.should complain(/literal string will be frozen in the future/) + end + + it "raises FrozenError after the string was explictly frozen" do + input = "chilled" + input.freeze + -> { + input << "mutated" + }.should raise_error(FrozenError) + end + end + end +end diff --git a/spec/ruby/core/string/chomp_spec.rb b/spec/ruby/core/string/chomp_spec.rb index 3d6207f876..d27c84c6f6 100644 --- a/spec/ruby/core/string/chomp_spec.rb +++ b/spec/ruby/core/string/chomp_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -40,24 +41,13 @@ describe "String#chomp" do "".chomp.should == "" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc".taint.chomp.tainted?.should be_true - end + it "returns a String in the same encoding as self" do + "abc\n\n".encode("US-ASCII").chomp.encoding.should == Encoding::US_ASCII end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - str = StringSpecs::MyString.new("hello\n").chomp - str.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - str = StringSpecs::MyString.new("hello\n").chomp - str.should be_an_instance_of(String) - end + it "returns String instances when called on a subclass" do + str = StringSpecs::MyString.new("hello\n").chomp + str.should be_an_instance_of(String) end it "removes trailing characters that match $/ when it has been assigned a value" do @@ -80,12 +70,6 @@ describe "String#chomp" do str.chomp(nil).should_not equal(str) end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc".taint.chomp(nil).tainted?.should be_true - end - end - it "returns an empty String when self is empty" do "".chomp(nil).should == "" end @@ -112,12 +96,6 @@ describe "String#chomp" do "abc\r\n\r\n\r\n".chomp("").should == "abc" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc".taint.chomp("").tainted?.should be_true - end - end - it "returns an empty String when self is empty" do "".chomp("").should == "" end @@ -140,12 +118,6 @@ describe "String#chomp" do "abc\r\n\r\n".chomp("\n").should == "abc\r\n" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc".taint.chomp("\n").tainted?.should be_true - end - end - it "returns an empty String when self is empty" do "".chomp("\n").should == "" end @@ -178,16 +150,6 @@ describe "String#chomp" do "".chomp("abc").should == "" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc".taint.chomp("abc").tainted?.should be_true - end - - it "does not taint the result when the argument is tainted" do - "abc".chomp("abc".taint).tainted?.should be_false - end - end - it "returns an empty String when the argument equals self" do "abc".chomp("abc").should == "" end @@ -232,12 +194,6 @@ describe "String#chomp!" do "".chomp!.should be_nil end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc\n".taint.chomp!.tainted?.should be_true - end - end - it "returns subclass instances when called on a subclass" do str = StringSpecs::MyString.new("hello\n").chomp! str.should be_an_instance_of(StringSpecs::MyString) @@ -280,12 +236,6 @@ describe "String#chomp!" do "abc\r\n\r\n\r\n".chomp!("").should == "abc" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc\n".taint.chomp!("").tainted?.should be_true - end - end - it "returns nil when self is empty" do "".chomp!("").should be_nil end @@ -304,12 +254,6 @@ describe "String#chomp!" do "abc\r\n\r\n".chomp!("\n").should == "abc\r\n" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc\n".taint.chomp!("\n").tainted?.should be_true - end - end - it "returns nil when self is empty" do "".chomp!("\n").should be_nil end @@ -341,16 +285,6 @@ describe "String#chomp!" do it "returns nil when self is empty" do "".chomp!("abc").should be_nil end - - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "abc".taint.chomp!("abc").tainted?.should be_true - end - - it "does not taint the result when the argument is tainted" do - "abc".chomp!("abc".taint).tainted?.should be_false - end - end end it "raises a FrozenError on a frozen instance when it is modified" do diff --git a/spec/ruby/core/string/chop_spec.rb b/spec/ruby/core/string/chop_spec.rb index 9b4e7363c6..99c2c82190 100644 --- a/spec/ruby/core/string/chop_spec.rb +++ b/spec/ruby/core/string/chop_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -49,28 +50,12 @@ describe "String#chop" do s.chop.should_not equal(s) end - ruby_version_is ''...'2.7' do - it "taints result when self is tainted" do - "hello".taint.chop.should.tainted? - "".taint.chop.should.tainted? - end - - it "untrusts result when self is untrusted" do - "hello".untrust.chop.should.untrusted? - "".untrust.chop.should.untrusted? - end - end - - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("hello\n").chop.should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("hello\n").chop.should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("hello\n").chop.should be_an_instance_of(String) - end + it "returns a String in the same encoding as self" do + "abc\n\n".encode("US-ASCII").chop.encoding.should == Encoding::US_ASCII end end diff --git a/spec/ruby/core/string/clear_spec.rb b/spec/ruby/core/string/clear_spec.rb index e1d68e03bd..152986fd0f 100644 --- a/spec/ruby/core/string/clear_spec.rb +++ b/spec/ruby/core/string/clear_spec.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false require_relative '../../spec_helper' describe "String#clear" do diff --git a/spec/ruby/core/string/clone_spec.rb b/spec/ruby/core/string/clone_spec.rb index f8d40423f0..a2ba2f9877 100644 --- a/spec/ruby/core/string/clone_spec.rb +++ b/spec/ruby/core/string/clone_spec.rb @@ -54,4 +54,8 @@ describe "String#clone" do orig.should == "xtring" clone.should == "string" end + + it "returns a String in the same encoding as self" do + "a".encode("US-ASCII").clone.encoding.should == Encoding::US_ASCII + end end diff --git a/spec/ruby/core/string/codepoints_spec.rb b/spec/ruby/core/string/codepoints_spec.rb index 0b6cde82f7..b276d0baa8 100644 --- a/spec/ruby/core/string/codepoints_spec.rb +++ b/spec/ruby/core/string/codepoints_spec.rb @@ -11,7 +11,7 @@ describe "String#codepoints" do end it "raises an ArgumentError when no block is given if self has an invalid encoding" do - s = "\xDF".force_encoding(Encoding::UTF_8) + s = "\xDF".dup.force_encoding(Encoding::UTF_8) s.valid_encoding?.should be_false -> { s.codepoints }.should raise_error(ArgumentError) end diff --git a/spec/ruby/core/string/comparison_spec.rb b/spec/ruby/core/string/comparison_spec.rb index 01199274b6..9db0cff5ee 100644 --- a/spec/ruby/core/string/comparison_spec.rb +++ b/spec/ruby/core/string/comparison_spec.rb @@ -61,12 +61,12 @@ describe "String#<=> with String" do end it "ignores encoding difference" do - ("ÄÖÛ".force_encoding("utf-8") <=> "ÄÖÜ".force_encoding("iso-8859-1")).should == -1 - ("ÄÖÜ".force_encoding("utf-8") <=> "ÄÖÛ".force_encoding("iso-8859-1")).should == 1 + ("ÄÖÛ".dup.force_encoding("utf-8") <=> "ÄÖÜ".dup.force_encoding("iso-8859-1")).should == -1 + ("ÄÖÜ".dup.force_encoding("utf-8") <=> "ÄÖÛ".dup.force_encoding("iso-8859-1")).should == 1 end it "returns 0 with identical ASCII-compatible bytes of different encodings" do - ("abc".force_encoding("utf-8") <=> "abc".force_encoding("iso-8859-1")).should == 0 + ("abc".dup.force_encoding("utf-8") <=> "abc".dup.force_encoding("iso-8859-1")).should == 0 end it "compares the indices of the encodings when the strings have identical non-ASCII-compatible bytes" do @@ -75,6 +75,10 @@ describe "String#<=> with String" do (xff_1 <=> xff_2).should == -1 (xff_2 <=> xff_1).should == 1 end + + it "returns 0 when comparing 2 empty strings but one is not ASCII-compatible" do + ("" <=> "".dup.force_encoding('iso-2022-jp')).should == 0 + end end # Note: This is inconsistent with Array#<=> which calls #to_ary instead of diff --git a/spec/ruby/core/string/concat_spec.rb b/spec/ruby/core/string/concat_spec.rb index 5f6daadad7..cbd7df54e2 100644 --- a/spec/ruby/core/string/concat_spec.rb +++ b/spec/ruby/core/string/concat_spec.rb @@ -5,21 +5,22 @@ require_relative 'shared/concat' describe "String#concat" do it_behaves_like :string_concat, :concat it_behaves_like :string_concat_encoding, :concat + it_behaves_like :string_concat_type_coercion, :concat it "takes multiple arguments" do - str = "hello " + str = +"hello " str.concat "wo", "", "rld" str.should == "hello world" end it "concatenates the initial value when given arguments contain 2 self" do - str = "hello" + str = +"hello" str.concat str, str str.should == "hellohellohello" end it "returns self when given no arguments" do - str = "hello" + str = +"hello" str.concat.should equal(str) str.should == "hello" end diff --git a/spec/ruby/core/string/crypt_spec.rb b/spec/ruby/core/string/crypt_spec.rb index b947702492..06f84c70a4 100644 --- a/spec/ruby/core/string/crypt_spec.rb +++ b/spec/ruby/core/string/crypt_spec.rb @@ -25,21 +25,6 @@ describe "String#crypt" do "mypassword".crypt(obj).should == "$2a$04$0WVaz0pV3jzfZ5G5tpmHWuBQGbkjzgtSc3gJbmdy0GAGMa45MFM2." end - ruby_version_is ''...'2.7' do - it "taints the result if either salt or self is tainted" do - tainted_salt = "$2a$04$0WVaz0pV3jzfZ5G5tpmHWu" - tainted_str = "mypassword" - - tainted_salt.taint - tainted_str.taint - - "mypassword".crypt("$2a$04$0WVaz0pV3jzfZ5G5tpmHWu").should_not.tainted? - tainted_str.crypt("$2a$04$0WVaz0pV3jzfZ5G5tpmHWu").should.tainted? - "mypassword".crypt(tainted_salt).should.tainted? - tainted_str.crypt(tainted_salt).should.tainted? - end - end - it "doesn't return subclass instances" do StringSpecs::MyString.new("mypassword").crypt("$2a$04$0WVaz0pV3jzfZ5G5tpmHWu").should be_an_instance_of(String) "mypassword".crypt(StringSpecs::MyString.new("$2a$04$0WVaz0pV3jzfZ5G5tpmHWu")).should be_an_instance_of(String) @@ -85,21 +70,6 @@ describe "String#crypt" do "".crypt(obj).should == "aaQSqAReePlq6" end - ruby_version_is ''...'2.7' do - it "taints the result if either salt or self is tainted" do - tainted_salt = "aa" - tainted_str = "hello" - - tainted_salt.taint - tainted_str.taint - - "hello".crypt("aa").should_not.tainted? - tainted_str.crypt("aa").should.tainted? - "hello".crypt(tainted_salt).should.tainted? - tainted_str.crypt(tainted_salt).should.tainted? - end - end - it "doesn't return subclass instances" do StringSpecs::MyString.new("hello").crypt("aa").should be_an_instance_of(String) "hello".crypt(StringSpecs::MyString.new("aa")).should be_an_instance_of(String) diff --git a/spec/ruby/core/string/dedup_spec.rb b/spec/ruby/core/string/dedup_spec.rb new file mode 100644 index 0000000000..57d2be2cfd --- /dev/null +++ b/spec/ruby/core/string/dedup_spec.rb @@ -0,0 +1,8 @@ +require_relative '../../spec_helper' +require_relative 'shared/dedup' + +describe 'String#dedup' do + ruby_version_is '3.2' do + it_behaves_like :string_dedup, :dedup + end +end diff --git a/spec/ruby/core/string/delete_prefix_spec.rb b/spec/ruby/core/string/delete_prefix_spec.rb index 8469791f74..ee7f044905 100644 --- a/spec/ruby/core/string/delete_prefix_spec.rb +++ b/spec/ruby/core/string/delete_prefix_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -21,11 +22,8 @@ describe "String#delete_prefix" do r.should == s end - ruby_version_is ''...'2.7' do - it "taints resulting strings when other is tainted" do - 'hello'.taint.delete_prefix('hell').should.tainted? - 'hello'.taint.delete_prefix('').should.tainted? - end + it "does not remove partial bytes, only full characters" do + "\xe3\x81\x82".delete_prefix("\xe3").should == "\xe3\x81\x82" end it "doesn't set $~" do @@ -41,18 +39,13 @@ describe "String#delete_prefix" do 'hello'.delete_prefix(o).should == 'o' end - ruby_version_is ''...'3.0' do - it "returns a subclass instance when called on a subclass instance" do - s = StringSpecs::MyString.new('hello') - s.delete_prefix('hell').should be_an_instance_of(StringSpecs::MyString) - end + it "returns a String instance when called on a subclass instance" do + s = StringSpecs::MyString.new('hello') + s.delete_prefix('hell').should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns a String instance when called on a subclass instance" do - s = StringSpecs::MyString.new('hello') - s.delete_prefix('hell').should be_an_instance_of(String) - end + it "returns a String in the same encoding as self" do + 'hello'.encode("US-ASCII").delete_prefix('hell').encoding.should == Encoding::US_ASCII end end diff --git a/spec/ruby/core/string/delete_spec.rb b/spec/ruby/core/string/delete_spec.rb index ebca0b7dae..6d359776e4 100644 --- a/spec/ruby/core/string/delete_spec.rb +++ b/spec/ruby/core/string/delete_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -68,15 +69,6 @@ describe "String#delete" do -> { "hello".delete("^h-e") }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "taints result when self is tainted" do - "hello".taint.delete("e").should.tainted? - "hello".taint.delete("a-z").should.tainted? - - "hello".delete("e".taint).should_not.tainted? - end - end - it "tries to convert each set arg to a string using to_str" do other_string = mock('lo') other_string.should_receive(:to_str).and_return("lo") @@ -93,16 +85,12 @@ describe "String#delete" do -> { "hello world".delete(mock('x')) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("oh no!!!").delete("!").should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("oh no!!!").delete("!").should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("oh no!!!").delete("!").should be_an_instance_of(String) - end + it "returns a String in the same encoding as self" do + "hello".encode("US-ASCII").delete("lo").encoding.should == Encoding::US_ASCII end end diff --git a/spec/ruby/core/string/delete_suffix_spec.rb b/spec/ruby/core/string/delete_suffix_spec.rb index 12d0ee175e..1842d75aa5 100644 --- a/spec/ruby/core/string/delete_suffix_spec.rb +++ b/spec/ruby/core/string/delete_suffix_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -21,11 +22,8 @@ describe "String#delete_suffix" do r.should == s end - ruby_version_is ''...'2.7' do - it "taints resulting strings when other is tainted" do - 'hello'.taint.delete_suffix('ello').should.tainted? - 'hello'.taint.delete_suffix('').should.tainted? - end + it "does not remove partial bytes, only full characters" do + "\xe3\x81\x82".delete_suffix("\x82").should == "\xe3\x81\x82" end it "doesn't set $~" do @@ -41,18 +39,13 @@ describe "String#delete_suffix" do 'hello'.delete_suffix(o).should == 'h' end - ruby_version_is ''...'3.0' do - it "returns a subclass instance when called on a subclass instance" do - s = StringSpecs::MyString.new('hello') - s.delete_suffix('ello').should be_an_instance_of(StringSpecs::MyString) - end + it "returns a String instance when called on a subclass instance" do + s = StringSpecs::MyString.new('hello') + s.delete_suffix('ello').should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns a String instance when called on a subclass instance" do - s = StringSpecs::MyString.new('hello') - s.delete_suffix('ello').should be_an_instance_of(String) - end + it "returns a String in the same encoding as self" do + "hello".encode("US-ASCII").delete_suffix("ello").encoding.should == Encoding::US_ASCII end end diff --git a/spec/ruby/core/string/downcase_spec.rb b/spec/ruby/core/string/downcase_spec.rb index 4427c9df10..2d260f23f1 100644 --- a/spec/ruby/core/string/downcase_spec.rb +++ b/spec/ruby/core/string/downcase_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -8,6 +9,10 @@ describe "String#downcase" do "hello".downcase.should == "hello" end + it "returns a String in the same encoding as self" do + "hELLO".encode("US-ASCII").downcase.encoding.should == Encoding::US_ASCII + end + describe "full Unicode case mapping" do it "works for all of Unicode with no option" do "ÄÖÜ".downcase.should == "äöü" @@ -27,6 +32,10 @@ describe "String#downcase" do it "does not downcase non-ASCII characters" do "Câ„«R".downcase(:ascii).should == "câ„«r" end + + it "works with substrings" do + "prefix TÉ"[-2..-1].downcase(:ascii).should == "tÉ" + end end describe "full Unicode case mapping adapted for Turkic languages" do @@ -68,24 +77,8 @@ describe "String#downcase" do -> { "ABC".downcase(:invalid_option) }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "taints result when self is tainted" do - "".taint.downcase.should.tainted? - "x".taint.downcase.should.tainted? - "X".taint.downcase.should.tainted? - end - end - - ruby_version_is ''...'3.0' do - it "returns a subclass instance for subclasses" do - StringSpecs::MyString.new("FOObar").downcase.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns a String instance for subclasses" do - StringSpecs::MyString.new("FOObar").downcase.should be_an_instance_of(String) - end + it "returns a String instance for subclasses" do + StringSpecs::MyString.new("FOObar").downcase.should be_an_instance_of(String) end end diff --git a/spec/ruby/core/string/dump_spec.rb b/spec/ruby/core/string/dump_spec.rb index 817dec6c4d..cab8beff5a 100644 --- a/spec/ruby/core/string/dump_spec.rb +++ b/spec/ruby/core/string/dump_spec.rb @@ -3,32 +3,12 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "String#dump" do - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "foo".taint.dump.should.tainted? - "foo\n".taint.dump.should.tainted? - end - - it "untrusts the result if self is untrusted" do - "foo".untrust.dump.should.untrusted? - "foo\n".untrust.dump.should.untrusted? - end - end - it "does not take into account if a string is frozen" do "foo".freeze.dump.should_not.frozen? end - ruby_version_is ''...'3.0' do - it "returns a subclass instance" do - StringSpecs::MyString.new.dump.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns a String instance" do - StringSpecs::MyString.new.dump.should be_an_instance_of(String) - end + it "returns a String instance" do + StringSpecs::MyString.new.dump.should be_an_instance_of(String) end it "wraps string with \"" do @@ -362,7 +342,7 @@ describe "String#dump" do ].should be_computed_by(:dump) end - it "returns a string with multi-byte UTF-8 characters replaced by \\u{} notation with upper-case hex digits" do + it "returns a string with multi-byte UTF-8 characters less than or equal 0xFFFF replaced by \\uXXXX notation with upper-case hex digits" do [ [0200.chr('utf-8'), '"\u0080"'], [0201.chr('utf-8'), '"\u0081"'], [0202.chr('utf-8'), '"\u0082"'], @@ -394,15 +374,21 @@ describe "String#dump" do [0235.chr('utf-8'), '"\u009D"'], [0236.chr('utf-8'), '"\u009E"'], [0237.chr('utf-8'), '"\u009F"'], + [0177777.chr('utf-8'), '"\uFFFF"'], ].should be_computed_by(:dump) end + it "returns a string with multi-byte UTF-8 characters greater than 0xFFFF replaced by \\u{XXXXXX} notation with upper-case hex digits" do + 0x10000.chr('utf-8').dump.should == '"\u{10000}"' + 0x10FFFF.chr('utf-8').dump.should == '"\u{10FFFF}"' + end + it "includes .force_encoding(name) if the encoding isn't ASCII compatible" do "\u{876}".encode('utf-16be').dump.should.end_with?(".force_encoding(\"UTF-16BE\")") "\u{876}".encode('utf-16le').dump.should.end_with?(".force_encoding(\"UTF-16LE\")") end - it "keeps origin encoding" do + it "returns a String in the same encoding as self" do "foo".encode("ISO-8859-1").dump.encoding.should == Encoding::ISO_8859_1 "foo".encode('windows-1251').dump.encoding.should == Encoding::Windows_1251 1.chr.dump.encoding.should == Encoding::US_ASCII diff --git a/spec/ruby/core/string/dup_spec.rb b/spec/ruby/core/string/dup_spec.rb index d650788210..073802d84b 100644 --- a/spec/ruby/core/string/dup_spec.rb +++ b/spec/ruby/core/string/dup_spec.rb @@ -49,4 +49,17 @@ describe "String#dup" do orig.should == "xtring" dup.should == "string" end + + it "does not modify the original setbyte-mutated string when changing dupped string" do + orig = +"a" + orig.setbyte 0, "b".ord + copy = orig.dup + orig.setbyte 0, "c".ord + orig.should == "c" + copy.should == "b" + end + + it "returns a String in the same encoding as self" do + "hello".encode("US-ASCII").dup.encoding.should == Encoding::US_ASCII + end end diff --git a/spec/ruby/core/string/each_byte_spec.rb b/spec/ruby/core/string/each_byte_spec.rb index e04dca807f..7b3db265ac 100644 --- a/spec/ruby/core/string/each_byte_spec.rb +++ b/spec/ruby/core/string/each_byte_spec.rb @@ -9,26 +9,26 @@ describe "String#each_byte" do end it "keeps iterating from the old position (to new string end) when self changes" do - r = "" - s = "hello world" + r = +"" + s = +"hello world" s.each_byte do |c| r << c s.insert(0, "<>") if r.size < 3 end r.should == "h><>hello world" - r = "" - s = "hello world" + r = +"" + s = +"hello world" s.each_byte { |c| s.slice!(-1); r << c } r.should == "hello " - r = "" - s = "hello world" + r = +"" + s = +"hello world" s.each_byte { |c| s.slice!(0); r << c } r.should == "hlowrd" - r = "" - s = "hello world" + r = +"" + s = +"hello world" s.each_byte { |c| s.slice!(0..-1); r << c } r.should == "h" end diff --git a/spec/ruby/core/string/each_char_spec.rb b/spec/ruby/core/string/each_char_spec.rb index aff98c0a5c..36219f79db 100644 --- a/spec/ruby/core/string/each_char_spec.rb +++ b/spec/ruby/core/string/each_char_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/chars' require_relative 'shared/each_char_without_block' diff --git a/spec/ruby/core/string/each_grapheme_cluster_spec.rb b/spec/ruby/core/string/each_grapheme_cluster_spec.rb index 632f2337f1..e1fa4ae67b 100644 --- a/spec/ruby/core/string/each_grapheme_cluster_spec.rb +++ b/spec/ruby/core/string/each_grapheme_cluster_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/chars' require_relative 'shared/grapheme_clusters' require_relative 'shared/each_char_without_block' @@ -6,4 +7,10 @@ describe "String#each_grapheme_cluster" do it_behaves_like :string_chars, :each_grapheme_cluster it_behaves_like :string_grapheme_clusters, :each_grapheme_cluster it_behaves_like :string_each_char_without_block, :each_grapheme_cluster + + it "yields String instances for subclasses" do + a = [] + StringSpecs::MyString.new("abc").each_grapheme_cluster { |s| a << s.class } + a.should == [String, String, String] + end end diff --git a/spec/ruby/core/string/element_set_spec.rb b/spec/ruby/core/string/element_set_spec.rb index c9e02a7381..e7599f832c 100644 --- a/spec/ruby/core/string/element_set_spec.rb +++ b/spec/ruby/core/string/element_set_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -14,18 +15,6 @@ describe "String#[]= with Integer index" do a.should == "bamelo" end - ruby_version_is ''...'2.7' do - it "taints self if other_str is tainted" do - a = "hello" - a[0] = "".taint - a.should.tainted? - - a = "hello" - a[0] = "x".taint - a.should.tainted? - end - end - it "raises an IndexError without changing self if idx is outside of self" do str = "hello" @@ -141,6 +130,12 @@ describe "String#[]= with Integer index" do str.encoding.should equal(Encoding::BINARY) end + it "updates the string to a compatible encoding" do + str = " " + str[1] = [0xB9].pack("C*") + str.encoding.should == Encoding::ASCII_8BIT + end + it "raises an Encoding::CompatibilityError if the replacement encoding is incompatible" do str = "ã‚ã‚Œ" rep = "ãŒ".encode Encoding::EUC_JP @@ -363,11 +358,11 @@ describe "String#[]= with a Range index" do end it "raises a RangeError if negative Range begin is out of range" do - -> { "abc"[-4..-2] = "x" }.should raise_error(RangeError) + -> { "abc"[-4..-2] = "x" }.should raise_error(RangeError, "-4..-2 out of range") end it "raises a RangeError if positive Range begin is greater than String size" do - -> { "abc"[4..2] = "x" }.should raise_error(RangeError) + -> { "abc"[4..2] = "x" }.should raise_error(RangeError, "4..2 out of range") end it "uses the Range end as an index rather than a count" do @@ -487,18 +482,6 @@ describe "String#[]= with Integer index, count" do a.should == "hellobob" end - ruby_version_is ''...'2.7' do - it "taints self if other_str is tainted" do - a = "hello" - a[0, 0] = "".taint - a.should.tainted? - - a = "hello" - a[1, 4] = "x".taint - a.should.tainted? - end - end - it "calls #to_int to convert the index and count objects" do index = mock("string element set index") index.should_receive(:to_int).and_return(-4) diff --git a/spec/ruby/core/string/encode_spec.rb b/spec/ruby/core/string/encode_spec.rb index ae641b2110..97dd753b62 100644 --- a/spec/ruby/core/string/encode_spec.rb +++ b/spec/ruby/core/string/encode_spec.rb @@ -34,8 +34,8 @@ describe "String#encode" do it "encodes an ascii substring of a binary string to UTF-8" do x82 = [0x82].pack('C') - str = "#{x82}foo".force_encoding("binary")[1..-1].encode("utf-8") - str.should == "foo".force_encoding("utf-8") + str = "#{x82}foo".dup.force_encoding("binary")[1..-1].encode("utf-8") + str.should == "foo".dup.force_encoding("utf-8") str.encoding.should equal(Encoding::UTF_8) end end @@ -49,7 +49,7 @@ describe "String#encode" do end it "round trips a String" do - str = "abc def".force_encoding Encoding::US_ASCII + str = "abc def".dup.force_encoding Encoding::US_ASCII str.encode("utf-32be").encode("ascii").should == "abc def" end end @@ -67,17 +67,62 @@ describe "String#encode" do "\rfoo".encode(universal_newline: true).should == "\nfoo" end - it "replaces invalid encoding" do - encoded = "ã¡\xE3\x81\xFF".encode("UTF-16LE", invalid: :replace, replace: "?") - encoded.should == "\u3061??".encode("UTF-16LE") - encoded.encode("UTF-8").should == "ã¡??" + it "replaces invalid encoding in source with default replacement" do + encoded = "ã¡\xE3\x81\xFF".encode("UTF-16LE", invalid: :replace) + encoded.should == "\u3061\ufffd\ufffd".encode("UTF-16LE") + encoded.encode("UTF-8").should == "ã¡\ufffd\ufffd" + end + + it "replaces invalid encoding in source with a specified replacement" do + encoded = "ã¡\xE3\x81\xFF".encode("UTF-16LE", invalid: :replace, replace: "foo") + encoded.should == "\u3061foofoo".encode("UTF-16LE") + encoded.encode("UTF-8").should == "ã¡foofoo" + end + + it "replace multiple invalid bytes at the end with a single replacement character" do + "\xE3\x81\x93\xE3\x81".encode("UTF-8", invalid: :replace).should == "\u3053\ufffd" + end + + it "replaces invalid encoding in source using a specified replacement even when a fallback is given" do + encoded = "ã¡\xE3\x81\xFF".encode("UTF-16LE", invalid: :replace, replace: "foo", fallback: -> c { "bar" }) + encoded.should == "\u3061foofoo".encode("UTF-16LE") + encoded.encode("UTF-8").should == "ã¡foofoo" + end + + it "replaces undefined encoding in destination with default replacement" do + encoded = "B\ufffd".encode(Encoding::US_ASCII, undef: :replace) + encoded.should == "B?".encode(Encoding::US_ASCII) + encoded.encode("UTF-8").should == "B?" + end + + it "replaces undefined encoding in destination with a specified replacement" do + encoded = "B\ufffd".encode(Encoding::US_ASCII, undef: :replace, replace: "foo") + encoded.should == "Bfoo".encode(Encoding::US_ASCII) + encoded.encode("UTF-8").should == "Bfoo" + end + + it "replaces undefined encoding in destination with a specified replacement even if a fallback is given" do + encoded = "B\ufffd".encode(Encoding::US_ASCII, undef: :replace, replace: "foo", fallback: proc {|x| "bar"}) + encoded.should == "Bfoo".encode(Encoding::US_ASCII) + encoded.encode("UTF-8").should == "Bfoo" + end + + it "replaces undefined encoding in destination using a fallback proc" do + encoded = "B\ufffd".encode(Encoding::US_ASCII, fallback: proc {|x| "bar"}) + encoded.should == "Bbar".encode(Encoding::US_ASCII) + encoded.encode("UTF-8").should == "Bbar" + end + + it "replaces invalid encoding in source using replace even when fallback is given as proc" do + encoded = "ã¡\xE3\x81\xFF".encode("UTF-16LE", invalid: :replace, replace: "foo", fallback: proc {|x| "bar"}) + encoded.should == "\u3061foofoo".encode("UTF-16LE") + encoded.encode("UTF-8").should == "ã¡foofoo" end end describe "when passed to, from" do it "returns a copy in the destination encoding when both encodings are the same" do - str = "ã‚" - str.force_encoding("binary") + str = "ã‚".dup.force_encoding("binary") encoded = str.encode("utf-8", "utf-8") encoded.should_not equal(str) @@ -109,8 +154,7 @@ describe "String#encode" do end it "returns a copy in the destination encoding when both encodings are the same" do - str = "ã‚" - str.force_encoding("binary") + str = "ã‚".dup.force_encoding("binary") encoded = str.encode("utf-8", "utf-8", invalid: :replace) encoded.should_not equal(str) @@ -145,13 +189,13 @@ describe "String#encode!" do describe "when passed no options" do it "returns self when Encoding.default_internal is nil" do Encoding.default_internal = nil - str = "ã‚" + str = +"ã‚" str.encode!.should equal(str) end it "returns self for a ASCII-only String when Encoding.default_internal is nil" do Encoding.default_internal = nil - str = "abc" + str = +"abc" str.encode!.should equal(str) end end @@ -159,14 +203,14 @@ describe "String#encode!" do describe "when passed options" do it "returns self for ASCII-only String when Encoding.default_internal is nil" do Encoding.default_internal = nil - str = "abc" + str = +"abc" str.encode!(invalid: :replace).should equal(str) end end describe "when passed to encoding" do it "returns self" do - str = "abc" + str = +"abc" result = str.encode!(Encoding::BINARY) result.encoding.should equal(Encoding::BINARY) result.should equal(str) @@ -175,7 +219,7 @@ describe "String#encode!" do describe "when passed to, from" do it "returns self" do - str = "ã‚ã‚" + str = +"ã‚ã‚" result = str.encode!("euc-jp", "utf-8") result.encoding.should equal(Encoding::EUC_JP) result.should equal(str) diff --git a/spec/ruby/core/string/encoding_spec.rb b/spec/ruby/core/string/encoding_spec.rb index 4d17a39f29..f6e8fd3470 100644 --- a/spec/ruby/core/string/encoding_spec.rb +++ b/spec/ruby/core/string/encoding_spec.rb @@ -10,14 +10,15 @@ describe "String#encoding" do it "is equal to the source encoding by default" do s = StringSpecs::ISO88599Encoding.new s.cedilla.encoding.should == s.source_encoding + s.cedilla.encode("utf-8").should == 350.chr(Encoding::UTF_8) # S-cedilla end it "returns the given encoding if #force_encoding has been called" do - "a".force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "a".dup.force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS end it "returns the given encoding if #encode!has been called" do - "a".encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "a".dup.encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS end end @@ -107,13 +108,13 @@ describe "String#encoding for Strings with \\u escapes" do end it "returns the given encoding if #force_encoding has been called" do - "\u{20}".force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS - "\u{2020}".force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "\u{20}".dup.force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "\u{2020}".dup.force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS end it "returns the given encoding if #encode!has been called" do - "\u{20}".encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS - "\u{2020}".encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "\u{20}".dup.encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "\u{2020}".dup.encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS end end @@ -172,16 +173,12 @@ describe "String#encoding for Strings with \\x escapes" do end it "returns the given encoding if #force_encoding has been called" do - x50 = "\x50" - x50.force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS - xD4 = [212].pack('C') - xD4.force_encoding(Encoding::ISO_8859_9).encoding.should == Encoding::ISO_8859_9 + "\x50".dup.force_encoding(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + [212].pack('C').force_encoding(Encoding::ISO_8859_9).encoding.should == Encoding::ISO_8859_9 end it "returns the given encoding if #encode!has been called" do - x50 = "\x50" - x50.encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS - x00 = "x\00" - x00.encode!(Encoding::UTF_8).encoding.should == Encoding::UTF_8 + "\x50".dup.encode!(Encoding::SHIFT_JIS).encoding.should == Encoding::SHIFT_JIS + "x\00".dup.encode!(Encoding::UTF_8).encoding.should == Encoding::UTF_8 end end diff --git a/spec/ruby/core/string/fixtures/iso-8859-9-encoding.rb b/spec/ruby/core/string/fixtures/iso-8859-9-encoding.rb index 61a691ff78..cfa91dedc3 100644 --- a/spec/ruby/core/string/fixtures/iso-8859-9-encoding.rb +++ b/spec/ruby/core/string/fixtures/iso-8859-9-encoding.rb @@ -4,6 +4,6 @@ module StringSpecs def source_encoding; __ENCODING__; end def x_escape; [0xDF].pack('C').force_encoding("iso-8859-9"); end def ascii_only; "glark"; end - def cedilla; "Åž"; end + def cedilla; "Þ"; end # S-cedilla end end diff --git a/spec/ruby/core/string/fixtures/to_c.rb b/spec/ruby/core/string/fixtures/to_c.rb new file mode 100644 index 0000000000..7776933263 --- /dev/null +++ b/spec/ruby/core/string/fixtures/to_c.rb @@ -0,0 +1,5 @@ +module StringSpecs + def self.to_c_method(string) + string.to_c + end +end diff --git a/spec/ruby/core/string/fixtures/utf-8-encoding.rb b/spec/ruby/core/string/fixtures/utf-8-encoding.rb deleted file mode 100644 index fd243ec522..0000000000 --- a/spec/ruby/core/string/fixtures/utf-8-encoding.rb +++ /dev/null @@ -1,7 +0,0 @@ -# -*- encoding: utf-8 -*- -module StringSpecs - class UTF8Encoding - def self.source_encoding; __ENCODING__; end - def self.egrave; "é"; end - end -end diff --git a/spec/ruby/core/string/force_encoding_spec.rb b/spec/ruby/core/string/force_encoding_spec.rb index 2fe5f79c0f..2259dcf3cf 100644 --- a/spec/ruby/core/string/force_encoding_spec.rb +++ b/spec/ruby/core/string/force_encoding_spec.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false require_relative '../../spec_helper' describe "String#force_encoding" do @@ -60,7 +61,7 @@ describe "String#force_encoding" do end it "does not transcode self" do - str = "\u{8612}" + str = "é" str.dup.force_encoding('utf-16le').should_not == str.encode('utf-16le') end diff --git a/spec/ruby/core/string/freeze_spec.rb b/spec/ruby/core/string/freeze_spec.rb index 04d1e9513c..2e8e70386d 100644 --- a/spec/ruby/core/string/freeze_spec.rb +++ b/spec/ruby/core/string/freeze_spec.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false require_relative '../../spec_helper' describe "String#freeze" do diff --git a/spec/ruby/core/string/grapheme_clusters_spec.rb b/spec/ruby/core/string/grapheme_clusters_spec.rb index 3046265a12..380a245083 100644 --- a/spec/ruby/core/string/grapheme_clusters_spec.rb +++ b/spec/ruby/core/string/grapheme_clusters_spec.rb @@ -1,3 +1,4 @@ +require_relative "../../spec_helper" require_relative 'shared/chars' require_relative 'shared/grapheme_clusters' diff --git a/spec/ruby/core/string/gsub_spec.rb b/spec/ruby/core/string/gsub_spec.rb index ad41b7e0a2..0d9f32eca2 100644 --- a/spec/ruby/core/string/gsub_spec.rb +++ b/spec/ruby/core/string/gsub_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -160,56 +161,12 @@ describe "String#gsub with pattern and replacement" do it_behaves_like :string_gsub_named_capture, :gsub - ruby_version_is ''...'2.7' do - it "taints the result if the original string or replacement is tainted" do - hello = "hello" - hello_t = "hello" - a = "a" - a_t = "a" - empty = "" - empty_t = "" - - hello_t.taint; a_t.taint; empty_t.taint - - hello_t.gsub(/./, a).should.tainted? - hello_t.gsub(/./, empty).should.tainted? - - hello.gsub(/./, a_t).should.tainted? - hello.gsub(/./, empty_t).should.tainted? - hello.gsub(//, empty_t).should.tainted? - - hello.gsub(//.taint, "foo").should_not.tainted? - end - end - it "handles pattern collapse" do str = "ã“ã«ã¡ã‚" reg = %r!! str.gsub(reg, ".").should == ".ã“.ã«.ã¡.ã‚." end - ruby_version_is ''...'2.7' do - it "untrusts the result if the original string or replacement is untrusted" do - hello = "hello" - hello_t = "hello" - a = "a" - a_t = "a" - empty = "" - empty_t = "" - - hello_t.untrust; a_t.untrust; empty_t.untrust - - hello_t.gsub(/./, a).should.untrusted? - hello_t.gsub(/./, empty).should.untrusted? - - hello.gsub(/./, a_t).should.untrusted? - hello.gsub(/./, empty_t).should.untrusted? - hello.gsub(//, empty_t).should.untrusted? - - hello.gsub(//.untrust, "foo").should_not.untrusted? - end - end - it "tries to convert pattern to a string using to_str" do pattern = mock('.') def pattern.to_str() "." end @@ -236,26 +193,13 @@ describe "String#gsub with pattern and replacement" do -> { "hello".gsub(/[aeiou]/, nil) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("").gsub(//, "").should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("").gsub(/foo/, "").should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").gsub(/foo/, "").should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").gsub("foo", "").should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("").gsub(//, "").should be_an_instance_of(String) + StringSpecs::MyString.new("").gsub(/foo/, "").should be_an_instance_of(String) + StringSpecs::MyString.new("foo").gsub(/foo/, "").should be_an_instance_of(String) + StringSpecs::MyString.new("foo").gsub("foo", "").should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("").gsub(//, "").should be_an_instance_of(String) - StringSpecs::MyString.new("").gsub(/foo/, "").should be_an_instance_of(String) - StringSpecs::MyString.new("foo").gsub(/foo/, "").should be_an_instance_of(String) - StringSpecs::MyString.new("foo").gsub("foo", "").should be_an_instance_of(String) - end - end - - # Note: $~ cannot be tested because mspec messes with it - it "sets $~ to MatchData of last match and nil when there's none" do 'hello.'.gsub('hello', 'x') $~[0].should == 'hello' @@ -269,6 +213,18 @@ describe "String#gsub with pattern and replacement" do 'hello.'.gsub(/not/, 'x') $~.should == nil end + + it "handles a pattern in a superset encoding" do + result = 'abc'.force_encoding(Encoding::US_ASCII).gsub('é', 'è') + result.should == 'abc' + result.encoding.should == Encoding::US_ASCII + end + + it "handles a pattern in a subset encoding" do + result = 'été'.gsub('t'.force_encoding(Encoding::US_ASCII), 'u') + result.should == 'éué' + result.encoding.should == Encoding::UTF_8 + end end describe "String#gsub with pattern and Hash" do @@ -336,28 +292,6 @@ describe "String#gsub with pattern and Hash" do repl = '\& \0 \1 \` \\\' \+ \\\\ foo' "hello".gsub(/(.+)/, 'hello' => repl ).should == repl end - - ruby_version_is ''...'2.7' do - it "untrusts the result if the original string is untrusted" do - str = "Ghana".untrust - str.gsub(/[Aa]na/, 'ana' => '').untrusted?.should be_true - end - - it "untrusts the result if a hash value is untrusted" do - str = "Ghana" - str.gsub(/a$/, 'a' => 'di'.untrust).untrusted?.should be_true - end - - it "taints the result if the original string is tainted" do - str = "Ghana".taint - str.gsub(/[Aa]na/, 'ana' => '').tainted?.should be_true - end - - it "taints the result if a hash value is tainted" do - str = "Ghana" - str.gsub(/a$/, 'a' => 'di'.taint).tainted?.should be_true - end - end end describe "String#gsub! with pattern and Hash" do @@ -426,28 +360,6 @@ describe "String#gsub! with pattern and Hash" do repl = '\& \0 \1 \` \\\' \+ \\\\ foo' "hello".gsub!(/(.+)/, 'hello' => repl ).should == repl end - - ruby_version_is ''...'2.7' do - it "keeps untrusted state" do - str = "Ghana".untrust - str.gsub!(/[Aa]na/, 'ana' => '').untrusted?.should be_true - end - - it "untrusts self if a hash value is untrusted" do - str = "Ghana" - str.gsub!(/a$/, 'a' => 'di'.untrust).untrusted?.should be_true - end - - it "keeps tainted state" do - str = "Ghana".taint - str.gsub!(/[Aa]na/, 'ana' => '').tainted?.should be_true - end - - it "taints self if a hash value is tainted" do - str = "Ghana" - str.gsub!(/a$/, 'a' => 'di'.taint).tainted?.should be_true - end - end end describe "String#gsub with pattern and block" do @@ -526,28 +438,6 @@ describe "String#gsub with pattern and block" do "hello".gsub(/.+/) { obj }.should == "ok" end - ruby_version_is ''...'2.7' do - it "untrusts the result if the original string or replacement is untrusted" do - hello = "hello" - hello_t = "hello" - a = "a" - a_t = "a" - empty = "" - empty_t = "" - - hello_t.untrust; a_t.untrust; empty_t.untrust - - hello_t.gsub(/./) { a }.should.untrusted? - hello_t.gsub(/./) { empty }.should.untrusted? - - hello.gsub(/./) { a_t }.should.untrusted? - hello.gsub(/./) { empty_t }.should.untrusted? - hello.gsub(//) { empty_t }.should.untrusted? - - hello.gsub(//.untrust) { "foo" }.should_not.untrusted? - end - end - it "uses the compatible encoding if they are compatible" do s = "hello" s2 = "#{195.chr}#{192.chr}#{195.chr}" @@ -615,20 +505,6 @@ describe "String#gsub! with pattern and replacement" do a.should == "*¿** **é*?*" end - ruby_version_is ''...'2.7' do - it "taints self if replacement is tainted" do - a = "hello" - a.gsub!(/./.taint, "foo").should_not.tainted? - a.gsub!(/./, "foo".taint).should.tainted? - end - - it "untrusts self if replacement is untrusted" do - a = "hello" - a.gsub!(/./.untrust, "foo").should_not.untrusted? - a.gsub!(/./, "foo".untrust).should.untrusted? - end - end - it "returns nil if no modifications were made" do a = "hello" a.gsub!(/z/, '*').should == nil @@ -645,6 +521,27 @@ describe "String#gsub! with pattern and replacement" do -> { s.gsub!(/e/, "e") }.should raise_error(FrozenError) -> { s.gsub!(/[aeiou]/, '*') }.should raise_error(FrozenError) end + + it "handles a pattern in a superset encoding" do + string = 'abc'.force_encoding(Encoding::US_ASCII) + + result = string.gsub!('é', 'è') + + result.should == nil + string.should == 'abc' + string.encoding.should == Encoding::US_ASCII + end + + it "handles a pattern in a subset encoding" do + string = 'été' + pattern = 't'.force_encoding(Encoding::US_ASCII) + + result = string.gsub!(pattern, 'u') + + result.should == string + string.should == 'éué' + string.encoding.should == Encoding::UTF_8 + end end describe "String#gsub! with pattern and block" do @@ -654,20 +551,6 @@ describe "String#gsub! with pattern and block" do a.should == "h*ll*" end - ruby_version_is ''...'2.7' do - it "taints self if block's result is tainted" do - a = "hello" - a.gsub!(/./.taint) { "foo" }.should_not.tainted? - a.gsub!(/./) { "foo".taint }.should.tainted? - end - - it "untrusts self if block's result is untrusted" do - a = "hello" - a.gsub!(/./.untrust) { "foo" }.should_not.untrusted? - a.gsub!(/./) { "foo".untrust }.should.untrusted? - end - end - it "returns nil if no modifications were made" do a = "hello" a.gsub!(/z/) { '*' }.should == nil diff --git a/spec/ruby/core/string/include_spec.rb b/spec/ruby/core/string/include_spec.rb index e32eb17c29..9781140a55 100644 --- a/spec/ruby/core/string/include_spec.rb +++ b/spec/ruby/core/string/include_spec.rb @@ -13,6 +13,20 @@ describe "String#include? with String" do StringSpecs::MyString.new("hello").include?(StringSpecs::MyString.new("lo")).should == true end + it "returns true if both strings are empty" do + "".should.include?("") + "".dup.force_encoding("EUC-JP").should.include?("") + "".should.include?("".dup.force_encoding("EUC-JP")) + "".dup.force_encoding("EUC-JP").should.include?("".dup.force_encoding("EUC-JP")) + end + + it "returns true if the RHS is empty" do + "a".should.include?("") + "a".dup.force_encoding("EUC-JP").should.include?("") + "a".should.include?("".dup.force_encoding("EUC-JP")) + "a".dup.force_encoding("EUC-JP").should.include?("".dup.force_encoding("EUC-JP")) + end + it "tries to convert other to string using to_str" do other = mock('lo') other.should_receive(:to_str).and_return("lo") diff --git a/spec/ruby/core/string/index_spec.rb b/spec/ruby/core/string/index_spec.rb index 5d77a88e4e..be79708045 100644 --- a/spec/ruby/core/string/index_spec.rb +++ b/spec/ruby/core/string/index_spec.rb @@ -159,6 +159,21 @@ describe "String#index with String" do "ã‚ã‚Œ".index char end.should raise_error(Encoding::CompatibilityError) end + + it "handles a substring in a superset encoding" do + 'abc'.dup.force_encoding(Encoding::US_ASCII).index('é').should == nil + end + + it "handles a substring in a subset encoding" do + 'été'.index('t'.dup.force_encoding(Encoding::US_ASCII)).should == 1 + end + + it "raises an Encoding::CompatibilityError if the encodings are incompatible" do + str = 'abc'.dup.force_encoding("ISO-2022-JP") + pattern = 'b'.dup.force_encoding("EUC-JP") + + -> { str.index(pattern) }.should raise_error(Encoding::CompatibilityError, "incompatible character encodings: ISO-2022-JP and EUC-JP") + end end describe "String#index with Regexp" do @@ -304,6 +319,17 @@ describe "String#index with Regexp" do "ã‚ã‚Œã‚ã‚ã‚Œ".index(/ã‚/, 3).should == 3 end + ruby_bug "#19763", ""..."3.3.0" do + it "raises an Encoding::CompatibilityError if the encodings are incompatible" do + re = Regexp.new "ã‚Œ".encode(Encoding::EUC_JP) + -> do + "ã‚ã‚Œ".index re + end.should raise_error(Encoding::CompatibilityError, "incompatible encoding regexp match (EUC-JP regexp with UTF-8 string)") + end + end + + # The exception message was incorrectly "incompatible character encodings: UTF-8 and EUC-JP" before 3.3.0 + # Still test that the right exception class is used before that. it "raises an Encoding::CompatibilityError if the encodings are incompatible" do re = Regexp.new "ã‚Œ".encode(Encoding::EUC_JP) -> do diff --git a/spec/ruby/core/string/insert_spec.rb b/spec/ruby/core/string/insert_spec.rb index 752cbb2f37..483f3c9367 100644 --- a/spec/ruby/core/string/insert_spec.rb +++ b/spec/ruby/core/string/insert_spec.rb @@ -1,5 +1,5 @@ # -*- encoding: utf-8 -*- - +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -41,18 +41,6 @@ describe "String#insert with index, other" do "abcd".insert(-3, other).should == "abXYZcd" end - ruby_version_is ''...'2.7' do - it "taints self if string to insert is tainted" do - str = "abcd" - str.insert(0, "T".taint).should.tainted? - - str = "abcd" - other = mock('T') - def other.to_str() "T".taint end - str.insert(0, other).should.tainted? - end - end - it "raises a TypeError if other can't be converted to string" do -> { "abcd".insert(-6, Object.new)}.should raise_error(TypeError) -> { "abcd".insert(-6, []) }.should raise_error(TypeError) @@ -81,4 +69,13 @@ describe "String#insert with index, other" do "ã‚ã‚Œ".insert 0, pat end.should raise_error(Encoding::CompatibilityError) end + + it "should not call subclassed string methods" do + cls = Class.new(String) do + def replace(arg) + raise "should not call replace" + end + end + cls.new("abcd").insert(0, 'X').should == "Xabcd" + end end diff --git a/spec/ruby/core/string/inspect_spec.rb b/spec/ruby/core/string/inspect_spec.rb index 98b5b32b61..15db06c7f5 100644 --- a/spec/ruby/core/string/inspect_spec.rb +++ b/spec/ruby/core/string/inspect_spec.rb @@ -3,18 +3,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "String#inspect" do - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "foo".taint.inspect.should.tainted? - "foo\n".taint.inspect.should.tainted? - end - - it "untrusts the result if self is untrusted" do - "foo".untrust.inspect.should.untrusted? - "foo\n".untrust.inspect.should.untrusted? - end - end - it "does not return a subclass instance" do StringSpecs::MyString.new.inspect.should be_an_instance_of(String) end @@ -31,6 +19,21 @@ describe "String#inspect" do ].should be_computed_by(:inspect) end + it "returns a string with special characters replaced with \\<char> notation for UTF-16" do + pairs = [ + ["\a", '"\\a"'], + ["\b", '"\\b"'], + ["\t", '"\\t"'], + ["\n", '"\\n"'], + ["\v", '"\\v"'], + ["\f", '"\\f"'], + ["\r", '"\\r"'], + ["\e", '"\\e"'] + ].map { |str, result| [str.encode('UTF-16LE'), result] } + + pairs.should be_computed_by(:inspect) + end + it "returns a string with \" and \\ escaped with a backslash" do [ ["\"", '"\\""'], ["\\", '"\\\\"'] @@ -323,6 +326,11 @@ describe "String#inspect" do "\xF0\x9F".inspect.should == '"\\xF0\\x9F"' end + it "works for broken US-ASCII strings" do + s = "©".dup.force_encoding("US-ASCII") + s.inspect.should == '"\xC2\xA9"' + end + describe "when default external is UTF-8" do before :each do @extenc, Encoding.default_external = Encoding.default_external, Encoding::UTF_8 diff --git a/spec/ruby/core/string/lines_spec.rb b/spec/ruby/core/string/lines_spec.rb index ad4b119074..40ab5f71d8 100644 --- a/spec/ruby/core/string/lines_spec.rb +++ b/spec/ruby/core/string/lines_spec.rb @@ -1,7 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative 'shared/each_line' -require_relative 'shared/each_line_without_block' describe "String#lines" do it_behaves_like :string_each_line, :lines diff --git a/spec/ruby/core/string/ljust_spec.rb b/spec/ruby/core/string/ljust_spec.rb index 0c3b2a2f44..47324c59d2 100644 --- a/spec/ruby/core/string/ljust_spec.rb +++ b/spec/ruby/core/string/ljust_spec.rb @@ -31,16 +31,6 @@ describe "String#ljust with length, padding" do "radiology".ljust(8, '-').should == "radiology" end - ruby_version_is ''...'2.7' do - it "taints result when self or padstr is tainted" do - "x".taint.ljust(4).should.tainted? - "x".taint.ljust(0).should.tainted? - "".taint.ljust(0).should.tainted? - "x".taint.ljust(4, "*").should.tainted? - "x".ljust(4, "*".taint).should.tainted? - end - end - it "tries to convert length to an integer using to_int" do "^".ljust(3.8, "_^").should == "^_^" @@ -74,39 +64,18 @@ describe "String#ljust with length, padding" do -> { "hello".ljust(10, '') }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on subclasses" do - StringSpecs::MyString.new("").ljust(10).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").ljust(10).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(StringSpecs::MyString) - - "".ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - "foo".ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - end - end + it "returns String instances when called on subclasses" do + StringSpecs::MyString.new("").ljust(10).should be_an_instance_of(String) + StringSpecs::MyString.new("foo").ljust(10).should be_an_instance_of(String) + StringSpecs::MyString.new("foo").ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - ruby_version_is '3.0' do - it "returns String instances when called on subclasses" do - StringSpecs::MyString.new("").ljust(10).should be_an_instance_of(String) - StringSpecs::MyString.new("foo").ljust(10).should be_an_instance_of(String) - StringSpecs::MyString.new("foo").ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - - "".ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - "foo".ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - end - end - - ruby_version_is ''...'2.7' do - it "when padding is tainted and self is untainted returns a tainted string if and only if length is longer than self" do - "hello".ljust(4, 'X'.taint).tainted?.should be_false - "hello".ljust(5, 'X'.taint).tainted?.should be_false - "hello".ljust(6, 'X'.taint).tainted?.should be_true - end + "".ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) + "foo".ljust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) end describe "with width" do it "returns a String in the same encoding as the original" do - str = "abc".force_encoding Encoding::IBM437 + str = "abc".dup.force_encoding Encoding::IBM437 result = str.ljust 5 result.should == "abc " result.encoding.should equal(Encoding::IBM437) @@ -115,7 +84,7 @@ describe "String#ljust with length, padding" do describe "with width, pattern" do it "returns a String in the compatible encoding" do - str = "abc".force_encoding Encoding::IBM437 + str = "abc".dup.force_encoding Encoding::IBM437 result = str.ljust 5, "ã‚" result.should == "abcã‚ã‚" result.encoding.should equal(Encoding::UTF_8) diff --git a/spec/ruby/core/string/lstrip_spec.rb b/spec/ruby/core/string/lstrip_spec.rb index 6b40189500..99bab6f349 100644 --- a/spec/ruby/core/string/lstrip_spec.rb +++ b/spec/ruby/core/string/lstrip_spec.rb @@ -1,27 +1,29 @@ +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/strip' describe "String#lstrip" do + it_behaves_like :string_strip, :lstrip + it "returns a copy of self with leading whitespace removed" do " hello ".lstrip.should == "hello " " hello world ".lstrip.should == "hello world " "\n\r\t\n\v\r hello world ".lstrip.should == "hello world " "hello".lstrip.should == "hello" + " ã“ã«ã¡ã‚".lstrip.should == "ã“ã«ã¡ã‚" end - ruby_version_is '3.1' do - it "strips leading \\0" do - "\x00hello".lstrip.should == "hello" - "\000 \000hello\000 \000".lstrip.should == "hello\000 \000" - end + it "works with lazy substrings" do + " hello "[1...-1].lstrip.should == "hello " + " hello world "[1...-1].lstrip.should == "hello world " + "\n\r\t\n\v\r hello world "[1...-1].lstrip.should == "hello world " + " ã“ã«ã¡ã‚ "[1...-1].lstrip.should == "ã“ã«ã¡ã‚" end - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - "".taint.lstrip.should.tainted? - "ok".taint.lstrip.should.tainted? - " ok".taint.lstrip.should.tainted? - end + it "strips leading \\0" do + "\x00hello".lstrip.should == "hello" + "\000 \000hello\000 \000".lstrip.should == "hello\000 \000" end end @@ -32,20 +34,24 @@ describe "String#lstrip!" do a.should == "hello " end - ruby_version_is '3.1' do - it "strips leading \\0" do - a = "\000 \000hello\000 \000" - a.lstrip! - a.should == "hello\000 \000" - end - end - it "returns nil if no modifications were made" do a = "hello" a.lstrip!.should == nil a.should == "hello" end + it "makes a string empty if it is only whitespace" do + "".lstrip!.should == nil + " ".lstrip.should == "" + " ".lstrip.should == "" + end + + it "removes leading NULL bytes and whitespace" do + a = "\000 \000hello\000 \000" + a.lstrip! + a.should == "hello\000 \000" + end + it "raises a FrozenError on a frozen instance that is modified" do -> { " hello ".freeze.lstrip! }.should raise_error(FrozenError) end @@ -55,4 +61,14 @@ describe "String#lstrip!" do -> { "hello".freeze.lstrip! }.should raise_error(FrozenError) -> { "".freeze.lstrip! }.should raise_error(FrozenError) end + + it "raises an ArgumentError if the first non-space codepoint is invalid" do + s = "\xDFabc".force_encoding(Encoding::UTF_8) + s.valid_encoding?.should be_false + -> { s.lstrip! }.should raise_error(ArgumentError) + + s = " \xDFabc".force_encoding(Encoding::UTF_8) + s.valid_encoding?.should be_false + -> { s.lstrip! }.should raise_error(ArgumentError) + end end diff --git a/spec/ruby/core/string/modulo_spec.rb b/spec/ruby/core/string/modulo_spec.rb index dc11ced4e2..bf96a82874 100644 --- a/spec/ruby/core/string/modulo_spec.rb +++ b/spec/ruby/core/string/modulo_spec.rb @@ -302,29 +302,6 @@ describe "String#%" do end end - ruby_version_is ''...'2.7' do - it "always taints the result when the format string is tainted" do - universal = mock('0') - def universal.to_int() 0 end - def universal.to_str() "0" end - def universal.to_f() 0.0 end - - [ - "", "foo", - "%b", "%B", "%c", "%d", "%e", "%E", - "%f", "%g", "%G", "%i", "%o", "%p", - "%s", "%u", "%x", "%X" - ].each do |format| - subcls_format = StringSpecs::MyString.new(format) - subcls_format.taint - format.taint - - (format % universal).should.tainted? - (subcls_format % universal).should.tainted? - end - end - end - it "supports binary formats using %b for positive numbers" do ("%b" % 10).should == "1010" ("% b" % 10).should == " 1010" @@ -391,8 +368,16 @@ describe "String#%" do ("%c" % 'A').should == "A" end - it "raises an exception for multiple character strings as argument for %c" do - -> { "%c" % 'AA' }.should raise_error(ArgumentError) + ruby_version_is ""..."3.2" do + it "raises an exception for multiple character strings as argument for %c" do + -> { "%c" % 'AA' }.should raise_error(ArgumentError) + end + end + + ruby_version_is "3.2" do + it "supports only the first character as argument for %c" do + ("%c" % 'AA').should == "A" + end end it "calls to_str on argument for %c formats" do @@ -578,20 +563,6 @@ describe "String#%" do # ("%p" % obj).should == "obj" end - ruby_version_is ''...'2.7' do - it "taints result for %p when argument.inspect is tainted" do - obj = mock('x') - def obj.inspect() "x".taint end - - ("%p" % obj).should.tainted? - - obj = mock('x'); obj.taint - def obj.inspect() "x" end - - ("%p" % obj).should_not.tainted? - end - end - it "supports string formats using %s" do ("%s" % "hello").should == "hello" ("%s" % "").should == "" @@ -620,13 +591,6 @@ describe "String#%" do # ("%s" % obj).should == "obj" end - ruby_version_is ''...'2.7' do - it "taints result for %s when argument is tainted" do - ("%s" % "x".taint).should.tainted? - ("%s" % mock('x').taint).should.tainted? - end - end - # MRI crashes on this one. # See http://groups.google.com/group/ruby-core-google/t/c285c18cd94c216d it "raises an ArgumentError for huge precisions for %s" do @@ -786,12 +750,6 @@ describe "String#%" do it "behaves as if calling Kernel#Float for #{format} arguments, when the passed argument is hexadecimal string" do (format % "0xA").should == (format % 0xA) end - - ruby_version_is ''...'2.7' do - it "doesn't taint the result for #{format} when argument is tainted" do - (format % "5".taint).should_not.tainted? - end - end end describe "when format string contains %{} sections" do diff --git a/spec/ruby/core/string/ord_spec.rb b/spec/ruby/core/string/ord_spec.rb index cfc630a124..35af3b5458 100644 --- a/spec/ruby/core/string/ord_spec.rb +++ b/spec/ruby/core/string/ord_spec.rb @@ -25,4 +25,9 @@ describe "String#ord" do it "raises an ArgumentError if called on an empty String" do -> { ''.ord }.should raise_error(ArgumentError) end + + it "raises ArgumentError if the character is broken" do + s = "©".dup.force_encoding("US-ASCII") + -> { s.ord }.should raise_error(ArgumentError, "invalid byte sequence in US-ASCII") + end end diff --git a/spec/ruby/core/string/partition_spec.rb b/spec/ruby/core/string/partition_spec.rb index 996368d6a4..d5370dcc73 100644 --- a/spec/ruby/core/string/partition_spec.rb +++ b/spec/ruby/core/string/partition_spec.rb @@ -1,7 +1,10 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/partition' describe "String#partition with String" do + it_behaves_like :string_partition, :partition + it "returns an array of substrings based on splitting on the given string" do "hello world".partition("o").should == ["hell", "o", " world"] end @@ -35,4 +38,26 @@ describe "String#partition with String" do it "takes precedence over a given block" do "hello world".partition("o") { true }.should == ["hell", "o", " world"] end + + it "handles a pattern in a superset encoding" do + string = "hello".dup.force_encoding(Encoding::US_ASCII) + + result = string.partition("é") + + result.should == ["hello", "", ""] + result[0].encoding.should == Encoding::US_ASCII + result[1].encoding.should == Encoding::US_ASCII + result[2].encoding.should == Encoding::US_ASCII + end + + it "handles a pattern in a subset encoding" do + pattern = "o".dup.force_encoding(Encoding::US_ASCII) + + result = "héllo world".partition(pattern) + + result.should == ["héll", "o", " world"] + result[0].encoding.should == Encoding::UTF_8 + result[1].encoding.should == Encoding::US_ASCII + result[2].encoding.should == Encoding::UTF_8 + end end diff --git a/spec/ruby/core/string/plus_spec.rb b/spec/ruby/core/string/plus_spec.rb index 9f0db6427c..9da17451c6 100644 --- a/spec/ruby/core/string/plus_spec.rb +++ b/spec/ruby/core/string/plus_spec.rb @@ -3,6 +3,9 @@ require_relative 'fixtures/classes' require_relative 'shared/concat' describe "String#+" do + it_behaves_like :string_concat_encoding, :+ + it_behaves_like :string_concat_type_coercion, :+ + it "returns a new string containing the given string concatenated to self" do ("" + "").should == "" ("" + "Hello").should == "Hello" @@ -31,19 +34,4 @@ describe "String#+" do ("hello" + StringSpecs::MyString.new("foo")).should be_an_instance_of(String) ("hello" + StringSpecs::MyString.new("")).should be_an_instance_of(String) end - - ruby_version_is ''...'2.7' do - it "taints the result when self or other is tainted" do - strs = ["", "OK", StringSpecs::MyString.new(""), StringSpecs::MyString.new("OK")] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - strs.each do |other| - (str + other).tainted?.should == (str.tainted? | other.tainted?) - end - end - end - end - - it_behaves_like :string_concat_encoding, :+ end diff --git a/spec/ruby/core/string/prepend_spec.rb b/spec/ruby/core/string/prepend_spec.rb index a6074be3c6..5248ea8056 100644 --- a/spec/ruby/core/string/prepend_spec.rb +++ b/spec/ruby/core/string/prepend_spec.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -34,16 +35,6 @@ describe "String#prepend" do a.should == "hello world" end - ruby_version_is ''...'2.7' do - it "taints self if other is tainted" do - x = "x" - x.prepend("".taint).tainted?.should be_true - - x = "x" - x.prepend("y".taint).tainted?.should be_true - end - end - it "takes multiple arguments" do str = " world" str.prepend "he", "", "llo" diff --git a/spec/ruby/core/string/reverse_spec.rb b/spec/ruby/core/string/reverse_spec.rb index cf4956a528..aa6abe6036 100644 --- a/spec/ruby/core/string/reverse_spec.rb +++ b/spec/ruby/core/string/reverse_spec.rb @@ -1,4 +1,5 @@ # encoding: utf-8 +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -10,17 +11,27 @@ describe "String#reverse" do "".reverse.should == "" end - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - "".taint.reverse.should.tainted? - "m".taint.reverse.should.tainted? - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("stressed").reverse.should be_an_instance_of(String) + StringSpecs::MyString.new("m").reverse.should be_an_instance_of(String) + StringSpecs::MyString.new("").reverse.should be_an_instance_of(String) end it "reverses a string with multi byte characters" do "微軟æ£é»‘é«”".reverse.should == "體黑æ£è»Ÿå¾®" end + it "works with a broken string" do + str = "微軟\xDF\xDEæ£é»‘é«”".force_encoding(Encoding::UTF_8) + + str.valid_encoding?.should be_false + + str.reverse.should == "體黑æ£\xDE\xDF軟微" + end + + it "returns a String in the same encoding as self" do + "stressed".encode("US-ASCII").reverse.encoding.should == Encoding::US_ASCII + end end describe "String#reverse!" do @@ -47,4 +58,13 @@ describe "String#reverse!" do str.reverse! str.should == "體黑æ£è»Ÿå¾®" end + + it "works with a broken string" do + str = "微軟\xDF\xDEæ£é»‘é«”".force_encoding(Encoding::UTF_8) + + str.valid_encoding?.should be_false + str.reverse! + + str.should == "體黑æ£\xDE\xDF軟微" + end end diff --git a/spec/ruby/core/string/rindex_spec.rb b/spec/ruby/core/string/rindex_spec.rb index 7a6af0c9d0..88ce733583 100644 --- a/spec/ruby/core/string/rindex_spec.rb +++ b/spec/ruby/core/string/rindex_spec.rb @@ -1,16 +1,19 @@ # -*- encoding: utf-8 -*- require_relative '../../spec_helper' require_relative 'fixtures/classes' -require_relative 'fixtures/utf-8-encoding' describe "String#rindex with object" do - it "raises a TypeError if obj isn't a String, Integer or Regexp" do + it "raises a TypeError if obj isn't a String or Regexp" do not_supported_on :opal do -> { "hello".rindex(:sym) }.should raise_error(TypeError) end -> { "hello".rindex(mock('x')) }.should raise_error(TypeError) end + it "raises a TypeError if obj is an Integer" do + -> { "hello".rindex(42) }.should raise_error(TypeError) + end + it "doesn't try to convert obj to an integer via to_int" do obj = mock('x') obj.should_not_receive(:to_int) @@ -192,6 +195,21 @@ describe "String#rindex with String" do it "raises a TypeError when given offset is nil" do -> { "str".rindex("st", nil) }.should raise_error(TypeError) end + + it "handles a substring in a superset encoding" do + 'abc'.dup.force_encoding(Encoding::US_ASCII).rindex('é').should == nil + end + + it "handles a substring in a subset encoding" do + 'été'.rindex('t'.dup.force_encoding(Encoding::US_ASCII)).should == 1 + end + + it "raises an Encoding::CompatibilityError if the encodings are incompatible" do + str = 'abc'.dup.force_encoding("ISO-2022-JP") + pattern = 'b'.dup.force_encoding("EUC-JP") + + -> { str.rindex(pattern) }.should raise_error(Encoding::CompatibilityError, "incompatible character encodings: ISO-2022-JP and EUC-JP") + end end describe "String#rindex with Regexp" do @@ -361,6 +379,6 @@ describe "String#rindex with Regexp" do re = Regexp.new "ã‚Œ".encode(Encoding::EUC_JP) -> do "ã‚ã‚Œ".rindex re - end.should raise_error(Encoding::CompatibilityError) + end.should raise_error(Encoding::CompatibilityError, "incompatible encoding regexp match (EUC-JP regexp with UTF-8 string)") end end diff --git a/spec/ruby/core/string/rjust_spec.rb b/spec/ruby/core/string/rjust_spec.rb index f51aacff44..4ad3e54aea 100644 --- a/spec/ruby/core/string/rjust_spec.rb +++ b/spec/ruby/core/string/rjust_spec.rb @@ -31,16 +31,6 @@ describe "String#rjust with length, padding" do "radiology".rjust(8, '-').should == "radiology" end - ruby_version_is ''...'2.7' do - it "taints result when self or padstr is tainted" do - "x".taint.rjust(4).should.tainted? - "x".taint.rjust(0).should.tainted? - "".taint.rjust(0).should.tainted? - "x".taint.rjust(4, "*").should.tainted? - "x".rjust(4, "*".taint).should.tainted? - end - end - it "tries to convert length to an integer using to_int" do "^".rjust(3.8, "^_").should == "^_^" @@ -74,39 +64,18 @@ describe "String#rjust with length, padding" do -> { "hello".rjust(10, '') }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on subclasses" do - StringSpecs::MyString.new("").rjust(10).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").rjust(10).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(StringSpecs::MyString) - - "".rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - "foo".rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - end - end + it "returns String instances when called on subclasses" do + StringSpecs::MyString.new("").rjust(10).should be_an_instance_of(String) + StringSpecs::MyString.new("foo").rjust(10).should be_an_instance_of(String) + StringSpecs::MyString.new("foo").rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - ruby_version_is '3.0' do - it "returns String instances when called on subclasses" do - StringSpecs::MyString.new("").rjust(10).should be_an_instance_of(String) - StringSpecs::MyString.new("foo").rjust(10).should be_an_instance_of(String) - StringSpecs::MyString.new("foo").rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - - "".rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - "foo".rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) - end - end - - ruby_version_is ''...'2.7' do - it "when padding is tainted and self is untainted returns a tainted string if and only if length is longer than self" do - "hello".rjust(4, 'X'.taint).tainted?.should be_false - "hello".rjust(5, 'X'.taint).tainted?.should be_false - "hello".rjust(6, 'X'.taint).tainted?.should be_true - end + "".rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) + "foo".rjust(10, StringSpecs::MyString.new("x")).should be_an_instance_of(String) end describe "with width" do it "returns a String in the same encoding as the original" do - str = "abc".force_encoding Encoding::IBM437 + str = "abc".dup.force_encoding Encoding::IBM437 result = str.rjust 5 result.should == " abc" result.encoding.should equal(Encoding::IBM437) @@ -115,7 +84,7 @@ describe "String#rjust with length, padding" do describe "with width, pattern" do it "returns a String in the compatible encoding" do - str = "abc".force_encoding Encoding::IBM437 + str = "abc".dup.force_encoding Encoding::IBM437 result = str.rjust 5, "ã‚" result.should == "ã‚ã‚abc" result.encoding.should equal(Encoding::UTF_8) diff --git a/spec/ruby/core/string/rpartition_spec.rb b/spec/ruby/core/string/rpartition_spec.rb index fc37f8b427..cef0384c73 100644 --- a/spec/ruby/core/string/rpartition_spec.rb +++ b/spec/ruby/core/string/rpartition_spec.rb @@ -1,7 +1,10 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/partition' describe "String#rpartition with String" do + it_behaves_like :string_partition, :rpartition + it "returns an array of substrings based on splitting on the given string" do "hello world".rpartition("o").should == ["hello w", "o", "rld"] end @@ -43,4 +46,26 @@ describe "String#rpartition with String" do ->{ "hello".rpartition(5) }.should raise_error(TypeError) ->{ "hello".rpartition(nil) }.should raise_error(TypeError) end + + it "handles a pattern in a superset encoding" do + string = "hello".dup.force_encoding(Encoding::US_ASCII) + + result = string.rpartition("é") + + result.should == ["", "", "hello"] + result[0].encoding.should == Encoding::US_ASCII + result[1].encoding.should == Encoding::US_ASCII + result[2].encoding.should == Encoding::US_ASCII + end + + it "handles a pattern in a subset encoding" do + pattern = "o".dup.force_encoding(Encoding::US_ASCII) + + result = "héllo world".rpartition(pattern) + + result.should == ["héllo w", "o", "rld"] + result[0].encoding.should == Encoding::UTF_8 + result[1].encoding.should == Encoding::US_ASCII + result[2].encoding.should == Encoding::UTF_8 + end end diff --git a/spec/ruby/core/string/rstrip_spec.rb b/spec/ruby/core/string/rstrip_spec.rb index 57e1867956..6d46eb590e 100644 --- a/spec/ruby/core/string/rstrip_spec.rb +++ b/spec/ruby/core/string/rstrip_spec.rb @@ -1,25 +1,29 @@ +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/strip' describe "String#rstrip" do + it_behaves_like :string_strip, :rstrip + it "returns a copy of self with trailing whitespace removed" do " hello ".rstrip.should == " hello" " hello world ".rstrip.should == " hello world" " hello world \n\r\t\n\v\r".rstrip.should == " hello world" "hello".rstrip.should == "hello" "hello\x00".rstrip.should == "hello" + "ã“ã«ã¡ã‚ ".rstrip.should == "ã“ã«ã¡ã‚" end - it "returns a copy of self with all trailing whitespace and NULL bytes removed" do - "\x00 \x00hello\x00 \x00".rstrip.should == "\x00 \x00hello" + it "works with lazy substrings" do + " hello "[1...-1].rstrip.should == " hello" + " hello world "[1...-1].rstrip.should == " hello world" + " hello world \n\r\t\n\v\r"[1...-1].rstrip.should == " hello world" + " ã“ã«ã¡ã‚ "[1...-1].rstrip.should == "ã“ã«ã¡ã‚" end - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - "".taint.rstrip.should.tainted? - "ok".taint.rstrip.should.tainted? - "ok ".taint.rstrip.should.tainted? - end + it "returns a copy of self with all trailing whitespace and NULL bytes removed" do + "\x00 \x00hello\x00 \x00".rstrip.should == "\x00 \x00hello" end end @@ -42,6 +46,18 @@ describe "String#rstrip!" do a.should == "hello" end + it "makes a string empty if it is only whitespace" do + "".rstrip!.should == nil + " ".rstrip.should == "" + " ".rstrip.should == "" + end + + it "removes trailing NULL bytes and whitespace" do + a = "\000 goodbye \000" + a.rstrip! + a.should == "\000 goodbye" + end + it "raises a FrozenError on a frozen instance that is modified" do -> { " hello ".freeze.rstrip! }.should raise_error(FrozenError) end @@ -51,4 +67,28 @@ describe "String#rstrip!" do -> { "hello".freeze.rstrip! }.should raise_error(FrozenError) -> { "".freeze.rstrip! }.should raise_error(FrozenError) end + + ruby_version_is "3.2" do + it "raises an Encoding::CompatibilityError if the last non-space codepoint is invalid" do + s = "abc\xDF".force_encoding(Encoding::UTF_8) + s.valid_encoding?.should be_false + -> { s.rstrip! }.should raise_error(Encoding::CompatibilityError) + + s = "abc\xDF ".force_encoding(Encoding::UTF_8) + s.valid_encoding?.should be_false + -> { s.rstrip! }.should raise_error(Encoding::CompatibilityError) + end + end + + ruby_version_is ""..."3.2" do + it "raises an ArgumentError if the last non-space codepoint is invalid" do + s = "abc\xDF".force_encoding(Encoding::UTF_8) + s.valid_encoding?.should be_false + -> { s.rstrip! }.should raise_error(ArgumentError) + + s = "abc\xDF ".force_encoding(Encoding::UTF_8) + s.valid_encoding?.should be_false + -> { s.rstrip! }.should raise_error(ArgumentError) + end + end end diff --git a/spec/ruby/core/string/scan_spec.rb b/spec/ruby/core/string/scan_spec.rb index 024e97022a..70c3b7fb7b 100644 --- a/spec/ruby/core/string/scan_spec.rb +++ b/spec/ruby/core/string/scan_spec.rb @@ -65,32 +65,16 @@ describe "String#scan" do -> { "cruel world".scan(mock('x')) }.should raise_error(TypeError) end - ruby_version_is ''...'2.7' do - it "taints the results if the String argument is tainted" do - a = "hello hello hello".scan("hello".taint) - a.each { |m| m.tainted?.should be_true } - end - - it "taints the results when passed a String argument if self is tainted" do - a = "hello hello hello".taint.scan("hello") - a.each { |m| m.tainted?.should be_true } - end - - it "taints the results if the Regexp argument is tainted" do - a = "hello".scan(/./.taint) - a.each { |m| m.tainted?.should be_true } - end - - it "taints the results when passed a Regexp argument if self is tainted" do - a = "hello".taint.scan(/./) - a.each { |m| m.tainted?.should be_true } - end - end - # jruby/jruby#5513 it "does not raise any errors when passed a multi-byte string" do "ã‚ã‚ã‚aaaã‚ã‚ã‚".scan("ã‚ã‚ã‚").should == ["ã‚ã‚ã‚", "ã‚ã‚ã‚"] end + + it "returns Strings in the same encoding as self" do + "cruel world".encode("US-ASCII").scan(/\w+/).each do |s| + s.encoding.should == Encoding::US_ASCII + end + end end describe "String#scan with pattern and block" do @@ -173,24 +157,6 @@ describe "String#scan with pattern and block" do $~.should == nil end - ruby_version_is ''...'2.7' do - it "taints the results if the String argument is tainted" do - "hello hello hello".scan("hello".taint).each { |m| m.tainted?.should be_true } - end - - it "taints the results when passed a String argument if self is tainted" do - "hello hello hello".taint.scan("hello").each { |m| m.tainted?.should be_true } - end - - it "taints the results if the Regexp argument is tainted" do - "hello".scan(/./.taint).each { |m| m.tainted?.should be_true } - end - - it "taints the results when passed a Regexp argument if self is tainted" do - "hello".taint.scan(/./).each { |m| m.tainted?.should be_true } - end - end - it "passes block arguments as individual arguments when blocks are provided" do "a b c\na b c\na b c".scan(/(\w*) (\w*) (\w*)/) do |first,second,third| first.should == 'a'; @@ -198,4 +164,10 @@ describe "String#scan with pattern and block" do third.should == 'c'; end end + + it "yields String instances for subclasses" do + a = [] + StringSpecs::MyString.new("abc").scan(/./) { |s| a << s.class } + a.should == [String, String, String] + end end diff --git a/spec/ruby/core/string/scrub_spec.rb b/spec/ruby/core/string/scrub_spec.rb index 5c67ad01bc..b9ef0f1a16 100644 --- a/spec/ruby/core/string/scrub_spec.rb +++ b/spec/ruby/core/string/scrub_spec.rb @@ -1,5 +1,7 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' +require_relative 'fixtures/classes' describe "String#scrub with a default replacement" do it "returns self for valid strings" do @@ -13,18 +15,33 @@ describe "String#scrub with a default replacement" do "abc\u3042#{x81}".scrub.should == "abc\u3042\uFFFD" end + it "replaces invalid byte sequences in lazy substrings" do + x81 = [0x81].pack('C').force_encoding('utf-8') + "abc\u3042#{x81}def"[1...-1].scrub.should == "bc\u3042\uFFFDde" + end + it "returns a copy of self when the input encoding is BINARY" do input = "foo".encode('BINARY') input.scrub.should == "foo" end - it "replaces invalid byte sequences when using ASCII as the input encoding" do xE3x80 = [0xE3, 0x80].pack('CC').force_encoding 'utf-8' input = "abc\u3042#{xE3x80}".force_encoding('ASCII') input.scrub.should == "abc?????" end + + it "returns a String in the same encoding as self" do + x81 = [0x81].pack('C').force_encoding('utf-8') + "abc\u3042#{x81}".scrub.encoding.should == Encoding::UTF_8 + end + + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("foo").scrub.should be_an_instance_of(String) + input = [0x81].pack('C').force_encoding('utf-8') + StringSpecs::MyString.new(input).scrub.should be_an_instance_of(String) + end end describe "String#scrub with a custom replacement" do @@ -42,7 +59,9 @@ describe "String#scrub with a custom replacement" do it "replaces invalid byte sequences in frozen strings" do x81 = [0x81].pack('C').force_encoding('utf-8') (-"abc\u3042#{x81}").scrub("*").should == "abc\u3042*" - utf16_str = ("abc".encode('UTF-16LE').bytes + [0x81]).pack('c*').force_encoding('UTF-16LE') + + leading_surrogate = [0x00, 0xD8] + utf16_str = ("abc".encode('UTF-16LE').bytes + leading_surrogate).pack('c*').force_encoding('UTF-16LE') (-(utf16_str)).scrub("*".encode('UTF-16LE')).should == "abc*".encode('UTF-16LE') end @@ -59,12 +78,23 @@ describe "String#scrub with a custom replacement" do block.should raise_error(ArgumentError) end + it "returns a String in the same encoding as self" do + x81 = [0x81].pack('C').force_encoding('utf-8') + "abc\u3042#{x81}".scrub("*").encoding.should == Encoding::UTF_8 + end + it "raises TypeError when a non String replacement is given" do x81 = [0x81].pack('C').force_encoding('utf-8') block = -> { "foo#{x81}".scrub(1) } block.should raise_error(TypeError) end + + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("foo").scrub("*").should be_an_instance_of(String) + input = [0x81].pack('C').force_encoding('utf-8') + StringSpecs::MyString.new(input).scrub("*").should be_an_instance_of(String) + end end describe "String#scrub with a block" do @@ -89,6 +119,12 @@ describe "String#scrub with a block" do replaced.should == "€€" end + + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("foo").scrub { |b| "*" }.should be_an_instance_of(String) + input = [0x81].pack('C').force_encoding('utf-8') + StringSpecs::MyString.new(input).scrub { |b| "<#{b.unpack("H*")[0]}>" }.should be_an_instance_of(String) + end end describe "String#scrub!" do diff --git a/spec/ruby/core/string/setbyte_spec.rb b/spec/ruby/core/string/setbyte_spec.rb index 03e5bad88b..85403ca62c 100644 --- a/spec/ruby/core/string/setbyte_spec.rb +++ b/spec/ruby/core/string/setbyte_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' describe "String#setbyte" do @@ -36,6 +37,12 @@ describe "String#setbyte" do str.valid_encoding?.should be_true str.setbyte(2,253) str.valid_encoding?.should be_false + + str = "ABC" + str.setbyte(0, 0x20) # ' ' + str.should.valid_encoding? + str.setbyte(0, 0xE3) + str.should_not.valid_encoding? end it "regards a negative index as counting from the end of the String" do diff --git a/spec/ruby/core/string/shared/byte_index_common.rb b/spec/ruby/core/string/shared/byte_index_common.rb new file mode 100644 index 0000000000..3de1453f4f --- /dev/null +++ b/spec/ruby/core/string/shared/byte_index_common.rb @@ -0,0 +1,63 @@ +# -*- encoding: utf-8 -*- +require_relative '../../../spec_helper' + +describe :byte_index_common, shared: true do + describe "raises on type errors" do + it "raises a TypeError if passed nil" do + -> { "abc".send(@method, nil) }.should raise_error(TypeError, "no implicit conversion of nil into String") + end + + it "raises a TypeError if passed a boolean" do + -> { "abc".send(@method, true) }.should raise_error(TypeError, "no implicit conversion of true into String") + end + + it "raises a TypeError if passed a Symbol" do + not_supported_on :opal do + -> { "abc".send(@method, :a) }.should raise_error(TypeError, "no implicit conversion of Symbol into String") + end + end + + it "raises a TypeError if passed a Symbol" do + obj = mock('x') + obj.should_not_receive(:to_int) + -> { "hello".send(@method, obj) }.should raise_error(TypeError, "no implicit conversion of MockObject into String") + end + + it "raises a TypeError if passed an Integer" do + -> { "abc".send(@method, 97) }.should raise_error(TypeError, "no implicit conversion of Integer into String") + end + end + + describe "with multibyte codepoints" do + it "raises an IndexError when byte offset lands in the middle of a multibyte character" do + -> { "ã‚".send(@method, "", 1) }.should raise_error(IndexError, "offset 1 does not land on character boundary") + -> { "ã‚".send(@method, "", 2) }.should raise_error(IndexError, "offset 2 does not land on character boundary") + -> { "ã‚".send(@method, "", -1) }.should raise_error(IndexError, "offset 2 does not land on character boundary") + -> { "ã‚".send(@method, "", -2) }.should raise_error(IndexError, "offset 1 does not land on character boundary") + end + + it "raises an Encoding::CompatibilityError if the encodings are incompatible" do + re = Regexp.new "ã‚Œ".encode(Encoding::EUC_JP) + -> do + "ã‚ã‚Œ".send(@method, re) + end.should raise_error(Encoding::CompatibilityError, "incompatible encoding regexp match (EUC-JP regexp with UTF-8 string)") + end + end + + describe "with global variables" do + it "doesn't set $~ for non regex search" do + $~ = nil + + 'hello.'.send(@method, 'll') + $~.should == nil + end + + it "sets $~ to MatchData of match and nil when there's none" do + 'hello.'.send(@method, /.e./) + $~[0].should == 'hel' + + 'hello.'.send(@method, /not/) + $~.should == nil + end + end +end diff --git a/spec/ruby/core/string/shared/chars.rb b/spec/ruby/core/string/shared/chars.rb index 1f045e4530..c730643cf4 100644 --- a/spec/ruby/core/string/shared/chars.rb +++ b/spec/ruby/core/string/shared/chars.rb @@ -21,12 +21,12 @@ describe :string_chars, shared: true do end it "returns characters in the same encoding as self" do - "&%".force_encoding('Shift_JIS').send(@method).to_a.all? {|c| c.encoding.name.should == 'Shift_JIS'} + "&%".dup.force_encoding('Shift_JIS').send(@method).to_a.all? {|c| c.encoding.name.should == 'Shift_JIS'} "&%".encode('BINARY').send(@method).to_a.all? {|c| c.encoding.should == Encoding::BINARY } end it "works with multibyte characters" do - s = "\u{8987}".force_encoding("UTF-8") + s = "\u{8987}".dup.force_encoding("UTF-8") s.bytesize.should == 3 s.send(@method).to_a.should == [s] end @@ -39,14 +39,14 @@ describe :string_chars, shared: true do end it "returns a different character if the String is transcoded" do - s = "\u{20AC}".force_encoding('UTF-8') - s.encode('UTF-8').send(@method).to_a.should == ["\u{20AC}".force_encoding('UTF-8')] + s = "\u{20AC}".dup.force_encoding('UTF-8') + s.encode('UTF-8').send(@method).to_a.should == ["\u{20AC}".dup.force_encoding('UTF-8')] s.encode('iso-8859-15').send(@method).to_a.should == [[0xA4].pack('C').force_encoding('iso-8859-15')] - s.encode('iso-8859-15').encode('UTF-8').send(@method).to_a.should == ["\u{20AC}".force_encoding('UTF-8')] + s.encode('iso-8859-15').encode('UTF-8').send(@method).to_a.should == ["\u{20AC}".dup.force_encoding('UTF-8')] end it "uses the String's encoding to determine what characters it contains" do - s = "\u{24B62}" + s = +"\u{24B62}" s.force_encoding('UTF-8').send(@method).to_a.should == [ s.force_encoding('UTF-8') @@ -63,18 +63,4 @@ describe :string_chars, shared: true do [0xA2].pack('C').force_encoding('SJIS') ] end - - ruby_version_is ''...'2.7' do - it "taints resulting strings when self is tainted" do - str = "hello" - - str.send(@method) do |x| - x.should_not.tainted? - end - - str.dup.taint.send(@method) do |x| - x.should.tainted? - end - end - end end diff --git a/spec/ruby/core/string/shared/codepoints.rb b/spec/ruby/core/string/shared/codepoints.rb index 0b2e078e0a..f71263054a 100644 --- a/spec/ruby/core/string/shared/codepoints.rb +++ b/spec/ruby/core/string/shared/codepoints.rb @@ -7,7 +7,7 @@ describe :string_codepoints, shared: true do end it "raises an ArgumentError when self has an invalid encoding and a method is called on the returned Enumerator" do - s = "\xDF".force_encoding(Encoding::UTF_8) + s = "\xDF".dup.force_encoding(Encoding::UTF_8) s.valid_encoding?.should be_false -> { s.send(@method).to_a }.should raise_error(ArgumentError) end @@ -21,7 +21,7 @@ describe :string_codepoints, shared: true do end it "raises an ArgumentError if self's encoding is invalid and a block is given" do - s = "\xDF".force_encoding(Encoding::UTF_8) + s = "\xDF".dup.force_encoding(Encoding::UTF_8) s.valid_encoding?.should be_false -> { s.send(@method) { } }.should raise_error(ArgumentError) end @@ -49,7 +49,7 @@ describe :string_codepoints, shared: true do it "round-trips to the original String using Integer#chr" do s = "\u{13}\u{7711}\u{1010}" - s2 = "" + s2 = +"" s.send(@method) {|n| s2 << n.chr(Encoding::UTF_8)} s.should == s2 end diff --git a/spec/ruby/core/string/shared/concat.rb b/spec/ruby/core/string/shared/concat.rb index d6ffad7d4d..dded9a69e7 100644 --- a/spec/ruby/core/string/shared/concat.rb +++ b/spec/ruby/core/string/shared/concat.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false describe :string_concat, shared: true do it "concatenates the given argument to self and returns self" do str = 'hello ' @@ -5,18 +6,6 @@ describe :string_concat, shared: true do str.should == "hello world" end - it "converts the given argument to a String using to_str" do - obj = mock('world!') - obj.should_receive(:to_str).and_return("world!") - a = 'hello '.send(@method, obj) - a.should == 'hello world!' - end - - it "raises a TypeError if the given argument can't be converted to a String" do - -> { 'hello '.send(@method, []) }.should raise_error(TypeError) - -> { 'hello '.send(@method, mock('x')) }.should raise_error(TypeError) - end - it "raises a FrozenError when self is frozen" do a = "hello" a.freeze @@ -39,18 +28,6 @@ describe :string_concat, shared: true do str.should be_an_instance_of(StringSpecs::MyString) end - ruby_version_is ''...'2.7' do - it "taints self if other is tainted" do - "x".send(@method, "".taint).should.tainted? - "x".send(@method, "y".taint).should.tainted? - end - - it "untrusts self if other is untrusted" do - "x".send(@method, "".untrust).should.untrusted? - "x".send(@method, "y".untrust).should.untrusted? - end - end - describe "with Integer" do it "concatenates the argument interpreted as a codepoint" do b = "".send(@method, 33) @@ -160,3 +137,23 @@ describe :string_concat_encoding, shared: true do end end end + +describe :string_concat_type_coercion, shared: true do + it "converts the given argument to a String using to_str" do + obj = mock('world!') + obj.should_receive(:to_str).and_return("world!") + a = 'hello '.send(@method, obj) + a.should == 'hello world!' + end + + it "raises a TypeError if the given argument can't be converted to a String" do + -> { 'hello '.send(@method, []) }.should raise_error(TypeError) + -> { 'hello '.send(@method, mock('x')) }.should raise_error(TypeError) + end + + it "raises a NoMethodError if the given argument raises a NoMethodError during type coercion to a String" do + obj = mock('world!') + obj.should_receive(:to_str).and_raise(NoMethodError) + -> { 'hello '.send(@method, obj) }.should raise_error(NoMethodError) + end +end diff --git a/spec/ruby/core/string/shared/dedup.rb b/spec/ruby/core/string/shared/dedup.rb new file mode 100644 index 0000000000..97b5df6ed1 --- /dev/null +++ b/spec/ruby/core/string/shared/dedup.rb @@ -0,0 +1,56 @@ +# frozen_string_literal: false +describe :string_dedup, shared: true do + it 'returns self if the String is frozen' do + input = 'foo'.freeze + output = input.send(@method) + + output.should equal(input) + output.should.frozen? + end + + it 'returns a frozen copy if the String is not frozen' do + input = 'foo' + output = input.send(@method) + + output.should.frozen? + output.should_not equal(input) + output.should == 'foo' + end + + it "returns the same object for equal unfrozen strings" do + origin = "this is a string" + dynamic = %w(this is a string).join(' ') + + origin.should_not equal(dynamic) + origin.send(@method).should equal(dynamic.send(@method)) + end + + it "returns the same object when it's called on the same String literal" do + "unfrozen string".send(@method).should equal("unfrozen string".send(@method)) + "unfrozen string".send(@method).should_not equal("another unfrozen string".send(@method)) + end + + it "deduplicates frozen strings" do + dynamic = %w(this string is frozen).join(' ').freeze + + dynamic.should_not equal("this string is frozen".freeze) + + dynamic.send(@method).should equal("this string is frozen".freeze) + dynamic.send(@method).should equal("this string is frozen".send(@method).freeze) + end + + it "does not deduplicate a frozen string when it has instance variables" do + dynamic = %w(this string is frozen).join(' ') + dynamic.instance_variable_set(:@a, 1) + dynamic.freeze + + dynamic.send(@method).should_not equal("this string is frozen".freeze) + dynamic.send(@method).should_not equal("this string is frozen".send(@method).freeze) + dynamic.send(@method).should equal(dynamic) + end + + it "interns the provided string if it is frozen" do + dynamic = "this string is unique and frozen #{rand}".freeze + dynamic.send(@method).should equal(dynamic) + end +end diff --git a/spec/ruby/core/string/shared/each_codepoint_without_block.rb b/spec/ruby/core/string/shared/each_codepoint_without_block.rb index 92b7f76032..31b4c02c9c 100644 --- a/spec/ruby/core/string/shared/each_codepoint_without_block.rb +++ b/spec/ruby/core/string/shared/each_codepoint_without_block.rb @@ -6,7 +6,7 @@ describe :string_each_codepoint_without_block, shared: true do end it "returns an Enumerator even when self has an invalid encoding" do - s = "\xDF".force_encoding(Encoding::UTF_8) + s = "\xDF".dup.force_encoding(Encoding::UTF_8) s.valid_encoding?.should be_false s.send(@method).should be_an_instance_of(Enumerator) end @@ -23,7 +23,7 @@ describe :string_each_codepoint_without_block, shared: true do end it "should return the size of the string even when the string has an invalid encoding" do - s = "\xDF".force_encoding(Encoding::UTF_8) + s = "\xDF".dup.force_encoding(Encoding::UTF_8) s.valid_encoding?.should be_false s.send(@method).size.should == 1 end diff --git a/spec/ruby/core/string/shared/each_line.rb b/spec/ruby/core/string/shared/each_line.rb index f9c910596a..231a6d9d4f 100644 --- a/spec/ruby/core/string/shared/each_line.rb +++ b/spec/ruby/core/string/shared/each_line.rb @@ -40,14 +40,6 @@ describe :string_each_line, shared: true do b.should == ["foo\n", "🤡🤡🤡🤡🤡🤡🤡\n", "bar\n", "baz\n"] end - ruby_version_is ''...'2.7' do - it "taints substrings that are passed to the block if self is tainted" do - "one\ntwo\r\nthree".taint.send(@method) { |s| s.should.tainted? } - - "x.y.".send(@method, ".".taint) { |s| s.should_not.tainted? } - end - end - it "passes self as a whole to the block if the separator is nil" do a = [] "one\ntwo\r\nthree".send(@method, nil) { |s| a << s } @@ -93,20 +85,10 @@ describe :string_each_line, shared: true do end end - ruby_version_is ''...'3.0' do - it "yields subclass instances for subclasses" do - a = [] - StringSpecs::MyString.new("hello\nworld").send(@method) { |s| a << s.class } - a.should == [StringSpecs::MyString, StringSpecs::MyString] - end - end - - ruby_version_is '3.0' do - it "yields String instances for subclasses" do - a = [] - StringSpecs::MyString.new("hello\nworld").send(@method) { |s| a << s.class } - a.should == [String, String] - end + it "yields String instances for subclasses" do + a = [] + StringSpecs::MyString.new("hello\nworld").send(@method) { |s| a << s.class } + a.should == [String, String] end it "returns self" do @@ -124,12 +106,18 @@ describe :string_each_line, shared: true do end it "does not care if the string is modified while substituting" do - str = "hello\nworld." + str = +"hello\nworld." out = [] str.send(@method){|x| out << x; str[-1] = '!' }.should == "hello\nworld!" out.should == ["hello\n", "world."] end + it "returns Strings in the same encoding as self" do + "one\ntwo\r\nthree".encode("US-ASCII").send(@method) do |s| + s.encoding.should == Encoding::US_ASCII + end + end + it "raises a TypeError when the separator can't be converted to a string" do -> { "hello world".send(@method, false) {} }.should raise_error(TypeError) -> { "hello world".send(@method, mock('x')) {} }.should raise_error(TypeError) diff --git a/spec/ruby/core/string/shared/encode.rb b/spec/ruby/core/string/shared/encode.rb index a73de5b943..3776e0d709 100644 --- a/spec/ruby/core/string/shared/encode.rb +++ b/spec/ruby/core/string/shared/encode.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false describe :string_encode, shared: true do describe "when passed no options" do it "transcodes to Encoding.default_internal when set" do diff --git a/spec/ruby/core/string/shared/eql.rb b/spec/ruby/core/string/shared/eql.rb index 85b861f4f1..845b0a3e15 100644 --- a/spec/ruby/core/string/shared/eql.rb +++ b/spec/ruby/core/string/shared/eql.rb @@ -13,15 +13,15 @@ describe :string_eql_value, shared: true do end it "ignores encoding difference of compatible string" do - "hello".force_encoding("utf-8").send(@method, "hello".force_encoding("iso-8859-1")).should be_true + "hello".dup.force_encoding("utf-8").send(@method, "hello".dup.force_encoding("iso-8859-1")).should be_true end it "considers encoding difference of incompatible string" do - "\xff".force_encoding("utf-8").send(@method, "\xff".force_encoding("iso-8859-1")).should be_false + "\xff".dup.force_encoding("utf-8").send(@method, "\xff".dup.force_encoding("iso-8859-1")).should be_false end it "considers encoding compatibility" do - "hello".force_encoding("utf-8").send(@method, "hello".force_encoding("utf-32le")).should be_false + "abcd".dup.force_encoding("utf-8").send(@method, "abcd".dup.force_encoding("utf-32le")).should be_false end it "ignores subclass differences" do @@ -31,4 +31,8 @@ describe :string_eql_value, shared: true do a.send(@method, b).should be_true b.send(@method, a).should be_true end + + it "returns true when comparing 2 empty strings but one is not ASCII-compatible" do + "".send(@method, "".dup.force_encoding('iso-2022-jp')).should == true + end end diff --git a/spec/ruby/core/string/shared/length.rb b/spec/ruby/core/string/shared/length.rb index b9eae5170f..ae572ba755 100644 --- a/spec/ruby/core/string/shared/length.rb +++ b/spec/ruby/core/string/shared/length.rb @@ -12,13 +12,13 @@ describe :string_length, shared: true do it "returns the length of a string in different encodings" do utf8_str = 'ã“ã«ã¡ã‚' * 100 - utf8_str.size.should == 400 - utf8_str.encode(Encoding::UTF_32BE).size.should == 400 - utf8_str.encode(Encoding::SHIFT_JIS).size.should == 400 + utf8_str.send(@method).should == 400 + utf8_str.encode(Encoding::UTF_32BE).send(@method).should == 400 + utf8_str.encode(Encoding::SHIFT_JIS).send(@method).should == 400 end it "returns the length of the new self after encoding is changed" do - str = 'ã“ã«ã¡ã‚' + str = +'ã“ã«ã¡ã‚' str.send(@method) str.force_encoding('BINARY').send(@method).should == 12 @@ -32,8 +32,24 @@ describe :string_length, shared: true do concat.encoding.should == Encoding::UTF_8 concat.bytesize.should == 4 - concat.size.should == 2 + concat.send(@method).should == 2 concat.force_encoding(Encoding::ASCII_8BIT) - concat.size.should == 4 + concat.send(@method).should == 4 + end + + it "adds 1 for every invalid byte in UTF-8" do + "\xF4\x90\x80\x80".send(@method).should == 4 + "a\xF4\x90\x80\x80b".send(@method).should == 6 + "é\xF4\x90\x80\x80è".send(@method).should == 6 + end + + it "adds 1 (and not 2) for a incomplete surrogate in UTF-16" do + "\x00\xd8".dup.force_encoding("UTF-16LE").send(@method).should == 1 + "\xd8\x00".dup.force_encoding("UTF-16BE").send(@method).should == 1 + end + + it "adds 1 for a broken sequence in UTF-32" do + "\x04\x03\x02\x01".dup.force_encoding("UTF-32LE").send(@method).should == 1 + "\x01\x02\x03\x04".dup.force_encoding("UTF-32BE").send(@method).should == 1 end end diff --git a/spec/ruby/core/string/shared/partition.rb b/spec/ruby/core/string/shared/partition.rb new file mode 100644 index 0000000000..4cac149ce5 --- /dev/null +++ b/spec/ruby/core/string/shared/partition.rb @@ -0,0 +1,33 @@ +require_relative '../../../spec_helper' +require_relative '../fixtures/classes' + +describe :string_partition, shared: true do + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("hello").send(@method, "l").each do |item| + item.should be_an_instance_of(String) + end + + StringSpecs::MyString.new("hello").send(@method, "x").each do |item| + item.should be_an_instance_of(String) + end + + StringSpecs::MyString.new("hello").send(@method, /l./).each do |item| + item.should be_an_instance_of(String) + end + end + + it "returns before- and after- parts in the same encoding as self" do + strings = "hello".encode("US-ASCII").send(@method, "ello") + strings[0].encoding.should == Encoding::US_ASCII + strings[2].encoding.should == Encoding::US_ASCII + + strings = "hello".encode("US-ASCII").send(@method, /ello/) + strings[0].encoding.should == Encoding::US_ASCII + strings[2].encoding.should == Encoding::US_ASCII + end + + it "returns the matching part in the separator's encoding" do + strings = "hello".encode("US-ASCII").send(@method, "ello") + strings[1].encoding.should == Encoding::UTF_8 + end +end diff --git a/spec/ruby/core/string/shared/replace.rb b/spec/ruby/core/string/shared/replace.rb index 8dfac49f02..24dac0eb27 100644 --- a/spec/ruby/core/string/shared/replace.rb +++ b/spec/ruby/core/string/shared/replace.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false describe :string_replace, shared: true do it "returns self" do a = "a" @@ -10,36 +11,6 @@ describe :string_replace, shared: true do a.should == "another string" end - ruby_version_is ''...'2.7' do - it "taints self if other is tainted" do - a = "" - b = "".taint - a.send(@method, b) - a.should.tainted? - end - - it "does not untaint self if other is untainted" do - a = "".taint - b = "" - a.send(@method, b) - a.should.tainted? - end - - it "untrusts self if other is untrusted" do - a = "" - b = "".untrust - a.send(@method, b) - a.should.untrusted? - end - - it "does not trust self if other is trusted" do - a = "".untrust - b = "" - a.send(@method, b) - a.should.untrusted? - end - end - it "replaces the encoding of self with that of other" do a = "".encode("UTF-16LE") b = "".encode("UTF-8") diff --git a/spec/ruby/core/string/shared/slice.rb b/spec/ruby/core/string/shared/slice.rb index 1db8fd6730..2f69b9ddce 100644 --- a/spec/ruby/core/string/shared/slice.rb +++ b/spec/ruby/core/string/shared/slice.rb @@ -80,23 +80,12 @@ describe :string_slice_index_length, shared: true do "hello there".send(@method, -3,2).should == "er" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self is tainted" do - str = "hello world" - str.taint - - str.send(@method, 0,0).should.tainted? - str.send(@method, 0,1).should.tainted? - str.send(@method, 2,1).should.tainted? - end - end - - it "returns a string with the same encoding" do + it "returns a string with the same encoding as self" do s = "hello there" s.send(@method, 1, 9).encoding.should == s.encoding - a = "hello".force_encoding("binary") - b = " there".force_encoding("ISO-8859-1") + a = "hello".dup.force_encoding("binary") + b = " there".dup.force_encoding("ISO-8859-1") c = (a + b).force_encoding(Encoding::US_ASCII) c.send(@method, 0, 5).encoding.should == Encoding::US_ASCII @@ -163,22 +152,11 @@ describe :string_slice_index_length, shared: true do -> { "hello".send(@method, 0, bignum_value) }.should raise_error(RangeError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, 0,0).should be_an_instance_of(StringSpecs::MyString) - s.send(@method, 0,4).should be_an_instance_of(StringSpecs::MyString) - s.send(@method, 1,4).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, 0,0).should be_an_instance_of(String) - s.send(@method, 0,4).should be_an_instance_of(String) - s.send(@method, 1,4).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.send(@method, 0,0).should be_an_instance_of(String) + s.send(@method, 0,4).should be_an_instance_of(String) + s.send(@method, 1,4).should be_an_instance_of(String) end it "handles repeated application" do @@ -217,6 +195,10 @@ describe :string_slice_range, shared: true do "x".send(@method, 1..-1).should == "" end + it "returns a String in the same encoding as self" do + "hello there".encode("US-ASCII").send(@method, 1..1).encoding.should == Encoding::US_ASCII + end + it "returns nil if the beginning of the range falls outside of self" do "hello there".send(@method, 12..-1).should == nil "hello there".send(@method, 20..25).should == nil @@ -249,36 +231,11 @@ describe :string_slice_range, shared: true do "x".send(@method, 1...-1).should == "" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self is tainted" do - str = "hello world" - str.taint - - str.send(@method, 0..0).should.tainted? - str.send(@method, 0...0).should.tainted? - str.send(@method, 0..1).should.tainted? - str.send(@method, 0...1).should.tainted? - str.send(@method, 2..3).should.tainted? - str.send(@method, 2..0).should.tainted? - end - end - - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, 0...0).should be_an_instance_of(StringSpecs::MyString) - s.send(@method, 0..4).should be_an_instance_of(StringSpecs::MyString) - s.send(@method, 1..4).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, 0...0).should be_an_instance_of(String) - s.send(@method, 0..4).should be_an_instance_of(String) - s.send(@method, 1..4).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.send(@method, 0...0).should be_an_instance_of(String) + s.send(@method, 0..4).should be_an_instance_of(String) + s.send(@method, 1..4).should be_an_instance_of(String) end it "calls to_int on range arguments" do @@ -334,14 +291,12 @@ describe :string_slice_range, shared: true do "hello there".send(@method, eval("(-4...)")).should == "here" end - ruby_version_is "2.7" do - it "works with beginless ranges" do - "hello there".send(@method, eval("(..5)")).should == "hello " - "hello there".send(@method, eval("(...5)")).should == "hello" - "hello there".send(@method, eval("(..-4)")).should == "hello th" - "hello there".send(@method, eval("(...-4)")).should == "hello t" - "hello there".send(@method, eval("(...nil)")).should == "hello there" - end + it "works with beginless ranges" do + "hello there".send(@method, (..5)).should == "hello " + "hello there".send(@method, (...5)).should == "hello" + "hello there".send(@method, (..-4)).should == "hello th" + "hello there".send(@method, (...-4)).should == "hello t" + "hello there".send(@method, (...nil)).should == "hello there" end end @@ -355,43 +310,14 @@ describe :string_slice_regexp, shared: true do "hello there".send(@method, /xyz/).should == nil end - not_supported_on :opal do - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self or regexp is tainted" do - strs = ["hello world"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - str.send(@method, //).tainted?.should == str.tainted? - str.send(@method, /hello/).tainted?.should == str.tainted? - - tainted_re = /./ - tainted_re.taint - - str.send(@method, tainted_re).should.tainted? - end - end - - it "returns an untrusted string if the regexp is untrusted" do - "hello".send(@method, /./.untrust).untrusted?.should be_true - end - end - end - - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, //).should be_an_instance_of(StringSpecs::MyString) - s.send(@method, /../).should be_an_instance_of(StringSpecs::MyString) - end + it "returns a String in the same encoding as self" do + "hello there".encode("US-ASCII").send(@method, /[aeiou](.)\1/).encoding.should == Encoding::US_ASCII end - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, //).should be_an_instance_of(String) - s.send(@method, /../).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.send(@method, //).should be_an_instance_of(String) + s.send(@method, /../).should be_an_instance_of(String) end it "sets $~ to MatchData when there is a match and nil when there's none" do @@ -418,44 +344,28 @@ describe :string_slice_regexp_index, shared: true do "har".send(@method, /(.)(.)(.)/, -3).should == "h" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self or regexp is tainted" do - strs = ["hello world"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - str.send(@method, //, 0).tainted?.should == str.tainted? - str.send(@method, /hello/, 0).tainted?.should == str.tainted? - - str.send(@method, /(.)(.)(.)/, 0).tainted?.should == str.tainted? - str.send(@method, /(.)(.)(.)/, 1).tainted?.should == str.tainted? - str.send(@method, /(.)(.)(.)/, -1).tainted?.should == str.tainted? - str.send(@method, /(.)(.)(.)/, -2).tainted?.should == str.tainted? - - tainted_re = /(.)(.)(.)/ - tainted_re.taint - - str.send(@method, tainted_re, 0).should.tainted? - str.send(@method, tainted_re, 1).should.tainted? - str.send(@method, tainted_re, -1).should.tainted? - end - end - - not_supported_on :opal do - it "returns an untrusted string if the regexp is untrusted" do - "hello".send(@method, /(.)/.untrust, 1).untrusted?.should be_true - end - end - end - it "returns nil if there is no match" do "hello there".send(@method, /(what?)/, 1).should == nil end + it "returns nil if the index is larger than the number of captures" do + "hello there".send(@method, /hello (.)/, 2).should == nil + # You can't refer to 0 using negative indices + "hello there".send(@method, /hello (.)/, -2).should == nil + end + it "returns nil if there is no capture for the given index" do "hello there".send(@method, /[aeiou](.)\1/, 2).should == nil - # You can't refer to 0 using negative indices - "hello there".send(@method, /[aeiou](.)\1/, -2).should == nil + end + + it "returns nil if the given capture group was not matched but still sets $~" do + "test".send(@method, /te(z)?/, 1).should == nil + $~[0].should == "te" + $~[1].should == nil + end + + it "returns a String in the same encoding as self" do + "hello there".encode("US-ASCII").send(@method, /[aeiou](.)\1/, 0).encoding.should == Encoding::US_ASCII end it "calls to_int on the given index" do @@ -476,20 +386,10 @@ describe :string_slice_regexp_index, shared: true do -> { "hello".send(@method, /(.)(.)(.)/, nil) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, /(.)(.)/, 0).should be_an_instance_of(StringSpecs::MyString) - s.send(@method, /(.)(.)/, 1).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, /(.)(.)/, 0).should be_an_instance_of(String) - s.send(@method, /(.)(.)/, 1).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.send(@method, /(.)(.)/, 0).should be_an_instance_of(String) + s.send(@method, /(.)(.)/, 1).should be_an_instance_of(String) end it "sets $~ to MatchData when there is a match and nil when there's none" do @@ -510,21 +410,6 @@ describe :string_slice_string, shared: true do "hello there".send(@method, s).should == s end - ruby_version_is ''...'2.7' do - it "taints resulting strings when other is tainted" do - strs = ["", "hello world", "hello"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - strs.each do |other| - r = str.send(@method, other) - - r.tainted?.should == !r.nil? & other.tainted? - end - end - end - end - it "doesn't set $~" do $~ = nil @@ -543,22 +428,11 @@ describe :string_slice_string, shared: true do -> { "hello".send(@method, o) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns a subclass instance when given a subclass instance" do - s = StringSpecs::MyString.new("el") - r = "hello".send(@method, s) - r.should == "el" - r.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns a String instance when given a subclass instance" do - s = StringSpecs::MyString.new("el") - r = "hello".send(@method, s) - r.should == "el" - r.should be_an_instance_of(String) - end + it "returns a String instance when given a subclass instance" do + s = StringSpecs::MyString.new("el") + r = "hello".send(@method, s) + r.should == "el" + r.should be_an_instance_of(String) end end @@ -584,30 +458,6 @@ describe :string_slice_regexp_group, shared: true do "hello there".send(@method, /(?<g>h(?<g>.))/, 'g').should == "e" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self or regexp is tainted" do - strs = ["hello world"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - str.send(@method, /(?<hi>hello)/, 'hi').tainted?.should == str.tainted? - - str.send(@method, /(?<g>(.)(.)(.))/, 'g').tainted?.should == str.tainted? - str.send(@method, /(?<h>.)(.)(.)/, 'h').tainted?.should == str.tainted? - str.send(@method, /(.)(?<a>.)(.)/, 'a').tainted?.should == str.tainted? - str.send(@method, /(.)(.)(?<r>.)/, 'r').tainted?.should == str.tainted? - str.send(@method, /(?<h>.)(?<a>.)(?<r>.)/, 'r').tainted?.should == str.tainted? - - tainted_re = /(?<a>.)(?<b>.)(?<c>.)/ - tainted_re.taint - - str.send(@method, tainted_re, 'a').tainted?.should be_true - str.send(@method, tainted_re, 'b').tainted?.should be_true - str.send(@method, tainted_re, 'c').tainted?.should be_true - end - end - end - it "returns nil if there is no match" do "hello there".send(@method, /(?<whut>what?)/, 'whut').should be_nil end @@ -628,18 +478,9 @@ describe :string_slice_regexp_group, shared: true do -> { "hello".send(@method, /(?<q>)/, '') }.should raise_error(IndexError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, /(?<q>.)/, 'q').should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.send(@method, /(?<q>.)/, 'q').should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.send(@method, /(?<q>.)/, 'q').should be_an_instance_of(String) end it "sets $~ to MatchData when there is a match and nil when there's none" do diff --git a/spec/ruby/core/string/shared/strip.rb b/spec/ruby/core/string/shared/strip.rb new file mode 100644 index 0000000000..3af77b50fe --- /dev/null +++ b/spec/ruby/core/string/shared/strip.rb @@ -0,0 +1,14 @@ +require_relative '../../../spec_helper' +require_relative '../fixtures/classes' + +describe :string_strip, shared: true do + it "returns a String in the same encoding as self" do + " hello ".encode("US-ASCII").send(@method).encoding.should == Encoding::US_ASCII + end + + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new(" hello ").send(@method).should be_an_instance_of(String) + StringSpecs::MyString.new(" ").send(@method).should be_an_instance_of(String) + StringSpecs::MyString.new("").send(@method).should be_an_instance_of(String) + end +end diff --git a/spec/ruby/core/string/shared/succ.rb b/spec/ruby/core/string/shared/succ.rb index 25602103b6..b69a394875 100644 --- a/spec/ruby/core/string/shared/succ.rb +++ b/spec/ruby/core/string/shared/succ.rb @@ -59,34 +59,21 @@ describe :string_succ, shared: true do "\xFF\xFF".send(@method).should == "\x01\x00\x00" end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("").send(@method).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("a").send(@method).should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("z").send(@method).should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("").send(@method).should be_an_instance_of(String) + StringSpecs::MyString.new("a").send(@method).should be_an_instance_of(String) + StringSpecs::MyString.new("z").send(@method).should be_an_instance_of(String) end - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("").send(@method).should be_an_instance_of(String) - StringSpecs::MyString.new("a").send(@method).should be_an_instance_of(String) - StringSpecs::MyString.new("z").send(@method).should be_an_instance_of(String) - end - end - - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - ["", "a", "z", "Z", "9", "\xFF", "\xFF\xFF"].each do |s| - s.taint.send(@method).should.tainted? - end - end + it "returns a String in the same encoding as self" do + "z".encode("US-ASCII").send(@method).encoding.should == Encoding::US_ASCII end end describe :string_succ_bang, shared: true do it "is equivalent to succ, but modifies self in place (still returns self)" do ["", "abcd", "THX1138"].each do |s| + s = +s r = s.dup.send(@method) s.send(@method).should equal(s) s.should == r diff --git a/spec/ruby/core/string/shared/to_a.rb b/spec/ruby/core/string/shared/to_a.rb deleted file mode 100644 index bad3ea6584..0000000000 --- a/spec/ruby/core/string/shared/to_a.rb +++ /dev/null @@ -1,9 +0,0 @@ -describe :string_to_a, shared: true do - it "returns an empty array for empty strings" do - "".send(@method).should == [] - end - - it "returns an array containing the string for non-empty strings" do - "hello".send(@method).should == ["hello"] - end -end diff --git a/spec/ruby/core/string/shared/to_s.rb b/spec/ruby/core/string/shared/to_s.rb index b8c9b8ab44..4b87a6cbe1 100644 --- a/spec/ruby/core/string/shared/to_s.rb +++ b/spec/ruby/core/string/shared/to_s.rb @@ -10,11 +10,4 @@ describe :string_to_s, shared: true do s.should == "a string" s.should be_an_instance_of(String) end - - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - "x".taint.send(@method).should.tainted? - StringSpecs::MyString.new("x").taint.send(@method).should.tainted? - end - end end diff --git a/spec/ruby/core/string/shared/to_sym.rb b/spec/ruby/core/string/shared/to_sym.rb index 416f302aef..833eae100e 100644 --- a/spec/ruby/core/string/shared/to_sym.rb +++ b/spec/ruby/core/string/shared/to_sym.rb @@ -53,11 +53,20 @@ describe :string_to_sym, shared: true do sym.to_s.should == binary_string end + it "ignores existing symbols with different encoding" do + source = "fée" + + iso_symbol = source.dup.force_encoding(Encoding::ISO_8859_1).send(@method) + iso_symbol.encoding.should == Encoding::ISO_8859_1 + binary_symbol = source.dup.force_encoding(Encoding::BINARY).send(@method) + binary_symbol.encoding.should == Encoding::BINARY + end + it "raises an EncodingError for UTF-8 String containing invalid bytes" do invalid_utf8 = "\xC3" invalid_utf8.should_not.valid_encoding? -> { invalid_utf8.send(@method) - }.should raise_error(EncodingError, /invalid/) + }.should raise_error(EncodingError, 'invalid symbol in encoding UTF-8 :"\xC3"') end end diff --git a/spec/ruby/core/string/slice_spec.rb b/spec/ruby/core/string/slice_spec.rb index 83b475c8b5..5aba2d3be0 100644 --- a/spec/ruby/core/string/slice_spec.rb +++ b/spec/ruby/core/string/slice_spec.rb @@ -1,5 +1,5 @@ # -*- encoding: utf-8 -*- - +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative 'shared/slice' @@ -94,16 +94,6 @@ describe "String#slice! with index, length" do a.should == "h" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self is tainted" do - str = "hello world" - str.taint - - str.slice!(0, 0).should.tainted? - str.slice!(2, 1).should.tainted? - end - end - it "returns nil if the given position is out of self" do a = "hello" a.slice(10, 3).should == nil @@ -142,20 +132,10 @@ describe "String#slice! with index, length" do "hello".slice!(obj, obj).should == "ll" end - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(0, 0).should be_an_instance_of(StringSpecs::MyString) - s.slice!(0, 4).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(0, 0).should be_an_instance_of(String) - s.slice!(0, 4).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.slice!(0, 0).should be_an_instance_of(String) + s.slice!(0, 4).should be_an_instance_of(String) end it "returns the substring given by the character offsets" do @@ -195,30 +175,10 @@ describe "String#slice! Range" do b.should == "hello" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self is tainted" do - str = "hello world" - str.taint - - str.slice!(0..0).should.tainted? - str.slice!(2..3).should.tainted? - end - end - - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(0...0).should be_an_instance_of(StringSpecs::MyString) - s.slice!(0..4).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(0...0).should be_an_instance_of(String) - s.slice!(0..4).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.slice!(0...0).should be_an_instance_of(String) + s.slice!(0..4).should be_an_instance_of(String) end it "calls to_int on range arguments" do @@ -294,44 +254,10 @@ describe "String#slice! with Regexp" do s.should == "this is a string" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self or regexp is tainted" do - strs = ["hello world"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - str = str.dup - str.slice!(//).tainted?.should == str.tainted? - str.slice!(/hello/).tainted?.should == str.tainted? - - tainted_re = /./ - tainted_re.taint - - str.slice!(tainted_re).should.tainted? - end - end - - it "doesn't taint self when regexp is tainted" do - s = "hello" - s.slice!(/./.taint) - s.should_not.tainted? - end - end - - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(//).should be_an_instance_of(StringSpecs::MyString) - s.slice!(/../).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(//).should be_an_instance_of(String) - s.slice!(/../).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.slice!(//).should be_an_instance_of(String) + s.slice!(/../).should be_an_instance_of(String) end it "returns the matching portion of self with a multi byte character" do @@ -365,30 +291,6 @@ describe "String#slice! with Regexp, index" do str.should == "ho here" end - ruby_version_is ''...'2.7' do - it "always taints resulting strings when self or regexp is tainted" do - strs = ["hello world"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - str = str.dup - str.slice!(//, 0).tainted?.should == str.tainted? - str.slice!(/hello/, 0).tainted?.should == str.tainted? - - tainted_re = /(.)(.)(.)/ - tainted_re.taint - - str.slice!(tainted_re, 1).should.tainted? - end - end - - it "doesn't taint self when regexp is tainted" do - s = "hello" - s.slice!(/(.)(.)/.taint, 1) - s.should_not.tainted? - end - end - it "returns nil if there was no match" do s = "this is a string" s.slice!(/x(zzz)/, 1).should == nil @@ -412,20 +314,10 @@ describe "String#slice! with Regexp, index" do "har".slice!(/(.)(.)(.)/, obj).should == "a" end - ruby_version_is ''...'3.0' do - it "returns subclass instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(/(.)(.)/, 0).should be_an_instance_of(StringSpecs::MyString) - s.slice!(/(.)(.)/, 1).should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances" do - s = StringSpecs::MyString.new("hello") - s.slice!(/(.)(.)/, 0).should be_an_instance_of(String) - s.slice!(/(.)(.)/, 1).should be_an_instance_of(String) - end + it "returns String instances" do + s = StringSpecs::MyString.new("hello") + s.slice!(/(.)(.)/, 0).should be_an_instance_of(String) + s.slice!(/(.)(.)/, 1).should be_an_instance_of(String) end it "returns the encoding aware capture for the given index" do @@ -463,23 +355,6 @@ describe "String#slice! with String" do c.should == "he hello" end - ruby_version_is ''...'2.7' do - it "taints resulting strings when other is tainted" do - strs = ["", "hello world", "hello"] - strs += strs.map { |s| s.dup.taint } - - strs.each do |str| - str = str.dup - strs.each do |other| - other = other.dup - r = str.slice!(other) - - r.tainted?.should == !r.nil? & other.tainted? - end - end - end - end - it "doesn't set $~" do $~ = nil @@ -500,22 +375,11 @@ describe "String#slice! with String" do -> { "hello".slice!(o) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns a subclass instance when given a subclass instance" do - s = StringSpecs::MyString.new("el") - r = "hello".slice!(s) - r.should == "el" - r.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns a subclass instance when given a subclass instance" do - s = StringSpecs::MyString.new("el") - r = "hello".slice!(s) - r.should == "el" - r.should be_an_instance_of(String) - end + it "returns a subclass instance when given a subclass instance" do + s = StringSpecs::MyString.new("el") + r = "hello".slice!(s) + r.should == "el" + r.should be_an_instance_of(String) end it "raises a FrozenError if self is frozen" do diff --git a/spec/ruby/core/string/split_spec.rb b/spec/ruby/core/string/split_spec.rb index a373be360d..3c6d1864d1 100644 --- a/spec/ruby/core/string/split_spec.rb +++ b/spec/ruby/core/string/split_spec.rb @@ -3,12 +3,17 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "String#split with String" do + it "throws an ArgumentError if the string is not a valid" do + s = "\xDF".dup.force_encoding(Encoding::UTF_8) + + -> { s.split }.should raise_error(ArgumentError) + -> { s.split(':') }.should raise_error(ArgumentError) + end + it "throws an ArgumentError if the pattern is not a valid string" do str = 'проверка' - broken_str = 'проверка' - broken_str.force_encoding('binary') - broken_str.chop! - broken_str.force_encoding('utf-8') + broken_str = "\xDF".dup.force_encoding(Encoding::UTF_8) + -> { str.split(broken_str) }.should raise_error(ArgumentError) end @@ -24,9 +29,35 @@ describe "String#split with String" do "1,2,,3,4,,".split(',').should == ["1", "2", "", "3", "4"] "1,2,,3,4,,".split(',', 0).should == ["1", "2", "", "3", "4"] " a b c\nd ".split(" ").should == ["", "a", "b", "c\nd"] + " a ã‚ c\nd ".split(" ").should == ["", "a", "ã‚", "c\nd"] "hai".split("hai").should == [] ",".split(",").should == [] ",".split(",", 0).should == [] + "ã‚".split("ã‚").should == [] + "ã‚".split("ã‚", 0).should == [] + end + + it "does not suppress trailing empty fields when a positive limit is given" do + " 1 2 ".split(" ", 2).should == ["1", "2 "] + " 1 2 ".split(" ", 3).should == ["1", "2", ""] + " 1 2 ".split(" ", 4).should == ["1", "2", ""] + " 1 ã‚ ".split(" ", 2).should == ["1", "ã‚ "] + " 1 ã‚ ".split(" ", 3).should == ["1", "ã‚", ""] + " 1 ã‚ ".split(" ", 4).should == ["1", "ã‚", ""] + + "1,2,".split(',', 2).should == ["1", "2,"] + "1,2,".split(',', 3).should == ["1", "2", ""] + "1,2,".split(',', 4).should == ["1", "2", ""] + "1,ã‚,".split(',', 2).should == ["1", "ã‚,"] + "1,ã‚,".split(',', 3).should == ["1", "ã‚", ""] + "1,ã‚,".split(',', 4).should == ["1", "ã‚", ""] + + "1 2 ".split(/ /, 2).should == ["1", "2 "] + "1 2 ".split(/ /, 3).should == ["1", "2", ""] + "1 2 ".split(/ /, 4).should == ["1", "2", ""] + "1 ã‚ ".split(/ /, 2).should == ["1", "ã‚ "] + "1 ã‚ ".split(/ /, 3).should == ["1", "ã‚", ""] + "1 ã‚ ".split(/ /, 4).should == ["1", "ã‚", ""] end it "returns an array with one entry if limit is 1: the original string" do @@ -62,6 +93,10 @@ describe "String#split with String" do ",".split(",", -1).should == ["", ""] end + it "raises a RangeError when the limit is larger than int" do + -> { "a,b".split(" ", 2147483649) }.should raise_error(RangeError) + end + it "defaults to $; when string isn't given or nil" do suppress_warning do old_fs = $; @@ -85,21 +120,19 @@ describe "String#split with String" do end end - ruby_version_is "2.7" do - context "when $; is not nil" do - before do - suppress_warning do - @old_value, $; = $;, 'foobar' - end + context "when $; is not nil" do + before do + suppress_warning do + @old_value, $; = $;, 'foobar' end + end - after do - $; = @old_value - end + after do + $; = @old_value + end - it "warns" do - -> { "".split }.should complain(/warning: \$; is set to non-nil value/) - end + it "warns" do + -> { "".split }.should complain(/warning: \$; is set to non-nil value/) end end end @@ -159,70 +192,48 @@ describe "String#split with String" do "foo".split("bar", 3).should == ["foo"] end - ruby_version_is ''...'3.0' do - it "returns subclass instances based on self" do - ["", "x.y.z.", " x y "].each do |str| - ["", ".", " "].each do |pat| - [-1, 0, 1, 2].each do |limit| - StringSpecs::MyString.new(str).split(pat, limit).each do |x| - x.should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances based on self" do + ["", "x.y.z.", " x y "].each do |str| + ["", ".", " "].each do |pat| + [-1, 0, 1, 2].each do |limit| + StringSpecs::MyString.new(str).split(pat, limit).each do |x| + x.should be_an_instance_of(String) + end - str.split(StringSpecs::MyString.new(pat), limit).each do |x| - x.should be_an_instance_of(String) - end + str.split(StringSpecs::MyString.new(pat), limit).each do |x| + x.should be_an_instance_of(String) end end end end - - it "does not call constructor on created subclass instances" do - # can't call should_not_receive on an object that doesn't yet exist - # so failure here is signalled by exception, not expectation failure - - s = StringSpecs::StringWithRaisingConstructor.new('silly:string') - s.split(':').first.should == 'silly' - end end - ruby_version_is '3.0' do - it "returns String instances based on self" do - ["", "x.y.z.", " x y "].each do |str| - ["", ".", " "].each do |pat| - [-1, 0, 1, 2].each do |limit| - StringSpecs::MyString.new(str).split(pat, limit).each do |x| - x.should be_an_instance_of(String) - end + it "returns an empty array when whitespace is split on whitespace" do + " ".split(" ").should == [] + " \n ".split(" ").should == [] + " ".split(" ").should == [] + " \t ".split(" ").should == [] + end - str.split(StringSpecs::MyString.new(pat), limit).each do |x| - x.should be_an_instance_of(String) - end - end - end - end - end + it "doesn't split on non-ascii whitespace" do + "a\u{2008}b".split(" ").should == ["a\u{2008}b"] end - ruby_version_is ''...'2.7' do - it "taints the resulting strings if self is tainted" do - ["", "x.y.z.", " x y "].each do |str| - ["", ".", " "].each do |pat| - [-1, 0, 1, 2].each do |limit| - str.dup.taint.split(pat).each do |x| - x.should.tainted? - end + it "returns Strings in the same encoding as self" do + strings = "hello world".encode("US-ASCII").split(" ") - str.split(pat.dup.taint).each do |x| - x.should_not.tainted? - end - end - end - end - end + strings[0].encoding.should == Encoding::US_ASCII + strings[1].encoding.should == Encoding::US_ASCII end end describe "String#split with Regexp" do + it "throws an ArgumentError if the string is not a valid" do + s = "\xDF".dup.force_encoding(Encoding::UTF_8) + + -> { s.split(/./) }.should raise_error(ArgumentError) + end + it "divides self on regexp matches" do " now's the time".split(/ /).should == ["", "now's", "", "the", "time"] " x\ny ".split(/ /).should == ["", "x\ny"] @@ -375,86 +386,30 @@ describe "String#split with Regexp" do "foo".split(/bar/, 3).should == ["foo"] end - ruby_version_is ''...'3.0' do - it "returns subclass instances based on self" do - ["", "x:y:z:", " x y "].each do |str| - [//, /:/, /\s+/].each do |pat| - [-1, 0, 1, 2].each do |limit| - StringSpecs::MyString.new(str).split(pat, limit).each do |x| - x.should be_an_instance_of(StringSpecs::MyString) - end + it "returns String instances based on self" do + ["", "x:y:z:", " x y "].each do |str| + [//, /:/, /\s+/].each do |pat| + [-1, 0, 1, 2].each do |limit| + StringSpecs::MyString.new(str).split(pat, limit).each do |x| + x.should be_an_instance_of(String) end end end end - - it "does not call constructor on created subclass instances" do - # can't call should_not_receive on an object that doesn't yet exist - # so failure here is signalled by exception, not expectation failure - - s = StringSpecs::StringWithRaisingConstructor.new('silly:string') - s.split(/:/).first.should == 'silly' - end end - ruby_version_is '3.0' do - it "returns String instances based on self" do - ["", "x:y:z:", " x y "].each do |str| - [//, /:/, /\s+/].each do |pat| - [-1, 0, 1, 2].each do |limit| - StringSpecs::MyString.new(str).split(pat, limit).each do |x| - x.should be_an_instance_of(String) - end - end - end - end - end - end - - ruby_version_is ''...'2.7' do - it "taints the resulting strings if self is tainted" do - ["", "x:y:z:", " x y "].each do |str| - [//, /:/, /\s+/].each do |pat| - [-1, 0, 1, 2].each do |limit| - str.dup.taint.split(pat, limit).each do |x| - # See the spec below for why the conditional is here - x.tainted?.should be_true unless x.empty? - end - end - end - end - end - - it "taints an empty string if self is tainted" do - ":".taint.split(//, -1).last.tainted?.should be_true - end - - it "doesn't taints the resulting strings if the Regexp is tainted" do - ["", "x:y:z:", " x y "].each do |str| - [//, /:/, /\s+/].each do |pat| - [-1, 0, 1, 2].each do |limit| - str.split(pat.dup.taint, limit).each do |x| - x.tainted?.should be_false - end - end - end - end - end - end - - it "retains the encoding of the source string" do + it "returns Strings in the same encoding as self" do ary = "а б в".split encodings = ary.map { |s| s.encoding } encodings.should == [Encoding::UTF_8, Encoding::UTF_8, Encoding::UTF_8] end - it "splits a string on each character for a multibyte encoding and empty split" do "That's why efficiency could not be helped".split("").size.should == 39 end it "returns an ArgumentError if an invalid UTF-8 string is supplied" do - broken_str = 'проверка' # in russian, means "test" + broken_str = +'проверка' # in russian, means "test" broken_str.force_encoding('binary') broken_str.chop! broken_str.force_encoding('utf-8') @@ -480,6 +435,14 @@ describe "String#split with Regexp" do a.should == ["Chunky", "Bacon"] end + it "yields each split substring with default pattern for a lazy substring" do + a = [] + returned_object = "chunky bacon"[1...-1].split { |str| a << str.capitalize } + + returned_object.should == "hunky baco" + a.should == ["Hunky", "Baco"] + end + it "yields each split substring with default pattern for a non-ASCII string" do a = [] returned_object = "l'été arrive bientôt".split { |str| a << str } @@ -488,6 +451,14 @@ describe "String#split with Regexp" do a.should == ["l'été", "arrive", "bientôt"] end + it "yields each split substring with default pattern for a non-ASCII lazy substring" do + a = [] + returned_object = "l'été arrive bientôt"[1...-1].split { |str| a << str } + + returned_object.should == "'été arrive bientô" + a.should == ["'été", "arrive", "bientô"] + end + it "yields the string when limit is 1" do a = [] returned_object = "chunky bacon".split("", 1) { |str| a << str.capitalize } @@ -546,32 +517,30 @@ describe "String#split with Regexp" do end describe "for a String subclass" do - ruby_version_is ''...'3.0' do - it "yields instances of the same subclass" do - a = [] - StringSpecs::MyString.new("a|b").split("|") { |str| a << str } - first, last = a + it "yields instances of String" do + a = [] + StringSpecs::MyString.new("a|b").split("|") { |str| a << str } + first, last = a - first.should be_an_instance_of(StringSpecs::MyString) - first.should == "a" + first.should be_an_instance_of(String) + first.should == "a" - last.should be_an_instance_of(StringSpecs::MyString) - last.should == "b" - end + last.should be_an_instance_of(String) + last.should == "b" end + end - ruby_version_is '3.0' do - it "yields instances of String" do - a = [] - StringSpecs::MyString.new("a|b").split("|") { |str| a << str } - first, last = a + it "raises a TypeError when not called with nil, String, or Regexp" do + -> { "hello".split(42) }.should raise_error(TypeError) + -> { "hello".split(:ll) }.should raise_error(TypeError) + -> { "hello".split(false) }.should raise_error(TypeError) + -> { "hello".split(Object.new) }.should raise_error(TypeError) + end - first.should be_an_instance_of(String) - first.should == "a" + it "returns Strings in the same encoding as self" do + strings = "hello world".encode("US-ASCII").split(/ /) - last.should be_an_instance_of(String) - last.should == "b" - end - end + strings[0].encoding.should == Encoding::US_ASCII + strings[1].encoding.should == Encoding::US_ASCII end end diff --git a/spec/ruby/core/string/squeeze_spec.rb b/spec/ruby/core/string/squeeze_spec.rb index 6f75402c9c..4ea238e6b5 100644 --- a/spec/ruby/core/string/squeeze_spec.rb +++ b/spec/ruby/core/string/squeeze_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: binary -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -54,16 +55,6 @@ describe "String#squeeze" do -> { s.squeeze("^e-b") }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - "hello".taint.squeeze("e").should.tainted? - "hello".taint.squeeze("a-z").should.tainted? - - "hello".squeeze("e".taint).should_not.tainted? - "hello".squeeze("l".taint).should_not.tainted? - end - end - it "tries to convert each set arg to a string using to_str" do other_string = mock('lo') other_string.should_receive(:to_str).and_return("lo") @@ -74,22 +65,19 @@ describe "String#squeeze" do "hello room".squeeze(other_string, other_string2).should == "hello rom" end + it "returns a String in the same encoding as self" do + "yellow moon".encode("US-ASCII").squeeze.encoding.should == Encoding::US_ASCII + "yellow moon".encode("US-ASCII").squeeze("a").encoding.should == Encoding::US_ASCII + end + it "raises a TypeError when one set arg can't be converted to a string" do -> { "hello world".squeeze([]) }.should raise_error(TypeError) -> { "hello world".squeeze(Object.new)}.should raise_error(TypeError) -> { "hello world".squeeze(mock('x')) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("oh no!!!").squeeze("!").should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("oh no!!!").squeeze("!").should be_an_instance_of(String) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("oh no!!!").squeeze("!").should be_an_instance_of(String) end end diff --git a/spec/ruby/core/string/start_with_spec.rb b/spec/ruby/core/string/start_with_spec.rb index aaed197ff3..35e33b46a6 100644 --- a/spec/ruby/core/string/start_with_spec.rb +++ b/spec/ruby/core/string/start_with_spec.rb @@ -5,4 +5,23 @@ require_relative '../../shared/string/start_with' describe "String#start_with?" do it_behaves_like :start_with, :to_s + + # Here and not in the shared examples because this is invalid as a Symbol + it "matches part of a character with the same part" do + "\xA9".should.start_with?("\xA9") # A9 is not a character head for UTF-8 + end + + ruby_version_is ""..."3.3" do + it "does not check we are matching only part of a character" do + "\xe3\x81\x82".size.should == 1 + "\xe3\x81\x82".should.start_with?("\xe3") + end + end + + ruby_version_is "3.3" do # #19784 + it "checks we are matching only part of a character" do + "\xe3\x81\x82".size.should == 1 + "\xe3\x81\x82".should_not.start_with?("\xe3") + end + end end diff --git a/spec/ruby/core/string/strip_spec.rb b/spec/ruby/core/string/strip_spec.rb index 463a9fedf3..edb6ea3b44 100644 --- a/spec/ruby/core/string/strip_spec.rb +++ b/spec/ruby/core/string/strip_spec.rb @@ -1,25 +1,19 @@ +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative 'shared/strip' describe "String#strip" do + it_behaves_like :string_strip, :strip + it "returns a new string with leading and trailing whitespace removed" do " hello ".strip.should == "hello" " hello world ".strip.should == "hello world" "\tgoodbye\r\v\n".strip.should == "goodbye" end - ruby_version_is '3.1' do - it "returns a copy of self without leading and trailing NULL bytes and whitespace" do - " \x00 goodbye \x00 ".strip.should == "goodbye" - end - end - - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - "".taint.strip.should.tainted? - "ok".taint.strip.should.tainted? - " ok ".taint.strip.should.tainted? - end + it "returns a copy of self without leading and trailing NULL bytes and whitespace" do + " \x00 goodbye \x00 ".strip.should == "goodbye" end end @@ -40,12 +34,16 @@ describe "String#strip!" do a.should == "hello" end - ruby_version_is '3.1' do - it "removes leading and trailing NULL bytes and whitespace" do - a = "\000 goodbye \000" - a.strip! - a.should == "goodbye" - end + it "makes a string empty if it is only whitespace" do + "".strip!.should == nil + " ".strip.should == "" + " ".strip.should == "" + end + + it "removes leading and trailing NULL bytes and whitespace" do + a = "\000 goodbye \000" + a.strip! + a.should == "goodbye" end it "raises a FrozenError on a frozen instance that is modified" do diff --git a/spec/ruby/core/string/sub_spec.rb b/spec/ruby/core/string/sub_spec.rb index 5ae9a4bbf3..4f9f87a433 100644 --- a/spec/ruby/core/string/sub_spec.rb +++ b/spec/ruby/core/string/sub_spec.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -137,28 +138,6 @@ describe "String#sub with pattern, replacement" do "hello".sub(/./, 'hah\\').should == 'hah\\ello' end - ruby_version_is ''...'2.7' do - it "taints the result if the original string or replacement is tainted" do - hello = "hello" - hello_t = "hello" - a = "a" - a_t = "a" - empty = "" - empty_t = "" - - hello_t.taint; a_t.taint; empty_t.taint - - hello_t.sub(/./, a).should.tainted? - hello_t.sub(/./, empty).should.tainted? - - hello.sub(/./, a_t).should.tainted? - hello.sub(/./, empty_t).should.tainted? - hello.sub(//, empty_t).should.tainted? - - hello.sub(//.taint, "foo").should_not.tainted? - end - end - it "tries to convert pattern to a string using to_str" do pattern = mock('.') pattern.should_receive(:to_str).and_return(".") @@ -192,22 +171,11 @@ describe "String#sub with pattern, replacement" do -> { "hello".sub(/[aeiou]/, 99) }.should raise_error(TypeError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("").sub(//, "").should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("").sub(/foo/, "").should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").sub(/foo/, "").should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("foo").sub("foo", "").should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("").sub(//, "").should be_an_instance_of(String) - StringSpecs::MyString.new("").sub(/foo/, "").should be_an_instance_of(String) - StringSpecs::MyString.new("foo").sub(/foo/, "").should be_an_instance_of(String) - StringSpecs::MyString.new("foo").sub("foo", "").should be_an_instance_of(String) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("").sub(//, "").should be_an_instance_of(String) + StringSpecs::MyString.new("").sub(/foo/, "").should be_an_instance_of(String) + StringSpecs::MyString.new("foo").sub(/foo/, "").should be_an_instance_of(String) + StringSpecs::MyString.new("foo").sub("foo", "").should be_an_instance_of(String) end it "sets $~ to MatchData of match and nil when there's none" do @@ -236,6 +204,17 @@ describe "String#sub with pattern, replacement" do "ababa".sub(/(b)/, '\\\\\1').should == "a\\baba" end + it "handles a pattern in a superset encoding" do + result = 'abc'.force_encoding(Encoding::US_ASCII).sub('é', 'è') + result.should == 'abc' + result.encoding.should == Encoding::US_ASCII + end + + it "handles a pattern in a subset encoding" do + result = 'été'.sub('t'.force_encoding(Encoding::US_ASCII), 'u') + result.should == 'éué' + result.encoding.should == Encoding::UTF_8 + end end describe "String#sub with pattern and block" do @@ -297,28 +276,6 @@ describe "String#sub with pattern and block" do obj.should_receive(:to_s).and_return("ok") "hello".sub(/.+/) { obj }.should == "ok" end - - ruby_version_is ''...'2.7' do - it "taints the result if the original string or replacement is tainted" do - hello = "hello" - hello_t = "hello" - a = "a" - a_t = "a" - empty = "" - empty_t = "" - - hello_t.taint; a_t.taint; empty_t.taint - - hello_t.sub(/./) { a }.should.tainted? - hello_t.sub(/./) { empty }.should.tainted? - - hello.sub(/./) { a_t }.should.tainted? - hello.sub(/./) { empty_t }.should.tainted? - hello.sub(//) { empty_t }.should.tainted? - - hello.sub(//.taint) { "foo" }.should_not.tainted? - end - end end describe "String#sub! with pattern, replacement" do @@ -328,14 +285,6 @@ describe "String#sub! with pattern, replacement" do a.should == "h*llo" end - ruby_version_is ''...'2.7' do - it "taints self if replacement is tainted" do - a = "hello" - a.sub!(/./.taint, "foo").should_not.tainted? - a.sub!(/./, "foo".taint).should.tainted? - end - end - it "returns nil if no modifications were made" do a = "hello" a.sub!(/z/, '*').should == nil @@ -351,6 +300,27 @@ describe "String#sub! with pattern, replacement" do -> { s.sub!(/e/, "e") }.should raise_error(FrozenError) -> { s.sub!(/[aeiou]/, '*') }.should raise_error(FrozenError) end + + it "handles a pattern in a superset encoding" do + string = 'abc'.force_encoding(Encoding::US_ASCII) + + result = string.sub!('é', 'è') + + result.should == nil + string.should == 'abc' + string.encoding.should == Encoding::US_ASCII + end + + it "handles a pattern in a subset encoding" do + string = 'été' + pattern = 't'.force_encoding(Encoding::US_ASCII) + + result = string.sub!(pattern, 'u') + + result.should == string + string.should == 'éué' + string.encoding.should == Encoding::UTF_8 + end end describe "String#sub! with pattern and block" do @@ -378,14 +348,6 @@ describe "String#sub! with pattern and block" do offsets.should == [[1, 2]] end - ruby_version_is ''...'2.7' do - it "taints self if block's result is tainted" do - a = "hello" - a.sub!(/./.taint) { "foo" }.should_not.tainted? - a.sub!(/./) { "foo".taint }.should.tainted? - end - end - it "returns nil if no modifications were made" do a = "hello" a.sub!(/z/) { '*' }.should == nil @@ -471,28 +433,6 @@ describe "String#sub with pattern and Hash" do "hello".sub(/(.+)/, 'hello' => repl ).should == repl end - ruby_version_is ''...'2.7' do - it "untrusts the result if the original string is untrusted" do - str = "Ghana".untrust - str.sub(/[Aa]na/, 'ana' => '').untrusted?.should be_true - end - - it "untrusts the result if a hash value is untrusted" do - str = "Ghana" - str.sub(/a$/, 'a' => 'di'.untrust).untrusted?.should be_true - end - - it "taints the result if the original string is tainted" do - str = "Ghana".taint - str.sub(/[Aa]na/, 'ana' => '').tainted?.should be_true - end - - it "taints the result if a hash value is tainted" do - str = "Ghana" - str.sub(/a$/, 'a' => 'di'.taint).tainted?.should be_true - end - end - end describe "String#sub! with pattern and Hash" do @@ -557,28 +497,6 @@ describe "String#sub! with pattern and Hash" do repl = '\& \0 \1 \` \\\' \+ \\\\ foo' "hello".sub!(/(.+)/, 'hello' => repl ).should == repl end - - ruby_version_is ''...'2.7' do - it "keeps untrusted state" do - str = "Ghana".untrust - str.sub!(/[Aa]na/, 'ana' => '').untrusted?.should be_true - end - - it "untrusts self if a hash value is untrusted" do - str = "Ghana" - str.sub!(/a$/, 'a' => 'di'.untrust).untrusted?.should be_true - end - - it "keeps tainted state" do - str = "Ghana".taint - str.sub!(/[Aa]na/, 'ana' => '').tainted?.should be_true - end - - it "taints self if a hash value is tainted" do - str = "Ghana" - str.sub!(/a$/, 'a' => 'di'.taint).tainted?.should be_true - end - end end describe "String#sub with pattern and without replacement and block" do diff --git a/spec/ruby/core/string/swapcase_spec.rb b/spec/ruby/core/string/swapcase_spec.rb index 32b358607e..7f4c68366d 100644 --- a/spec/ruby/core/string/swapcase_spec.rb +++ b/spec/ruby/core/string/swapcase_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -9,11 +10,8 @@ describe "String#swapcase" do "+++---111222???".swapcase.should == "+++---111222???" end - ruby_version_is ''...'2.7' do - it "taints resulting string when self is tainted" do - "".taint.swapcase.should.tainted? - "hello".taint.swapcase.should.tainted? - end + it "returns a String in the same encoding as self" do + "Hello".encode("US-ASCII").swapcase.encoding.should == Encoding::US_ASCII end describe "full Unicode case mapping" do @@ -35,6 +33,10 @@ describe "String#swapcase" do it "does not swapcase non-ASCII characters" do "aßet".swapcase(:ascii).should == "AßET" end + + it "works with substrings" do + "prefix aTé"[-3..-1].swapcase(:ascii).should == "Até" + end end describe "full Unicode case mapping adapted for Turkic languages" do @@ -73,18 +75,9 @@ describe "String#swapcase" do -> { "abc".swapcase(:invalid_option) }.should raise_error(ArgumentError) end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("").swapcase.should be_an_instance_of(StringSpecs::MyString) - StringSpecs::MyString.new("hello").swapcase.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("").swapcase.should be_an_instance_of(String) - StringSpecs::MyString.new("hello").swapcase.should be_an_instance_of(String) - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("").swapcase.should be_an_instance_of(String) + StringSpecs::MyString.new("hello").swapcase.should be_an_instance_of(String) end end diff --git a/spec/ruby/core/string/to_c_spec.rb b/spec/ruby/core/string/to_c_spec.rb index 9c84b14f4d..9d24f1f56c 100644 --- a/spec/ruby/core/string/to_c_spec.rb +++ b/spec/ruby/core/string/to_c_spec.rb @@ -1,99 +1,53 @@ require_relative '../../spec_helper' +require_relative '../../shared/kernel/complex' +require_relative 'fixtures/to_c' describe "String#to_c" do - it "returns a Complex object" do - '9'.to_c.should be_an_instance_of(Complex) - end - - it "understands integers" do - '20'.to_c.should == Complex(20) - end - - it "understands negative integers" do - '-3'.to_c.should == Complex(-3) - end - - it "understands fractions (numerator/denominator) for the real part" do - '2/3'.to_c.should == Complex(Rational(2, 3)) - end - - it "understands fractions (numerator/denominator) for the imaginary part" do - '4+2/3i'.to_c.should == Complex(4, Rational(2, 3)) - end - - it "understands negative fractions (-numerator/denominator) for the real part" do - '-2/3'.to_c.should == Complex(Rational(-2, 3)) - end - - it "understands negative fractions (-numerator/denominator) for the imaginary part" do - '7-2/3i'.to_c.should == Complex(7, Rational(-2, 3)) - end - - it "understands floats (a.b) for the real part" do - '2.3'.to_c.should == Complex(2.3) - end - - it "understands floats (a.b) for the imaginary part" do - '4+2.3i'.to_c.should == Complex(4, 2.3) - end - - it "understands negative floats (-a.b) for the real part" do - '-2.33'.to_c.should == Complex(-2.33) - end - - it "understands negative floats (-a.b) for the imaginary part" do - '7-28.771i'.to_c.should == Complex(7, -28.771) - end - - it "understands an integer followed by 'i' to mean that integer is the imaginary part" do - '35i'.to_c.should == Complex(0,35) - end - - it "understands a negative integer followed by 'i' to mean that negative integer is the imaginary part" do - '-29i'.to_c.should == Complex(0,-29) - end - - it "understands an 'i' by itself as denoting a complex number with an imaginary part of 1" do - 'i'.to_c.should == Complex(0,1) - end - - it "understands a '-i' by itself as denoting a complex number with an imaginary part of -1" do - '-i'.to_c.should == Complex(0,-1) - end - - it "understands 'a+bi' to mean a complex number with 'a' as the real part, 'b' as the imaginary" do - '79+4i'.to_c.should == Complex(79,4) - end + it_behaves_like :kernel_complex, :to_c_method, StringSpecs +end - it "understands 'a-bi' to mean a complex number with 'a' as the real part, '-b' as the imaginary" do - '79-4i'.to_c.should == Complex(79,-4) +describe "String#to_c" do + it "returns a complex number with 0 as the real part, 0 as the imaginary part for unrecognised Strings" do + 'ruby'.to_c.should == Complex(0, 0) end - it "understands scientific notation for the real part" do - '2e3+4i'.to_c.should == Complex(2e3,4) + it "ignores trailing garbage" do + '79+4iruby'.to_c.should == Complex(79, 4) + ruby_bug "[Bug #19087]", ""..."3.2" do + '7__9+4__0i'.to_c.should == Complex(7, 0) + end end - it "understands negative scientific notation for the real part" do - '-2e3+4i'.to_c.should == Complex(-2e3,4) + it "understands Float::INFINITY" do + 'Infinity'.to_c.should == Complex(0, 1) + '-Infinity'.to_c.should == Complex(0, -1) end - it "understands scientific notation for the imaginary part" do - '4+2e3i'.to_c.should == Complex(4, 2e3) + it "understands Float::NAN" do + 'NaN'.to_c.should == Complex(0, 0) end - it "understands negative scientific notation for the imaginary part" do - '4-2e3i'.to_c.should == Complex(4, -2e3) + it "allows null-byte" do + "1-2i\0".to_c.should == Complex(1, -2) + "1\0-2i".to_c.should == Complex(1, 0) + "\01-2i".to_c.should == Complex(0, 0) end - it "understands scientific notation for the real and imaginary part in the same String" do - '2e3+2e4i'.to_c.should == Complex(2e3,2e4) + it "raises Encoding::CompatibilityError if String is in not ASCII-compatible encoding" do + -> { + '79+4i'.encode("UTF-16").to_c + }.should raise_error(Encoding::CompatibilityError, "ASCII incompatible encoding: UTF-16") end - it "understands negative scientific notation for the real and imaginary part in the same String" do - '-2e3-2e4i'.to_c.should == Complex(-2e3,-2e4) - end + ruby_version_is "3.2" do + it "treats a sequence of underscores as an end of Complex string" do + "5+3_1i".to_c.should == Complex(5, 31) + "5+3__1i".to_c.should == Complex(5) + "5+3___1i".to_c.should == Complex(5) - it "returns a complex number with 0 as the real part, 0 as the imaginary part for unrecognised Strings" do - 'ruby'.to_c.should == Complex(0,0) + "12_3".to_c.should == Complex(123) + "12__3".to_c.should == Complex(12) + "12___3".to_c.should == Complex(12) + end end end diff --git a/spec/ruby/core/string/to_i_spec.rb b/spec/ruby/core/string/to_i_spec.rb index e4fa89aab3..9931502baa 100644 --- a/spec/ruby/core/string/to_i_spec.rb +++ b/spec/ruby/core/string/to_i_spec.rb @@ -10,6 +10,18 @@ describe "String#to_i" do "1_2_3asdf".to_i.should == 123 end + it "ignores multiple non-consecutive underscoes when the first digit is 0" do + (2..16).each do |base| + "0_0_010".to_i(base).should == base; + end + end + + it "bails out at the first double underscore if the first digit is 0" do + (2..16).each do |base| + "010__1".to_i(base).should == base; + end + end + it "ignores leading whitespaces" do [ " 123", " 123", "\r\n\r\n123", "\t\t123", "\r\n\t\n123", " \t\n\r\t 123"].each do |str| diff --git a/spec/ruby/core/string/tr_s_spec.rb b/spec/ruby/core/string/tr_s_spec.rb index c6ad12139e..dd72da440c 100644 --- a/spec/ruby/core/string/tr_s_spec.rb +++ b/spec/ruby/core/string/tr_s_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -17,6 +18,15 @@ describe "String#tr_s" do "hello ^--^".tr_s("---", "_").should == "hello ^_^" end + ruby_bug "#19769", ""..."3.3" do + it "accepts c1-c1 notation to denote range of one character" do + "hello".tr_s('e-e', 'x').should == "hxllo" + "123456789".tr_s("2-23","xy").should == "1xy456789" + "hello ^-^".tr_s("e-", "a-a_").should == "hallo ^_^" + "hello ^-^".tr_s("---o", "_a").should == "hella ^_^" + end + end + it "pads to_str with its last char if it is shorter than from_string" do "this".tr_s("this", "x").should == "x" end @@ -45,29 +55,8 @@ describe "String#tr_s" do "bla".tr_s(from_str, to_str).should == "BlA" end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("hello").tr_s("e", "a").should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns String instances when called on a subclass" do - StringSpecs::MyString.new("hello").tr_s("e", "a").should be_an_instance_of(String) - end - end - - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - ["h", "hello"].each do |str| - tainted_str = str.dup.taint - - tainted_str.tr_s("e", "a").should.tainted? - - str.tr_s("e".taint, "a").should_not.tainted? - str.tr_s("e", "a".taint).should_not.tainted? - end - end + it "returns String instances when called on a subclass" do + StringSpecs::MyString.new("hello").tr_s("e", "a").should be_an_instance_of(String) end # http://redmine.ruby-lang.org/issues/show/1839 diff --git a/spec/ruby/core/string/tr_spec.rb b/spec/ruby/core/string/tr_spec.rb index 06be1e6641..75841a974f 100644 --- a/spec/ruby/core/string/tr_spec.rb +++ b/spec/ruby/core/string/tr_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -16,6 +17,15 @@ describe "String#tr" do "hello ^-^".tr("---", "_").should == "hello ^_^" end + ruby_bug "#19769", ""..."3.3" do + it "accepts c1-c1 notation to denote range of one character" do + "hello".tr('e-e', 'x').should == "hxllo" + "123456789".tr("2-23","xy").should == "1xy456789" + "hello ^-^".tr("e-", "a-a_").should == "hallo ^_^" + "hello ^-^".tr("---o", "_a").should == "hella ^_^" + end + end + it "pads to_str with its last char if it is shorter than from_string" do "this".tr("this", "x").should == "xxxx" "hello".tr("a-z", "A-H.").should == "HE..." @@ -57,29 +67,8 @@ describe "String#tr" do "bla".tr(from_str, to_str).should == "BlA" end - ruby_version_is ''...'3.0' do - it "returns subclass instances when called on a subclass" do - StringSpecs::MyString.new("hello").tr("e", "a").should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns Stringinstances when called on a subclass" do - StringSpecs::MyString.new("hello").tr("e", "a").should be_an_instance_of(String) - end - end - - ruby_version_is ''...'2.7' do - it "taints the result when self is tainted" do - ["h", "hello"].each do |str| - tainted_str = str.dup.taint - - tainted_str.tr("e", "a").should.tainted? - - str.tr("e".taint, "a").should_not.tainted? - str.tr("e", "a".taint).should_not.tainted? - end - end + it "returns Stringinstances when called on a subclass" do + StringSpecs::MyString.new("hello").tr("e", "a").should be_an_instance_of(String) end # http://redmine.ruby-lang.org/issues/show/1839 diff --git a/spec/ruby/core/string/try_convert_spec.rb b/spec/ruby/core/string/try_convert_spec.rb index 84415c4a75..72ce5dd8b2 100644 --- a/spec/ruby/core/string/try_convert_spec.rb +++ b/spec/ruby/core/string/try_convert_spec.rb @@ -39,7 +39,7 @@ describe "String.try_convert" do it "sends #to_str to the argument and raises TypeError if it's not a kind of String" do obj = mock("to_str") obj.should_receive(:to_str).and_return(Object.new) - -> { String.try_convert obj }.should raise_error(TypeError) + -> { String.try_convert obj }.should raise_error(TypeError, "can't convert MockObject to String (MockObject#to_str gives Object)") end it "does not rescue exceptions raised by #to_str" do diff --git a/spec/ruby/core/string/uminus_spec.rb b/spec/ruby/core/string/uminus_spec.rb index 800dca5044..46d88f6704 100644 --- a/spec/ruby/core/string/uminus_spec.rb +++ b/spec/ruby/core/string/uminus_spec.rb @@ -1,49 +1,6 @@ require_relative '../../spec_helper' +require_relative 'shared/dedup' describe 'String#-@' do - it 'returns self if the String is frozen' do - input = 'foo'.freeze - output = -input - - output.should equal(input) - output.should.frozen? - end - - it 'returns a frozen copy if the String is not frozen' do - input = 'foo' - output = -input - - output.should.frozen? - output.should_not equal(input) - output.should == 'foo' - end - - it "returns the same object for equal unfrozen strings" do - origin = "this is a string" - dynamic = %w(this is a string).join(' ') - - origin.should_not equal(dynamic) - (-origin).should equal(-dynamic) - end - - it "returns the same object when it's called on the same String literal" do - (-"unfrozen string").should equal(-"unfrozen string") - (-"unfrozen string").should_not equal(-"another unfrozen string") - end - - it "deduplicates frozen strings" do - dynamic = %w(this string is frozen).join(' ').freeze - - dynamic.should_not equal("this string is frozen".freeze) - - (-dynamic).should equal("this string is frozen".freeze) - (-dynamic).should equal(-"this string is frozen".freeze) - end - - ruby_version_is "3.0" do - it "interns the provided string if it is frozen" do - dynamic = "this string is unique and frozen #{rand}".freeze - (-dynamic).should equal(dynamic) - end - end + it_behaves_like :string_dedup, :-@ end diff --git a/spec/ruby/core/string/undump_spec.rb b/spec/ruby/core/string/undump_spec.rb index b990aa25ee..6ff220161c 100644 --- a/spec/ruby/core/string/undump_spec.rb +++ b/spec/ruby/core/string/undump_spec.rb @@ -3,16 +3,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' describe "String#undump" do - ruby_version_is ''...'2.7' do - it "taints the result if self is tainted" do - '"foo"'.taint.undump.should.tainted? - end - - it "untrusts the result if self is untrusted" do - '"foo"'.untrust.undump.should.untrusted? - end - end - it "does not take into account if a string is frozen" do '"foo"'.freeze.undump.should_not.frozen? end @@ -399,7 +389,7 @@ describe "String#undump" do '"\\bv".force_encoding("UTF-16BE")'.undump.should == "\u0876".encode('utf-16be') end - it "keeps origin encoding" do + it "returns a String in the same encoding as self" do '"foo"'.encode("ISO-8859-1").undump.encoding.should == Encoding::ISO_8859_1 '"foo"'.encode('windows-1251').undump.encoding.should == Encoding::Windows_1251 end diff --git a/spec/ruby/core/string/unicode_normalize_spec.rb b/spec/ruby/core/string/unicode_normalize_spec.rb index 6de7533fc7..2e7d22394a 100644 --- a/spec/ruby/core/string/unicode_normalize_spec.rb +++ b/spec/ruby/core/string/unicode_normalize_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' # Examples taken from http://www.unicode.org/reports/tr15/#Norm_Forms diff --git a/spec/ruby/core/string/unicode_normalized_spec.rb b/spec/ruby/core/string/unicode_normalized_spec.rb index 87f3740459..91cf2086b2 100644 --- a/spec/ruby/core/string/unicode_normalized_spec.rb +++ b/spec/ruby/core/string/unicode_normalized_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' describe "String#unicode_normalized?" do diff --git a/spec/ruby/core/string/unpack/a_spec.rb b/spec/ruby/core/string/unpack/a_spec.rb index 2d83b4c824..4002ece697 100644 --- a/spec/ruby/core/string/unpack/a_spec.rb +++ b/spec/ruby/core/string/unpack/a_spec.rb @@ -31,7 +31,7 @@ describe "String#unpack with format 'A'" do end it "decodes into raw (ascii) string values" do - str = "str".force_encoding('UTF-8').unpack("A*")[0] + str = "str".dup.force_encoding('UTF-8').unpack("A*")[0] str.encoding.should == Encoding::BINARY end diff --git a/spec/ruby/core/string/unpack/b_spec.rb b/spec/ruby/core/string/unpack/b_spec.rb index 1a838d6c7c..23d93a8aea 100644 --- a/spec/ruby/core/string/unpack/b_spec.rb +++ b/spec/ruby/core/string/unpack/b_spec.rb @@ -86,13 +86,30 @@ describe "String#unpack with format 'B'" do ].should be_computed_by(:unpack, "BBB") end - it "ignores NULL bytes between directives" do - "\x80\x00".unpack("B\x00B").should == ["1", "0"] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "\x80\x00".unpack("B\x00B").should == ["1", "0"] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x80\x00".unpack("B\x00B") + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do "\x80\x00".unpack("B B").should == ["1", "0"] end + + it "decodes into US-ASCII string values" do + str = "s".dup.force_encoding('UTF-8').unpack("B*")[0] + str.encoding.name.should == 'US-ASCII' + end end describe "String#unpack with format 'b'" do @@ -177,8 +194,20 @@ describe "String#unpack with format 'b'" do ].should be_computed_by(:unpack, "bbb") end - it "ignores NULL bytes between directives" do - "\x01\x00".unpack("b\x00b").should == ["1", "0"] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "\x01\x00".unpack("b\x00b").should == ["1", "0"] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x01\x00".unpack("b\x00b") + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -186,8 +215,7 @@ describe "String#unpack with format 'b'" do end it "decodes into US-ASCII string values" do - str = "s".force_encoding('UTF-8').unpack("b*")[0] + str = "s".dup.force_encoding('UTF-8').unpack("b*")[0] str.encoding.name.should == 'US-ASCII' end - end diff --git a/spec/ruby/core/string/unpack/c_spec.rb b/spec/ruby/core/string/unpack/c_spec.rb index ed8caa4895..c2bf813954 100644 --- a/spec/ruby/core/string/unpack/c_spec.rb +++ b/spec/ruby/core/string/unpack/c_spec.rb @@ -35,8 +35,20 @@ describe :string_unpack_8bit, shared: true do ].should be_computed_by(:unpack, unpack_format(3)) end - it "ignores NULL bytes between directives" do - "abc".unpack(unpack_format("\000", 2)).should == [97, 98] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "abc".unpack(unpack_format("\000", 2)).should == [97, 98] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "abc".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/string/unpack/h_spec.rb b/spec/ruby/core/string/unpack/h_spec.rb index f2f5dcf396..19c4d63664 100644 --- a/spec/ruby/core/string/unpack/h_spec.rb +++ b/spec/ruby/core/string/unpack/h_spec.rb @@ -56,8 +56,20 @@ describe "String#unpack with format 'H'" do ].should be_computed_by(:unpack, "HHH") end - it "ignores NULL bytes between directives" do - "\x01\x10".unpack("H\x00H").should == ["0", "1"] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "\x01\x10".unpack("H\x00H").should == ["0", "1"] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x01\x10".unpack("H\x00H") + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -121,8 +133,20 @@ describe "String#unpack with format 'h'" do ].should be_computed_by(:unpack, "hhh") end - it "ignores NULL bytes between directives" do - "\x01\x10".unpack("h\x00h").should == ["1", "0"] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "\x01\x10".unpack("h\x00h").should == ["1", "0"] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x01\x10".unpack("h\x00h") + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/string/unpack/m_spec.rb b/spec/ruby/core/string/unpack/m_spec.rb index 21134514a1..c551c755d1 100644 --- a/spec/ruby/core/string/unpack/m_spec.rb +++ b/spec/ruby/core/string/unpack/m_spec.rb @@ -97,6 +97,11 @@ describe "String#unpack with format 'M'" do ["=FF=\n", ["\xff"]] ].should be_computed_by(:unpack, "M") end + + it "unpacks incomplete escape sequences as literal characters" do + "foo=".unpack("M").should == ["foo="] + "foo=4".unpack("M").should == ["foo=4"] + end end describe "String#unpack with format 'm'" do diff --git a/spec/ruby/core/string/unpack/p_spec.rb b/spec/ruby/core/string/unpack/p_spec.rb index 3e187d674f..cd48c0523d 100644 --- a/spec/ruby/core/string/unpack/p_spec.rb +++ b/spec/ruby/core/string/unpack/p_spec.rb @@ -18,12 +18,6 @@ describe "String#unpack with format 'P'" do -> { packed.to_sym.to_s.unpack("P5") }.should raise_error(ArgumentError, /no associated pointer/) end - ruby_version_is ''...'2.7' do - it "taints the unpacked string" do - ["hello"].pack("P").unpack("P5").first.tainted?.should be_true - end - end - it "reads as many characters as specified" do ["hello"].pack("P").unpack("P1").should == ["h"] end @@ -47,10 +41,4 @@ describe "String#unpack with format 'p'" do packed.dup.unpack("p").should == ["hello"] -> { packed.to_sym.to_s.unpack("p") }.should raise_error(ArgumentError, /no associated pointer/) end - - ruby_version_is ''...'2.7' do - it "taints the unpacked string" do - ["hello"].pack("p").unpack("p").first.tainted?.should be_true - end - end end diff --git a/spec/ruby/core/string/unpack/shared/basic.rb b/spec/ruby/core/string/unpack/shared/basic.rb index 332e39d8d1..bb5302edc5 100644 --- a/spec/ruby/core/string/unpack/shared/basic.rb +++ b/spec/ruby/core/string/unpack/shared/basic.rb @@ -8,14 +8,6 @@ describe :string_unpack_basic, shared: true do d.should_receive(:to_str).and_return("a"+unpack_format) "abc".unpack(d).should be_an_instance_of(Array) end - - it "raises a TypeError when passed nil" do - -> { "abc".unpack(nil) }.should raise_error(TypeError) - end - - it "raises a TypeError when passed an Integer" do - -> { "abc".unpack(1) }.should raise_error(TypeError) - end end describe :string_unpack_no_platform, shared: true do diff --git a/spec/ruby/core/string/unpack/shared/float.rb b/spec/ruby/core/string/unpack/shared/float.rb index 99bd8a3401..93282bf4c9 100644 --- a/spec/ruby/core/string/unpack/shared/float.rb +++ b/spec/ruby/core/string/unpack/shared/float.rb @@ -56,9 +56,21 @@ describe :string_unpack_float_le, shared: true do [nan_value].pack(unpack_format).unpack(unpack_format).first.nan?.should be_true end - it "ignores NULL bytes between directives" do - array = "\x9a\x999@33\xb3?".unpack(unpack_format("\000", 2)) - array.should == [2.9000000953674316, 1.399999976158142] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + array = "\x9a\x999@33\xb3?".unpack(unpack_format("\000", 2)) + array.should == [2.9000000953674316, 1.399999976158142] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x9a\x999@33\xb3?".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -123,9 +135,21 @@ describe :string_unpack_float_be, shared: true do [nan_value].pack(unpack_format).unpack(unpack_format).first.nan?.should be_true end - it "ignores NULL bytes between directives" do - array = "@9\x99\x9a?\xb333".unpack(unpack_format("\000", 2)) - array.should == [2.9000000953674316, 1.399999976158142] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + array = "@9\x99\x9a?\xb333".unpack(unpack_format("\000", 2)) + array.should == [2.9000000953674316, 1.399999976158142] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "@9\x99\x9a?\xb333".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -193,8 +217,20 @@ describe :string_unpack_double_le, shared: true do [nan_value].pack(unpack_format).unpack(unpack_format).first.nan?.should be_true end - it "ignores NULL bytes between directives" do - "333333\x07@ffffff\xf6?".unpack(unpack_format("\000", 2)).should == [2.9, 1.4] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "333333\x07@ffffff\xf6?".unpack(unpack_format("\000", 2)).should == [2.9, 1.4] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "333333\x07@ffffff\xf6?".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -261,8 +297,20 @@ describe :string_unpack_double_be, shared: true do [nan_value].pack(unpack_format).unpack(unpack_format).first.nan?.should be_true end - it "ignores NULL bytes between directives" do - "@\x07333333?\xf6ffffff".unpack(unpack_format("\000", 2)).should == [2.9, 1.4] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "@\x07333333?\xf6ffffff".unpack(unpack_format("\000", 2)).should == [2.9, 1.4] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "@\x07333333?\xf6ffffff".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/string/unpack/shared/integer.rb b/spec/ruby/core/string/unpack/shared/integer.rb index cbaa743683..d71a2cf00d 100644 --- a/spec/ruby/core/string/unpack/shared/integer.rb +++ b/spec/ruby/core/string/unpack/shared/integer.rb @@ -32,8 +32,20 @@ describe :string_unpack_16bit_le, shared: true do ].should be_computed_by(:unpack, unpack_format(3)) end - it "ignores NULL bytes between directives" do - "abcd".unpack(unpack_format("\000", 2)).should == [25185, 25699] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "abcd".unpack(unpack_format("\000", 2)).should == [25185, 25699] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "abcd".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -85,8 +97,20 @@ describe :string_unpack_16bit_be, shared: true do ].should be_computed_by(:unpack, unpack_format(3)) end - it "ignores NULL bytes between directives" do - "badc".unpack(unpack_format("\000", 2)).should == [25185, 25699] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "badc".unpack(unpack_format("\000", 2)).should == [25185, 25699] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "badc".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -139,8 +163,20 @@ describe :string_unpack_32bit_le, shared: true do ].should be_computed_by(:unpack, unpack_format(3)) end - it "ignores NULL bytes between directives" do - "abcdefgh".unpack(unpack_format("\000", 2)).should == [1684234849, 1751606885] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "abcdefgh".unpack(unpack_format("\000", 2)).should == [1684234849, 1751606885] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "abcdefgh".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -193,8 +229,20 @@ describe :string_unpack_32bit_be, shared: true do ].should be_computed_by(:unpack, unpack_format(3)) end - it "ignores NULL bytes between directives" do - "dcbahgfe".unpack(unpack_format("\000", 2)).should == [1684234849, 1751606885] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "dcbahgfe".unpack(unpack_format("\000", 2)).should == [1684234849, 1751606885] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "dcbahgfe".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -243,9 +291,21 @@ describe :string_unpack_64bit_le, shared: true do "abc".unpack(unpack_format('*')).should == [] end - it "ignores NULL bytes between directives" do - array = "abcdefghabghefcd".unpack(unpack_format("\000", 2)) - array.should == [7523094288207667809, 7233738012216484449] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + array = "abcdefghabghefcd".unpack(unpack_format("\000", 2)) + array.should == [7523094288207667809, 7233738012216484449] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "badc".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do @@ -305,9 +365,21 @@ describe :string_unpack_64bit_be, shared: true do "abc".unpack(unpack_format('*')).should == [] end - it "ignores NULL bytes between directives" do - array = "hgfedcbadcfehgba".unpack(unpack_format("\000", 2)) - array.should == [7523094288207667809, 7233738012216484449] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + array = "hgfedcbadcfehgba".unpack(unpack_format("\000", 2)) + array.should == [7523094288207667809, 7233738012216484449] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "hgfedcbadcfehgba".unpack(unpack_format("\000", 2)) + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/string/unpack/shared/taint.rb b/spec/ruby/core/string/unpack/shared/taint.rb index 061a3e26ad..79c7251f01 100644 --- a/spec/ruby/core/string/unpack/shared/taint.rb +++ b/spec/ruby/core/string/unpack/shared/taint.rb @@ -1,83 +1,2 @@ describe :string_unpack_taint, shared: true do - ruby_version_is ''...'2.7' do - it "does not taint returned arrays if given an untainted format string" do - "".unpack(unpack_format(2)).tainted?.should be_false - end - - it "does not taint returned arrays if given a tainted format string" do - format_string = unpack_format(2).dup - format_string.taint - "".unpack(format_string).tainted?.should be_false - end - - it "does not taint returned strings if given an untainted format string" do - "".unpack(unpack_format(2)).any?(&:tainted?).should be_false - end - - it "does not taint returned strings if given a tainted format string" do - format_string = unpack_format(2).dup - format_string.taint - "".unpack(format_string).any?(&:tainted?).should be_false - end - - it "does not taint returned arrays if given an untainted packed string" do - "".unpack(unpack_format(2)).tainted?.should be_false - end - - it "does not taint returned arrays if given a tainted packed string" do - packed_string = "" - packed_string.taint - packed_string.unpack(unpack_format(2)).tainted?.should be_false - end - - it "does not taint returned strings if given an untainted packed string" do - "".unpack(unpack_format(2)).any?(&:tainted?).should be_false - end - - it "taints returned strings if given a tainted packed string" do - packed_string = "" - packed_string.taint - packed_string.unpack(unpack_format(2)).all?(&:tainted?).should be_true - end - - it "does not untrust returned arrays if given an untrusted format string" do - "".unpack(unpack_format(2)).untrusted?.should be_false - end - - it "does not untrust returned arrays if given a untrusted format string" do - format_string = unpack_format(2).dup - format_string.untrust - "".unpack(format_string).untrusted?.should be_false - end - - it "does not untrust returned strings if given an untainted format string" do - "".unpack(unpack_format(2)).any?(&:untrusted?).should be_false - end - - it "does not untrust returned strings if given a untrusted format string" do - format_string = unpack_format(2).dup - format_string.untrust - "".unpack(format_string).any?(&:untrusted?).should be_false - end - - it "does not untrust returned arrays if given an trusted packed string" do - "".unpack(unpack_format(2)).untrusted?.should be_false - end - - it "does not untrust returned arrays if given a untrusted packed string" do - packed_string = "" - packed_string.untrust - packed_string.unpack(unpack_format(2)).untrusted?.should be_false - end - - it "does not untrust returned strings if given an trusted packed string" do - "".unpack(unpack_format(2)).any?(&:untrusted?).should be_false - end - - it "untrusts returned strings if given a untrusted packed string" do - packed_string = "" - packed_string.untrust - packed_string.unpack(unpack_format(2)).all?(&:untrusted?).should be_true - end - end end diff --git a/spec/ruby/core/string/unpack/shared/unicode.rb b/spec/ruby/core/string/unpack/shared/unicode.rb index a2b4e142b2..9fe07f53ae 100644 --- a/spec/ruby/core/string/unpack/shared/unicode.rb +++ b/spec/ruby/core/string/unpack/shared/unicode.rb @@ -50,8 +50,20 @@ describe :string_unpack_unicode, shared: true do "\xc2\x80".unpack("UUUU").should == [0x80] end - it "ignores NULL bytes between directives" do - "\x01\x02".unpack("U\x00U").should == [1, 2] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "\x01\x02".unpack("U\x00U").should == [1, 2] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x01\x02".unpack("U\x00U") + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/string/unpack/u_spec.rb b/spec/ruby/core/string/unpack/u_spec.rb index 7845e6d5f2..456abee784 100644 --- a/spec/ruby/core/string/unpack/u_spec.rb +++ b/spec/ruby/core/string/unpack/u_spec.rb @@ -33,7 +33,7 @@ describe "String#unpack with format 'u'" do str = "".unpack("u")[0] str.encoding.should == Encoding::BINARY - str = "1".force_encoding('UTF-8').unpack("u")[0] + str = "1".dup.force_encoding('UTF-8').unpack("u")[0] str.encoding.should == Encoding::BINARY end diff --git a/spec/ruby/core/string/unpack/w_spec.rb b/spec/ruby/core/string/unpack/w_spec.rb index 011c75f5c4..6a1cff1965 100644 --- a/spec/ruby/core/string/unpack/w_spec.rb +++ b/spec/ruby/core/string/unpack/w_spec.rb @@ -15,8 +15,20 @@ describe "String#unpack with directive 'w'" do ].should be_computed_by(:unpack, "w") end - it "ignores NULL bytes between directives" do - "\x01\x02\x03".unpack("w\x00w").should == [1, 2] + ruby_version_is ""..."3.3" do + it "ignores NULL bytes between directives" do + suppress_warning do + "\x01\x02\x03".unpack("w\x00w").should == [1, 2] + end + end + end + + ruby_version_is "3.3" do + it "raise ArgumentError for NULL bytes between directives" do + -> { + "\x01\x02\x03".unpack("w\x00w") + }.should raise_error(ArgumentError, /unknown unpack directive/) + end end it "ignores spaces between directives" do diff --git a/spec/ruby/core/string/unpack/z_spec.rb b/spec/ruby/core/string/unpack/z_spec.rb index 552851ce04..ce8da4b29e 100644 --- a/spec/ruby/core/string/unpack/z_spec.rb +++ b/spec/ruby/core/string/unpack/z_spec.rb @@ -20,4 +20,9 @@ describe "String#unpack with format 'Z'" do ["\x00a\x00 bc \x00", ["", "c"]] ].should be_computed_by(:unpack, "Z5Z") end + + it "does not advance past the null byte when given a 'Z' format specifier" do + "a\x00\x0f".unpack('Zxc').should == ['a', 15] + "a\x00\x0f".unpack('Zcc').should == ['a', 0, 15] + end end diff --git a/spec/ruby/core/string/unpack1_spec.rb b/spec/ruby/core/string/unpack1_spec.rb index 5fe81733fb..df830916a3 100644 --- a/spec/ruby/core/string/unpack1_spec.rb +++ b/spec/ruby/core/string/unpack1_spec.rb @@ -7,4 +7,30 @@ describe "String#unpack1" do "aG9nZWZ1Z2E=".unpack1("m").should == "hogefuga" "A".unpack1("B*").should == "01000001" end + + ruby_version_is "3.1" do + it "starts unpacking from the given offset" do + "ZZABCD".unpack1('x3C', offset: 2).should == "ABCD".unpack('x3C')[0] + "ZZZZaG9nZWZ1Z2E=".unpack1("m", offset: 4).should == "hogefuga" + "ZA".unpack1("B*", offset: 1).should == "01000001" + end + + it "traits offset as a bytes offset" do + "؈".unpack("CC").should == [216, 136] + "؈".unpack1("C").should == 216 + "؈".unpack1("C", offset: 1).should == 136 + end + + it "raises an ArgumentError when the offset is negative" do + -> { "a".unpack1("C", offset: -1) }.should raise_error(ArgumentError, "offset can't be negative") + end + + it "returns nil if the offset is at the end of the string" do + "a".unpack1("C", offset: 1).should == nil + end + + it "raises an ArgumentError when the offset is larger than the string bytesize" do + -> { "a".unpack1("C", offset: 2) }.should raise_error(ArgumentError, "offset outside of string") + end + end end diff --git a/spec/ruby/core/string/unpack_spec.rb b/spec/ruby/core/string/unpack_spec.rb new file mode 100644 index 0000000000..52b4af3a95 --- /dev/null +++ b/spec/ruby/core/string/unpack_spec.rb @@ -0,0 +1,34 @@ +require_relative '../../spec_helper' + +describe "String#unpack" do + it "raises a TypeError when passed nil" do + -> { "abc".unpack(nil) }.should raise_error(TypeError) + end + + it "raises a TypeError when passed an Integer" do + -> { "abc".unpack(1) }.should raise_error(TypeError) + end + + ruby_version_is "3.1" do + it "starts unpacking from the given offset" do + "abc".unpack("CC", offset: 1).should == [98, 99] + end + + it "traits offset as a bytes offset" do + "؈".unpack("CC").should == [216, 136] + "؈".unpack("CC", offset: 1).should == [136, nil] + end + + it "raises an ArgumentError when the offset is negative" do + -> { "a".unpack("C", offset: -1) }.should raise_error(ArgumentError, "offset can't be negative") + end + + it "returns nil if the offset is at the end of the string" do + "a".unpack("C", offset: 1).should == [nil] + end + + it "raises an ArgumentError when the offset is larget than the string" do + -> { "a".unpack("C", offset: 2) }.should raise_error(ArgumentError, "offset outside of string") + end + end +end diff --git a/spec/ruby/core/string/upcase_spec.rb b/spec/ruby/core/string/upcase_spec.rb index 6cf44b4703..652de5c2ef 100644 --- a/spec/ruby/core/string/upcase_spec.rb +++ b/spec/ruby/core/string/upcase_spec.rb @@ -1,4 +1,5 @@ # -*- encoding: utf-8 -*- +# frozen_string_literal: false require_relative '../../spec_helper' require_relative 'fixtures/classes' @@ -8,6 +9,10 @@ describe "String#upcase" do "hello".upcase.should == "HELLO" end + it "returns a String in the same encoding as self" do + "hello".encode("US-ASCII").upcase.encoding.should == Encoding::US_ASCII + end + describe "full Unicode case mapping" do it "works for all of Unicode with no option" do "äöü".upcase.should == "ÄÖÜ" @@ -27,6 +32,10 @@ describe "String#upcase" do it "does not upcase non-ASCII characters" do "aßet".upcase(:ascii).should == "AßET" end + + it "works with substrings" do + "prefix té"[-2..-1].upcase(:ascii).should == "Té" + end end describe "full Unicode case mapping adapted for Turkic languages" do @@ -65,24 +74,8 @@ describe "String#upcase" do -> { "abc".upcase(:invalid_option) }.should raise_error(ArgumentError) end - ruby_version_is ''...'2.7' do - it "taints result when self is tainted" do - "".taint.upcase.should.tainted? - "X".taint.upcase.should.tainted? - "x".taint.upcase.should.tainted? - end - end - - ruby_version_is ''...'3.0' do - it "returns a subclass instance for subclasses" do - StringSpecs::MyString.new("fooBAR").upcase.should be_an_instance_of(StringSpecs::MyString) - end - end - - ruby_version_is '3.0' do - it "returns a String instance for subclasses" do - StringSpecs::MyString.new("fooBAR").upcase.should be_an_instance_of(String) - end + it "returns a String instance for subclasses" do + StringSpecs::MyString.new("fooBAR").upcase.should be_an_instance_of(String) end end diff --git a/spec/ruby/core/string/uplus_spec.rb b/spec/ruby/core/string/uplus_spec.rb index 038b283c90..c0b0c49ede 100644 --- a/spec/ruby/core/string/uplus_spec.rb +++ b/spec/ruby/core/string/uplus_spec.rb @@ -1,3 +1,4 @@ +# frozen_string_literal: false require_relative '../../spec_helper' describe 'String#+@' do @@ -7,6 +8,9 @@ describe 'String#+@' do output.should_not.frozen? output.should == 'foo' + + output << 'bar' + output.should == 'foobar' end it 'returns self if the String is not frozen' do diff --git a/spec/ruby/core/string/upto_spec.rb b/spec/ruby/core/string/upto_spec.rb index f8529b1d2b..8bc847d5ac 100644 --- a/spec/ruby/core/string/upto_spec.rb +++ b/spec/ruby/core/string/upto_spec.rb @@ -80,6 +80,12 @@ describe "String#upto" do a.should == ["Σ", "Τ", "Î¥", "Φ", "Χ", "Ψ", "Ω"] end + it "raises Encoding::CompatibilityError when incompatible characters are given" do + char1 = 'a'.dup.force_encoding("EUC-JP") + char2 = 'b'.dup.force_encoding("ISO-2022-JP") + -> { char1.upto(char2) {} }.should raise_error(Encoding::CompatibilityError, "incompatible character encodings: EUC-JP and ISO-2022-JP") + end + describe "on sequence of numbers" do it "calls the block as Integer#upto" do "8".upto("11").to_a.should == 8.upto(11).map(&:to_s) diff --git a/spec/ruby/core/string/valid_encoding/utf_8_spec.rb b/spec/ruby/core/string/valid_encoding/utf_8_spec.rb new file mode 100644 index 0000000000..a14c3af830 --- /dev/null +++ b/spec/ruby/core/string/valid_encoding/utf_8_spec.rb @@ -0,0 +1,214 @@ +# -*- encoding: utf-8 -*- +require_relative '../../../spec_helper' + +describe "String#valid_encoding? and UTF-8" do + def utf8(bytes) + bytes.pack("C*").force_encoding("UTF-8") + end + + describe "1-byte character" do + it "is valid if is in format 0xxxxxxx" do + utf8([0b00000000]).valid_encoding?.should == true + utf8([0b01111111]).valid_encoding?.should == true + end + + it "is not valid if is not in format 0xxxxxxx" do + utf8([0b10000000]).valid_encoding?.should == false + utf8([0b11111111]).valid_encoding?.should == false + end + end + + describe "2-bytes character" do + it "is valid if in format [110xxxxx 10xxxxx]" do + utf8([0b11000010, 0b10000000]).valid_encoding?.should == true + utf8([0b11000010, 0b10111111]).valid_encoding?.should == true + + utf8([0b11011111, 0b10000000]).valid_encoding?.should == true + utf8([0b11011111, 0b10111111]).valid_encoding?.should == true + end + + it "is not valid if the first byte is not in format 110xxxxx" do + utf8([0b00000010, 0b10000000]).valid_encoding?.should == false + utf8([0b00100010, 0b10000000]).valid_encoding?.should == false + utf8([0b01000010, 0b10000000]).valid_encoding?.should == false + utf8([0b01100010, 0b10000000]).valid_encoding?.should == false + utf8([0b10000010, 0b10000000]).valid_encoding?.should == false + utf8([0b10100010, 0b10000000]).valid_encoding?.should == false + utf8([0b11000010, 0b10000000]).valid_encoding?.should == true # correct bytes + utf8([0b11100010, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if the second byte is not in format 10xxxxxx" do + utf8([0b11000010, 0b00000000]).valid_encoding?.should == false + utf8([0b11000010, 0b01000000]).valid_encoding?.should == false + utf8([0b11000010, 0b11000000]).valid_encoding?.should == false + end + + it "is not valid if is smaller than [xxxxxx10 xx000000] (codepoints < U+007F, that are encoded with the 1-byte format)" do + utf8([0b11000000, 0b10111111]).valid_encoding?.should == false + utf8([0b11000001, 0b10111111]).valid_encoding?.should == false + end + + it "is not valid if the first byte is missing" do + bytes = [0b11000010, 0b10000000] + utf8(bytes[1..1]).valid_encoding?.should == false + end + + it "is not valid if the second byte is missing" do + bytes = [0b11000010, 0b10000000] + utf8(bytes[0..0]).valid_encoding?.should == false + end + end + + describe "3-bytes character" do + it "is valid if in format [1110xxxx 10xxxxxx 10xxxxxx]" do + utf8([0b11100000, 0b10100000, 0b10000000]).valid_encoding?.should == true + utf8([0b11100000, 0b10100000, 0b10111111]).valid_encoding?.should == true + utf8([0b11100000, 0b10111111, 0b10111111]).valid_encoding?.should == true + utf8([0b11101111, 0b10111111, 0b10111111]).valid_encoding?.should == true + end + + it "is not valid if the first byte is not in format 1110xxxx" do + utf8([0b00000000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b00010000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b00100000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b00110000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b01000000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b01010000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b01100000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b01110000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b10000000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b10010000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b10100000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b10110000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b11000000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b11010000, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10100000, 0b10000000]).valid_encoding?.should == true # correct bytes + utf8([0b11110000, 0b10100000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if the second byte is not in format 10xxxxxx" do + utf8([0b11100000, 0b00100000, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b01100000, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b11100000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if the third byte is not in format 10xxxxxx" do + utf8([0b11100000, 0b10100000, 0b00000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10100000, 0b01000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10100000, 0b01000000]).valid_encoding?.should == false + end + + it "is not valid if is smaller than [xxxx0000 xx100000 xx000000] (codepoints < U+07FF that are encoded with the 2-byte format)" do + utf8([0b11100000, 0b10010000, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10001000, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10000100, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10000010, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10000001, 0b10000000]).valid_encoding?.should == false + utf8([0b11100000, 0b10000000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if in range [xxxx1101 xx100000 xx000000] - [xxxx1101 xx111111 xx111111] (codepoints U+D800 - U+DFFF)" do + utf8([0b11101101, 0b10100000, 0b10000000]).valid_encoding?.should == false + utf8([0b11101101, 0b10100000, 0b10000001]).valid_encoding?.should == false + utf8([0b11101101, 0b10111111, 0b10111111]).valid_encoding?.should == false + + utf8([0b11101101, 0b10011111, 0b10111111]).valid_encoding?.should == true # lower boundary - 1 + utf8([0b11101110, 0b10000000, 0b10000000]).valid_encoding?.should == true # upper boundary + 1 + end + + it "is not valid if the first byte is missing" do + bytes = [0b11100000, 0b10100000, 0b10000000] + utf8(bytes[2..3]).valid_encoding?.should == false + end + + it "is not valid if the second byte is missing" do + bytes = [0b11100000, 0b10100000, 0b10000000] + utf8([bytes[0], bytes[2]]).valid_encoding?.should == false + end + + it "is not valid if the second and the third bytes are missing" do + bytes = [0b11100000, 0b10100000, 0b10000000] + utf8(bytes[0..0]).valid_encoding?.should == false + end + end + + describe "4-bytes character" do + it "is valid if in format [11110xxx 10xxxxxx 10xxxxxx 10xxxxxx]" do + utf8([0b11110000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == true + utf8([0b11110000, 0b10010000, 0b10000000, 0b10111111]).valid_encoding?.should == true + utf8([0b11110000, 0b10010000, 0b10111111, 0b10111111]).valid_encoding?.should == true + utf8([0b11110000, 0b10111111, 0b10111111, 0b10111111]).valid_encoding?.should == true + utf8([0b11110100, 0b10001111, 0b10111111, 0b10111111]).valid_encoding?.should == true + end + + it "is not valid if the first byte is not in format 11110xxx" do + utf8([0b11100000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11010000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b10110000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b01110000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if the second byte is not in format 10xxxxxx" do + utf8([0b11110000, 0b00010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b01010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == true # correct bytes + utf8([0b11110000, 0b11010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if the third byte is not in format 10xxxxxx" do + utf8([0b11110000, 0b10010000, 0b00000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10010000, 0b01000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == true # correct bytes + utf8([0b11110000, 0b10010000, 0b11000000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if the forth byte is not in format 10xxxxxx" do + utf8([0b11110000, 0b10010000, 0b10000000, 0b00000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10010000, 0b10000000, 0b01000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == true # correct bytes + utf8([0b11110000, 0b10010000, 0b10000000, 0b11000000]).valid_encoding?.should == false + end + + it "is not valid if is smaller than [xxxxx000 xx001000 xx000000 xx000000] (codepoint < U+10000)" do + utf8([0b11110000, 0b10000111, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000110, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000101, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000100, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000011, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000010, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000001, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110000, 0b10000000, 0b10000000, 0b10000000]).valid_encoding?.should == false + end + + it "is not valid if is greater than [xxxxx100 xx001111 xx111111 xx111111] (codepoint > U+10FFFF)" do + utf8([0b11110100, 0b10010000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110100, 0b10100000, 0b10000000, 0b10000000]).valid_encoding?.should == false + utf8([0b11110100, 0b10110000, 0b10000000, 0b10000000]).valid_encoding?.should == false + + utf8([0b11110101, 0b10001111, 0b10111111, 0b10111111]).valid_encoding?.should == false + utf8([0b11110110, 0b10001111, 0b10111111, 0b10111111]).valid_encoding?.should == false + utf8([0b11110111, 0b10001111, 0b10111111, 0b10111111]).valid_encoding?.should == false + end + + it "is not valid if the first byte is missing" do + bytes = [0b11110000, 0b10010000, 0b10000000, 0b10000000] + utf8(bytes[1..3]).valid_encoding?.should == false + end + + it "is not valid if the second byte is missing" do + bytes = [0b11110000, 0b10010000, 0b10000000, 0b10000000] + utf8([bytes[0], bytes[2], bytes[3]]).valid_encoding?.should == false + end + + it "is not valid if the second and the third bytes are missing" do + bytes = [0b11110000, 0b10010000, 0b10000000, 0b10000000] + utf8([bytes[0], bytes[3]]).valid_encoding?.should == false + end + + it "is not valid if the second, the third and the fourth bytes are missing" do + bytes = [0b11110000, 0b10010000, 0b10000000, 0b10000000] + utf8(bytes[0..0]).valid_encoding?.should == false + end + end +end diff --git a/spec/ruby/core/string/valid_encoding_spec.rb b/spec/ruby/core/string/valid_encoding_spec.rb index d5bf31710f..375035cd94 100644 --- a/spec/ruby/core/string/valid_encoding_spec.rb +++ b/spec/ruby/core/string/valid_encoding_spec.rb @@ -7,13 +7,13 @@ describe "String#valid_encoding?" do end it "returns true if self is valid in the current encoding and other encodings" do - str = "\x77" + str = +"\x77" str.force_encoding('utf-8').valid_encoding?.should be_true str.force_encoding('binary').valid_encoding?.should be_true end it "returns true for all encodings self is valid in" do - str = "\xE6\x9D\x94" + str = +"\xE6\x9D\x94" str.force_encoding('BINARY').valid_encoding?.should be_true str.force_encoding('UTF-8').valid_encoding?.should be_true str.force_encoding('US-ASCII').valid_encoding?.should be_false @@ -43,10 +43,10 @@ describe "String#valid_encoding?" do str.force_encoding('KOI8-R').valid_encoding?.should be_true str.force_encoding('KOI8-U').valid_encoding?.should be_true str.force_encoding('Shift_JIS').valid_encoding?.should be_false - str.force_encoding('UTF-16BE').valid_encoding?.should be_false - str.force_encoding('UTF-16LE').valid_encoding?.should be_false - str.force_encoding('UTF-32BE').valid_encoding?.should be_false - str.force_encoding('UTF-32LE').valid_encoding?.should be_false + "\xD8\x00".dup.force_encoding('UTF-16BE').valid_encoding?.should be_false + "\x00\xD8".dup.force_encoding('UTF-16LE').valid_encoding?.should be_false + "\x04\x03\x02\x01".dup.force_encoding('UTF-32BE').valid_encoding?.should be_false + "\x01\x02\x03\x04".dup.force_encoding('UTF-32LE').valid_encoding?.should be_false str.force_encoding('Windows-1251').valid_encoding?.should be_true str.force_encoding('IBM437').valid_encoding?.should be_true str.force_encoding('IBM737').valid_encoding?.should be_true @@ -100,27 +100,25 @@ describe "String#valid_encoding?" do str.force_encoding('UTF8-MAC').valid_encoding?.should be_true end - ruby_version_is '3.0' do - it "returns true for IBM720 encoding self is valid in" do - str = "\xE6\x9D\x94" - str.force_encoding('IBM720').valid_encoding?.should be_true - str.force_encoding('CP720').valid_encoding?.should be_true - end + it "returns true for IBM720 encoding self is valid in" do + str = +"\xE6\x9D\x94" + str.force_encoding('IBM720').valid_encoding?.should be_true + str.force_encoding('CP720').valid_encoding?.should be_true end it "returns false if self is valid in one encoding, but invalid in the one it's tagged with" do - str = "\u{8765}" + str = +"\u{8765}" str.valid_encoding?.should be_true - str = str.force_encoding('ascii') + str.force_encoding('ascii') str.valid_encoding?.should be_false end it "returns false if self contains a character invalid in the associated encoding" do - "abc#{[0x80].pack('C')}".force_encoding('ascii').valid_encoding?.should be_false + "abc#{[0x80].pack('C')}".dup.force_encoding('ascii').valid_encoding?.should be_false end it "returns false if a valid String had an invalid character appended to it" do - str = "a" + str = +"a" str.valid_encoding?.should be_true str << [0xDD].pack('C').force_encoding('utf-8') str.valid_encoding?.should be_false diff --git a/spec/ruby/core/struct/constants_spec.rb b/spec/ruby/core/struct/constants_spec.rb new file mode 100644 index 0000000000..fa61a4b912 --- /dev/null +++ b/spec/ruby/core/struct/constants_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "Struct::Group" do + it "is no longer defined" do + Struct.should_not.const_defined?(:Group) + end + end + + describe "Struct::Passwd" do + it "is no longer defined" do + Struct.should_not.const_defined?(:Passwd) + end + end +end diff --git a/spec/ruby/core/struct/deconstruct_keys_spec.rb b/spec/ruby/core/struct/deconstruct_keys_spec.rb index f0a1f50ad3..b4c84c49df 100644 --- a/spec/ruby/core/struct/deconstruct_keys_spec.rb +++ b/spec/ruby/core/struct/deconstruct_keys_spec.rb @@ -1,78 +1,76 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Struct#deconstruct_keys" do - it "returns a hash of attributes" do - struct = Struct.new(:x, :y) - s = struct.new(1, 2) - - s.deconstruct_keys([:x, :y]).should == {x: 1, y: 2} - end - - it "requires one argument" do - struct = Struct.new(:x) - obj = struct.new(1) - - -> { - obj.deconstruct_keys - }.should raise_error(ArgumentError, /wrong number of arguments \(given 0, expected 1\)/) - end - - it "returns only specified keys" do - struct = Struct.new(:x, :y, :z) - s = struct.new(1, 2, 3) - - s.deconstruct_keys([:x, :y]).should == {x: 1, y: 2} - s.deconstruct_keys([:x] ).should == {x: 1} - s.deconstruct_keys([] ).should == {} - end - - it "accepts string attribute names" do - struct = Struct.new(:x, :y) - s = struct.new(1, 2) - - s.deconstruct_keys(['x', 'y']).should == {'x' => 1, 'y' => 2} - end - - it "accepts argument position number as well but returns them as keys" do - struct = Struct.new(:x, :y, :z) - s = struct.new(10, 20, 30) - - s.deconstruct_keys([0, 1, 2]).should == {0 => 10, 1 => 20, 2 => 30} - s.deconstruct_keys([0, 1] ).should == {0 => 10, 1 => 20} - s.deconstruct_keys([0] ).should == {0 => 10} - end - - it "returns an empty hash when there are more keys than attributes" do - struct = Struct.new(:x, :y) - s = struct.new(1, 2) - - s.deconstruct_keys([:x, :y, :a]).should == {} - end - - it "returns at first not existing attribute name" do - struct = Struct.new(:x, :y) - s = struct.new(1, 2) - - s.deconstruct_keys([:a, :x]).should == {} - s.deconstruct_keys([:x, :a]).should == {x: 1} - end - - it "accepts nil argument and return all the attributes" do - struct = Struct.new(:x, :y) - obj = struct.new(1, 2) - - obj.deconstruct_keys(nil).should == {x: 1, y: 2} - end - - it "raise TypeError if passed anything accept nil or array" do - struct = Struct.new(:x, :y) - s = struct.new(1, 2) - - -> { s.deconstruct_keys('x') }.should raise_error(TypeError, /expected Array or nil/) - -> { s.deconstruct_keys(1) }.should raise_error(TypeError, /expected Array or nil/) - -> { s.deconstruct_keys(:x) }.should raise_error(TypeError, /expected Array or nil/) - -> { s.deconstruct_keys({}) }.should raise_error(TypeError, /expected Array or nil/) - end +describe "Struct#deconstruct_keys" do + it "returns a hash of attributes" do + struct = Struct.new(:x, :y) + s = struct.new(1, 2) + + s.deconstruct_keys([:x, :y]).should == {x: 1, y: 2} + end + + it "requires one argument" do + struct = Struct.new(:x) + obj = struct.new(1) + + -> { + obj.deconstruct_keys + }.should raise_error(ArgumentError, /wrong number of arguments \(given 0, expected 1\)/) + end + + it "returns only specified keys" do + struct = Struct.new(:x, :y, :z) + s = struct.new(1, 2, 3) + + s.deconstruct_keys([:x, :y]).should == {x: 1, y: 2} + s.deconstruct_keys([:x] ).should == {x: 1} + s.deconstruct_keys([] ).should == {} + end + + it "accepts string attribute names" do + struct = Struct.new(:x, :y) + s = struct.new(1, 2) + + s.deconstruct_keys(['x', 'y']).should == {'x' => 1, 'y' => 2} + end + + it "accepts argument position number as well but returns them as keys" do + struct = Struct.new(:x, :y, :z) + s = struct.new(10, 20, 30) + + s.deconstruct_keys([0, 1, 2]).should == {0 => 10, 1 => 20, 2 => 30} + s.deconstruct_keys([0, 1] ).should == {0 => 10, 1 => 20} + s.deconstruct_keys([0] ).should == {0 => 10} + end + + it "returns an empty hash when there are more keys than attributes" do + struct = Struct.new(:x, :y) + s = struct.new(1, 2) + + s.deconstruct_keys([:x, :y, :a]).should == {} + end + + it "returns at first not existing attribute name" do + struct = Struct.new(:x, :y) + s = struct.new(1, 2) + + s.deconstruct_keys([:a, :x]).should == {} + s.deconstruct_keys([:x, :a]).should == {x: 1} + end + + it "accepts nil argument and return all the attributes" do + struct = Struct.new(:x, :y) + obj = struct.new(1, 2) + + obj.deconstruct_keys(nil).should == {x: 1, y: 2} + end + + it "raise TypeError if passed anything except nil or array" do + struct = Struct.new(:x, :y) + s = struct.new(1, 2) + + -> { s.deconstruct_keys('x') }.should raise_error(TypeError, /expected Array or nil/) + -> { s.deconstruct_keys(1) }.should raise_error(TypeError, /expected Array or nil/) + -> { s.deconstruct_keys(:x) }.should raise_error(TypeError, /expected Array or nil/) + -> { s.deconstruct_keys({}) }.should raise_error(TypeError, /expected Array or nil/) end end diff --git a/spec/ruby/core/struct/deconstruct_spec.rb b/spec/ruby/core/struct/deconstruct_spec.rb index 7518a40987..32d4f6bac4 100644 --- a/spec/ruby/core/struct/deconstruct_spec.rb +++ b/spec/ruby/core/struct/deconstruct_spec.rb @@ -1,12 +1,10 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Struct#deconstruct" do - it "returns an array of attribute values" do - struct = Struct.new(:x, :y) - s = struct.new(1, 2) +describe "Struct#deconstruct" do + it "returns an array of attribute values" do + struct = Struct.new(:x, :y) + s = struct.new(1, 2) - s.deconstruct.should == [1, 2] - end + s.deconstruct.should == [1, 2] end end diff --git a/spec/ruby/core/struct/fixtures/classes.rb b/spec/ruby/core/struct/fixtures/classes.rb index 6d620f9060..bf838d05df 100644 --- a/spec/ruby/core/struct/fixtures/classes.rb +++ b/spec/ruby/core/struct/fixtures/classes.rb @@ -13,6 +13,12 @@ module StructClasses end end + class StructWithOverriddenName < Struct.new(:a) + def self.name + "A" + end + end + class SubclassX < Struct end diff --git a/spec/ruby/core/struct/initialize_spec.rb b/spec/ruby/core/struct/initialize_spec.rb index e82289071a..a5ebe9551c 100644 --- a/spec/ruby/core/struct/initialize_spec.rb +++ b/spec/ruby/core/struct/initialize_spec.rb @@ -40,4 +40,22 @@ describe "Struct#initialize" do it "can be overridden" do StructClasses::SubclassX.new(:y).new.key.should == :value end + + ruby_version_is "3.1"..."3.2" do + it "warns about passing only keyword arguments" do + -> { + StructClasses::Ruby.new(version: "3.1", platform: "OS") + }.should complain(/warning: Passing only keyword arguments/) + end + end + + ruby_version_is "3.2" do + it "can be initialized with keyword arguments" do + positional_args = StructClasses::Ruby.new("3.2", "OS") + keyword_args = StructClasses::Ruby.new(version: "3.2", platform: "OS") + + positional_args.version.should == keyword_args.version + positional_args.platform.should == keyword_args.platform + end + end end diff --git a/spec/ruby/core/struct/inspect_spec.rb b/spec/ruby/core/struct/inspect_spec.rb index 83e13597ba..657b06abc1 100644 --- a/spec/ruby/core/struct/inspect_spec.rb +++ b/spec/ruby/core/struct/inspect_spec.rb @@ -3,10 +3,5 @@ require_relative 'fixtures/classes' require_relative 'shared/inspect' describe "Struct#inspect" do - it "returns a string representation showing members and values" do - car = StructClasses::Car.new('Ford', 'Ranger') - car.inspect.should == '#<struct StructClasses::Car make="Ford", model="Ranger", year=nil>' - end - it_behaves_like :struct_inspect, :inspect end diff --git a/spec/ruby/core/struct/keyword_init_spec.rb b/spec/ruby/core/struct/keyword_init_spec.rb new file mode 100644 index 0000000000..8de4c14351 --- /dev/null +++ b/spec/ruby/core/struct/keyword_init_spec.rb @@ -0,0 +1,40 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + # See https://bugs.ruby-lang.org/issues/18008 + describe "StructClass#keyword_init?" do + it "returns true for a struct that accepts keyword arguments to initialize" do + struct = Struct.new(:arg, keyword_init: true) + struct.keyword_init?.should be_true + end + + it "returns false for a struct that does not accept keyword arguments to initialize" do + struct = Struct.new(:arg, keyword_init: false) + struct.keyword_init?.should be_false + end + + it "returns nil for a struct that did not explicitly specify keyword_init" do + struct = Struct.new(:arg) + struct.keyword_init?.should be_nil + end + + it "returns nil for a struct that does specify keyword_init to be nil" do + struct = Struct.new(:arg, keyword_init: nil) + struct.keyword_init?.should be_nil + end + + it "returns true for any truthy value, not just for true" do + struct = Struct.new(:arg, keyword_init: 1) + struct.keyword_init?.should be_true + + struct = Struct.new(:arg, keyword_init: "") + struct.keyword_init?.should be_true + + struct = Struct.new(:arg, keyword_init: []) + struct.keyword_init?.should be_true + + struct = Struct.new(:arg, keyword_init: {}) + struct.keyword_init?.should be_true + end + end +end diff --git a/spec/ruby/core/struct/new_spec.rb b/spec/ruby/core/struct/new_spec.rb index cbbec829d7..a94eb852e1 100644 --- a/spec/ruby/core/struct/new_spec.rb +++ b/spec/ruby/core/struct/new_spec.rb @@ -47,6 +47,11 @@ describe "Struct.new" do Struct.const_defined?("Animal2").should be_false end + it "allows non-ASCII member name" do + name = "r\xe9sum\xe9".dup.force_encoding(Encoding::ISO_8859_1).to_sym + struct = Struct.new(name) + struct.new("foo").send(name).should == "foo" + end it "fails with invalid constant name as first argument" do -> { Struct.new('animal', :name, :legs, :eyeballs) }.should raise_error(NameError) @@ -62,8 +67,34 @@ describe "Struct.new" do -> { Struct.new(:animal, ['chris', 'evan']) }.should raise_error(TypeError) end - it "raises a ArgumentError if passed a Hash with an unknown key" do - -> { Struct.new(:animal, { name: 'chris' }) }.should raise_error(ArgumentError) + ruby_version_is ""..."3.2" do + it "raises a TypeError or ArgumentError if passed a Hash with an unknown key" do + # CRuby < 3.2 raises ArgumentError: unknown keyword: :name, but that seems a bug: + # https://bugs.ruby-lang.org/issues/18632 + -> { Struct.new(:animal, { name: 'chris' }) }.should raise_error(StandardError) { |e| + [ArgumentError, TypeError].should.include?(e.class) + } + end + end + + ruby_version_is "3.2" do + it "raises a TypeError if passed a Hash with an unknown key" do + -> { Struct.new(:animal, { name: 'chris' }) }.should raise_error(TypeError) + end + end + + ruby_version_is ""..."3.3" do + it "raises ArgumentError if not provided any arguments" do + -> { Struct.new }.should raise_error(ArgumentError) + end + end + + ruby_version_is "3.3" do + it "works when not provided any arguments" do + c = Struct.new + c.should be_kind_of(Class) + c.superclass.should == Struct + end end it "raises ArgumentError when there is a duplicate member" do diff --git a/spec/ruby/core/struct/shared/inspect.rb b/spec/ruby/core/struct/shared/inspect.rb index 90594a5452..1a0fb6a6b2 100644 --- a/spec/ruby/core/struct/shared/inspect.rb +++ b/spec/ruby/core/struct/shared/inspect.rb @@ -1,5 +1,40 @@ describe :struct_inspect, shared: true do + it "returns a string representation showing members and values" do + car = StructClasses::Car.new('Ford', 'Ranger') + car.send(@method).should == '#<struct StructClasses::Car make="Ford", model="Ranger", year=nil>' + end + it "returns a string representation without the class name for anonymous structs" do Struct.new(:a).new("").send(@method).should == '#<struct a="">' end + + it "returns a string representation without the class name for structs nested in anonymous classes" do + c = Class.new + c.class_eval <<~DOC + class Foo < Struct.new(:a); end + DOC + + c::Foo.new("").send(@method).should == '#<struct a="">' + end + + it "returns a string representation without the class name for structs nested in anonymous modules" do + m = Module.new + m.module_eval <<~DOC + class Foo < Struct.new(:a); end + DOC + + m::Foo.new("").send(@method).should == '#<struct a="">' + end + + it "does not call #name method" do + struct = StructClasses::StructWithOverriddenName.new("") + struct.send(@method).should == '#<struct StructClasses::StructWithOverriddenName a="">' + end + + it "does not call #name method when struct is anonymous" do + struct = Struct.new(:a) + def struct.name; "A"; end + + struct.new("").send(@method).should == '#<struct a="">' + end end diff --git a/spec/ruby/core/struct/values_at_spec.rb b/spec/ruby/core/struct/values_at_spec.rb index 7e517cdb4b..5e5a496600 100644 --- a/spec/ruby/core/struct/values_at_spec.rb +++ b/spec/ruby/core/struct/values_at_spec.rb @@ -1,16 +1,59 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +# Should be synchronized with core/array/values_at_spec.rb describe "Struct#values_at" do - it "returns an array of values" do + before do clazz = Struct.new(:name, :director, :year) - movie = clazz.new('Sympathy for Mr. Vengence', 'Chan-wook Park', 2002) - movie.values_at(0, 1).should == ['Sympathy for Mr. Vengence', 'Chan-wook Park'] - movie.values_at(0..2).should == ['Sympathy for Mr. Vengence', 'Chan-wook Park', 2002] + @movie = clazz.new('Sympathy for Mr. Vengeance', 'Chan-wook Park', 2002) + end + + context "when passed a list of Integers" do + it "returns an array containing each value given by one of integers" do + @movie.values_at(0, 1).should == ['Sympathy for Mr. Vengeance', 'Chan-wook Park'] + end + + it "raises IndexError if any of integers is out of range" do + -> { @movie.values_at(3) }.should raise_error(IndexError, "offset 3 too large for struct(size:3)") + -> { @movie.values_at(-4) }.should raise_error(IndexError, "offset -4 too small for struct(size:3)") + end + end + + context "when passed an integer Range" do + it "returns an array containing each value given by the elements of the range" do + @movie.values_at(0..2).should == ['Sympathy for Mr. Vengeance', 'Chan-wook Park', 2002] + end + + it "fills with nil values for range elements larger than the structure" do + @movie.values_at(0..3).should == ['Sympathy for Mr. Vengeance', 'Chan-wook Park', 2002, nil] + end + + it "raises RangeError if any element of the range is negative and out of range" do + -> { @movie.values_at(-4..3) }.should raise_error(RangeError, "-4..3 out of range") + end + + it "supports endless Range" do + @movie.values_at(0..).should == ["Sympathy for Mr. Vengeance", "Chan-wook Park", 2002] + end + + it "supports beginningless Range" do + @movie.values_at(..2).should == ["Sympathy for Mr. Vengeance", "Chan-wook Park", 2002] + end + end + + it "supports multiple integer Ranges" do + @movie.values_at(0..2, 1..2).should == ['Sympathy for Mr. Vengeance', 'Chan-wook Park', 2002, 'Chan-wook Park', 2002] + end + + it "supports mixing integer Ranges and Integers" do + @movie.values_at(0..2, 2).should == ['Sympathy for Mr. Vengeance', 'Chan-wook Park', 2002, 2002] + end + + it "returns a new empty Array if no arguments given" do + @movie.values_at().should == [] end it "fails when passed unsupported types" do - car = StructClasses::Car.new('Ford', 'Ranger') - -> { car.values_at('make') }.should raise_error(TypeError) + -> { @movie.values_at('make') }.should raise_error(TypeError, "no implicit conversion of String into Integer") end end diff --git a/spec/ruby/core/symbol/casecmp_spec.rb b/spec/ruby/core/symbol/casecmp_spec.rb index 80ea51e910..662a29a284 100644 --- a/spec/ruby/core/symbol/casecmp_spec.rb +++ b/spec/ruby/core/symbol/casecmp_spec.rb @@ -56,6 +56,10 @@ describe "Symbol#casecmp with Symbol" do lower_a_tilde.casecmp(upper_a_tilde).should == 1 lower_a_umlaut.casecmp(upper_a_umlaut).should == 1 end + + it "returns 0 for empty strings in different encodings" do + ''.to_sym.casecmp(''.encode("UTF-32LE").to_sym).should == 0 + end end describe "Symbol#casecmp" do @@ -141,4 +145,8 @@ describe 'Symbol#casecmp?' do upper_a_tilde.casecmp?(lower_a_tilde).should == nil lower_a_tilde.casecmp?(upper_a_tilde).should == nil end + + it "returns true for empty symbols in different encodings" do + ''.to_sym.should.casecmp?(''.encode("UTF-32LE").to_sym) + end end diff --git a/spec/ruby/core/symbol/end_with_spec.rb b/spec/ruby/core/symbol/end_with_spec.rb index 77dc4caf71..4b9f5a4996 100644 --- a/spec/ruby/core/symbol/end_with_spec.rb +++ b/spec/ruby/core/symbol/end_with_spec.rb @@ -3,8 +3,6 @@ require_relative '../../spec_helper' require_relative '../../shared/string/end_with' -ruby_version_is "2.7" do - describe "Symbol#end_with?" do - it_behaves_like :end_with, :to_sym - end +describe "Symbol#end_with?" do + it_behaves_like :end_with, :to_sym end diff --git a/spec/ruby/core/symbol/inspect_spec.rb b/spec/ruby/core/symbol/inspect_spec.rb index 58402ab261..6dbb36c2ad 100644 --- a/spec/ruby/core/symbol/inspect_spec.rb +++ b/spec/ruby/core/symbol/inspect_spec.rb @@ -5,6 +5,8 @@ describe "Symbol#inspect" do fred: ":fred", :fred? => ":fred?", :fred! => ":fred!", + :BAD! => ":BAD!", + :_BAD! => ":_BAD!", :$ruby => ":$ruby", :@ruby => ":@ruby", :@@ruby => ":@@ruby", diff --git a/spec/ruby/core/symbol/name_spec.rb b/spec/ruby/core/symbol/name_spec.rb index 15b9aa75e9..f9b631266c 100644 --- a/spec/ruby/core/symbol/name_spec.rb +++ b/spec/ruby/core/symbol/name_spec.rb @@ -1,19 +1,17 @@ require_relative '../../spec_helper' -ruby_version_is "3.0" do - describe "Symbol#name" do - it "returns string" do - :ruby.name.should == "ruby" - :ルビー.name.should == "ルビー" - end +describe "Symbol#name" do + it "returns string" do + :ruby.name.should == "ruby" + :ルビー.name.should == "ルビー" + end - it "returns same string instance" do - :"ruby_3".name.should.equal?(:ruby_3.name) - :"ruby_#{1+2}".name.should.equal?(:ruby_3.name) - end + it "returns same string instance" do + :"ruby_3".name.should.equal?(:ruby_3.name) + :"ruby_#{1+2}".name.should.equal?(:ruby_3.name) + end - it "returns frozen string" do - :symbol.name.should.frozen? - end + it "returns frozen string" do + :symbol.name.should.frozen? end end diff --git a/spec/ruby/core/symbol/shared/id2name.rb b/spec/ruby/core/symbol/shared/id2name.rb index 47f97bd332..d012b7634e 100644 --- a/spec/ruby/core/symbol/shared/id2name.rb +++ b/spec/ruby/core/symbol/shared/id2name.rb @@ -6,4 +6,11 @@ describe :symbol_id2name, shared: true do :@ruby.send(@method).should == "@ruby" :@@ruby.send(@method).should == "@@ruby" end + + it "returns a String in the same encoding as self" do + string = "ruby".encode("US-ASCII") + symbol = string.to_sym + + symbol.send(@method).encoding.should == Encoding::US_ASCII + end end diff --git a/spec/ruby/core/symbol/shared/slice.rb b/spec/ruby/core/symbol/shared/slice.rb index 3f07f6aedb..0df87e183d 100644 --- a/spec/ruby/core/symbol/shared/slice.rb +++ b/spec/ruby/core/symbol/shared/slice.rb @@ -190,16 +190,6 @@ describe :symbol_slice, shared: true do :symbol.send(@method, /[0-9]+/) $~.should be_nil end - - ruby_version_is ''...'2.7' do - it "returns a tainted string if the regexp is tainted" do - :symbol.send(@method, /./.taint).tainted?.should be_true - end - - it "returns an untrusted string if the regexp is untrusted" do - :symbol.send(@method, /./.untrust).untrusted?.should be_true - end - end end describe "with a capture index" do @@ -221,16 +211,6 @@ describe :symbol_slice, shared: true do :symbol.send(@method, /(sy)(mb)(ol)/, 1.5).should == "sy" end - ruby_version_is ''...'2.7' do - it "returns a tainted string if the regexp is tainted" do - :symbol.send(@method, /(.)/.taint, 1).tainted?.should be_true - end - - it "returns an untrusted string if the regexp is untrusted" do - :symbol.send(@method, /(.)/.untrust, 1).untrusted?.should be_true - end - end - describe "and an index that cannot be converted to an Integer" do it "raises a TypeError when given an Hash" do -> { :symbol.send(@method, /(sy)(mb)(ol)/, Hash.new) }.should raise_error(TypeError) diff --git a/spec/ruby/core/symbol/start_with_spec.rb b/spec/ruby/core/symbol/start_with_spec.rb index f54b3e499e..cd43279003 100644 --- a/spec/ruby/core/symbol/start_with_spec.rb +++ b/spec/ruby/core/symbol/start_with_spec.rb @@ -3,8 +3,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' require_relative '../../shared/string/start_with' -ruby_version_is "2.7" do - describe "Symbol#start_with?" do - it_behaves_like :start_with, :to_sym - end +describe "Symbol#start_with?" do + it_behaves_like :start_with, :to_sym end diff --git a/spec/ruby/core/symbol/to_proc_spec.rb b/spec/ruby/core/symbol/to_proc_spec.rb index e9261e6cdf..54eccdba11 100644 --- a/spec/ruby/core/symbol/to_proc_spec.rb +++ b/spec/ruby/core/symbol/to_proc_spec.rb @@ -12,42 +12,52 @@ describe "Symbol#to_proc" do :to_s.to_proc.call(obj).should == "Received #to_s" end - ruby_version_is ""..."3.0" do - it "returns a Proc with #lambda? false" do - pr = :to_s.to_proc - pr.should_not.lambda? - end + it "returns a Proc with #lambda? true" do + pr = :to_s.to_proc + pr.should.lambda? + end - it "produces a Proc with arity -1" do - pr = :to_s.to_proc - pr.arity.should == -1 - end + it "produces a Proc with arity -2" do + pr = :to_s.to_proc + pr.arity.should == -2 + end - it "produces a Proc that always returns [[:rest]] for #parameters" do - pr = :to_s.to_proc - pr.parameters.should == [[:rest]] - end + it "produces a Proc that always returns [[:req], [:rest]] for #parameters" do + pr = :to_s.to_proc + pr.parameters.should == [[:req], [:rest]] end - ruby_version_is "3.0" do - it "returns a Proc with #lambda? true" do - pr = :to_s.to_proc - pr.should.lambda? - end + ruby_version_is "3.2" do + it "only calls public methods" do + body = proc do + public def pub; @a << :pub end + protected def pro; @a << :pro end + private def pri; @a << :pri end + attr_reader :a + end - it "produces a Proc with arity -2" do - pr = :to_s.to_proc - pr.arity.should == -2 - end + @a = [] + singleton_class.class_eval(&body) + tap(&:pub) + proc{tap(&:pro)}.should raise_error(NoMethodError, /protected method [`']pro' called/) + proc{tap(&:pri)}.should raise_error(NoMethodError, /private method [`']pri' called/) + @a.should == [:pub] - it "produces a Proc that always returns [[:req], [:rest]] for #parameters" do - pr = :to_s.to_proc - pr.parameters.should == [[:req], [:rest]] + @a = [] + c = Class.new(&body) + o = c.new + o.instance_variable_set(:@a, []) + o.tap(&:pub) + proc{tap(&:pro)}.should raise_error(NoMethodError, /protected method [`']pro' called/) + proc{o.tap(&:pri)}.should raise_error(NoMethodError, /private method [`']pri' called/) + o.a.should == [:pub] end end it "raises an ArgumentError when calling #call on the Proc without receiver" do - -> { :object_id.to_proc.call }.should raise_error(ArgumentError, "no receiver given") + -> { + :object_id.to_proc.call + }.should raise_error(ArgumentError, /no receiver given|wrong number of arguments \(given 0, expected 1\+\)/) end it "passes along the block passed to Proc#call" do diff --git a/spec/ruby/core/thread/backtrace/limit_spec.rb b/spec/ruby/core/thread/backtrace/limit_spec.rb new file mode 100644 index 0000000000..26a87a806c --- /dev/null +++ b/spec/ruby/core/thread/backtrace/limit_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../../spec_helper' + +ruby_version_is "3.1" do + describe "Thread::Backtrace.limit" do + it "returns maximum backtrace length set by --backtrace-limit command-line option" do + out = ruby_exe("print Thread::Backtrace.limit", options: "--backtrace-limit=2") + out.should == "2" + end + + it "returns -1 when --backtrace-limit command-line option is not set" do + out = ruby_exe("print Thread::Backtrace.limit") + out.should == "-1" + end + end +end diff --git a/spec/ruby/core/thread/backtrace/location/absolute_path_spec.rb b/spec/ruby/core/thread/backtrace/location/absolute_path_spec.rb index b0ae28beee..6e381e4868 100644 --- a/spec/ruby/core/thread/backtrace/location/absolute_path_spec.rb +++ b/spec/ruby/core/thread/backtrace/location/absolute_path_spec.rb @@ -17,11 +17,30 @@ describe 'Thread::Backtrace::Location#absolute_path' do end end + it 'returns the correct absolute path when using a relative main script path and changing CWD' do + script = fixture(__FILE__, 'subdir/absolute_path_main_chdir.rb') + sibling = fixture(__FILE__, 'subdir/sibling.rb') + subdir = File.dirname script + Dir.chdir(fixture(__FILE__)) do + ruby_exe('subdir/absolute_path_main_chdir.rb').should == "subdir/absolute_path_main_chdir.rb\n#{subdir}\n#{subdir}\n#{script}\n#{sibling}\n" + end + end + context "when used in eval with a given filename" do - it "returns filename" do - code = "caller_locations(0)[0].absolute_path" - eval(code, nil, "foo.rb").should == "foo.rb" - eval(code, nil, "foo/bar.rb").should == "foo/bar.rb" + code = "caller_locations(0)[0].absolute_path" + + ruby_version_is ""..."3.1" do + it "returns filename with absolute_path" do + eval(code, nil, "foo.rb").should == "foo.rb" + eval(code, nil, "foo/bar.rb").should == "foo/bar.rb" + end + end + + ruby_version_is "3.1" do + it "returns nil with absolute_path" do + eval(code, nil, "foo.rb").should == nil + eval(code, nil, "foo/bar.rb").should == nil + end end end @@ -40,7 +59,7 @@ describe 'Thread::Backtrace::Location#absolute_path' do it "returns nil" do location = nil tap { location = caller_locations(1, 1)[0] } - location.label.should == "tap" + location.label.should =~ /\A(?:Kernel#)?tap\z/ if location.path.start_with?("<internal:") location.absolute_path.should == nil else diff --git a/spec/ruby/core/thread/backtrace/location/fixtures/subdir/absolute_path_main_chdir.rb b/spec/ruby/core/thread/backtrace/location/fixtures/subdir/absolute_path_main_chdir.rb new file mode 100644 index 0000000000..33c8fb36ef --- /dev/null +++ b/spec/ruby/core/thread/backtrace/location/fixtures/subdir/absolute_path_main_chdir.rb @@ -0,0 +1,11 @@ +puts __FILE__ +puts __dir__ +Dir.chdir __dir__ + +# Check __dir__ is still correct after chdir +puts __dir__ + +puts caller_locations(0)[0].absolute_path + +# require_relative also needs to know the absolute path of the current file so we test it here too +require_relative 'sibling' diff --git a/spec/ruby/core/thread/backtrace/location/fixtures/subdir/sibling.rb b/spec/ruby/core/thread/backtrace/location/fixtures/subdir/sibling.rb new file mode 100644 index 0000000000..2a854ddccd --- /dev/null +++ b/spec/ruby/core/thread/backtrace/location/fixtures/subdir/sibling.rb @@ -0,0 +1 @@ +puts __FILE__ diff --git a/spec/ruby/core/thread/backtrace/location/label_spec.rb b/spec/ruby/core/thread/backtrace/location/label_spec.rb index 7312d017e5..85ddccc8e3 100644 --- a/spec/ruby/core/thread/backtrace/location/label_spec.rb +++ b/spec/ruby/core/thread/backtrace/location/label_spec.rb @@ -7,11 +7,11 @@ describe 'Thread::Backtrace::Location#label' do end it 'returns the method name for a method location' do - ThreadBacktraceLocationSpecs.method_location[0].label.should == "method_location" + ThreadBacktraceLocationSpecs.method_location[0].label.should =~ /\A(?:ThreadBacktraceLocationSpecs\.)?method_location\z/ end it 'returns the block name for a block location' do - ThreadBacktraceLocationSpecs.block_location[0].label.should == "block in block_location" + ThreadBacktraceLocationSpecs.block_location[0].label.should =~ /\Ablock in (?:ThreadBacktraceLocationSpecs\.)?block_location\z/ end it 'returns the module name for a module location' do @@ -22,9 +22,9 @@ describe 'Thread::Backtrace::Location#label' do first_level_location, second_level_location, third_level_location = ThreadBacktraceLocationSpecs.locations_inside_nested_blocks - first_level_location.label.should == 'block in locations_inside_nested_blocks' - second_level_location.label.should == 'block (2 levels) in locations_inside_nested_blocks' - third_level_location.label.should == 'block (3 levels) in locations_inside_nested_blocks' + first_level_location.label.should =~ /\Ablock in (?:ThreadBacktraceLocationSpecs\.)?locations_inside_nested_blocks\z/ + second_level_location.label.should =~ /\Ablock \(2 levels\) in (?:ThreadBacktraceLocationSpecs\.)?locations_inside_nested_blocks\z/ + third_level_location.label.should =~ /\Ablock \(3 levels\) in (?:ThreadBacktraceLocationSpecs\.)?locations_inside_nested_blocks\z/ end it 'sets the location label for a top-level block differently depending on it being in the main file or a required file' do diff --git a/spec/ruby/core/thread/backtrace/location/lineno_spec.rb b/spec/ruby/core/thread/backtrace/location/lineno_spec.rb index d14cf17514..10457f80f0 100644 --- a/spec/ruby/core/thread/backtrace/location/lineno_spec.rb +++ b/spec/ruby/core/thread/backtrace/location/lineno_spec.rb @@ -7,7 +7,7 @@ describe 'Thread::Backtrace::Location#lineno' do @line = __LINE__ - 1 end - it 'returns the absolute path of the call frame' do + it 'returns the line number of the call frame' do @frame.lineno.should == @line end diff --git a/spec/ruby/core/thread/backtrace/location/path_spec.rb b/spec/ruby/core/thread/backtrace/location/path_spec.rb index 7863c055d3..75f76833a9 100644 --- a/spec/ruby/core/thread/backtrace/location/path_spec.rb +++ b/spec/ruby/core/thread/backtrace/location/path_spec.rb @@ -41,7 +41,7 @@ describe 'Thread::Backtrace::Location#path' do context 'when using a relative script path' do it 'returns a path relative to the working directory' do path = 'fixtures/main.rb' - directory = File.dirname(__FILE__) + directory = __dir__ Dir.chdir(directory) { ruby_exe(path) }.should == path diff --git a/spec/ruby/core/thread/backtrace_locations_spec.rb b/spec/ruby/core/thread/backtrace_locations_spec.rb index 237941c214..09fe622e0d 100644 --- a/spec/ruby/core/thread/backtrace_locations_spec.rb +++ b/spec/ruby/core/thread/backtrace_locations_spec.rb @@ -49,12 +49,10 @@ describe "Thread#backtrace_locations" do locations2.map(&:to_s).should == locations1[2..-1].map(&:to_s) end - ruby_version_is "2.7" do - it "can be called with an beginless range" do - locations1 = Thread.current.backtrace_locations(0) - locations2 = Thread.current.backtrace_locations(eval("(..5)")) - locations2.map(&:to_s)[eval("(2..)")].should == locations1[eval("(..5)")].map(&:to_s)[eval("(2..)")] - end + it "can be called with an beginless range" do + locations1 = Thread.current.backtrace_locations(0) + locations2 = Thread.current.backtrace_locations((..5)) + locations2.map(&:to_s)[eval("(2..)")].should == locations1[(..5)].map(&:to_s)[eval("(2..)")] end it "returns nil if omitting more locations than available" do @@ -72,7 +70,7 @@ describe "Thread#backtrace_locations" do end it "the first location reports the call to #backtrace_locations" do - Thread.current.backtrace_locations(0..0)[0].to_s.should == "#{__FILE__ }:#{__LINE__ }:in `backtrace_locations'" + Thread.current.backtrace_locations(0..0)[0].to_s.should =~ /\A#{__FILE__ }:#{__LINE__ }:in [`'](?:Thread#)?backtrace_locations'\z/ end it "[1..-1] is the same as #caller_locations(0..-1) for Thread.current" do diff --git a/spec/ruby/core/thread/backtrace_spec.rb b/spec/ruby/core/thread/backtrace_spec.rb index 9001b1b7eb..15bb29a349 100644 --- a/spec/ruby/core/thread/backtrace_spec.rb +++ b/spec/ruby/core/thread/backtrace_spec.rb @@ -13,7 +13,7 @@ describe "Thread#backtrace" do backtrace = t.backtrace backtrace.should be_kind_of(Array) - backtrace.first.should =~ /`sleep'/ + backtrace.first.should =~ /[`'](?:Kernel#)?sleep'/ t.raise 'finish the thread' t.join diff --git a/spec/ruby/core/thread/each_caller_location_spec.rb b/spec/ruby/core/thread/each_caller_location_spec.rb new file mode 100644 index 0000000000..29c271789b --- /dev/null +++ b/spec/ruby/core/thread/each_caller_location_spec.rb @@ -0,0 +1,49 @@ +require_relative '../../spec_helper' + +describe "Thread.each_caller_location" do + ruby_version_is "3.2" do + it "iterates through the current execution stack and matches caller_locations content and type" do + ScratchPad.record [] + Thread.each_caller_location { |l| ScratchPad << l; } + + ScratchPad.recorded.map(&:to_s).should == caller_locations.map(&:to_s) + ScratchPad.recorded[0].should be_kind_of(Thread::Backtrace::Location) + end + + it "returns subset of 'Thread.to_enum(:each_caller_location)' locations" do + ar = [] + ecl = Thread.each_caller_location { |x| ar << x } + + (ar.map(&:to_s) - Thread.to_enum(:each_caller_location).to_a.map(&:to_s)).should.empty? + end + + it "stops the backtrace iteration if 'break' occurs" do + i = 0 + ar = [] + ecl = Thread.each_caller_location do |x| + ar << x + i += 1 + break x if i == 2 + end + + ar.map(&:to_s).should == caller_locations(1, 2).map(&:to_s) + ecl.should be_kind_of(Thread::Backtrace::Location) + end + + it "returns nil" do + Thread.each_caller_location {}.should == nil + end + + it "raises LocalJumpError when called without a block" do + -> { + Thread.each_caller_location + }.should raise_error(LocalJumpError, "no block given") + end + + it "doesn't accept keyword arguments" do + -> { + Thread.each_caller_location(12, foo: 10) {} + }.should raise_error(ArgumentError); + end + end +end diff --git a/spec/ruby/core/thread/exclusive_spec.rb b/spec/ruby/core/thread/exclusive_spec.rb deleted file mode 100644 index 37c4b19d1a..0000000000 --- a/spec/ruby/core/thread/exclusive_spec.rb +++ /dev/null @@ -1,49 +0,0 @@ -require_relative '../../spec_helper' - -ruby_version_is ''...'3.0' do - describe "Thread.exclusive" do - before :each do - ScratchPad.clear - $VERBOSE, @verbose = nil, $VERBOSE - end - - after :each do - $VERBOSE = @verbose - end - - it "yields to the block" do - Thread.exclusive { ScratchPad.record true } - ScratchPad.recorded.should == true - end - - it "returns the result of yielding" do - Thread.exclusive { :result }.should == :result - end - - it "blocks the caller if another thread is also in an exclusive block" do - m = Mutex.new - q1 = Queue.new - q2 = Queue.new - - t = Thread.new { - Thread.exclusive { - q1.push :ready - q2.pop - } - } - - q1.pop.should == :ready - - -> { Thread.exclusive { } }.should block_caller - - q2.push :done - t.join - end - - it "is not recursive" do - Thread.exclusive do - -> { Thread.exclusive { } }.should raise_error(ThreadError) - end - end - end -end diff --git a/spec/ruby/core/thread/fetch_spec.rb b/spec/ruby/core/thread/fetch_spec.rb index 6b37d4cfc5..85ffb71874 100644 --- a/spec/ruby/core/thread/fetch_spec.rb +++ b/spec/ruby/core/thread/fetch_spec.rb @@ -29,6 +29,36 @@ describe 'Thread#fetch' do end end + describe 'with a block' do + it 'returns the value of the fiber-local variable if value has been assigned' do + th = Thread.new { Thread.current[:cat] = 'meow' } + th.join + th.fetch(:cat) { true }.should == 'meow' + end + + it "returns the block value if fiber-local variable hasn't been assigned" do + th = Thread.new {} + th.join + th.fetch(:cat) { true }.should == true + end + + it "does not call the block if value has been assigned" do + th = Thread.new { Thread.current[:cat] = 'meow' } + th.join + var = :not_updated + th.fetch(:cat) { var = :updated }.should == 'meow' + var.should == :not_updated + end + + it "uses the block if a default is given and warns about it" do + th = Thread.new {} + th.join + -> { + th.fetch(:cat, false) { true }.should == true + }.should complain(/warning: block supersedes default value argument/) + end + end + it 'raises an ArgumentError when not passed one or two arguments' do -> { Thread.current.fetch() }.should raise_error(ArgumentError) -> { Thread.current.fetch(1, 2, 3) }.should raise_error(ArgumentError) diff --git a/spec/ruby/core/thread/ignore_deadlock_spec.rb b/spec/ruby/core/thread/ignore_deadlock_spec.rb new file mode 100644 index 0000000000..b48bc9f9b0 --- /dev/null +++ b/spec/ruby/core/thread/ignore_deadlock_spec.rb @@ -0,0 +1,19 @@ +require_relative '../../spec_helper' + +describe "Thread.ignore_deadlock" do + it "returns false by default" do + Thread.ignore_deadlock.should == false + end +end + +describe "Thread.ignore_deadlock=" do + it "changes the value of Thread.ignore_deadlock" do + ignore_deadlock = Thread.ignore_deadlock + Thread.ignore_deadlock = true + begin + Thread.ignore_deadlock.should == true + ensure + Thread.ignore_deadlock = ignore_deadlock + end + end +end diff --git a/spec/ruby/core/thread/kill_spec.rb b/spec/ruby/core/thread/kill_spec.rb index f932bf5232..4b62c686c7 100644 --- a/spec/ruby/core/thread/kill_spec.rb +++ b/spec/ruby/core/thread/kill_spec.rb @@ -9,10 +9,6 @@ platform_is_not :mingw do it_behaves_like :thread_exit, :kill end - describe "Thread#kill!" do - it "needs to be reviewed for spec completeness" - end - describe "Thread.kill" do it "causes the given thread to exit" do thread = Thread.new { sleep } diff --git a/spec/ruby/core/thread/native_thread_id_spec.rb b/spec/ruby/core/thread/native_thread_id_spec.rb new file mode 100644 index 0000000000..17a08c8a15 --- /dev/null +++ b/spec/ruby/core/thread/native_thread_id_spec.rb @@ -0,0 +1,37 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.1" do + platform_is :linux, :darwin, :windows, :freebsd do + describe "Thread#native_thread_id" do + it "returns an integer when the thread is alive" do + Thread.current.native_thread_id.should be_kind_of(Integer) + end + + it "returns nil when the thread is not running" do + t = Thread.new {} + t.join + t.native_thread_id.should == nil + end + + it "each thread has different native thread id" do + t = Thread.new { sleep } + Thread.pass until t.stop? + main_thread_id = Thread.current.native_thread_id + t_thread_id = t.native_thread_id + + if ruby_version_is "3.3" + # native_thread_id can be nil on a M:N scheduler + t_thread_id.should be_kind_of(Integer) if t_thread_id != nil + else + t_thread_id.should be_kind_of(Integer) + end + + main_thread_id.should_not == t_thread_id + + t.run + t.join + t.native_thread_id.should == nil + end + end + end +end diff --git a/spec/ruby/core/thread/raise_spec.rb b/spec/ruby/core/thread/raise_spec.rb index 27de3cc627..49323cf270 100644 --- a/spec/ruby/core/thread/raise_spec.rb +++ b/spec/ruby/core/thread/raise_spec.rb @@ -102,6 +102,30 @@ describe "Thread#raise on a sleeping thread" do raised_again.backtrace.first.should_not include("#{__FILE__}:#{raise_again_line}:") end end + + it "calls #exception in both the caller and in the target thread" do + cls = Class.new(Exception) do + attr_accessor :log + def initialize(*args) + @log = [] # This is shared because the super #exception uses a shallow clone + super + end + + def exception(*args) + @log << [self, Thread.current, args] + super + end + end + exc = cls.new + + @thr.raise exc, "Thread#raise #exception spec" + @thr.join + ScratchPad.recorded.should.is_a?(cls) + exc.log.should == [ + [exc, Thread.current, ["Thread#raise #exception spec"]], + [ScratchPad.recorded, @thr, []] + ] + end end describe "Thread#raise on a running thread" do diff --git a/spec/ruby/core/thread/report_on_exception_spec.rb b/spec/ruby/core/thread/report_on_exception_spec.rb index bf50a167df..d9daa041cd 100644 --- a/spec/ruby/core/thread/report_on_exception_spec.rb +++ b/spec/ruby/core/thread/report_on_exception_spec.rb @@ -60,6 +60,55 @@ describe "Thread#report_on_exception=" do t.join }.should raise_error(RuntimeError, "Thread#report_on_exception specs") end + + it "prints a backtrace on $stderr in the regular backtrace order" do + line_raise = __LINE__ + 2 + def foo + raise RuntimeError, "Thread#report_on_exception specs backtrace order" + end + + line_call_foo = __LINE__ + 5 + go = false + t = Thread.new { + Thread.current.report_on_exception = true + Thread.pass until go + foo + } + + -> { + go = true + Thread.pass while t.alive? + }.should output("", /\A +#{Regexp.quote(t.inspect)}\sterminated\swith\sexception\s\(report_on_exception\sis\strue\):\n +#{Regexp.quote(__FILE__)}:#{line_raise}:in\s[`']foo':\sThread\#report_on_exception\sspecs\sbacktrace\sorder\s\(RuntimeError\)\n +\tfrom\s#{Regexp.quote(__FILE__)}:#{line_call_foo}:in\s[`']block\s\(4\slevels\)\sin\s<top\s\(required\)>'\n +\z/x) + + -> { + t.join + }.should raise_error(RuntimeError, "Thread#report_on_exception specs backtrace order") + end + + it "prints the backtrace even if the thread was killed just after Thread#raise" do + t = nil + ready = false + -> { + t = Thread.new { + Thread.current.report_on_exception = true + ready = true + sleep + } + + Thread.pass until ready and t.stop? + t.raise RuntimeError, "Thread#report_on_exception before kill spec" + t.kill + Thread.pass while t.alive? + }.should output("", /Thread.+terminated with exception.+Thread#report_on_exception before kill spec/m) + + -> { + t.join + }.should raise_error(RuntimeError, "Thread#report_on_exception before kill spec") + end end describe "when set to false" do diff --git a/spec/ruby/core/thread/shared/exit.rb b/spec/ruby/core/thread/shared/exit.rb index 40dc478947..13e8832684 100644 --- a/spec/ruby/core/thread/shared/exit.rb +++ b/spec/ruby/core/thread/shared/exit.rb @@ -66,6 +66,26 @@ describe :thread_exit, shared: true do ScratchPad.recorded.should == nil end + it "does not reset $!" do + ScratchPad.record [] + + exc = RuntimeError.new("foo") + thread = Thread.new do + begin + raise exc + ensure + ScratchPad << $! + begin + Thread.current.send(@method) + ensure + ScratchPad << $! + end + end + end + thread.join + ScratchPad.recorded.should == [exc, exc] + end + it "cannot be rescued" do thread = Thread.new do begin @@ -73,7 +93,7 @@ describe :thread_exit, shared: true do rescue Exception ScratchPad.record :in_rescue end - ScratchPad.record :end_of_thread_block + ScratchPad.record :end_of_thread_block end thread.join @@ -93,6 +113,25 @@ describe :thread_exit, shared: true do ScratchPad.recorded.should == nil end + it "kills other fibers of that thread without running their ensure clauses" do + t = Thread.new do + f = Fiber.new do + ScratchPad.record :fiber_resumed + begin + Fiber.yield + ensure + ScratchPad.record :fiber_ensure + end + end + f.resume + sleep + end + Thread.pass until t.stop? + t.send(@method) + t.join + ScratchPad.recorded.should == :fiber_resumed + end + # This spec is a mess. It fails randomly, it hangs on MRI, it needs to be removed quarantine! do it "killing dying running does nothing" do diff --git a/spec/ruby/core/thread/shared/to_s.rb b/spec/ruby/core/thread/shared/to_s.rb index 45c04af627..43640deb33 100644 --- a/spec/ruby/core/thread/shared/to_s.rb +++ b/spec/ruby/core/thread/shared/to_s.rb @@ -1,12 +1,10 @@ require_relative '../fixtures/classes' describe :thread_to_s, shared: true do - sep = ruby_version_is("2.7") ? " " : "@" - it "returns a description including file and line number" do thread, line = Thread.new { "hello" }, __LINE__ thread.join - thread.send(@method).should =~ /^#<Thread:([^ ]*?)#{sep}#{Regexp.escape __FILE__}:#{line} \w+>$/ + thread.send(@method).should =~ /^#<Thread:([^ ]*?) #{Regexp.escape __FILE__}:#{line} \w+>$/ end it "has a binary encoding" do diff --git a/spec/ruby/core/thread/thread_variable_get_spec.rb b/spec/ruby/core/thread/thread_variable_get_spec.rb index 38f90d5830..0ad19bfd88 100644 --- a/spec/ruby/core/thread/thread_variable_get_spec.rb +++ b/spec/ruby/core/thread/thread_variable_get_spec.rb @@ -13,7 +13,7 @@ describe "Thread#thread_variable_get" do @t.thread_variable_get(:a).should be_nil end - it "returns the value previously set by #[]=" do + it "returns the value previously set by #thread_variable_set" do @t.thread_variable_set :a, 49 @t.thread_variable_get(:a).should == 49 end diff --git a/spec/ruby/core/time/_load_spec.rb b/spec/ruby/core/time/_load_spec.rb index 152934370f..bb0d705bbc 100644 --- a/spec/ruby/core/time/_load_spec.rb +++ b/spec/ruby/core/time/_load_spec.rb @@ -44,8 +44,7 @@ describe "Time._load" do end it "treats the data as binary data" do - data = "\x04\bu:\tTime\r\fM\x1C\xC0\x00\x00\xD0\xBE" - data.force_encoding Encoding::UTF_8 + data = "\x04\bu:\tTime\r\fM\x1C\xC0\x00\x00\xD0\xBE".dup.force_encoding Encoding::UTF_8 t = Marshal.load(data) t.to_s.should == "2013-04-08 12:47:45 UTC" end diff --git a/spec/ruby/core/time/at_spec.rb b/spec/ruby/core/time/at_spec.rb index 2cc46ab8c9..48fb3c6f52 100644 --- a/spec/ruby/core/time/at_spec.rb +++ b/spec/ruby/core/time/at_spec.rb @@ -32,13 +32,6 @@ describe "Time.at" do t2.nsec.should == t.nsec end - describe "passed BigDecimal" do - it "doesn't round input value" do - require 'bigdecimal' - Time.at(BigDecimal('1.1')).to_f.should == 1.1 - end - end - describe "passed Rational" do it "returns Time with correct microseconds" do t = Time.at(Rational(1_486_570_508_539_759, 1_000_000)) @@ -203,7 +196,7 @@ describe "Time.at" do end it "does not try to convert format to Symbol with #to_sym" do - format = "usec" + format = +"usec" format.should_not_receive(:to_sym) -> { Time.at(0, 123456, format) }.should raise_error(ArgumentError) end @@ -251,6 +244,22 @@ describe "Time.at" do time.to_i.should == @epoch_time end + it "could be UTC offset as a 'UTC' String" do + time = Time.at(@epoch_time, in: "UTC") + + time.utc_offset.should == 0 + time.zone.should == "UTC" + time.to_i.should == @epoch_time + end + + it "could be UTC offset as a military zone A-Z" do + time = Time.at(@epoch_time, in: "B") + + time.utc_offset.should == 3600 * 2 + time.zone.should == nil + time.to_i.should == @epoch_time + end + it "could be a timezone object" do zone = TimeSpecs::TimezoneWithName.new(name: "Asia/Colombo") time = Time.at(@epoch_time, in: zone) @@ -266,5 +275,10 @@ describe "Time.at" do time.zone.should == zone time.to_i.should == @epoch_time end + + it "raises ArgumentError if format is invalid" do + -> { Time.at(@epoch_time, in: "+09:99") }.should raise_error(ArgumentError) + -> { Time.at(@epoch_time, in: "ABC") }.should raise_error(ArgumentError) + end end end diff --git a/spec/ruby/core/time/ceil_spec.rb b/spec/ruby/core/time/ceil_spec.rb index 86029554db..9d624a1ed0 100644 --- a/spec/ruby/core/time/ceil_spec.rb +++ b/spec/ruby/core/time/ceil_spec.rb @@ -1,46 +1,44 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Time#ceil" do - before do - @time = Time.utc(2010, 3, 30, 5, 43, "25.0123456789".to_r) - end - - it "defaults to ceiling to 0 places" do - @time.ceil.should == Time.utc(2010, 3, 30, 5, 43, 26.to_r) - end +describe "Time#ceil" do + before do + @time = Time.utc(2010, 3, 30, 5, 43, "25.0123456789".to_r) + end - it "ceils to 0 decimal places with an explicit argument" do - @time.ceil(0).should == Time.utc(2010, 3, 30, 5, 43, 26.to_r) - end + it "defaults to ceiling to 0 places" do + @time.ceil.should == Time.utc(2010, 3, 30, 5, 43, 26.to_r) + end - it "ceils to 2 decimal places with an explicit argument" do - @time.ceil(2).should == Time.utc(2010, 3, 30, 5, 43, "25.02".to_r) - end + it "ceils to 0 decimal places with an explicit argument" do + @time.ceil(0).should == Time.utc(2010, 3, 30, 5, 43, 26.to_r) + end - it "ceils to 4 decimal places with an explicit argument" do - @time.ceil(4).should == Time.utc(2010, 3, 30, 5, 43, "25.0124".to_r) - end + it "ceils to 2 decimal places with an explicit argument" do + @time.ceil(2).should == Time.utc(2010, 3, 30, 5, 43, "25.02".to_r) + end - it "ceils to 7 decimal places with an explicit argument" do - @time.ceil(7).should == Time.utc(2010, 3, 30, 5, 43, "25.0123457".to_r) - end + it "ceils to 4 decimal places with an explicit argument" do + @time.ceil(4).should == Time.utc(2010, 3, 30, 5, 43, "25.0124".to_r) + end - it "returns an instance of Time, even if #ceil is called on a subclass" do - subclass = Class.new(Time) - instance = subclass.at(0) - instance.class.should equal subclass - instance.ceil.should be_an_instance_of(Time) - end + it "ceils to 7 decimal places with an explicit argument" do + @time.ceil(7).should == Time.utc(2010, 3, 30, 5, 43, "25.0123457".to_r) + end - it "copies own timezone to the returning value" do - @time.zone.should == @time.ceil.zone + it "returns an instance of Time, even if #ceil is called on a subclass" do + subclass = Class.new(Time) + instance = subclass.at(0) + instance.class.should equal subclass + instance.ceil.should be_an_instance_of(Time) + end - time = with_timezone "JST-9" do - Time.at 0, 1 - end + it "copies own timezone to the returning value" do + @time.zone.should == @time.ceil.zone - time.zone.should == time.ceil.zone + time = with_timezone "JST-9" do + Time.at 0, 1 end + + time.zone.should == time.ceil.zone end end diff --git a/spec/ruby/core/time/deconstruct_keys_spec.rb b/spec/ruby/core/time/deconstruct_keys_spec.rb new file mode 100644 index 0000000000..ee17e7dbd4 --- /dev/null +++ b/spec/ruby/core/time/deconstruct_keys_spec.rb @@ -0,0 +1,45 @@ +require_relative '../../spec_helper' + +ruby_version_is "3.2" do + describe "Time#deconstruct_keys" do + it "returns whole hash for nil as an argument" do + d = Time.utc(2022, 10, 5, 13, 30) + res = { year: 2022, month: 10, day: 5, yday: 278, wday: 3, hour: 13, + min: 30, sec: 0, subsec: 0, dst: false, zone: "UTC" } + d.deconstruct_keys(nil).should == res + end + + it "returns only specified keys" do + d = Time.utc(2022, 10, 5, 13, 39) + d.deconstruct_keys([:zone, :subsec]).should == { zone: "UTC", subsec: 0 } + end + + it "requires one argument" do + -> { + Time.new(2022, 10, 5, 13, 30).deconstruct_keys + }.should raise_error(ArgumentError) + end + + it "it raises error when argument is neither nil nor array" do + d = Time.new(2022, 10, 5, 13, 30) + + -> { d.deconstruct_keys(1) }.should raise_error(TypeError, "wrong argument type Integer (expected Array or nil)") + -> { d.deconstruct_keys("asd") }.should raise_error(TypeError, "wrong argument type String (expected Array or nil)") + -> { d.deconstruct_keys(:x) }.should raise_error(TypeError, "wrong argument type Symbol (expected Array or nil)") + -> { d.deconstruct_keys({}) }.should raise_error(TypeError, "wrong argument type Hash (expected Array or nil)") + end + + it "returns {} when passed []" do + Time.new(2022, 10, 5, 13, 30).deconstruct_keys([]).should == {} + end + + it "ignores non-Symbol keys" do + Time.new(2022, 10, 5, 13, 30).deconstruct_keys(['year', []]).should == {} + end + + it "ignores not existing Symbol keys and processes keys after the first non-existing one" do + d = Time.utc(2022, 10, 5, 13, 30) + d.deconstruct_keys([:year, :a, :month, :b, :day]).should == { year: 2022, month: 10, day: 5 } + end + end +end diff --git a/spec/ruby/core/time/fixtures/classes.rb b/spec/ruby/core/time/fixtures/classes.rb index 1a9511b261..21c4e1effb 100644 --- a/spec/ruby/core/time/fixtures/classes.rb +++ b/spec/ruby/core/time/fixtures/classes.rb @@ -59,7 +59,6 @@ module TimeSpecs Zone = Struct.new(:std, :dst, :dst_range) Zones = { "Asia/Colombo" => Zone[Z[5*3600+30*60, "MMT"], nil, nil], - "Europe/Kiev" => Zone[Z[2*3600, "EET"], Z[3*3600, "EEST"], 4..10], "PST" => Zone[Z[(-9*60*60), "PST"], nil, nil], } diff --git a/spec/ruby/core/time/floor_spec.rb b/spec/ruby/core/time/floor_spec.rb index a19585b787..b0003469c9 100644 --- a/spec/ruby/core/time/floor_spec.rb +++ b/spec/ruby/core/time/floor_spec.rb @@ -1,38 +1,36 @@ require_relative '../../spec_helper' -ruby_version_is "2.7" do - describe "Time#floor" do - before do - @time = Time.utc(2010, 3, 30, 5, 43, "25.123456789".to_r) - end - - it "defaults to flooring to 0 places" do - @time.floor.should == Time.utc(2010, 3, 30, 5, 43, 25.to_r) - end +describe "Time#floor" do + before do + @time = Time.utc(2010, 3, 30, 5, 43, "25.123456789".to_r) + end - it "floors to 0 decimal places with an explicit argument" do - @time.floor(0).should == Time.utc(2010, 3, 30, 5, 43, 25.to_r) - end + it "defaults to flooring to 0 places" do + @time.floor.should == Time.utc(2010, 3, 30, 5, 43, 25.to_r) + end - it "floors to 7 decimal places with an explicit argument" do - @time.floor(7).should == Time.utc(2010, 3, 30, 5, 43, "25.1234567".to_r) - end + it "floors to 0 decimal places with an explicit argument" do + @time.floor(0).should == Time.utc(2010, 3, 30, 5, 43, 25.to_r) + end - it "returns an instance of Time, even if #floor is called on a subclass" do - subclass = Class.new(Time) - instance = subclass.at(0) - instance.class.should equal subclass - instance.floor.should be_an_instance_of(Time) - end + it "floors to 7 decimal places with an explicit argument" do + @time.floor(7).should == Time.utc(2010, 3, 30, 5, 43, "25.1234567".to_r) + end - it "copies own timezone to the returning value" do - @time.zone.should == @time.floor.zone + it "returns an instance of Time, even if #floor is called on a subclass" do + subclass = Class.new(Time) + instance = subclass.at(0) + instance.class.should equal subclass + instance.floor.should be_an_instance_of(Time) + end - time = with_timezone "JST-9" do - Time.at 0, 1 - end + it "copies own timezone to the returning value" do + @time.zone.should == @time.floor.zone - time.zone.should == time.floor.zone + time = with_timezone "JST-9" do + Time.at 0, 1 end + + time.zone.should == time.floor.zone end end diff --git a/spec/ruby/core/time/inspect_spec.rb b/spec/ruby/core/time/inspect_spec.rb index 6f1b2e3ef1..c3a4519a24 100644 --- a/spec/ruby/core/time/inspect_spec.rb +++ b/spec/ruby/core/time/inspect_spec.rb @@ -4,32 +4,30 @@ require_relative 'shared/inspect' describe "Time#inspect" do it_behaves_like :inspect, :inspect - ruby_version_is "2.7" do - it "preserves microseconds" do - t = Time.utc(2007, 11, 1, 15, 25, 0, 123456) - t.inspect.should == "2007-11-01 15:25:00.123456 UTC" - end + it "preserves microseconds" do + t = Time.utc(2007, 11, 1, 15, 25, 0, 123456) + t.inspect.should == "2007-11-01 15:25:00.123456 UTC" + end - it "omits trailing zeros from microseconds" do - t = Time.utc(2007, 11, 1, 15, 25, 0, 100000) - t.inspect.should == "2007-11-01 15:25:00.1 UTC" - end + it "omits trailing zeros from microseconds" do + t = Time.utc(2007, 11, 1, 15, 25, 0, 100000) + t.inspect.should == "2007-11-01 15:25:00.1 UTC" + end - it "uses the correct time zone without microseconds" do - t = Time.utc(2000, 1, 1) - t = t.localtime(9*3600) - t.inspect.should == "2000-01-01 09:00:00 +0900" - end + it "uses the correct time zone without microseconds" do + t = Time.utc(2000, 1, 1) + t = t.localtime(9*3600) + t.inspect.should == "2000-01-01 09:00:00 +0900" + end - it "uses the correct time zone with microseconds" do - t = Time.utc(2000, 1, 1, 0, 0, 0, 123456) - t = t.localtime(9*3600) - t.inspect.should == "2000-01-01 09:00:00.123456 +0900" - end + it "uses the correct time zone with microseconds" do + t = Time.utc(2000, 1, 1, 0, 0, 0, 123456) + t = t.localtime(9*3600) + t.inspect.should == "2000-01-01 09:00:00.123456 +0900" + end - it "preserves nanoseconds" do - t = Time.utc(2007, 11, 1, 15, 25, 0, 123456.789r) - t.inspect.should == "2007-11-01 15:25:00.123456789 UTC" - end + it "preserves nanoseconds" do + t = Time.utc(2007, 11, 1, 15, 25, 0, 123456.789r) + t.inspect.should == "2007-11-01 15:25:00.123456789 UTC" end end diff --git a/spec/ruby/core/time/localtime_spec.rb b/spec/ruby/core/time/localtime_spec.rb index 2975e112d0..609b6532a1 100644 --- a/spec/ruby/core/time/localtime_spec.rb +++ b/spec/ruby/core/time/localtime_spec.rb @@ -29,10 +29,10 @@ describe "Time#localtime" do time.localtime.should equal(time) end - it "raises a RuntimeError if the time has a different time zone" do + it "raises a FrozenError if the time has a different time zone" do time = Time.gm(2007, 1, 9, 12, 0, 0) time.freeze - -> { time.localtime }.should raise_error(RuntimeError) + -> { time.localtime }.should raise_error(FrozenError) end end @@ -79,6 +79,18 @@ describe "Time#localtime" do t.utc_offset.should == -3600 end + it "returns a Time with a UTC offset specified as UTC" do + t = Time.new(2007, 1, 9, 12, 0, 0, 3600) + t.localtime("UTC") + t.utc_offset.should == 0 + end + + it "returns a Time with a UTC offset specified as A-Z military zone" do + t = Time.new(2007, 1, 9, 12, 0, 0, 3600) + t.localtime("B") + t.utc_offset.should == 3600 * 2 + end + platform_is_not :windows do it "changes the timezone according to the set one" do t = Time.new(2005, 2, 27, 22, 50, 0, -3600) diff --git a/spec/ruby/core/time/new_spec.rb b/spec/ruby/core/time/new_spec.rb index 09b4d03a44..d686355270 100644 --- a/spec/ruby/core/time/new_spec.rb +++ b/spec/ruby/core/time/new_spec.rb @@ -58,6 +58,32 @@ describe "Time.new with a utc_offset argument" do Time.new(2000, 1, 1, 0, 0, 0, "-04:10:43").utc_offset.should == -15043 end + ruby_bug '#13669', ''...'3.1' do + it "returns a Time with a UTC offset specified as +HH" do + Time.new(2000, 1, 1, 0, 0, 0, "+05").utc_offset.should == 3600 * 5 + end + + it "returns a Time with a UTC offset specified as -HH" do + Time.new(2000, 1, 1, 0, 0, 0, "-05").utc_offset.should == -3600 * 5 + end + + it "returns a Time with a UTC offset specified as +HHMM" do + Time.new(2000, 1, 1, 0, 0, 0, "+0530").utc_offset.should == 19800 + end + + it "returns a Time with a UTC offset specified as -HHMM" do + Time.new(2000, 1, 1, 0, 0, 0, "-0530").utc_offset.should == -19800 + end + + it "returns a Time with a UTC offset specified as +HHMMSS" do + Time.new(2000, 1, 1, 0, 0, 0, "+053037").utc_offset.should == 19837 + end + + it "returns a Time with a UTC offset specified as -HHMMSS" do + Time.new(2000, 1, 1, 0, 0, 0, "-053037").utc_offset.should == -19837 + end + end + describe "with an argument that responds to #to_str" do it "coerces using #to_str" do o = mock('string') @@ -66,6 +92,57 @@ describe "Time.new with a utc_offset argument" do end end + it "returns a Time with UTC offset specified as UTC" do + Time.new(2000, 1, 1, 0, 0, 0, "UTC").utc_offset.should == 0 + end + + it "returns a Time with UTC offset specified as a single letter military timezone" do + [ + ["A", 3600], + ["B", 3600 * 2], + ["C", 3600 * 3], + ["D", 3600 * 4], + ["E", 3600 * 5], + ["F", 3600 * 6], + ["G", 3600 * 7], + ["H", 3600 * 8], + ["I", 3600 * 9], + # J is not supported + ["K", 3600 * 10], + ["L", 3600 * 11], + ["M", 3600 * 12], + ["N", 3600 * -1], + ["O", 3600 * -2], + ["P", 3600 * -3], + ["Q", 3600 * -4], + ["R", 3600 * -5], + ["S", 3600 * -6], + ["T", 3600 * -7], + ["U", 3600 * -8], + ["V", 3600 * -9], + ["W", 3600 * -10], + ["X", 3600 * -11], + ["Y", 3600 * -12], + ["Z", 0] + ].each do |letter, offset| + Time.new(2000, 1, 1, 0, 0, 0, letter).utc_offset.should == offset + end + end + + ruby_version_is ""..."3.1" do + it "raises ArgumentError if the string argument is J" do + message = '"+HH:MM", "-HH:MM", "UTC" or "A".."I","K".."Z" expected for utc_offset' + -> { Time.new(2000, 1, 1, 0, 0, 0, "J") }.should raise_error(ArgumentError, message) + end + end + + ruby_version_is "3.1" do + it "raises ArgumentError if the string argument is J" do + message = '"+HH:MM", "-HH:MM", "UTC" or "A".."I","K".."Z" expected for utc_offset: J' + -> { Time.new(2000, 1, 1, 0, 0, 0, "J") }.should raise_error(ArgumentError, message) + end + end + it "returns a local Time if the argument is nil" do with_timezone("PST", -8) do t = Time.new(2000, 1, 1, 0, 0, 0, nil) @@ -93,7 +170,12 @@ describe "Time.new with a utc_offset argument" do end it "raises ArgumentError if the String argument is not in an ASCII-compatible encoding" do - -> { Time.new(2000, 1, 1, 0, 0, 0, "-04:10".encode("UTF-16LE")) }.should raise_error(ArgumentError) + # Don't check exception message - it was changed in previous CRuby versions: + # - "string contains null byte" + # - '"+HH:MM", "-HH:MM", "UTC" or "A".."I","K".."Z" expected for utc_offset' + -> { + Time.new(2000, 1, 1, 0, 0, 0, "-04:10".encode("UTF-16LE")) + }.should raise_error(ArgumentError) end it "raises ArgumentError if the argument represents a value less than or equal to -86400 seconds" do @@ -106,19 +188,9 @@ describe "Time.new with a utc_offset argument" do -> { Time.new(2000, 1, 1, 0, 0, 0, 86400) }.should raise_error(ArgumentError) end - it "raises ArgumentError if the seconds argument is negative" do - -> { Time.new(2000, 1, 1, 0, 0, -1) }.should raise_error(ArgumentError) - end - it "raises ArgumentError if the utc_offset argument is greater than or equal to 10e9" do -> { Time.new(2000, 1, 1, 0, 0, 0, 1000000000) }.should raise_error(ArgumentError) end - - it "raises ArgumentError if the month is greater than 12" do - # For some reason MRI uses a different message for month in 13-15 and month>=16 - -> { Time.new(2000, 13, 1, 0, 0, 0, "+01:00") }.should raise_error(ArgumentError, /(mon|argument) out of range/) - -> { Time.new(2000, 16, 1, 0, 0, 0, "+01:00") }.should raise_error(ArgumentError, "argument out of range") - end end describe "Time.new with a timezone argument" do @@ -128,10 +200,8 @@ describe "Time.new with a timezone argument" do time.zone.should == zone time.utc_offset.should == 5*3600+30*60 - ruby_version_is "3.0" do - time.wday.should == 6 - time.yday.should == 1 - end + time.wday.should == 6 + time.yday.should == 1 end it "accepts timezone argument that must have #local_to_utc and #utc_to_local methods" do @@ -288,7 +358,7 @@ describe "Time.new with a timezone argument" do -> { Marshal.dump(time) - }.should raise_error(NoMethodError, /undefined method `name' for/) + }.should raise_error(NoMethodError, /undefined method [`']name' for/) end end @@ -332,4 +402,245 @@ describe "Time.new with a timezone argument" do end end end + + ruby_version_is '3.1' do # https://bugs.ruby-lang.org/issues/17485 + describe ":in keyword argument" do + it "could be UTC offset as a String in '+HH:MM or '-HH:MM' format" do + time = Time.new(2000, 1, 1, 12, 0, 0, in: "+05:00") + + time.utc_offset.should == 5*60*60 + time.zone.should == nil + + time = Time.new(2000, 1, 1, 12, 0, 0, in: "-09:00") + + time.utc_offset.should == -9*60*60 + time.zone.should == nil + end + + it "could be UTC offset as a number of seconds" do + time = Time.new(2000, 1, 1, 12, 0, 0, in: 5*60*60) + + time.utc_offset.should == 5*60*60 + time.zone.should == nil + + time = Time.new(2000, 1, 1, 12, 0, 0, in: -9*60*60) + + time.utc_offset.should == -9*60*60 + time.zone.should == nil + end + + it "returns a Time with UTC offset specified as a single letter military timezone" do + Time.new(2000, 1, 1, 0, 0, 0, in: "W").utc_offset.should == 3600 * -10 + end + + it "could be a timezone object" do + zone = TimeSpecs::TimezoneWithName.new(name: "Asia/Colombo") + time = Time.new(2000, 1, 1, 12, 0, 0, in: zone) + + time.utc_offset.should == 5*3600+30*60 + time.zone.should == zone + + zone = TimeSpecs::TimezoneWithName.new(name: "PST") + time = Time.new(2000, 1, 1, 12, 0, 0, in: zone) + + time.utc_offset.should == -9*60*60 + time.zone.should == zone + end + + it "allows omitting minor arguments" do + Time.new(2000, 1, 1, 12, 1, 1, in: "+05:00").should == Time.new(2000, 1, 1, 12, 1, 1, "+05:00") + Time.new(2000, 1, 1, 12, 1, in: "+05:00").should == Time.new(2000, 1, 1, 12, 1, 0, "+05:00") + Time.new(2000, 1, 1, 12, in: "+05:00").should == Time.new(2000, 1, 1, 12, 0, 0, "+05:00") + Time.new(2000, 1, 1, in: "+05:00").should == Time.new(2000, 1, 1, 0, 0, 0, "+05:00") + Time.new(2000, 1, in: "+05:00").should == Time.new(2000, 1, 1, 0, 0, 0, "+05:00") + Time.new(2000, in: "+05:00").should == Time.new(2000, 1, 1, 0, 0, 0, "+05:00") + Time.new(in: "+05:00").should be_close(Time.now.getlocal("+05:00"), TIME_TOLERANCE) + end + + it "converts to a provided timezone if all the positional arguments are omitted" do + Time.new(in: "+05:00").utc_offset.should == 5*3600 + end + + it "raises ArgumentError if format is invalid" do + -> { Time.new(2000, 1, 1, 12, 0, 0, in: "+09:99") }.should raise_error(ArgumentError) + -> { Time.new(2000, 1, 1, 12, 0, 0, in: "ABC") }.should raise_error(ArgumentError) + end + + it "raises ArgumentError if two offset arguments are given" do + -> { + Time.new(2000, 1, 1, 12, 0, 0, "+05:00", in: "+05:00") + }.should raise_error(ArgumentError, "timezone argument given as positional and keyword arguments") + end + end + end + + ruby_version_is "3.2" do + describe "Time.new with a String argument" do + it "parses an ISO-8601 like format" do + t = Time.utc(2020, 12, 24, 15, 56, 17) + + Time.new("2020-12-24T15:56:17Z").should == t + Time.new("2020-12-25 00:56:17 +09:00").should == t + Time.new("2020-12-25 00:57:47 +09:01:30").should == t + Time.new("2020-12-25 00:56:17 +0900").should == t + Time.new("2020-12-25 00:57:47 +090130").should == t + Time.new("2020-12-25T00:56:17+09:00").should == t + end + + it "accepts precision keyword argument and truncates specified digits of sub-second part" do + Time.new("2021-12-25 00:00:00.123456789876 +09:00").subsec.should == 0.123456789r + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: nil).subsec.should == 0.123456789876r + Time.new("2021-12-25 00:00:00 +09:00", precision: 0).subsec.should == 0 + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: -1).subsec.should == 0.123456789876r + end + + it "returns Time in local timezone if not provided in the String argument" do + Time.new("2021-12-25 00:00:00").zone.should == Time.new(2021, 12, 25).zone + Time.new("2021-12-25 00:00:00").utc_offset.should == Time.new(2021, 12, 25).utc_offset + end + + it "returns Time in timezone specified in the String argument" do + Time.new("2021-12-25 00:00:00 +05:00").to_s.should == "2021-12-25 00:00:00 +0500" + end + + it "returns Time in timezone specified in the String argument even if the in keyword argument provided" do + Time.new("2021-12-25 00:00:00 +09:00", in: "-01:00").to_s.should == "2021-12-25 00:00:00 +0900" + end + + it "returns Time in timezone specified with in keyword argument if timezone isn't provided in the String argument" do + Time.new("2021-12-25 00:00:00", in: "-01:00").to_s.should == "2021-12-25 00:00:00 -0100" + end + + it "converts precision keyword argument into Integer if is not nil" do + obj = Object.new + def obj.to_int; 3; end + + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: 1.2).subsec.should == 0.1r + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: obj).subsec.should == 0.123r + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: 3r).subsec.should == 0.123r + end + + ruby_version_is ""..."3.3" do + it "raise TypeError is can't convert precision keyword argument into Integer" do + -> { + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: "") + }.should raise_error(TypeError, "no implicit conversion from string") + end + end + + ruby_version_is "3.3" do + it "raise TypeError is can't convert precision keyword argument into Integer" do + -> { + Time.new("2021-12-25 00:00:00.123456789876 +09:00", precision: "") + }.should raise_error(TypeError, "no implicit conversion of String into Integer") + end + end + + it "raises ArgumentError if part of time string is missing" do + -> { + Time.new("2020-12-25 00:56 +09:00") + }.should raise_error(ArgumentError, "missing sec part: 00:56 ") + + -> { + Time.new("2020-12-25 00 +09:00") + }.should raise_error(ArgumentError, "missing min part: 00 ") + end + + it "raises ArgumentError if subsecond is missing after dot" do + -> { + Time.new("2020-12-25 00:56:17. +0900") + }.should raise_error(ArgumentError, "subsecond expected after dot: 00:56:17. ") + end + + it "raises ArgumentError if String argument is not in the supported format" do + -> { + Time.new("021-12-25 00:00:00.123456 +09:00") + }.should raise_error(ArgumentError, "year must be 4 or more digits: 021") + + -> { + Time.new("2020-012-25 00:56:17 +0900") + }.should raise_error(ArgumentError, /\Atwo digits mon is expected after [`']-': -012-25 00:\z/) + + -> { + Time.new("2020-2-25 00:56:17 +0900") + }.should raise_error(ArgumentError, /\Atwo digits mon is expected after [`']-': -2-25 00:56\z/) + + -> { + Time.new("2020-12-215 00:56:17 +0900") + }.should raise_error(ArgumentError, /\Atwo digits mday is expected after [`']-': -215 00:56:\z/) + + -> { + Time.new("2020-12-25 000:56:17 +0900") + }.should raise_error(ArgumentError, "two digits hour is expected: 000:56:17 ") + + -> { + Time.new("2020-12-25 0:56:17 +0900") + }.should raise_error(ArgumentError, "two digits hour is expected: 0:56:17 +0") + + -> { + Time.new("2020-12-25 00:516:17 +0900") + }.should raise_error(ArgumentError, /\Atwo digits min is expected after [`']:': :516:17 \+09\z/) + + -> { + Time.new("2020-12-25 00:6:17 +0900") + }.should raise_error(ArgumentError, /\Atwo digits min is expected after [`']:': :6:17 \+0900\z/) + + -> { + Time.new("2020-12-25 00:56:137 +0900") + }.should raise_error(ArgumentError, /\Atwo digits sec is expected after [`']:': :137 \+0900\z/) + + -> { + Time.new("2020-12-25 00:56:7 +0900") + }.should raise_error(ArgumentError, /\Atwo digits sec is expected after [`']:': :7 \+0900\z/) + + -> { + Time.new("2020-12-25 00:56. +0900") + }.should raise_error(ArgumentError, "fraction min is not supported: 00:56.") + + -> { + Time.new("2020-12-25 00. +0900") + }.should raise_error(ArgumentError, "fraction hour is not supported: 00.") + end + + it "raises ArgumentError if date/time parts values are not valid" do + -> { + Time.new("2020-13-25 00:56:17 +09:00") + }.should raise_error(ArgumentError, "mon out of range") + + -> { + Time.new("2020-12-32 00:56:17 +09:00") + }.should raise_error(ArgumentError, "mday out of range") + + -> { + Time.new("2020-12-25 25:56:17 +09:00") + }.should raise_error(ArgumentError, "hour out of range") + + -> { + Time.new("2020-12-25 00:61:17 +09:00") + }.should raise_error(ArgumentError, "min out of range") + + -> { + Time.new("2020-12-25 00:56:61 +09:00") + }.should raise_error(ArgumentError, "sec out of range") + + -> { + Time.new("2020-12-25 00:56:17 +23:59:60") + }.should raise_error(ArgumentError, "utc_offset out of range") + + -> { + Time.new("2020-12-25 00:56:17 +24:00") + }.should raise_error(ArgumentError, "utc_offset out of range") + + -> { + Time.new("2020-12-25 00:56:17 +23:61") + }.should raise_error(ArgumentError, '"+HH:MM", "-HH:MM", "UTC" or "A".."I","K".."Z" expected for utc_offset: +23:61') + end + + it "raises ArgumentError if string has not ascii-compatible encoding" do + -> { + Time.new("2021-11-31 00:00:60 +09:00".encode("utf-32le")) + }.should raise_error(ArgumentError, "time string should have ASCII compatible encoding") + end + end + end end diff --git a/spec/ruby/core/time/now_spec.rb b/spec/ruby/core/time/now_spec.rb index 7dc7951996..d47f00723e 100644 --- a/spec/ruby/core/time/now_spec.rb +++ b/spec/ruby/core/time/now_spec.rb @@ -3,4 +3,55 @@ require_relative 'shared/now' describe "Time.now" do it_behaves_like :time_now, :now + + ruby_version_is '3.1' do # https://bugs.ruby-lang.org/issues/17485 + describe ":in keyword argument" do + it "could be UTC offset as a String in '+HH:MM or '-HH:MM' format" do + time = Time.now(in: "+05:00") + + time.utc_offset.should == 5*60*60 + time.zone.should == nil + + time = Time.now(in: "-09:00") + + time.utc_offset.should == -9*60*60 + time.zone.should == nil + end + + it "could be UTC offset as a number of seconds" do + time = Time.now(in: 5*60*60) + + time.utc_offset.should == 5*60*60 + time.zone.should == nil + + time = Time.now(in: -9*60*60) + + time.utc_offset.should == -9*60*60 + time.zone.should == nil + end + + it "returns a Time with UTC offset specified as a single letter military timezone" do + Time.now(in: "W").utc_offset.should == 3600 * -10 + end + + it "could be a timezone object" do + zone = TimeSpecs::TimezoneWithName.new(name: "Asia/Colombo") + time = Time.now(in: zone) + + time.utc_offset.should == 5*3600+30*60 + time.zone.should == zone + + zone = TimeSpecs::TimezoneWithName.new(name: "PST") + time = Time.now(in: zone) + + time.utc_offset.should == -9*60*60 + time.zone.should == zone + end + + it "raises ArgumentError if format is invalid" do + -> { Time.now(in: "+09:99") }.should raise_error(ArgumentError) + -> { Time.now(in: "ABC") }.should raise_error(ArgumentError) + end + end + end end diff --git a/spec/ruby/core/time/shared/gmtime.rb b/spec/ruby/core/time/shared/gmtime.rb index 5ed64c2ab6..bae19da462 100644 --- a/spec/ruby/core/time/shared/gmtime.rb +++ b/spec/ruby/core/time/shared/gmtime.rb @@ -22,11 +22,11 @@ describe :time_gmtime, shared: true do time.send(@method).should equal(time) end - it "raises a RuntimeError if the time is not UTC" do + it "raises a FrozenError if the time is not UTC" do with_timezone("CST", -6) do time = Time.now time.freeze - -> { time.send(@method) }.should raise_error(RuntimeError) + -> { time.send(@method) }.should raise_error(FrozenError) end end end diff --git a/spec/ruby/core/time/shared/local.rb b/spec/ruby/core/time/shared/local.rb index 43f331c4c1..068e314999 100644 --- a/spec/ruby/core/time/shared/local.rb +++ b/spec/ruby/core/time/shared/local.rb @@ -7,12 +7,10 @@ describe :time_local, shared: true do end platform_is_not :windows do - describe "timezone changes" do - it "correctly adjusts the timezone change to 'CEST' on 'Europe/Amsterdam'" do - with_timezone("Europe/Amsterdam") do - Time.send(@method, 1940, 5, 16).to_a.should == - [0, 40, 1, 16, 5, 1940, 4, 137, true, "CEST"] - end + it "uses the 'CET' timezone with TZ=Europe/Amsterdam in 1970" do + with_timezone("Europe/Amsterdam") do + Time.send(@method, 1970, 5, 16).to_a.should == + [0, 0, 0, 16, 5, 1970, 6, 136, false, "CET"] end end end @@ -41,5 +39,4 @@ describe :time_local_10_arg, shared: true do end end end - end diff --git a/spec/ruby/core/time/shared/time_params.rb b/spec/ruby/core/time/shared/time_params.rb index 63d0dbc120..b6a6c88c8e 100644 --- a/spec/ruby/core/time/shared/time_params.rb +++ b/spec/ruby/core/time/shared/time_params.rb @@ -145,9 +145,10 @@ describe :time_params, shared: true do end it "raises an ArgumentError for out of range month" do + # For some reason MRI uses a different message for month in 13-15 and month>=16 -> { - Time.send(@method, 2008, 13, 31, 23, 59, 59) - }.should raise_error(ArgumentError) + Time.send(@method, 2008, 16, 31, 23, 59, 59) + }.should raise_error(ArgumentError, /(mon|argument) out of range/) end it "raises an ArgumentError for out of range day" do @@ -169,9 +170,13 @@ describe :time_params, shared: true do end it "raises an ArgumentError for out of range second" do + # For some reason MRI uses different messages for seconds 61-63 and seconds >= 64 -> { Time.send(@method, 2008, 12, 31, 23, 59, 61) - }.should raise_error(ArgumentError) + }.should raise_error(ArgumentError, /(sec|argument) out of range/) + -> { + Time.send(@method, 2008, 12, 31, 23, 59, -1) + }.should raise_error(ArgumentError, "argument out of range") end it "raises ArgumentError when given 9 arguments" do diff --git a/spec/ruby/core/time/strftime_spec.rb b/spec/ruby/core/time/strftime_spec.rb index 1bd24b0538..4cb300c916 100644 --- a/spec/ruby/core/time/strftime_spec.rb +++ b/spec/ruby/core/time/strftime_spec.rb @@ -49,4 +49,45 @@ describe "Time#strftime" do time = @new_time_with_offset[2012, 1, 1, 0, 0, 0, Rational(36645, 10)] time.strftime("%::z").should == "+01:01:05" end + + ruby_version_is "3.1" do + it "supports RFC 3339 UTC for unknown offset local time, -0000, as %-z" do + time = Time.gm(2022) + + time.strftime("%z").should == "+0000" + time.strftime("%-z").should == "-0000" + time.strftime("%-:z").should == "-00:00" + time.strftime("%-::z").should == "-00:00:00" + end + + it "applies '-' flag to UTC time" do + time = Time.utc(2022) + time.strftime("%-z").should == "-0000" + + time = Time.gm(2022) + time.strftime("%-z").should == "-0000" + + time = Time.new(2022, 1, 1, 0, 0, 0, "Z") + time.strftime("%-z").should == "-0000" + + time = Time.new(2022, 1, 1, 0, 0, 0, "-00:00") + time.strftime("%-z").should == "-0000" + + time = Time.new(2022, 1, 1, 0, 0, 0, "+03:00").utc + time.strftime("%-z").should == "-0000" + end + + it "ignores '-' flag for non-UTC time" do + time = Time.new(2022, 1, 1, 0, 0, 0, "+03:00") + time.strftime("%-z").should == "+0300" + end + + it "works correctly with width, _ and 0 flags, and :" do + Time.now.utc.strftime("%-_10z").should == " -000" + Time.now.utc.strftime("%-10z").should == "-000000000" + Time.now.utc.strftime("%-010:z").should == "-000000:00" + Time.now.utc.strftime("%-_10:z").should == " -0:00" + Time.now.utc.strftime("%-_10::z").should == " -0:00:00" + end + end end diff --git a/spec/ruby/core/time/succ_spec.rb b/spec/ruby/core/time/succ_spec.rb deleted file mode 100644 index e8249059d1..0000000000 --- a/spec/ruby/core/time/succ_spec.rb +++ /dev/null @@ -1,39 +0,0 @@ -ruby_version_is ""..."3.0" do - require_relative '../../spec_helper' - require_relative 'fixtures/classes' - - describe "Time#succ" do - it "returns a new time one second later than time" do - suppress_warning { - @result = Time.at(100).succ - } - - @result.should == Time.at(101) - end - - it "returns a new instance" do - time = Time.at(100) - - suppress_warning { - @result = time.succ - } - - @result.should_not equal time - end - - it "is obsolete" do - -> { - Time.at(100).succ - }.should complain(/Time#succ is obsolete/) - end - - context "zone is a timezone object" do - it "preserves time zone" do - zone = TimeSpecs::Timezone.new(offset: (5*3600+30*60)) - time = Time.new(2012, 1, 1, 12, 0, 0, zone) - 1 - - time.zone.should == zone - end - end - end -end diff --git a/spec/ruby/core/time/utc_spec.rb b/spec/ruby/core/time/utc_spec.rb index 74c17a93d1..566509fd33 100644 --- a/spec/ruby/core/time/utc_spec.rb +++ b/spec/ruby/core/time/utc_spec.rb @@ -4,8 +4,55 @@ require_relative 'shared/gmtime' require_relative 'shared/time_params' describe "Time#utc?" do - it "returns true if time represents a time in UTC (GMT)" do - Time.now.should_not.utc? + it "returns true only if time represents a time in UTC (GMT)" do + Time.now.utc?.should == false + Time.now.utc.utc?.should == true + end + + it "treats time as UTC what was created in different ways" do + Time.now.utc.utc?.should == true + Time.now.gmtime.utc?.should == true + Time.now.getgm.utc?.should == true + Time.now.getutc.utc?.should == true + Time.utc(2022).utc?.should == true + end + + it "does treat time with 'UTC' offset as UTC" do + Time.new(2022, 1, 1, 0, 0, 0, "UTC").utc?.should == true + Time.now.localtime("UTC").utc?.should == true + Time.at(Time.now, in: 'UTC').utc?.should == true + + ruby_version_is "3.1" do + Time.new(2022, 1, 1, 0, 0, 0, in: "UTC").utc?.should == true + Time.now(in: "UTC").utc?.should == true + end + end + + it "does treat time with Z offset as UTC" do + Time.new(2022, 1, 1, 0, 0, 0, "Z").utc?.should == true + Time.now.localtime("Z").utc?.should == true + Time.at(Time.now, in: 'Z').utc?.should == true + + ruby_version_is "3.1" do + Time.new(2022, 1, 1, 0, 0, 0, in: "Z").utc?.should == true + Time.now(in: "Z").utc?.should == true + end + end + + ruby_version_is "3.1" do + it "does treat time with -00:00 offset as UTC" do + Time.new(2022, 1, 1, 0, 0, 0, "-00:00").utc?.should == true + Time.now.localtime("-00:00").utc?.should == true + Time.at(Time.now, in: '-00:00').utc?.should == true + end + end + + it "does not treat time with +00:00 offset as UTC" do + Time.new(2022, 1, 1, 0, 0, 0, "+00:00").utc?.should == false + end + + it "does not treat time with 0 offset as UTC" do + Time.new(2022, 1, 1, 0, 0, 0, 0).utc?.should == false end end diff --git a/spec/ruby/core/time/zone_spec.rb b/spec/ruby/core/time/zone_spec.rb index 907ccf9f4b..63c92602d1 100644 --- a/spec/ruby/core/time/zone_spec.rb +++ b/spec/ruby/core/time/zone_spec.rb @@ -52,14 +52,39 @@ describe "Time#zone" do end it "doesn't raise errors for a Time with a fixed offset" do - -> { - Time.new(2001, 1, 1, 0, 0, 0, "+05:00").zone - }.should_not raise_error + Time.new(2001, 1, 1, 0, 0, 0, "+05:00").zone.should == nil end end it "returns UTC when called on a UTC time" do Time.now.utc.zone.should == "UTC" + Time.now.gmtime.zone.should == "UTC" + Time.now.getgm.zone.should == "UTC" + Time.now.getutc.zone.should == "UTC" + Time.utc(2022).zone.should == "UTC" + Time.new(2022, 1, 1, 0, 0, 0, "UTC").zone.should == "UTC" + Time.new(2022, 1, 1, 0, 0, 0, "Z").zone.should == "UTC" + Time.now.localtime("UTC").zone.should == "UTC" + Time.now.localtime("Z").zone.should == "UTC" + Time.at(Time.now, in: 'UTC').zone.should == "UTC" + Time.at(Time.now, in: 'Z').zone.should == "UTC" + + ruby_version_is "3.1" do + Time.new(2022, 1, 1, 0, 0, 0, "-00:00").zone.should == "UTC" + Time.now.localtime("-00:00").zone.should == "UTC" + Time.at(Time.now, in: '-00:00').zone.should == "UTC" + end + + ruby_version_is "3.1" do + Time.new(2022, 1, 1, 0, 0, 0, in: "UTC").zone.should == "UTC" + Time.new(2022, 1, 1, 0, 0, 0, in: "Z").zone.should == "UTC" + + Time.now(in: 'UTC').zone.should == "UTC" + Time.now(in: 'Z').zone.should == "UTC" + + Time.at(Time.now, in: 'UTC').zone.should == "UTC" + Time.at(Time.now, in: 'Z').zone.should == "UTC" + end end platform_is_not :aix, :windows do diff --git a/spec/ruby/core/tracepoint/allow_reentry_spec.rb b/spec/ruby/core/tracepoint/allow_reentry_spec.rb new file mode 100644 index 0000000000..6bff1bed76 --- /dev/null +++ b/spec/ruby/core/tracepoint/allow_reentry_spec.rb @@ -0,0 +1,32 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +ruby_version_is "3.1" do + describe 'TracePoint.allow_reentry' do + it 'allows the reentrance in a given block' do + event_lines = [] + l1 = l2 = l3 = l4 = nil + TracePoint.new(:line) do |tp| + next unless TracePointSpec.target_thread? + + event_lines << tp.lineno + next if (__LINE__ + 2 .. __LINE__ + 4).cover?(tp.lineno) + TracePoint.allow_reentry do + a = 1; l3 = __LINE__ + b = 2; l4 = __LINE__ + end + end.enable do + c = 3; l1 = __LINE__ + d = 4; l2 = __LINE__ + end + + event_lines.should == [l1, l3, l4, l2, l3, l4] + end + + it 'raises RuntimeError when not called inside a TracePoint' do + -> { + TracePoint.allow_reentry{} + }.should raise_error(RuntimeError) + end + end +end diff --git a/spec/ruby/core/tracepoint/enable_spec.rb b/spec/ruby/core/tracepoint/enable_spec.rb index ab392c7583..6cc8bb3897 100644 --- a/spec/ruby/core/tracepoint/enable_spec.rb +++ b/spec/ruby/core/tracepoint/enable_spec.rb @@ -57,25 +57,50 @@ describe 'TracePoint#enable' do end.enable { event_name.should equal(:line) } end - it 'enables the trace object for any thread' do - threads = [] - trace = TracePoint.new(:line) do |tp| - # Runs on purpose on any Thread - threads << Thread.current - end + ruby_version_is '3.2' do + it 'enables the trace object only for the current thread' do + threads = [] + trace = TracePoint.new(:line) do |tp| + # Runs on purpose on any Thread + threads << Thread.current + end - thread = nil - trace.enable do - line_event = true - thread = Thread.new do - event_in_other_thread = true + thread = nil + trace.enable do + line_event = true + thread = Thread.new do + event_in_other_thread = true + end + thread.join end - thread.join + + threads = threads.uniq + threads.should.include?(Thread.current) + threads.should_not.include?(thread) end + end + + ruby_version_is ''...'3.2' do + it 'enables the trace object for any thread' do + threads = [] + trace = TracePoint.new(:line) do |tp| + # Runs on purpose on any Thread + threads << Thread.current + end + + thread = nil + trace.enable do + line_event = true + thread = Thread.new do + event_in_other_thread = true + end + thread.join + end - threads = threads.uniq - threads.should.include?(Thread.current) - threads.should.include?(thread) + threads = threads.uniq + threads.should.include?(Thread.current) + threads.should.include?(thread) + end end it 'can accept arguments within a block but it should not yield arguments' do @@ -124,13 +149,7 @@ describe 'TracePoint#enable' do describe "when nested" do before do - ruby_version_is ""..."3.0" do - @path_prefix = '@' - end - - ruby_version_is "3.0" do - @path_prefix = ' ' - end + @path_prefix = ' ' end it "enables both TracePoints but only calls the respective callbacks" do diff --git a/spec/ruby/core/tracepoint/inspect_spec.rb b/spec/ruby/core/tracepoint/inspect_spec.rb index 06bed9c99a..cc6bf0f842 100644 --- a/spec/ruby/core/tracepoint/inspect_spec.rb +++ b/spec/ruby/core/tracepoint/inspect_spec.rb @@ -3,19 +3,22 @@ require_relative 'fixtures/classes' describe 'TracePoint#inspect' do before do - ruby_version_is ""..."3.0" do - @path_prefix = '@' - end - - ruby_version_is "3.0" do - @path_prefix = ' ' - end + @path_prefix = ' ' end it 'returns a string containing a human-readable TracePoint status' do TracePoint.new(:line) {}.inspect.should == '#<TracePoint:disabled>' end + it "shows only whether it's enabled when outside the TracePoint handler" do + trace = TracePoint.new(:line) {} + trace.enable + + trace.inspect.should == '#<TracePoint:enabled>' + + trace.disable + end + it 'returns a String showing the event, path and line' do inspect = nil line = nil @@ -41,7 +44,7 @@ describe 'TracePoint#inspect' do trace_point_spec_test_call end - inspect.should == "#<TracePoint:call `trace_point_spec_test_call'#{@path_prefix}#{__FILE__}:#{line}>" + inspect.should =~ /\A#<TracePoint:call [`']trace_point_spec_test_call'#{@path_prefix}#{__FILE__}:#{line}>\z/ end it 'returns a String showing the event, method, path and line for a :return event' do @@ -59,21 +62,21 @@ describe 'TracePoint#inspect' do trace_point_spec_test_return end - inspect.should == "#<TracePoint:return `trace_point_spec_test_return'#{@path_prefix}#{__FILE__}:#{line}>" + inspect.should =~ /\A#<TracePoint:return [`']trace_point_spec_test_return'#{@path_prefix}#{__FILE__}:#{line}>\z/ end it 'returns a String showing the event, method, path and line for a :c_call event' do inspect = nil - line = nil - TracePoint.new(:c_call) { |tp| + tracepoint = TracePoint.new(:c_call) { |tp| next unless TracePointSpec.target_thread? inspect ||= tp.inspect - }.enable do - line = __LINE__ + 1 + } + line = __LINE__ + 2 + tracepoint.enable do [0, 1].max end - inspect.should == "#<TracePoint:c_call `max'#{@path_prefix}#{__FILE__}:#{line}>" + inspect.should =~ /\A#<TracePoint:c_call [`']max'#{@path_prefix}#{__FILE__}:#{line}>\z/ end it 'returns a String showing the event, path and line for a :class event' do @@ -98,7 +101,7 @@ describe 'TracePoint#inspect' do TracePoint.new(:thread_begin) { |tp| next unless Thread.current == thread inspect ||= tp.inspect - }.enable do + }.enable(target_thread: nil) do thread = Thread.new {} thread_inspection = thread.inspect thread.join @@ -114,7 +117,7 @@ describe 'TracePoint#inspect' do TracePoint.new(:thread_end) { |tp| next unless Thread.current == thread inspect ||= tp.inspect - }.enable do + }.enable(target_thread: nil) do thread = Thread.new {} thread_inspection = thread.inspect thread.join diff --git a/spec/ruby/core/tracepoint/path_spec.rb b/spec/ruby/core/tracepoint/path_spec.rb index 5b6c6d4cfc..dc2ca840b8 100644 --- a/spec/ruby/core/tracepoint/path_spec.rb +++ b/spec/ruby/core/tracepoint/path_spec.rb @@ -13,14 +13,29 @@ describe 'TracePoint#path' do path.should == "#{__FILE__}" end - it 'equals (eval) inside an eval for :end event' do - path = nil - TracePoint.new(:end) { |tp| - next unless TracePointSpec.target_thread? - path = tp.path - }.enable do - eval("module TracePointSpec; end") + ruby_version_is ""..."3.3" do + it 'equals (eval) inside an eval for :end event' do + path = nil + TracePoint.new(:end) { |tp| + next unless TracePointSpec.target_thread? + path = tp.path + }.enable do + eval("module TracePointSpec; end") + end + path.should == '(eval)' + end + end + + ruby_version_is "3.3" do + it 'equals "(eval at __FILE__:__LINE__)" inside an eval for :end event' do + path = nil + TracePoint.new(:end) { |tp| + next unless TracePointSpec.target_thread? + path = tp.path + }.enable do + eval("module TracePointSpec; end") + end + path.should == "(eval at #{__FILE__}:#{__LINE__ - 2})" end - path.should == '(eval)' end end diff --git a/spec/ruby/core/true/singleton_method_spec.rb b/spec/ruby/core/true/singleton_method_spec.rb new file mode 100644 index 0000000000..c06793850f --- /dev/null +++ b/spec/ruby/core/true/singleton_method_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' + +describe "TrueClass#singleton_method" do + ruby_version_is '3.3' do + it "raises regardless of whether TrueClass defines the method" do + -> { true.singleton_method(:foo) }.should raise_error(NameError) + begin + def (true).foo; end + -> { true.singleton_method(:foo) }.should raise_error(NameError) + ensure + TrueClass.send(:remove_method, :foo) + end + end + end +end diff --git a/spec/ruby/core/true/to_s_spec.rb b/spec/ruby/core/true/to_s_spec.rb index f26cd138e2..fa1b53a580 100644 --- a/spec/ruby/core/true/to_s_spec.rb +++ b/spec/ruby/core/true/to_s_spec.rb @@ -5,13 +5,11 @@ describe "TrueClass#to_s" do true.to_s.should == "true" end - ruby_version_is "2.7" do - it "returns a frozen string" do - true.to_s.should.frozen? - end + it "returns a frozen string" do + true.to_s.should.frozen? + end - it "always returns the same string" do - true.to_s.should equal(true.to_s) - end + it "always returns the same string" do + true.to_s.should equal(true.to_s) end end diff --git a/spec/ruby/core/unboundmethod/bind_call_spec.rb b/spec/ruby/core/unboundmethod/bind_call_spec.rb index c5d392156c..80b2095d86 100644 --- a/spec/ruby/core/unboundmethod/bind_call_spec.rb +++ b/spec/ruby/core/unboundmethod/bind_call_spec.rb @@ -1,52 +1,58 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' -ruby_version_is '2.7' do - describe "UnboundMethod#bind_call" do - before :each do - @normal_um = UnboundMethodSpecs::Methods.new.method(:foo).unbind - @parent_um = UnboundMethodSpecs::Parent.new.method(:foo).unbind - @child1_um = UnboundMethodSpecs::Child1.new.method(:foo).unbind - @child2_um = UnboundMethodSpecs::Child2.new.method(:foo).unbind - end +describe "UnboundMethod#bind_call" do + before :each do + @normal_um = UnboundMethodSpecs::Methods.new.method(:foo).unbind + @parent_um = UnboundMethodSpecs::Parent.new.method(:foo).unbind + @child1_um = UnboundMethodSpecs::Child1.new.method(:foo).unbind + @child2_um = UnboundMethodSpecs::Child2.new.method(:foo).unbind + @normal_um_super = UnboundMethodSpecs::Mod.instance_method(:foo_super) + @parent_um_super = UnboundMethodSpecs::Parent.new.method(:foo_super).unbind + end - it "raises TypeError if object is not kind_of? the Module the method defined in" do - -> { @normal_um.bind_call(UnboundMethodSpecs::B.new) }.should raise_error(TypeError) - end + it "raises TypeError if object is not kind_of? the Module the method defined in" do + -> { @normal_um.bind_call(UnboundMethodSpecs::B.new) }.should raise_error(TypeError) + end - it "binds and calls the method if object is kind_of the Module the method defined in" do - @normal_um.bind_call(UnboundMethodSpecs::Methods.new).should == true - end + it "binds and calls the method if object is kind_of the Module the method defined in" do + @normal_um.bind_call(UnboundMethodSpecs::Methods.new).should == true + end - it "binds and calls the method on any object when UnboundMethod is unbound from a module" do - UnboundMethodSpecs::Mod.instance_method(:from_mod).bind_call(Object.new).should == nil - end + it "binds and calls the method on any object when UnboundMethod is unbound from a module" do + UnboundMethodSpecs::Mod.instance_method(:from_mod).bind_call(Object.new).should == nil + end - it "binds and calls the method for any object kind_of? the Module the method is defined in" do - @parent_um.bind_call(UnboundMethodSpecs::Child1.new).should == nil - @child1_um.bind_call(UnboundMethodSpecs::Parent.new).should == nil - @child2_um.bind_call(UnboundMethodSpecs::Child1.new).should == nil - end + it "binds and calls the method for any object kind_of? the Module the method is defined in" do + @parent_um.bind_call(UnboundMethodSpecs::Child1.new).should == nil + @child1_um.bind_call(UnboundMethodSpecs::Parent.new).should == nil + @child2_um.bind_call(UnboundMethodSpecs::Child1.new).should == nil + end - it "binds and calls a Kernel method retrieved from Object on BasicObject" do - Object.instance_method(:instance_of?).bind_call(BasicObject.new, BasicObject).should == true - end + it "binds and calls a Kernel method retrieved from Object on BasicObject" do + Object.instance_method(:instance_of?).bind_call(BasicObject.new, BasicObject).should == true + end - it "binds and calls a Parent's class method to any Child's class methods" do - um = UnboundMethodSpecs::Parent.method(:class_method).unbind - um.bind_call(UnboundMethodSpecs::Child1).should == "I am UnboundMethodSpecs::Child1" - end + it "binds and calls a Parent's class method to any Child's class methods" do + um = UnboundMethodSpecs::Parent.method(:class_method).unbind + um.bind_call(UnboundMethodSpecs::Child1).should == "I am UnboundMethodSpecs::Child1" + end - it "will raise when binding a an object singleton's method to another object" do - other = UnboundMethodSpecs::Parent.new - p = UnboundMethodSpecs::Parent.new - class << p - def singleton_method - :single - end + it "will raise when binding a an object singleton's method to another object" do + other = UnboundMethodSpecs::Parent.new + p = UnboundMethodSpecs::Parent.new + class << p + def singleton_method + :single end - um = p.method(:singleton_method).unbind - ->{ um.bind_call(other) }.should raise_error(TypeError) end + um = p.method(:singleton_method).unbind + ->{ um.bind_call(other) }.should raise_error(TypeError) + end + + it "allows calling super for module methods bound to hierarchies that do not already have that module" do + p = UnboundMethodSpecs::Parent.new + + @normal_um_super.bind_call(p).should == true end end diff --git a/spec/ruby/core/unboundmethod/bind_spec.rb b/spec/ruby/core/unboundmethod/bind_spec.rb index 03aaa22e74..7658b664e5 100644 --- a/spec/ruby/core/unboundmethod/bind_spec.rb +++ b/spec/ruby/core/unboundmethod/bind_spec.rb @@ -7,6 +7,8 @@ describe "UnboundMethod#bind" do @parent_um = UnboundMethodSpecs::Parent.new.method(:foo).unbind @child1_um = UnboundMethodSpecs::Child1.new.method(:foo).unbind @child2_um = UnboundMethodSpecs::Child2.new.method(:foo).unbind + @normal_um_super = UnboundMethodSpecs::Mod.instance_method(:foo_super) + @parent_um_super = UnboundMethodSpecs::Parent.new.method(:foo_super).unbind end it "raises TypeError if object is not kind_of? the Module the method defined in" do @@ -58,4 +60,10 @@ describe "UnboundMethod#bind" do um = p.method(:singleton_method).unbind ->{ um.bind(other) }.should raise_error(TypeError) end + + it "allows calling super for module methods bound to hierarchies that do not already have that module" do + p = UnboundMethodSpecs::Parent.new + + @normal_um_super.bind(p).call.should == true + end end diff --git a/spec/ruby/core/unboundmethod/clone_spec.rb b/spec/ruby/core/unboundmethod/clone_spec.rb index 098ee61476..1e7fb18744 100644 --- a/spec/ruby/core/unboundmethod/clone_spec.rb +++ b/spec/ruby/core/unboundmethod/clone_spec.rb @@ -1,12 +1,13 @@ require_relative '../../spec_helper' -require_relative 'fixtures/classes' +require_relative 'shared/dup' describe "UnboundMethod#clone" do - it "returns a copy of the UnboundMethod" do - um1 = UnboundMethodSpecs::Methods.instance_method(:foo) - um2 = um1.clone + it_behaves_like :unboundmethod_dup, :clone - (um1 == um2).should == true - um1.bind(UnboundMethodSpecs::Methods.new).call.should == um2.bind(UnboundMethodSpecs::Methods.new).call + it "preserves frozen status" do + method = Class.instance_method(:instance_method) + method.freeze + method.frozen?.should == true + method.clone.frozen?.should == true end end diff --git a/spec/ruby/core/unboundmethod/dup_spec.rb b/spec/ruby/core/unboundmethod/dup_spec.rb new file mode 100644 index 0000000000..5a78dd8e36 --- /dev/null +++ b/spec/ruby/core/unboundmethod/dup_spec.rb @@ -0,0 +1,15 @@ +require_relative '../../spec_helper' +require_relative 'shared/dup' + +describe "UnboundMethod#dup" do + ruby_version_is "3.4" do + it_behaves_like :unboundmethod_dup, :dup + + it "resets frozen status" do + method = Class.instance_method(:instance_method) + method.freeze + method.frozen?.should == true + method.dup.frozen?.should == false + end + end +end diff --git a/spec/ruby/core/unboundmethod/equal_value_spec.rb b/spec/ruby/core/unboundmethod/equal_value_spec.rb index 6242b04884..036c6b7f8c 100644 --- a/spec/ruby/core/unboundmethod/equal_value_spec.rb +++ b/spec/ruby/core/unboundmethod/equal_value_spec.rb @@ -76,19 +76,38 @@ describe "UnboundMethod#==" do (@identical_body == @original_body).should == false end - it "returns false if same method but one extracted from a subclass" do - (@parent == @child1).should == false - (@child1 == @parent).should == false - end + ruby_version_is ""..."3.2" do + it "returns false if same method but one extracted from a subclass" do + (@parent == @child1).should == false + (@child1 == @parent).should == false + end + + it "returns false if same method but extracted from two different subclasses" do + (@child2 == @child1).should == false + (@child1 == @child2).should == false + end - it "returns false if same method but extracted from two different subclasses" do - (@child2 == @child1).should == false - (@child1 == @child2).should == false + it "returns false if methods are the same but added from an included Module" do + (@includee == @includer).should == false + (@includer == @includee).should == false + end end - it "returns false if methods are the same but added from an included Module" do - (@includee == @includer).should == false - (@includer == @includee).should == false + ruby_version_is "3.2" do + it "returns true if same method but one extracted from a subclass" do + (@parent == @child1).should == true + (@child1 == @parent).should == true + end + + it "returns false if same method but extracted from two different subclasses" do + (@child2 == @child1).should == true + (@child1 == @child2).should == true + end + + it "returns true if methods are the same but added from an included Module" do + (@includee == @includer).should == true + (@includer == @includee).should == true + end end it "returns false if both have same Module, same name, identical body but not the same" do @@ -98,4 +117,41 @@ describe "UnboundMethod#==" do (@discard_1 == UnboundMethodSpecs::Methods.instance_method(:discard_1)).should == false end + + it "considers methods through aliasing equal" do + c = Class.new do + class << self + alias_method :n, :new + end + end + + c.method(:new).should == c.method(:n) + c.method(:n).should == Class.instance_method(:new).bind(c) + end + + # On CRuby < 3.2, the 2 specs below pass due to method/instance_method skipping zsuper methods. + # We are interested in the general pattern working, i.e. the combination of method/instance_method + # and #== exposes the wanted behavior. + it "considers methods through visibility change equal" do + c = Class.new do + class << self + private :new + end + end + + c.method(:new).should == Class.instance_method(:new).bind(c) + end + + it "considers methods through aliasing and visibility change equal" do + c = Class.new do + class << self + alias_method :n, :new + private :new + end + end + + c.method(:new).should == c.method(:n) + c.method(:n).should == Class.instance_method(:new).bind(c) + c.method(:new).should == Class.instance_method(:new).bind(c) + end end diff --git a/spec/ruby/core/unboundmethod/fixtures/classes.rb b/spec/ruby/core/unboundmethod/fixtures/classes.rb index 46b1c51669..28d8e0a965 100644 --- a/spec/ruby/core/unboundmethod/fixtures/classes.rb +++ b/spec/ruby/core/unboundmethod/fixtures/classes.rb @@ -22,6 +22,7 @@ module UnboundMethodSpecs module Mod def from_mod; end + def foo_super; super; end end class Methods @@ -53,10 +54,19 @@ module UnboundMethodSpecs def discard_1(); :discard; end def discard_2(); :discard; end + + def my_public_method; end + def my_protected_method; end + def my_private_method; end + protected :my_protected_method + private :my_private_method end class Parent def foo; end + def foo_super + true + end def self.class_method "I am #{name}" end @@ -84,4 +94,14 @@ module UnboundMethodSpecs class C < B def overridden; end end + + module HashSpecs + class SuperClass + def foo + end + end + + class SubClass < SuperClass + end + end end diff --git a/spec/ruby/core/unboundmethod/hash_spec.rb b/spec/ruby/core/unboundmethod/hash_spec.rb index 12dce0020f..6888675bc1 100644 --- a/spec/ruby/core/unboundmethod/hash_spec.rb +++ b/spec/ruby/core/unboundmethod/hash_spec.rb @@ -12,4 +12,11 @@ describe "UnboundMethod#hash" do to_s, inspect = Array.instance_method(:to_s), Array.instance_method(:inspect) to_s.hash.should == inspect.hash end + + it "equals a hash of the same method in the superclass" do + foo_in_superclass = UnboundMethodSpecs::HashSpecs::SuperClass.instance_method(:foo) + foo = UnboundMethodSpecs::HashSpecs::SubClass.instance_method(:foo) + + foo.hash.should == foo_in_superclass.hash + end end diff --git a/spec/ruby/core/unboundmethod/owner_spec.rb b/spec/ruby/core/unboundmethod/owner_spec.rb index 5f1f4646b3..e8a734dac4 100644 --- a/spec/ruby/core/unboundmethod/owner_spec.rb +++ b/spec/ruby/core/unboundmethod/owner_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative '../method/fixtures/classes' describe "UnboundMethod#owner" do it "returns the owner of the method" do @@ -23,4 +24,10 @@ describe "UnboundMethod#owner" do child_singleton_class.instance_method(:class_method).owner.should == parent_singleton_class child_singleton_class.instance_method(:another_class_method).owner.should == child_singleton_class end + + ruby_version_is "3.2" do + it "returns the class on which public was called for a private method in ancestor" do + MethodSpecs::InheritedMethods::C.instance_method(:derp).owner.should == MethodSpecs::InheritedMethods::C + end + end end diff --git a/spec/ruby/core/unboundmethod/private_spec.rb b/spec/ruby/core/unboundmethod/private_spec.rb new file mode 100644 index 0000000000..8ea50bb5d4 --- /dev/null +++ b/spec/ruby/core/unboundmethod/private_spec.rb @@ -0,0 +1,28 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "UnboundMethod#private?" do + ruby_version_is "3.1"..."3.2" do + it "returns false when the method is public" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_public_method).unbind.private?.should == false + end + + it "returns false when the method is protected" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_protected_method).unbind.private?.should == false + end + + it "returns true when the method is private" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_private_method).unbind.private?.should == true + end + end + + ruby_version_is "3.2" do + it "has been removed" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_private_method).unbind.should_not.respond_to?(:private?) + end + end +end diff --git a/spec/ruby/core/unboundmethod/protected_spec.rb b/spec/ruby/core/unboundmethod/protected_spec.rb new file mode 100644 index 0000000000..0c215d8638 --- /dev/null +++ b/spec/ruby/core/unboundmethod/protected_spec.rb @@ -0,0 +1,28 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "UnboundMethod#protected?" do + ruby_version_is "3.1"..."3.2" do + it "returns false when the method is public" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_public_method).unbind.protected?.should == false + end + + it "returns true when the method is protected" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_protected_method).unbind.protected?.should == true + end + + it "returns false when the method is private" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_private_method).unbind.protected?.should == false + end + end + + ruby_version_is "3.2" do + it "has been removed" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_protected_method).unbind.should_not.respond_to?(:protected?) + end + end +end diff --git a/spec/ruby/core/unboundmethod/public_spec.rb b/spec/ruby/core/unboundmethod/public_spec.rb new file mode 100644 index 0000000000..552bbf6eab --- /dev/null +++ b/spec/ruby/core/unboundmethod/public_spec.rb @@ -0,0 +1,28 @@ +require_relative '../../spec_helper' +require_relative 'fixtures/classes' + +describe "UnboundMethod#public?" do + ruby_version_is "3.1"..."3.2" do + it "returns true when the method is public" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_public_method).unbind.public?.should == true + end + + it "returns false when the method is protected" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_protected_method).unbind.public?.should == false + end + + it "returns false when the method is private" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_private_method).unbind.public?.should == false + end + end + + ruby_version_is "3.2" do + it "has been removed" do + obj = UnboundMethodSpecs::Methods.new + obj.method(:my_public_method).unbind.should_not.respond_to?(:public?) + end + end +end diff --git a/spec/ruby/core/unboundmethod/shared/dup.rb b/spec/ruby/core/unboundmethod/shared/dup.rb new file mode 100644 index 0000000000..943a7faaa3 --- /dev/null +++ b/spec/ruby/core/unboundmethod/shared/dup.rb @@ -0,0 +1,32 @@ +describe :unboundmethod_dup, shared: true do + it "returns a copy of self" do + a = Class.instance_method(:instance_method) + b = a.send(@method) + + a.should == b + a.should_not equal(b) + end + + ruby_version_is "3.4" do + it "copies instance variables" do + method = Class.instance_method(:instance_method) + method.instance_variable_set(:@ivar, 1) + cl = method.send(@method) + cl.instance_variables.should == [:@ivar] + end + + it "copies the finalizer" do + code = <<-RUBY + obj = Class.instance_method(:instance_method) + + ObjectSpace.define_finalizer(obj, Proc.new { STDOUT.write "finalized\n" }) + + obj.clone + + exit 0 + RUBY + + ruby_exe(code).lines.sort.should == ["finalized\n", "finalized\n"] + end + end +end diff --git a/spec/ruby/core/unboundmethod/shared/to_s.rb b/spec/ruby/core/unboundmethod/shared/to_s.rb index 38503c3c60..b92bb0b207 100644 --- a/spec/ruby/core/unboundmethod/shared/to_s.rb +++ b/spec/ruby/core/unboundmethod/shared/to_s.rb @@ -20,12 +20,22 @@ describe :unboundmethod_to_s, shared: true do it "the String shows the method name, Module defined in and Module extracted from" do @from_module.send(@method).should =~ /\bfrom_mod\b/ @from_module.send(@method).should =~ /\bUnboundMethodSpecs::Mod\b/ - @from_method.send(@method).should =~ /\bUnboundMethodSpecs::Methods\b/ + + ruby_version_is ""..."3.2" do + @from_method.send(@method).should =~ /\bUnboundMethodSpecs::Methods\b/ + end end it "returns a String including all details" do - @from_module.send(@method).should.start_with? "#<UnboundMethod: UnboundMethodSpecs::Methods(UnboundMethodSpecs::Mod)#from_mod" - @from_method.send(@method).should.start_with? "#<UnboundMethod: UnboundMethodSpecs::Methods(UnboundMethodSpecs::Mod)#from_mod" + ruby_version_is ""..."3.2" do + @from_module.send(@method).should.start_with? "#<UnboundMethod: UnboundMethodSpecs::Methods(UnboundMethodSpecs::Mod)#from_mod" + @from_method.send(@method).should.start_with? "#<UnboundMethod: UnboundMethodSpecs::Methods(UnboundMethodSpecs::Mod)#from_mod" + end + + ruby_version_is "3.2" do + @from_module.send(@method).should.start_with? "#<UnboundMethod: UnboundMethodSpecs::Mod#from_mod" + @from_method.send(@method).should.start_with? "#<UnboundMethod: UnboundMethodSpecs::Mod#from_mod" + end end it "does not show the defining module if it is the same as the origin" do diff --git a/spec/ruby/core/unboundmethod/source_location_spec.rb b/spec/ruby/core/unboundmethod/source_location_spec.rb index 96933a5d40..5c2f14362c 100644 --- a/spec/ruby/core/unboundmethod/source_location_spec.rb +++ b/spec/ruby/core/unboundmethod/source_location_spec.rb @@ -9,7 +9,7 @@ describe "UnboundMethod#source_location" do it "sets the first value to the path of the file in which the method was defined" do file = @method.source_location.first file.should be_an_instance_of(String) - file.should == File.realpath('../fixtures/classes.rb', __FILE__) + file.should == File.realpath('fixtures/classes.rb', __dir__) end it "sets the last value to an Integer representing the line on which the method was defined" do @@ -49,4 +49,11 @@ describe "UnboundMethod#source_location" do method.source_location[0].should =~ /#{__FILE__}/ method.source_location[1].should == line end + + it "works for eval with a given line" do + c = Class.new do + eval('def m; end', nil, "foo", 100) + end + c.instance_method(:m).source_location.should == ["foo", 100] + end end diff --git a/spec/ruby/core/unboundmethod/super_method_spec.rb b/spec/ruby/core/unboundmethod/super_method_spec.rb index c9fa1ec533..aa7c129377 100644 --- a/spec/ruby/core/unboundmethod/super_method_spec.rb +++ b/spec/ruby/core/unboundmethod/super_method_spec.rb @@ -1,5 +1,6 @@ require_relative '../../spec_helper' require_relative 'fixtures/classes' +require_relative '../method/fixtures/classes' describe "UnboundMethod#super_method" do it "returns the method that would be called by super in the method" do @@ -25,4 +26,24 @@ describe "UnboundMethod#super_method" do method.super_method.should == nil end + + # https://github.com/jruby/jruby/issues/7240 + context "after changing an inherited methods visibility" do + it "calls the proper super method" do + method = MethodSpecs::InheritedMethods::C.instance_method(:derp) + method.bind(MethodSpecs::InheritedMethods::C.new).call.should == 'BA' + end + + it "returns the expected super_method" do + method = MethodSpecs::InheritedMethods::C.instance_method(:derp) + method.super_method.owner.should == MethodSpecs::InheritedMethods::A + end + end + + context "after aliasing an inherited method" do + it "returns the expected super_method" do + method = MethodSpecs::InheritedMethods::C.instance_method(:meow) + method.super_method.owner.should == MethodSpecs::InheritedMethods::A + end + end end diff --git a/spec/ruby/core/warning/element_reference_spec.rb b/spec/ruby/core/warning/element_reference_spec.rb index c3bf06a95b..8cb4018c20 100644 --- a/spec/ruby/core/warning/element_reference_spec.rb +++ b/spec/ruby/core/warning/element_reference_spec.rb @@ -1,14 +1,25 @@ require_relative '../../spec_helper' -ruby_version_is '2.7.2' do - describe "Warning.[]" do - it "returns default values for categories :deprecated and :experimental" do - ruby_exe('p Warning[:deprecated]').chomp.should == "false" - ruby_exe('p Warning[:experimental]').chomp.should == "true" - end +describe "Warning.[]" do + it "returns default values for categories :deprecated and :experimental" do + ruby_exe('p [Warning[:deprecated], Warning[:experimental]]').chomp.should == "[false, true]" + ruby_exe('p [Warning[:deprecated], Warning[:experimental]]', options: "-w").chomp.should == "[true, true]" + end - it "raises for unknown category" do - -> { Warning[:noop] }.should raise_error(ArgumentError, /unknown category: noop/) + ruby_version_is '3.3' do + it "returns default values for :performance category" do + ruby_exe('p Warning[:performance]').chomp.should == "false" + ruby_exe('p Warning[:performance]', options: "-w").chomp.should == "false" end end + + it "raises for unknown category" do + -> { Warning[:noop] }.should raise_error(ArgumentError, /unknown category: noop/) + end + + it "raises for non-Symbol category" do + -> { Warning[42] }.should raise_error(TypeError) + -> { Warning[false] }.should raise_error(TypeError) + -> { Warning["noop"] }.should raise_error(TypeError) + end end diff --git a/spec/ruby/core/warning/element_set_spec.rb b/spec/ruby/core/warning/element_set_spec.rb index 3b0ea45c9b..d59a7d4c9e 100644 --- a/spec/ruby/core/warning/element_set_spec.rb +++ b/spec/ruby/core/warning/element_set_spec.rb @@ -1,31 +1,41 @@ require_relative '../../spec_helper' -ruby_version_is '2.7' do - describe "Warning.[]=" do - it "emits and suppresses warnings for :deprecated" do - ruby_exe('Warning[:deprecated] = true; $; = ""', args: "2>&1").should =~ /is deprecated/ - ruby_exe('Warning[:deprecated] = false; $; = ""', args: "2>&1").should == "" - end +describe "Warning.[]=" do + it "emits and suppresses warnings for :deprecated" do + ruby_exe('Warning[:deprecated] = true; $; = ""', args: "2>&1").should =~ /is deprecated/ + ruby_exe('Warning[:deprecated] = false; $; = ""', args: "2>&1").should == "" + end - describe ":experimental" do - before do - ruby_version_is ""..."3.0" do - @src = 'case [0, 1]; in [a, b]; end' - end + describe ":experimental" do + before do + @src = 'warn "This is experimental warning.", category: :experimental' + end - ruby_version_is "3.0" do - @src = 'warn "This is experimental warning.", category: :experimental' - end - end + it "emits and suppresses warnings for :experimental" do + ruby_exe("Warning[:experimental] = true; eval('#{@src}')", args: "2>&1").should =~ /is experimental/ + ruby_exe("Warning[:experimental] = false; eval('#{@src}')", args: "2>&1").should == "" + end + end - it "emits and suppresses warnings for :experimental" do - ruby_exe("Warning[:experimental] = true; eval('#{@src}')", args: "2>&1").should =~ /is experimental/ - ruby_exe("Warning[:experimental] = false; eval('#{@src}')", args: "2>&1").should == "" + ruby_version_is '3.3' do + it "enables or disables performance warnings" do + original = Warning[:performance] + begin + Warning[:performance] = !original + Warning[:performance].should == !original + ensure + Warning[:performance] = original end end + end - it "raises for unknown category" do - -> { Warning[:noop] = false }.should raise_error(ArgumentError, /unknown category: noop/) - end + it "raises for unknown category" do + -> { Warning[:noop] = false }.should raise_error(ArgumentError, /unknown category: noop/) + end + + it "raises for non-Symbol category" do + -> { Warning[42] = false }.should raise_error(TypeError) + -> { Warning[false] = false }.should raise_error(TypeError) + -> { Warning["noop"] = false }.should raise_error(TypeError) end end diff --git a/spec/ruby/core/warning/warn_spec.rb b/spec/ruby/core/warning/warn_spec.rb index 2ded6a109d..8f96fe9287 100644 --- a/spec/ruby/core/warning/warn_spec.rb +++ b/spec/ruby/core/warning/warn_spec.rb @@ -51,41 +51,85 @@ describe "Warning.warn" do end end + it "is called by Kernel.warn with nil category keyword" do + Warning.should_receive(:warn).with("Chunky bacon!\n", category: nil) + verbose = $VERBOSE + $VERBOSE = false + begin + Kernel.warn("Chunky bacon!") + ensure + $VERBOSE = verbose + end + end - ruby_version_is '3.0' do - it "is called by Kernel.warn with nil category keyword" do - Warning.should_receive(:warn).with("Chunky bacon!\n", category: nil) - verbose = $VERBOSE - $VERBOSE = false - begin - Kernel.warn("Chunky bacon!") - ensure - $VERBOSE = verbose - end + it "is called by Kernel.warn with given category keyword converted to a symbol" do + Warning.should_receive(:warn).with("Chunky bacon!\n", category: :deprecated) + verbose = $VERBOSE + $VERBOSE = false + begin + Kernel.warn("Chunky bacon!", category: "deprecated") + ensure + $VERBOSE = verbose end + end - it "is called by Kernel.warn with given category keyword converted to a symbol" do - Warning.should_receive(:warn).with("Chunky bacon!\n", category: :deprecated) - verbose = $VERBOSE - $VERBOSE = false - begin - Kernel.warn("Chunky bacon!", category: 'deprecated') - ensure - $VERBOSE = verbose - end + it "warns when category is :deprecated and Warning[:deprecated] is true" do + warn_deprecated = Warning[:deprecated] + Warning[:deprecated] = true + begin + -> { + Warning.warn("foo", category: :deprecated) + }.should complain("foo") + ensure + Warning[:deprecated] = warn_deprecated end end - ruby_version_is ''...'3.0' do - it "is called by Kernel.warn" do - Warning.should_receive(:warn).with("Chunky bacon!\n") - verbose = $VERBOSE - $VERBOSE = false - begin - Kernel.warn("Chunky bacon!") - ensure - $VERBOSE = verbose - end + it "warns when category is :experimental and Warning[:experimental] is true" do + warn_experimental = Warning[:experimental] + Warning[:experimental] = true + begin + -> { + Warning.warn("foo", category: :experimental) + }.should complain("foo") + ensure + Warning[:experimental] = warn_experimental + end + end + + it "doesn't print message when category is :deprecated but Warning[:deprecated] is false" do + warn_deprecated = Warning[:deprecated] + Warning[:deprecated] = false + begin + -> { + Warning.warn("foo", category: :deprecated) + }.should_not complain + ensure + Warning[:deprecated] = warn_deprecated + end + end + + it "doesn't print message when category is :experimental but Warning[:experimental] is false" do + warn_experimental = Warning[:experimental] + Warning[:experimental] = false + begin + -> { + Warning.warn("foo", category: :experimental) + }.should_not complain + ensure + Warning[:experimental] = warn_experimental end end + + it "prints the message when VERBOSE is false" do + -> { Warning.warn("foo") }.should complain("foo") + end + + it "prints the message when VERBOSE is nil" do + -> { Warning.warn("foo") }.should complain("foo", verbose: nil) + end + + it "prints the message when VERBOSE is true" do + -> { Warning.warn("foo") }.should complain("foo", verbose: true) + end end |